mirror of
https://github.com/Hopiu/fabric.js.git
synced 2026-04-22 23:04:42 +00:00
17321 lines
480 KiB
JavaScript
17321 lines
480 KiB
JavaScript
/* build: `node build.js modules=ALL exclude=gestures` */
|
|
/*! Fabric.js Copyright 2008-2013, Printio (Juriy Zaytsev, Maxim Chernyak) */
|
|
|
|
var fabric = fabric || { version: "1.1.15" };
|
|
|
|
if (typeof exports !== 'undefined') {
|
|
exports.fabric = fabric;
|
|
}
|
|
|
|
if (typeof document !== 'undefined' && typeof window !== 'undefined') {
|
|
fabric.document = document;
|
|
fabric.window = window;
|
|
}
|
|
else {
|
|
// assume we're running under node.js when document/window are not present
|
|
fabric.document = require("jsdom").jsdom("<!DOCTYPE html><html><head></head><body></body></html>");
|
|
fabric.window = fabric.document.createWindow();
|
|
}
|
|
|
|
/**
|
|
* True when in environment that supports touch events
|
|
* @type boolean
|
|
*/
|
|
fabric.isTouchSupported = "ontouchstart" in fabric.document.documentElement;
|
|
|
|
/**
|
|
* True when in environment that's probably Node.js
|
|
* @type boolean
|
|
*/
|
|
fabric.isLikelyNode = typeof Buffer !== 'undefined' && typeof window === 'undefined';
|
|
|
|
/*!
|
|
* Copyright (c) 2009 Simo Kinnunen.
|
|
* Licensed under the MIT license.
|
|
*/
|
|
|
|
var Cufon = (function() {
|
|
|
|
/** @ignore */
|
|
var api = function() {
|
|
return api.replace.apply(null, arguments);
|
|
};
|
|
|
|
/** @ignore */
|
|
var DOM = api.DOM = {
|
|
|
|
ready: (function() {
|
|
|
|
var complete = false, readyStatus = { loaded: 1, complete: 1 };
|
|
|
|
var queue = [], /** @ignore */ perform = function() {
|
|
if (complete) return;
|
|
complete = true;
|
|
for (var fn; fn = queue.shift(); fn());
|
|
};
|
|
|
|
// Gecko, Opera, WebKit r26101+
|
|
|
|
if (fabric.document.addEventListener) {
|
|
fabric.document.addEventListener('DOMContentLoaded', perform, false);
|
|
fabric.window.addEventListener('pageshow', perform, false); // For cached Gecko pages
|
|
}
|
|
|
|
// Old WebKit, Internet Explorer
|
|
|
|
if (!fabric.window.opera && fabric.document.readyState) (function() {
|
|
readyStatus[fabric.document.readyState] ? perform() : setTimeout(arguments.callee, 10);
|
|
})();
|
|
|
|
// Internet Explorer
|
|
|
|
if (fabric.document.readyState && fabric.document.createStyleSheet) (function() {
|
|
try {
|
|
fabric.document.body.doScroll('left');
|
|
perform();
|
|
}
|
|
catch (e) {
|
|
setTimeout(arguments.callee, 1);
|
|
}
|
|
})();
|
|
|
|
addEvent(fabric.window, 'load', perform); // Fallback
|
|
|
|
return function(listener) {
|
|
if (!arguments.length) perform();
|
|
else complete ? listener() : queue.push(listener);
|
|
};
|
|
|
|
})()
|
|
|
|
};
|
|
|
|
/** @ignore */
|
|
var CSS = api.CSS = /** @ignore */ {
|
|
|
|
/** @ignore */
|
|
Size: function(value, base) {
|
|
|
|
this.value = parseFloat(value);
|
|
this.unit = String(value).match(/[a-z%]*$/)[0] || 'px';
|
|
|
|
/** @ignore */
|
|
this.convert = function(value) {
|
|
return value / base * this.value;
|
|
};
|
|
|
|
/** @ignore */
|
|
this.convertFrom = function(value) {
|
|
return value / this.value * base;
|
|
};
|
|
|
|
/** @ignore */
|
|
this.toString = function() {
|
|
return this.value + this.unit;
|
|
};
|
|
|
|
},
|
|
|
|
/** @ignore */
|
|
getStyle: function(el) {
|
|
return new Style(el.style);
|
|
/*
|
|
var view = document.defaultView;
|
|
if (view && view.getComputedStyle) return new Style(view.getComputedStyle(el, null));
|
|
if (el.currentStyle) return new Style(el.currentStyle);
|
|
return new Style(el.style);
|
|
*/
|
|
},
|
|
|
|
quotedList: cached(function(value) {
|
|
// doesn't work properly with empty quoted strings (""), but
|
|
// it's not worth the extra code.
|
|
var list = [], re = /\s*((["'])([\s\S]*?[^\\])\2|[^,]+)\s*/g, match;
|
|
while (match = re.exec(value)) list.push(match[3] || match[1]);
|
|
return list;
|
|
}),
|
|
|
|
ready: (function() {
|
|
|
|
var complete = false;
|
|
|
|
var queue = [], perform = function() {
|
|
complete = true;
|
|
for (var fn; fn = queue.shift(); fn());
|
|
};
|
|
|
|
// Safari 2 does not include <style> elements in document.styleSheets.
|
|
// Safari 2 also does not support Object.prototype.propertyIsEnumerable.
|
|
|
|
var styleElements = Object.prototype.propertyIsEnumerable ? elementsByTagName('style') : { length: 0 };
|
|
var linkElements = elementsByTagName('link');
|
|
|
|
DOM.ready(function() {
|
|
// These checks are actually only needed for WebKit-based browsers, but don't really hurt other browsers.
|
|
var linkStyles = 0, link;
|
|
for (var i = 0, l = linkElements.length; link = linkElements[i], i < l; ++i) {
|
|
// WebKit does not load alternate stylesheets.
|
|
if (!link.disabled && link.rel.toLowerCase() == 'stylesheet') ++linkStyles;
|
|
}
|
|
if (fabric.document.styleSheets.length >= styleElements.length + linkStyles) perform();
|
|
else setTimeout(arguments.callee, 10);
|
|
});
|
|
|
|
return function(listener) {
|
|
if (complete) listener();
|
|
else queue.push(listener);
|
|
};
|
|
|
|
})(),
|
|
|
|
/** @ignore */
|
|
supports: function(property, value) {
|
|
var checker = fabric.document.createElement('span').style;
|
|
if (checker[property] === undefined) return false;
|
|
checker[property] = value;
|
|
return checker[property] === value;
|
|
},
|
|
|
|
/** @ignore */
|
|
textAlign: function(word, style, position, wordCount) {
|
|
if (style.get('textAlign') == 'right') {
|
|
if (position > 0) word = ' ' + word;
|
|
}
|
|
else if (position < wordCount - 1) word += ' ';
|
|
return word;
|
|
},
|
|
|
|
/** @ignore */
|
|
textDecoration: function(el, style) {
|
|
if (!style) style = this.getStyle(el);
|
|
var types = {
|
|
underline: null,
|
|
overline: null,
|
|
'line-through': null
|
|
};
|
|
for (var search = el; search.parentNode && search.parentNode.nodeType == 1; ) {
|
|
var foundAll = true;
|
|
for (var type in types) {
|
|
if (types[type]) continue;
|
|
if (style.get('textDecoration').indexOf(type) != -1) types[type] = style.get('color');
|
|
foundAll = false;
|
|
}
|
|
if (foundAll) break; // this is rather unlikely to happen
|
|
style = this.getStyle(search = search.parentNode);
|
|
}
|
|
return types;
|
|
},
|
|
|
|
textShadow: cached(function(value) {
|
|
if (value == 'none') return null;
|
|
var shadows = [], currentShadow = {}, result, offCount = 0;
|
|
var re = /(#[a-f0-9]+|[a-z]+\(.*?\)|[a-z]+)|(-?[\d.]+[a-z%]*)|,/ig;
|
|
while (result = re.exec(value)) {
|
|
if (result[0] == ',') {
|
|
shadows.push(currentShadow);
|
|
currentShadow = {}, offCount = 0;
|
|
}
|
|
else if (result[1]) {
|
|
currentShadow.color = result[1];
|
|
}
|
|
else {
|
|
currentShadow[[ 'offX', 'offY', 'blur' ][offCount++]] = result[2];
|
|
}
|
|
}
|
|
shadows.push(currentShadow);
|
|
return shadows;
|
|
}),
|
|
|
|
color: cached(function(value) {
|
|
var parsed = {};
|
|
parsed.color = value.replace(/^rgba\((.*?),\s*([\d.]+)\)/, function($0, $1, $2) {
|
|
parsed.opacity = parseFloat($2);
|
|
return 'rgb(' + $1 + ')';
|
|
});
|
|
return parsed;
|
|
}),
|
|
|
|
/** @ignore */
|
|
textTransform: function(text, style) {
|
|
return text[{
|
|
uppercase: 'toUpperCase',
|
|
lowercase: 'toLowerCase'
|
|
}[style.get('textTransform')] || 'toString']();
|
|
}
|
|
|
|
};
|
|
|
|
function Font(data) {
|
|
|
|
var face = this.face = data.face;
|
|
this.glyphs = data.glyphs;
|
|
this.w = data.w;
|
|
this.baseSize = parseInt(face['units-per-em'], 10);
|
|
|
|
this.family = face['font-family'].toLowerCase();
|
|
this.weight = face['font-weight'];
|
|
this.style = face['font-style'] || 'normal';
|
|
|
|
this.viewBox = (function () {
|
|
var parts = face.bbox.split(/\s+/);
|
|
var box = {
|
|
minX: parseInt(parts[0], 10),
|
|
minY: parseInt(parts[1], 10),
|
|
maxX: parseInt(parts[2], 10),
|
|
maxY: parseInt(parts[3], 10)
|
|
};
|
|
box.width = box.maxX - box.minX,
|
|
box.height = box.maxY - box.minY;
|
|
/** @ignore */
|
|
box.toString = function() {
|
|
return [ this.minX, this.minY, this.width, this.height ].join(' ');
|
|
};
|
|
return box;
|
|
})();
|
|
|
|
this.ascent = -parseInt(face.ascent, 10);
|
|
this.descent = -parseInt(face.descent, 10);
|
|
|
|
this.height = -this.ascent + this.descent;
|
|
|
|
}
|
|
|
|
function FontFamily() {
|
|
|
|
var styles = {}, mapping = {
|
|
oblique: 'italic',
|
|
italic: 'oblique'
|
|
};
|
|
|
|
this.add = function(font) {
|
|
(styles[font.style] || (styles[font.style] = {}))[font.weight] = font;
|
|
};
|
|
|
|
/** @ignore */
|
|
this.get = function(style, weight) {
|
|
var weights = styles[style] || styles[mapping[style]]
|
|
|| styles.normal || styles.italic || styles.oblique;
|
|
if (!weights) return null;
|
|
// we don't have to worry about "bolder" and "lighter"
|
|
// because IE's currentStyle returns a numeric value for it,
|
|
// and other browsers use the computed value anyway
|
|
weight = {
|
|
normal: 400,
|
|
bold: 700
|
|
}[weight] || parseInt(weight, 10);
|
|
if (weights[weight]) return weights[weight];
|
|
// http://www.w3.org/TR/CSS21/fonts.html#propdef-font-weight
|
|
// Gecko uses x99/x01 for lighter/bolder
|
|
var up = {
|
|
1: 1,
|
|
99: 0
|
|
}[weight % 100], alts = [], min, max;
|
|
if (up === undefined) up = weight > 400;
|
|
if (weight == 500) weight = 400;
|
|
for (var alt in weights) {
|
|
alt = parseInt(alt, 10);
|
|
if (!min || alt < min) min = alt;
|
|
if (!max || alt > max) max = alt;
|
|
alts.push(alt);
|
|
}
|
|
if (weight < min) weight = min;
|
|
if (weight > max) weight = max;
|
|
alts.sort(function(a, b) {
|
|
return (up
|
|
? (a > weight && b > weight) ? a < b : a > b
|
|
: (a < weight && b < weight) ? a > b : a < b) ? -1 : 1;
|
|
});
|
|
return weights[alts[0]];
|
|
};
|
|
|
|
}
|
|
|
|
function HoverHandler() {
|
|
|
|
function contains(node, anotherNode) {
|
|
if (node.contains) return node.contains(anotherNode);
|
|
return node.compareDocumentPosition(anotherNode) & 16;
|
|
}
|
|
|
|
function onOverOut(e) {
|
|
var related = e.relatedTarget;
|
|
if (!related || contains(this, related)) return;
|
|
trigger(this);
|
|
}
|
|
|
|
function onEnterLeave(e) {
|
|
trigger(this);
|
|
}
|
|
|
|
function trigger(el) {
|
|
// A timeout is needed so that the event can actually "happen"
|
|
// before replace is triggered. This ensures that styles are up
|
|
// to date.
|
|
setTimeout(function() {
|
|
api.replace(el, sharedStorage.get(el).options, true);
|
|
}, 10);
|
|
}
|
|
|
|
this.attach = function(el) {
|
|
if (el.onmouseenter === undefined) {
|
|
addEvent(el, 'mouseover', onOverOut);
|
|
addEvent(el, 'mouseout', onOverOut);
|
|
}
|
|
else {
|
|
addEvent(el, 'mouseenter', onEnterLeave);
|
|
addEvent(el, 'mouseleave', onEnterLeave);
|
|
}
|
|
};
|
|
|
|
}
|
|
|
|
function Storage() {
|
|
|
|
var map = {}, at = 0;
|
|
|
|
function identify(el) {
|
|
return el.cufid || (el.cufid = ++at);
|
|
}
|
|
|
|
/** @ignore */
|
|
this.get = function(el) {
|
|
var id = identify(el);
|
|
return map[id] || (map[id] = {});
|
|
};
|
|
|
|
}
|
|
|
|
function Style(style) {
|
|
|
|
var custom = {}, sizes = {};
|
|
|
|
this.get = function(property) {
|
|
return custom[property] != undefined ? custom[property] : style[property];
|
|
};
|
|
|
|
this.getSize = function(property, base) {
|
|
return sizes[property] || (sizes[property] = new CSS.Size(this.get(property), base));
|
|
};
|
|
|
|
this.extend = function(styles) {
|
|
for (var property in styles) custom[property] = styles[property];
|
|
return this;
|
|
};
|
|
|
|
}
|
|
|
|
function addEvent(el, type, listener) {
|
|
if (el.addEventListener) {
|
|
el.addEventListener(type, listener, false);
|
|
}
|
|
else if (el.attachEvent) {
|
|
el.attachEvent('on' + type, function() {
|
|
return listener.call(el, fabric.window.event);
|
|
});
|
|
}
|
|
}
|
|
|
|
function attach(el, options) {
|
|
var storage = sharedStorage.get(el);
|
|
if (storage.options) return el;
|
|
if (options.hover && options.hoverables[el.nodeName.toLowerCase()]) {
|
|
hoverHandler.attach(el);
|
|
}
|
|
storage.options = options;
|
|
return el;
|
|
}
|
|
|
|
function cached(fun) {
|
|
var cache = {};
|
|
return function(key) {
|
|
if (!cache.hasOwnProperty(key)) cache[key] = fun.apply(null, arguments);
|
|
return cache[key];
|
|
};
|
|
}
|
|
|
|
function getFont(el, style) {
|
|
if (!style) style = CSS.getStyle(el);
|
|
var families = CSS.quotedList(style.get('fontFamily').toLowerCase()), family;
|
|
for (var i = 0, l = families.length; i < l; ++i) {
|
|
family = families[i];
|
|
if (fonts[family]) return fonts[family].get(style.get('fontStyle'), style.get('fontWeight'));
|
|
}
|
|
return null;
|
|
}
|
|
|
|
function elementsByTagName(query) {
|
|
return fabric.document.getElementsByTagName(query);
|
|
}
|
|
|
|
function merge() {
|
|
var merged = {}, key;
|
|
for (var i = 0, l = arguments.length; i < l; ++i) {
|
|
for (key in arguments[i]) merged[key] = arguments[i][key];
|
|
}
|
|
return merged;
|
|
}
|
|
|
|
function process(font, text, style, options, node, el) {
|
|
|
|
var separate = options.separate;
|
|
if (separate == 'none') return engines[options.engine].apply(null, arguments);
|
|
var fragment = fabric.document.createDocumentFragment(), processed;
|
|
var parts = text.split(separators[separate]), needsAligning = (separate == 'words');
|
|
if (needsAligning && HAS_BROKEN_REGEXP) {
|
|
// @todo figure out a better way to do this
|
|
if (/^\s/.test(text)) parts.unshift('');
|
|
if (/\s$/.test(text)) parts.push('');
|
|
}
|
|
for (var i = 0, l = parts.length; i < l; ++i) {
|
|
processed = engines[options.engine](font,
|
|
needsAligning ? CSS.textAlign(parts[i], style, i, l) : parts[i],
|
|
style, options, node, el, i < l - 1);
|
|
if (processed) fragment.appendChild(processed);
|
|
}
|
|
return fragment;
|
|
}
|
|
|
|
/** @ignore */
|
|
function replaceElement(el, options) {
|
|
var font, style, nextNode, redraw;
|
|
for (var node = attach(el, options).firstChild; node; node = nextNode) {
|
|
nextNode = node.nextSibling;
|
|
redraw = false;
|
|
if (node.nodeType == 1) {
|
|
if (!node.firstChild) continue;
|
|
if (!/cufon/.test(node.className)) {
|
|
arguments.callee(node, options);
|
|
continue;
|
|
}
|
|
else redraw = true;
|
|
}
|
|
if (!style) style = CSS.getStyle(el).extend(options);
|
|
if (!font) font = getFont(el, style);
|
|
|
|
if (!font) continue;
|
|
if (redraw) {
|
|
engines[options.engine](font, null, style, options, node, el);
|
|
continue;
|
|
}
|
|
var text = node.data;
|
|
//for some reason, the carriage return is not stripped by IE but "\n" is, so let's keep \r as a new line marker...
|
|
if (typeof G_vmlCanvasManager != 'undefined') {
|
|
text = text.replace(/\r/g, "\n");
|
|
}
|
|
if (text === '') continue;
|
|
var processed = process(font, text, style, options, node, el);
|
|
if (processed) node.parentNode.replaceChild(processed, node);
|
|
else node.parentNode.removeChild(node);
|
|
}
|
|
}
|
|
|
|
var HAS_BROKEN_REGEXP = ' '.split(/\s+/).length == 0;
|
|
|
|
var sharedStorage = new Storage();
|
|
var hoverHandler = new HoverHandler();
|
|
var replaceHistory = [];
|
|
|
|
var engines = {}, fonts = {}, defaultOptions = {
|
|
engine: null,
|
|
//fontScale: 1,
|
|
//fontScaling: false,
|
|
hover: false,
|
|
hoverables: {
|
|
a: true
|
|
},
|
|
printable: true,
|
|
//rotation: 0,
|
|
//selectable: false,
|
|
selector: (
|
|
fabric.window.Sizzle
|
|
|| (fabric.window.jQuery && function(query) { return jQuery(query); }) // avoid noConflict issues
|
|
|| (fabric.window.dojo && dojo.query)
|
|
|| (fabric.window.$$ && function(query) { return $$(query); })
|
|
|| (fabric.window.$ && function(query) { return $(query); })
|
|
|| (fabric.document.querySelectorAll && function(query) { return fabric.document.querySelectorAll(query); })
|
|
|| elementsByTagName
|
|
),
|
|
separate: 'words', // 'none' and 'characters' are also accepted
|
|
textShadow: 'none'
|
|
};
|
|
|
|
var separators = {
|
|
words: /\s+/,
|
|
characters: ''
|
|
};
|
|
|
|
/** @ignore */
|
|
api.now = function() {
|
|
DOM.ready();
|
|
return api;
|
|
};
|
|
|
|
/** @ignore */
|
|
api.refresh = function() {
|
|
var currentHistory = replaceHistory.splice(0, replaceHistory.length);
|
|
for (var i = 0, l = currentHistory.length; i < l; ++i) {
|
|
api.replace.apply(null, currentHistory[i]);
|
|
}
|
|
return api;
|
|
};
|
|
|
|
/** @ignore */
|
|
api.registerEngine = function(id, engine) {
|
|
if (!engine) return api;
|
|
engines[id] = engine;
|
|
return api.set('engine', id);
|
|
};
|
|
|
|
/** @ignore */
|
|
api.registerFont = function(data) {
|
|
var font = new Font(data), family = font.family;
|
|
if (!fonts[family]) fonts[family] = new FontFamily();
|
|
fonts[family].add(font);
|
|
return api.set('fontFamily', '"' + family + '"');
|
|
};
|
|
|
|
/** @ignore */
|
|
api.replace = function(elements, options, ignoreHistory) {
|
|
options = merge(defaultOptions, options);
|
|
if (!options.engine) return api; // there's no browser support so we'll just stop here
|
|
if (typeof options.textShadow == 'string' && options.textShadow)
|
|
options.textShadow = CSS.textShadow(options.textShadow);
|
|
if (!ignoreHistory) replaceHistory.push(arguments);
|
|
if (elements.nodeType || typeof elements == 'string') elements = [ elements ];
|
|
CSS.ready(function() {
|
|
for (var i = 0, l = elements.length; i < l; ++i) {
|
|
var el = elements[i];
|
|
if (typeof el == 'string') api.replace(options.selector(el), options, true);
|
|
else replaceElement(el, options);
|
|
}
|
|
});
|
|
return api;
|
|
};
|
|
|
|
/** @ignore */
|
|
api.replaceElement = function(el, options) {
|
|
options = merge(defaultOptions, options);
|
|
if (typeof options.textShadow == 'string' && options.textShadow)
|
|
options.textShadow = CSS.textShadow(options.textShadow);
|
|
return replaceElement(el, options);
|
|
};
|
|
|
|
api.engines = engines;
|
|
api.fonts = fonts;
|
|
/** @ignore */
|
|
api.getOptions = function() {
|
|
return merge(defaultOptions);
|
|
};
|
|
|
|
/** @ignore */
|
|
api.set = function(option, value) {
|
|
defaultOptions[option] = value;
|
|
return api;
|
|
};
|
|
|
|
return api;
|
|
|
|
})();
|
|
|
|
Cufon.registerEngine('canvas', (function() {
|
|
|
|
// Safari 2 doesn't support .apply() on native methods
|
|
var HAS_INLINE_BLOCK = Cufon.CSS.supports('display', 'inline-block');
|
|
|
|
// Firefox 2 w/ non-strict doctype (almost standards mode)
|
|
var HAS_BROKEN_LINEHEIGHT = !HAS_INLINE_BLOCK && (fabric.document.compatMode == 'BackCompat' || /frameset|transitional/i.test(fabric.document.doctype.publicId));
|
|
|
|
var styleSheet = fabric.document.createElement('style');
|
|
styleSheet.type = 'text/css';
|
|
|
|
var textNode = fabric.document.createTextNode(
|
|
'.cufon-canvas{text-indent:0}' +
|
|
'@media screen,projection{' +
|
|
'.cufon-canvas{display:inline;display:inline-block;position:relative;vertical-align:middle' +
|
|
(HAS_BROKEN_LINEHEIGHT
|
|
? ''
|
|
: ';font-size:1px;line-height:1px') +
|
|
'}.cufon-canvas .cufon-alt{display:-moz-inline-box;display:inline-block;width:0;height:0;overflow:hidden}' +
|
|
(HAS_INLINE_BLOCK
|
|
? '.cufon-canvas canvas{position:relative}'
|
|
: '.cufon-canvas canvas{position:absolute}') +
|
|
'}' +
|
|
'@media print{' +
|
|
'.cufon-canvas{padding:0 !important}' +
|
|
'.cufon-canvas canvas{display:none}' +
|
|
'.cufon-canvas .cufon-alt{display:inline}' +
|
|
'}'
|
|
)
|
|
|
|
try {
|
|
styleSheet.appendChild(textNode);
|
|
} catch(e) {
|
|
//IE8- can't do this...
|
|
styleSheet.setAttribute("type", "text/css");
|
|
styleSheet.styleSheet.cssText = textNode.data;
|
|
}
|
|
fabric.document.getElementsByTagName('head')[0].appendChild(styleSheet);
|
|
|
|
function generateFromVML(path, context) {
|
|
var atX = 0, atY = 0;
|
|
var code = [], re = /([mrvxe])([^a-z]*)/g, match;
|
|
generate: for (var i = 0; match = re.exec(path); ++i) {
|
|
var c = match[2].split(',');
|
|
switch (match[1]) {
|
|
case 'v':
|
|
code[i] = { m: 'bezierCurveTo', a: [ atX + ~~c[0], atY + ~~c[1], atX + ~~c[2], atY + ~~c[3], atX += ~~c[4], atY += ~~c[5] ] };
|
|
break;
|
|
case 'r':
|
|
code[i] = { m: 'lineTo', a: [ atX += ~~c[0], atY += ~~c[1] ] };
|
|
break;
|
|
case 'm':
|
|
code[i] = { m: 'moveTo', a: [ atX = ~~c[0], atY = ~~c[1] ] };
|
|
break;
|
|
case 'x':
|
|
code[i] = { m: 'closePath', a: [] };
|
|
break;
|
|
case 'e':
|
|
break generate;
|
|
}
|
|
context[code[i].m].apply(context, code[i].a);
|
|
}
|
|
return code;
|
|
}
|
|
|
|
function interpret(code, context) {
|
|
for (var i = 0, l = code.length; i < l; ++i) {
|
|
var line = code[i];
|
|
context[line.m].apply(context, line.a);
|
|
}
|
|
}
|
|
|
|
return function(font, text, style, options, node, el) {
|
|
|
|
var redraw = (text === null);
|
|
|
|
var viewBox = font.viewBox;
|
|
|
|
var size = style.getSize('fontSize', font.baseSize);
|
|
|
|
var letterSpacing = style.get('letterSpacing');
|
|
letterSpacing = (letterSpacing == 'normal') ? 0 : size.convertFrom(parseInt(letterSpacing, 10));
|
|
|
|
var expandTop = 0, expandRight = 0, expandBottom = 0, expandLeft = 0;
|
|
var shadows = options.textShadow, shadowOffsets = [];
|
|
|
|
Cufon.textOptions.shadowOffsets = [ ];
|
|
Cufon.textOptions.shadows = null;
|
|
|
|
if (shadows) {
|
|
Cufon.textOptions.shadows = shadows;
|
|
for (var i = 0, l = shadows.length; i < l; ++i) {
|
|
var shadow = shadows[i];
|
|
var x = size.convertFrom(parseFloat(shadow.offX));
|
|
var y = size.convertFrom(parseFloat(shadow.offY));
|
|
shadowOffsets[i] = [ x, y ];
|
|
//if (y < expandTop) expandTop = y;
|
|
//if (x > expandRight) expandRight = x;
|
|
//if (y > expandBottom) expandBottom = y;
|
|
//if (x < expandLeft) expandLeft = x;
|
|
}
|
|
}
|
|
|
|
var chars = Cufon.CSS.textTransform(redraw ? node.alt : text, style).split('');
|
|
|
|
var width = 0, lastWidth = null;
|
|
|
|
var maxWidth = 0, lines = 1, lineWidths = [ ];
|
|
for (var i = 0, l = chars.length; i < l; ++i) {
|
|
if (chars[i] === '\n') {
|
|
lines++;
|
|
if (width > maxWidth) {
|
|
maxWidth = width;
|
|
}
|
|
lineWidths.push(width);
|
|
width = 0;
|
|
continue;
|
|
}
|
|
var glyph = font.glyphs[chars[i]] || font.missingGlyph;
|
|
if (!glyph) continue;
|
|
width += lastWidth = Number(glyph.w || font.w) + letterSpacing;
|
|
}
|
|
lineWidths.push(width);
|
|
|
|
width = Math.max(maxWidth, width);
|
|
|
|
var lineOffsets = [ ];
|
|
for (var i = lineWidths.length; i--; ) {
|
|
lineOffsets[i] = width - lineWidths[i];
|
|
}
|
|
|
|
if (lastWidth === null) return null; // there's nothing to render
|
|
|
|
expandRight += (viewBox.width - lastWidth);
|
|
expandLeft += viewBox.minX;
|
|
|
|
var wrapper, canvas;
|
|
|
|
if (redraw) {
|
|
wrapper = node;
|
|
canvas = node.firstChild;
|
|
}
|
|
else {
|
|
wrapper = fabric.document.createElement('span');
|
|
wrapper.className = 'cufon cufon-canvas';
|
|
wrapper.alt = text;
|
|
|
|
canvas = fabric.document.createElement('canvas');
|
|
wrapper.appendChild(canvas);
|
|
|
|
if (options.printable) {
|
|
var print = fabric.document.createElement('span');
|
|
print.className = 'cufon-alt';
|
|
print.appendChild(fabric.document.createTextNode(text));
|
|
wrapper.appendChild(print);
|
|
}
|
|
}
|
|
|
|
var wStyle = wrapper.style;
|
|
var cStyle = canvas.style || { };
|
|
|
|
var height = size.convert(viewBox.height - expandTop + expandBottom);
|
|
var roundedHeight = Math.ceil(height);
|
|
var roundingFactor = roundedHeight / height;
|
|
|
|
canvas.width = Math.ceil(size.convert(width + expandRight - expandLeft) * roundingFactor);
|
|
canvas.height = roundedHeight;
|
|
|
|
expandTop += viewBox.minY;
|
|
|
|
cStyle.top = Math.round(size.convert(expandTop - font.ascent)) + 'px';
|
|
cStyle.left = Math.round(size.convert(expandLeft)) + 'px';
|
|
|
|
var _width = Math.ceil(size.convert(width * roundingFactor));
|
|
var wrapperWidth = _width + 'px';
|
|
var _height = size.convert(font.height);
|
|
var totalLineHeight = (options.lineHeight - 1) * size.convert(-font.ascent / 5) * (lines - 1);
|
|
|
|
Cufon.textOptions.width = _width;
|
|
Cufon.textOptions.height = (_height * lines) + totalLineHeight;
|
|
Cufon.textOptions.lines = lines;
|
|
Cufon.textOptions.totalLineHeight = totalLineHeight;
|
|
|
|
if (HAS_INLINE_BLOCK) {
|
|
wStyle.width = wrapperWidth;
|
|
wStyle.height = _height + 'px';
|
|
}
|
|
else {
|
|
wStyle.paddingLeft = wrapperWidth;
|
|
wStyle.paddingBottom = (_height - 1) + 'px';
|
|
}
|
|
|
|
var g = Cufon.textOptions.context || canvas.getContext('2d'),
|
|
scale = roundedHeight / viewBox.height;
|
|
|
|
Cufon.textOptions.fontAscent = font.ascent * scale;
|
|
Cufon.textOptions.boundaries = null;
|
|
|
|
for (var offsets = Cufon.textOptions.shadowOffsets, i = shadowOffsets.length; i--; ) {
|
|
offsets[i] = [ shadowOffsets[i][0] * scale, shadowOffsets[i][1] * scale ];
|
|
}
|
|
|
|
g.save();
|
|
g.scale(scale, scale);
|
|
|
|
g.translate(
|
|
// we're at the center of an object and need to jump to the top left corner
|
|
// where first character is to be drawn
|
|
-expandLeft - ((1/scale * canvas.width) / 2) + (Cufon.fonts[font.family].offsetLeft || 0),
|
|
-expandTop - ((Cufon.textOptions.height / scale) / 2) + (Cufon.fonts[font.family].offsetTop || 0)
|
|
);
|
|
|
|
g.lineWidth = font.face['underline-thickness'];
|
|
|
|
g.save();
|
|
|
|
function line(y, color) {
|
|
g.strokeStyle = color;
|
|
|
|
g.beginPath();
|
|
|
|
g.moveTo(0, y);
|
|
g.lineTo(width, y);
|
|
|
|
g.stroke();
|
|
}
|
|
|
|
var textDecoration = Cufon.getTextDecoration(options),
|
|
isItalic = options.fontStyle === 'italic';
|
|
|
|
function renderBackground() {
|
|
g.save();
|
|
|
|
var left = 0, lineNum = 0, boundaries = [{ left: 0 }];
|
|
|
|
if (options.backgroundColor) {
|
|
g.save();
|
|
g.fillStyle = options.backgroundColor;
|
|
g.translate(0, font.ascent);
|
|
g.fillRect(0, 0, width + 10, (-font.ascent + font.descent) * lines);
|
|
g.restore();
|
|
}
|
|
|
|
if (options.textAlign === 'right') {
|
|
g.translate(lineOffsets[lineNum], 0);
|
|
boundaries[0].left = lineOffsets[lineNum] * scale;
|
|
}
|
|
else if (options.textAlign === 'center') {
|
|
g.translate(lineOffsets[lineNum] / 2, 0);
|
|
boundaries[0].left = lineOffsets[lineNum] / 2 * scale;
|
|
}
|
|
|
|
for (var i = 0, l = chars.length; i < l; ++i) {
|
|
if (chars[i] === '\n') {
|
|
|
|
lineNum++;
|
|
|
|
var topOffset = -font.ascent - ((font.ascent / 5) * options.lineHeight);
|
|
var boundary = boundaries[boundaries.length - 1];
|
|
var nextBoundary = { left: 0 };
|
|
|
|
boundary.width = left * scale;
|
|
boundary.height = (-font.ascent + font.descent) * scale;
|
|
|
|
if (options.textAlign === 'right') {
|
|
g.translate(-width, topOffset);
|
|
g.translate(lineOffsets[lineNum], 0);
|
|
nextBoundary.left = lineOffsets[lineNum] * scale;
|
|
}
|
|
else if (options.textAlign === 'center') {
|
|
// offset to the start of text in previous line AND half of its offset
|
|
// (essentially moving caret to the left edge of bounding box)
|
|
g.translate(-left - (lineOffsets[lineNum - 1] / 2), topOffset);
|
|
g.translate(lineOffsets[lineNum] / 2, 0);
|
|
nextBoundary.left = lineOffsets[lineNum] / 2 * scale;
|
|
}
|
|
else {
|
|
g.translate(-left, topOffset);
|
|
}
|
|
|
|
/* push next boundary (for the next line) */
|
|
boundaries.push(nextBoundary);
|
|
|
|
left = 0;
|
|
|
|
continue;
|
|
}
|
|
var glyph = font.glyphs[chars[i]] || font.missingGlyph;
|
|
if (!glyph) continue;
|
|
|
|
var charWidth = Number(glyph.w || font.w) + letterSpacing;
|
|
|
|
// only draw text-background when there's some kind of value
|
|
if (options.textBackgroundColor) {
|
|
g.save();
|
|
g.fillStyle = options.textBackgroundColor;
|
|
g.translate(0, font.ascent);
|
|
g.fillRect(0, 0, charWidth + 10, -font.ascent + font.descent);
|
|
g.restore();
|
|
}
|
|
|
|
g.translate(charWidth, 0);
|
|
left += charWidth;
|
|
|
|
if (i == l-1) {
|
|
boundaries[boundaries.length - 1].width = left * scale;
|
|
boundaries[boundaries.length - 1].height = (-font.ascent + font.descent) * scale;
|
|
}
|
|
}
|
|
g.restore();
|
|
|
|
Cufon.textOptions.boundaries = boundaries;
|
|
}
|
|
|
|
function renderText(color) {
|
|
g.fillStyle = color || Cufon.textOptions.color || style.get('color');
|
|
|
|
var left = 0, lineNum = 0;
|
|
|
|
if (options.textAlign === 'right') {
|
|
g.translate(lineOffsets[lineNum], 0);
|
|
}
|
|
else if (options.textAlign === 'center') {
|
|
g.translate(lineOffsets[lineNum] / 2, 0);
|
|
}
|
|
|
|
for (var i = 0, l = chars.length; i < l; ++i) {
|
|
if (chars[i] === '\n') {
|
|
|
|
lineNum++;
|
|
|
|
var topOffset = -font.ascent - ((font.ascent / 5) * options.lineHeight);
|
|
|
|
if (options.textAlign === 'right') {
|
|
g.translate(-width, topOffset);
|
|
g.translate(lineOffsets[lineNum], 0);
|
|
}
|
|
else if (options.textAlign === 'center') {
|
|
// offset to the start of text in previous line AND half of its offset
|
|
// (essentially moving caret to the left edge of bounding box)
|
|
g.translate(-left - (lineOffsets[lineNum - 1] / 2), topOffset);
|
|
g.translate(lineOffsets[lineNum] / 2, 0);
|
|
}
|
|
else {
|
|
g.translate(-left, topOffset);
|
|
}
|
|
|
|
left = 0;
|
|
|
|
continue;
|
|
}
|
|
var glyph = font.glyphs[chars[i]] || font.missingGlyph;
|
|
if (!glyph) continue;
|
|
|
|
var charWidth = Number(glyph.w || font.w) + letterSpacing;
|
|
|
|
if (textDecoration) {
|
|
g.save();
|
|
g.strokeStyle = g.fillStyle;
|
|
|
|
// add 2x more thickness — closer to SVG rendering
|
|
g.lineWidth += g.lineWidth;
|
|
|
|
g.beginPath();
|
|
if (textDecoration.underline) {
|
|
g.moveTo(0, -font.face['underline-position'] + 0.5);
|
|
g.lineTo(charWidth, -font.face['underline-position'] + 0.5);
|
|
}
|
|
if (textDecoration.overline) {
|
|
g.moveTo(0, font.ascent + 0.5);
|
|
g.lineTo(charWidth, font.ascent + 0.5);
|
|
}
|
|
if (textDecoration['line-through']) {
|
|
g.moveTo(0, -font.descent + 0.5);
|
|
g.lineTo(charWidth, -font.descent + 0.5);
|
|
}
|
|
g.stroke();
|
|
g.restore();
|
|
}
|
|
|
|
if (isItalic) {
|
|
g.save();
|
|
g.transform(1, 0, -0.25, 1, 0, 0);
|
|
}
|
|
|
|
g.beginPath();
|
|
if (glyph.d) {
|
|
if (glyph.code) interpret(glyph.code, g);
|
|
else glyph.code = generateFromVML('m' + glyph.d, g);
|
|
}
|
|
|
|
g.fill();
|
|
|
|
if (options.strokeStyle) {
|
|
g.closePath();
|
|
g.save();
|
|
g.lineWidth = options.strokeWidth;
|
|
g.strokeStyle = options.strokeStyle;
|
|
g.stroke();
|
|
g.restore();
|
|
}
|
|
|
|
if (isItalic) {
|
|
g.restore();
|
|
}
|
|
|
|
g.translate(charWidth, 0);
|
|
left += charWidth;
|
|
}
|
|
}
|
|
|
|
g.save();
|
|
renderBackground();
|
|
if (shadows) {
|
|
for (var i = 0, l = shadows.length; i < l; ++i) {
|
|
var shadow = shadows[i];
|
|
g.save();
|
|
g.translate.apply(g, shadowOffsets[i]);
|
|
renderText(shadow.color);
|
|
g.restore();
|
|
}
|
|
}
|
|
renderText();
|
|
g.restore();
|
|
g.restore();
|
|
g.restore();
|
|
|
|
return wrapper;
|
|
|
|
};
|
|
|
|
})());
|
|
|
|
Cufon.registerEngine('vml', (function() {
|
|
|
|
if (!fabric.document.namespaces) return;
|
|
|
|
var canvasEl = fabric.document.createElement('canvas');
|
|
if (canvasEl && canvasEl.getContext && canvasEl.getContext.apply) return;
|
|
|
|
if (fabric.document.namespaces.cvml == null) {
|
|
fabric.document.namespaces.add('cvml', 'urn:schemas-microsoft-com:vml');
|
|
}
|
|
|
|
var check = fabric.document.createElement('cvml:shape');
|
|
check.style.behavior = 'url(#default#VML)';
|
|
if (!check.coordsize) return; // VML isn't supported
|
|
check = null;
|
|
|
|
fabric.document.write('<style type="text/css">' +
|
|
'.cufon-vml-canvas{text-indent:0}' +
|
|
'@media screen{' +
|
|
'cvml\\:shape,cvml\\:shadow{behavior:url(#default#VML);display:block;antialias:true;position:absolute}' +
|
|
'.cufon-vml-canvas{position:absolute;text-align:left}' +
|
|
'.cufon-vml{display:inline-block;position:relative;vertical-align:middle}' +
|
|
'.cufon-vml .cufon-alt{position:absolute;left:-10000in;font-size:1px}' +
|
|
'a .cufon-vml{cursor:pointer}' +
|
|
'}' +
|
|
'@media print{' +
|
|
'.cufon-vml *{display:none}' +
|
|
'.cufon-vml .cufon-alt{display:inline}' +
|
|
'}' +
|
|
'</style>');
|
|
|
|
function getFontSizeInPixels(el, value) {
|
|
return getSizeInPixels(el, /(?:em|ex|%)$/i.test(value) ? '1em' : value);
|
|
}
|
|
|
|
// Original by Dead Edwards.
|
|
// Combined with getFontSizeInPixels it also works with relative units.
|
|
function getSizeInPixels(el, value) {
|
|
if (/px$/i.test(value)) return parseFloat(value);
|
|
var style = el.style.left, runtimeStyle = el.runtimeStyle.left;
|
|
el.runtimeStyle.left = el.currentStyle.left;
|
|
el.style.left = value;
|
|
var result = el.style.pixelLeft;
|
|
el.style.left = style;
|
|
el.runtimeStyle.left = runtimeStyle;
|
|
return result;
|
|
}
|
|
|
|
return function(font, text, style, options, node, el, hasNext) {
|
|
var redraw = (text === null);
|
|
|
|
if (redraw) text = node.alt;
|
|
|
|
// @todo word-spacing, text-decoration
|
|
|
|
var viewBox = font.viewBox;
|
|
|
|
var size = style.computedFontSize ||
|
|
(style.computedFontSize = new Cufon.CSS.Size(getFontSizeInPixels(el, style.get('fontSize')) + 'px', font.baseSize));
|
|
|
|
var letterSpacing = style.computedLSpacing;
|
|
|
|
if (letterSpacing == undefined) {
|
|
letterSpacing = style.get('letterSpacing');
|
|
style.computedLSpacing = letterSpacing =
|
|
(letterSpacing == 'normal') ? 0 : ~~size.convertFrom(getSizeInPixels(el, letterSpacing));
|
|
}
|
|
|
|
var wrapper, canvas;
|
|
|
|
if (redraw) {
|
|
wrapper = node;
|
|
canvas = node.firstChild;
|
|
}
|
|
else {
|
|
wrapper = fabric.document.createElement('span');
|
|
wrapper.className = 'cufon cufon-vml';
|
|
wrapper.alt = text;
|
|
|
|
canvas = fabric.document.createElement('span');
|
|
canvas.className = 'cufon-vml-canvas';
|
|
wrapper.appendChild(canvas);
|
|
|
|
if (options.printable) {
|
|
var print = fabric.document.createElement('span');
|
|
print.className = 'cufon-alt';
|
|
print.appendChild(fabric.document.createTextNode(text));
|
|
wrapper.appendChild(print);
|
|
}
|
|
|
|
// ie6, for some reason, has trouble rendering the last VML element in the document.
|
|
// we can work around this by injecting a dummy element where needed.
|
|
// @todo find a better solution
|
|
if (!hasNext) wrapper.appendChild(fabric.document.createElement('cvml:shape'));
|
|
}
|
|
|
|
var wStyle = wrapper.style;
|
|
var cStyle = canvas.style;
|
|
|
|
var height = size.convert(viewBox.height), roundedHeight = Math.ceil(height);
|
|
var roundingFactor = roundedHeight / height;
|
|
var minX = viewBox.minX, minY = viewBox.minY;
|
|
|
|
cStyle.height = roundedHeight;
|
|
cStyle.top = Math.round(size.convert(minY - font.ascent));
|
|
cStyle.left = Math.round(size.convert(minX));
|
|
|
|
wStyle.height = size.convert(font.height) + 'px';
|
|
|
|
var textDecoration = Cufon.getTextDecoration(options);
|
|
|
|
var color = style.get('color');
|
|
|
|
var chars = Cufon.CSS.textTransform(text, style).split('');
|
|
|
|
var width = 0, offsetX = 0, advance = null;
|
|
|
|
var glyph, shape, shadows = options.textShadow;
|
|
|
|
// pre-calculate width
|
|
for (var i = 0, k = 0, l = chars.length; i < l; ++i) {
|
|
glyph = font.glyphs[chars[i]] || font.missingGlyph;
|
|
if (glyph) width += advance = ~~(glyph.w || font.w) + letterSpacing;
|
|
}
|
|
|
|
if (advance === null) return null;
|
|
|
|
var fullWidth = -minX + width + (viewBox.width - advance);
|
|
|
|
var shapeWidth = size.convert(fullWidth * roundingFactor), roundedShapeWidth = Math.round(shapeWidth);
|
|
|
|
var coordSize = fullWidth + ',' + viewBox.height, coordOrigin;
|
|
var stretch = 'r' + coordSize + 'nsnf';
|
|
|
|
for (i = 0; i < l; ++i) {
|
|
|
|
glyph = font.glyphs[chars[i]] || font.missingGlyph;
|
|
if (!glyph) continue;
|
|
|
|
if (redraw) {
|
|
// some glyphs may be missing so we can't use i
|
|
shape = canvas.childNodes[k];
|
|
if (shape.firstChild) shape.removeChild(shape.firstChild); // shadow
|
|
}
|
|
else {
|
|
shape = fabric.document.createElement('cvml:shape');
|
|
canvas.appendChild(shape);
|
|
}
|
|
|
|
shape.stroked = 'f';
|
|
shape.coordsize = coordSize;
|
|
shape.coordorigin = coordOrigin = (minX - offsetX) + ',' + minY;
|
|
shape.path = (glyph.d ? 'm' + glyph.d + 'xe' : '') + 'm' + coordOrigin + stretch;
|
|
shape.fillcolor = color;
|
|
|
|
// it's important to not set top/left or IE8 will grind to a halt
|
|
var sStyle = shape.style;
|
|
sStyle.width = roundedShapeWidth;
|
|
sStyle.height = roundedHeight;
|
|
|
|
if (shadows) {
|
|
// due to the limitations of the VML shadow element there
|
|
// can only be two visible shadows. opacity is shared
|
|
// for all shadows.
|
|
var shadow1 = shadows[0], shadow2 = shadows[1];
|
|
var color1 = Cufon.CSS.color(shadow1.color), color2;
|
|
var shadow = fabric.document.createElement('cvml:shadow');
|
|
shadow.on = 't';
|
|
shadow.color = color1.color;
|
|
shadow.offset = shadow1.offX + ',' + shadow1.offY;
|
|
if (shadow2) {
|
|
color2 = Cufon.CSS.color(shadow2.color);
|
|
shadow.type = 'double';
|
|
shadow.color2 = color2.color;
|
|
shadow.offset2 = shadow2.offX + ',' + shadow2.offY;
|
|
}
|
|
shadow.opacity = color1.opacity || (color2 && color2.opacity) || 1;
|
|
shape.appendChild(shadow);
|
|
}
|
|
|
|
offsetX += ~~(glyph.w || font.w) + letterSpacing;
|
|
|
|
++k;
|
|
|
|
}
|
|
|
|
wStyle.width = Math.max(Math.ceil(size.convert(width * roundingFactor)), 0);
|
|
|
|
return wrapper;
|
|
|
|
};
|
|
|
|
})());
|
|
|
|
Cufon.getTextDecoration = function(options) {
|
|
return {
|
|
underline: options.textDecoration === 'underline',
|
|
overline: options.textDecoration === 'overline',
|
|
'line-through': options.textDecoration === 'line-through'
|
|
};
|
|
};
|
|
|
|
if (typeof exports != 'undefined') {
|
|
exports.Cufon = Cufon;
|
|
}
|
|
|
|
/*
|
|
json2.js
|
|
2011-10-19
|
|
|
|
Public Domain.
|
|
|
|
NO WARRANTY EXPRESSED OR IMPLIED. USE AT YOUR OWN RISK.
|
|
|
|
See http://www.JSON.org/js.html
|
|
|
|
|
|
This code should be minified before deployment.
|
|
See http://javascript.crockford.com/jsmin.html
|
|
|
|
USE YOUR OWN COPY. IT IS EXTREMELY UNWISE TO LOAD CODE FROM SERVERS YOU DO
|
|
NOT CONTROL.
|
|
|
|
|
|
This file creates a global JSON object containing two methods: stringify
|
|
and parse.
|
|
|
|
JSON.stringify(value, replacer, space)
|
|
value any JavaScript value, usually an object or array.
|
|
|
|
replacer an optional parameter that determines how object
|
|
values are stringified for objects. It can be a
|
|
function or an array of strings.
|
|
|
|
space an optional parameter that specifies the indentation
|
|
of nested structures. If it is omitted, the text will
|
|
be packed without extra whitespace. If it is a number,
|
|
it will specify the number of spaces to indent at each
|
|
level. If it is a string (such as '\t' or ' '),
|
|
it contains the characters used to indent at each level.
|
|
|
|
This method produces a JSON text from a JavaScript value.
|
|
|
|
When an object value is found, if the object contains a toJSON
|
|
method, its toJSON method will be called and the result will be
|
|
stringified. A toJSON method does not serialize: it returns the
|
|
value represented by the name/value pair that should be serialized,
|
|
or undefined if nothing should be serialized. The toJSON method
|
|
will be passed the key associated with the value, and this will be
|
|
bound to the value
|
|
|
|
For example, this would serialize Dates as ISO strings.
|
|
|
|
Date.prototype.toJSON = function (key) {
|
|
function f(n) {
|
|
// Format integers to have at least two digits.
|
|
return n < 10 ? '0' + n : n;
|
|
}
|
|
|
|
return this.getUTCFullYear() + '-' +
|
|
f(this.getUTCMonth() + 1) + '-' +
|
|
f(this.getUTCDate()) + 'T' +
|
|
f(this.getUTCHours()) + ':' +
|
|
f(this.getUTCMinutes()) + ':' +
|
|
f(this.getUTCSeconds()) + 'Z';
|
|
};
|
|
|
|
You can provide an optional replacer method. It will be passed the
|
|
key and value of each member, with this bound to the containing
|
|
object. The value that is returned from your method will be
|
|
serialized. If your method returns undefined, then the member will
|
|
be excluded from the serialization.
|
|
|
|
If the replacer parameter is an array of strings, then it will be
|
|
used to select the members to be serialized. It filters the results
|
|
such that only members with keys listed in the replacer array are
|
|
stringified.
|
|
|
|
Values that do not have JSON representations, such as undefined or
|
|
functions, will not be serialized. Such values in objects will be
|
|
dropped; in arrays they will be replaced with null. You can use
|
|
a replacer function to replace those with JSON values.
|
|
JSON.stringify(undefined) returns undefined.
|
|
|
|
The optional space parameter produces a stringification of the
|
|
value that is filled with line breaks and indentation to make it
|
|
easier to read.
|
|
|
|
If the space parameter is a non-empty string, then that string will
|
|
be used for indentation. If the space parameter is a number, then
|
|
the indentation will be that many spaces.
|
|
|
|
Example:
|
|
|
|
text = JSON.stringify(['e', {pluribus: 'unum'}]);
|
|
// text is '["e",{"pluribus":"unum"}]'
|
|
|
|
|
|
text = JSON.stringify(['e', {pluribus: 'unum'}], null, '\t');
|
|
// text is '[\n\t"e",\n\t{\n\t\t"pluribus": "unum"\n\t}\n]'
|
|
|
|
text = JSON.stringify([new Date()], function (key, value) {
|
|
return this[key] instanceof Date ?
|
|
'Date(' + this[key] + ')' : value;
|
|
});
|
|
// text is '["Date(---current time---)"]'
|
|
|
|
|
|
JSON.parse(text, reviver)
|
|
This method parses a JSON text to produce an object or array.
|
|
It can throw a SyntaxError exception.
|
|
|
|
The optional reviver parameter is a function that can filter and
|
|
transform the results. It receives each of the keys and values,
|
|
and its return value is used instead of the original value.
|
|
If it returns what it received, then the structure is not modified.
|
|
If it returns undefined then the member is deleted.
|
|
|
|
Example:
|
|
|
|
// Parse the text. Values that look like ISO date strings will
|
|
// be converted to Date objects.
|
|
|
|
myData = JSON.parse(text, function (key, value) {
|
|
var a;
|
|
if (typeof value === 'string') {
|
|
a =
|
|
/^(\d{4})-(\d{2})-(\d{2})T(\d{2}):(\d{2}):(\d{2}(?:\.\d*)?)Z$/.exec(value);
|
|
if (a) {
|
|
return new Date(Date.UTC(+a[1], +a[2] - 1, +a[3], +a[4],
|
|
+a[5], +a[6]));
|
|
}
|
|
}
|
|
return value;
|
|
});
|
|
|
|
myData = JSON.parse('["Date(09/09/2001)"]', function (key, value) {
|
|
var d;
|
|
if (typeof value === 'string' &&
|
|
value.slice(0, 5) === 'Date(' &&
|
|
value.slice(-1) === ')') {
|
|
d = new Date(value.slice(5, -1));
|
|
if (d) {
|
|
return d;
|
|
}
|
|
}
|
|
return value;
|
|
});
|
|
|
|
|
|
This is a reference implementation. You are free to copy, modify, or
|
|
redistribute.
|
|
*/
|
|
|
|
/*jslint evil: true, regexp: true */
|
|
|
|
/*members "", "\b", "\t", "\n", "\f", "\r", "\"", JSON, "\\", apply,
|
|
call, charCodeAt, getUTCDate, getUTCFullYear, getUTCHours,
|
|
getUTCMinutes, getUTCMonth, getUTCSeconds, hasOwnProperty, join,
|
|
lastIndex, length, parse, prototype, push, replace, slice, stringify,
|
|
test, toJSON, toString, valueOf
|
|
*/
|
|
|
|
|
|
// Create a JSON object only if one does not already exist. We create the
|
|
// methods in a closure to avoid creating global variables.
|
|
|
|
var JSON;
|
|
if (!JSON) {
|
|
JSON = {};
|
|
}
|
|
|
|
(function () {
|
|
'use strict';
|
|
|
|
function f(n) {
|
|
// Format integers to have at least two digits.
|
|
return n < 10 ? '0' + n : n;
|
|
}
|
|
|
|
if (typeof Date.prototype.toJSON !== 'function') {
|
|
|
|
/** @ignore */
|
|
Date.prototype.toJSON = function (key) {
|
|
|
|
return isFinite(this.valueOf())
|
|
? this.getUTCFullYear() + '-' +
|
|
f(this.getUTCMonth() + 1) + '-' +
|
|
f(this.getUTCDate()) + 'T' +
|
|
f(this.getUTCHours()) + ':' +
|
|
f(this.getUTCMinutes()) + ':' +
|
|
f(this.getUTCSeconds()) + 'Z'
|
|
: null;
|
|
};
|
|
|
|
String.prototype.toJSON =
|
|
Number.prototype.toJSON =
|
|
/** @ignore */
|
|
Boolean.prototype.toJSON = function (key) {
|
|
return this.valueOf();
|
|
};
|
|
}
|
|
|
|
var cx = /[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,
|
|
escapable = /[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,
|
|
gap,
|
|
indent,
|
|
meta = { // table of character substitutions
|
|
'\b': '\\b',
|
|
'\t': '\\t',
|
|
'\n': '\\n',
|
|
'\f': '\\f',
|
|
'\r': '\\r',
|
|
'"' : '\\"',
|
|
'\\': '\\\\'
|
|
},
|
|
rep;
|
|
|
|
|
|
function quote(string) {
|
|
|
|
// If the string contains no control characters, no quote characters, and no
|
|
// backslash characters, then we can safely slap some quotes around it.
|
|
// Otherwise we must also replace the offending characters with safe escape
|
|
// sequences.
|
|
|
|
escapable.lastIndex = 0;
|
|
return escapable.test(string) ? '"' + string.replace(escapable, function (a) {
|
|
var c = meta[a];
|
|
return typeof c === 'string'
|
|
? c
|
|
: '\\u' + ('0000' + a.charCodeAt(0).toString(16)).slice(-4);
|
|
}) + '"' : '"' + string + '"';
|
|
}
|
|
|
|
|
|
function str(key, holder) {
|
|
|
|
// Produce a string from holder[key].
|
|
|
|
var i, // The loop counter.
|
|
k, // The member key.
|
|
v, // The member value.
|
|
length,
|
|
mind = gap,
|
|
partial,
|
|
value = holder[key];
|
|
|
|
// If the value has a toJSON method, call it to obtain a replacement value.
|
|
|
|
if (value && typeof value === 'object' &&
|
|
typeof value.toJSON === 'function') {
|
|
value = value.toJSON(key);
|
|
}
|
|
|
|
// If we were called with a replacer function, then call the replacer to
|
|
// obtain a replacement value.
|
|
|
|
if (typeof rep === 'function') {
|
|
value = rep.call(holder, key, value);
|
|
}
|
|
|
|
// What happens next depends on the value's type.
|
|
|
|
switch (typeof value) {
|
|
case 'string':
|
|
return quote(value);
|
|
|
|
case 'number':
|
|
|
|
// JSON numbers must be finite. Encode non-finite numbers as null.
|
|
|
|
return isFinite(value) ? String(value) : 'null';
|
|
|
|
case 'boolean':
|
|
case 'null':
|
|
|
|
// If the value is a boolean or null, convert it to a string. Note:
|
|
// typeof null does not produce 'null'. The case is included here in
|
|
// the remote chance that this gets fixed someday.
|
|
|
|
return String(value);
|
|
|
|
// If the type is 'object', we might be dealing with an object or an array or
|
|
// null.
|
|
|
|
case 'object':
|
|
|
|
// Due to a specification blunder in ECMAScript, typeof null is 'object',
|
|
// so watch out for that case.
|
|
|
|
if (!value) {
|
|
return 'null';
|
|
}
|
|
|
|
// Make an array to hold the partial results of stringifying this object value.
|
|
|
|
gap += indent;
|
|
partial = [];
|
|
|
|
// Is the value an array?
|
|
|
|
if (Object.prototype.toString.apply(value) === '[object Array]') {
|
|
|
|
// The value is an array. Stringify every element. Use null as a placeholder
|
|
// for non-JSON values.
|
|
|
|
length = value.length;
|
|
for (i = 0; i < length; i += 1) {
|
|
partial[i] = str(i, value) || 'null';
|
|
}
|
|
|
|
// Join all of the elements together, separated with commas, and wrap them in
|
|
// brackets.
|
|
|
|
v = partial.length === 0
|
|
? '[]'
|
|
: gap
|
|
? '[\n' + gap + partial.join(',\n' + gap) + '\n' + mind + ']'
|
|
: '[' + partial.join(',') + ']';
|
|
gap = mind;
|
|
return v;
|
|
}
|
|
|
|
// If the replacer is an array, use it to select the members to be stringified.
|
|
|
|
if (rep && typeof rep === 'object') {
|
|
length = rep.length;
|
|
for (i = 0; i < length; i += 1) {
|
|
if (typeof rep[i] === 'string') {
|
|
k = rep[i];
|
|
v = str(k, value);
|
|
if (v) {
|
|
partial.push(quote(k) + (gap ? ': ' : ':') + v);
|
|
}
|
|
}
|
|
}
|
|
} else {
|
|
|
|
// Otherwise, iterate through all of the keys in the object.
|
|
|
|
for (k in value) {
|
|
if (Object.prototype.hasOwnProperty.call(value, k)) {
|
|
v = str(k, value);
|
|
if (v) {
|
|
partial.push(quote(k) + (gap ? ': ' : ':') + v);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
// Join all of the member texts together, separated with commas,
|
|
// and wrap them in braces.
|
|
|
|
v = partial.length === 0
|
|
? '{}'
|
|
: gap
|
|
? '{\n' + gap + partial.join(',\n' + gap) + '\n' + mind + '}'
|
|
: '{' + partial.join(',') + '}';
|
|
gap = mind;
|
|
return v;
|
|
}
|
|
}
|
|
|
|
// If the JSON object does not yet have a stringify method, give it one.
|
|
|
|
if (typeof JSON.stringify !== 'function') {
|
|
/** @ignore */
|
|
JSON.stringify = function (value, replacer, space) {
|
|
|
|
// The stringify method takes a value and an optional replacer, and an optional
|
|
// space parameter, and returns a JSON text. The replacer can be a function
|
|
// that can replace values, or an array of strings that will select the keys.
|
|
// A default replacer method can be provided. Use of the space parameter can
|
|
// produce text that is more easily readable.
|
|
|
|
var i;
|
|
gap = '';
|
|
indent = '';
|
|
|
|
// If the space parameter is a number, make an indent string containing that
|
|
// many spaces.
|
|
|
|
if (typeof space === 'number') {
|
|
for (i = 0; i < space; i += 1) {
|
|
indent += ' ';
|
|
}
|
|
|
|
// If the space parameter is a string, it will be used as the indent string.
|
|
|
|
} else if (typeof space === 'string') {
|
|
indent = space;
|
|
}
|
|
|
|
// If there is a replacer, it must be a function or an array.
|
|
// Otherwise, throw an error.
|
|
|
|
rep = replacer;
|
|
if (replacer && typeof replacer !== 'function' &&
|
|
(typeof replacer !== 'object' ||
|
|
typeof replacer.length !== 'number')) {
|
|
throw new Error('JSON.stringify');
|
|
}
|
|
|
|
// Make a fake root object containing our value under the key of ''.
|
|
// Return the result of stringifying the value.
|
|
|
|
return str('', {'': value});
|
|
};
|
|
}
|
|
|
|
|
|
// If the JSON object does not yet have a parse method, give it one.
|
|
|
|
if (typeof JSON.parse !== 'function') {
|
|
/** @ignore */
|
|
JSON.parse = function (text, reviver) {
|
|
|
|
// The parse method takes a text and an optional reviver function, and returns
|
|
// a JavaScript value if the text is a valid JSON text.
|
|
|
|
var j;
|
|
|
|
function walk(holder, key) {
|
|
|
|
// The walk method is used to recursively walk the resulting structure so
|
|
// that modifications can be made.
|
|
|
|
var k, v, value = holder[key];
|
|
if (value && typeof value === 'object') {
|
|
for (k in value) {
|
|
if (Object.prototype.hasOwnProperty.call(value, k)) {
|
|
v = walk(value, k);
|
|
if (v !== undefined) {
|
|
value[k] = v;
|
|
} else {
|
|
delete value[k];
|
|
}
|
|
}
|
|
}
|
|
}
|
|
return reviver.call(holder, key, value);
|
|
}
|
|
|
|
|
|
// Parsing happens in four stages. In the first stage, we replace certain
|
|
// Unicode characters with escape sequences. JavaScript handles many characters
|
|
// incorrectly, either silently deleting them, or treating them as line endings.
|
|
|
|
text = String(text);
|
|
cx.lastIndex = 0;
|
|
if (cx.test(text)) {
|
|
text = text.replace(cx, function (a) {
|
|
return '\\u' +
|
|
('0000' + a.charCodeAt(0).toString(16)).slice(-4);
|
|
});
|
|
}
|
|
|
|
// In the second stage, we run the text against regular expressions that look
|
|
// for non-JSON patterns. We are especially concerned with '()' and 'new'
|
|
// because they can cause invocation, and '=' because it can cause mutation.
|
|
// But just to be safe, we want to reject all unexpected forms.
|
|
|
|
// We split the second stage into 4 regexp operations in order to work around
|
|
// crippling inefficiencies in IE's and Safari's regexp engines. First we
|
|
// replace the JSON backslash pairs with '@' (a non-JSON character). Second, we
|
|
// replace all simple value tokens with ']' characters. Third, we delete all
|
|
// open brackets that follow a colon or comma or that begin the text. Finally,
|
|
// we look to see that the remaining characters are only whitespace or ']' or
|
|
// ',' or ':' or '{' or '}'. If that is so, then the text is safe for eval.
|
|
|
|
if (/^[\],:{}\s]*$/
|
|
.test(text.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, '@')
|
|
.replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, ']')
|
|
.replace(/(?:^|:|,)(?:\s*\[)+/g, ''))) {
|
|
|
|
// In the third stage we use the eval function to compile the text into a
|
|
// JavaScript structure. The '{' operator is subject to a syntactic ambiguity
|
|
// in JavaScript: it can begin a block or an object literal. We wrap the text
|
|
// in parens to eliminate the ambiguity.
|
|
|
|
j = eval('(' + text + ')');
|
|
|
|
// In the optional fourth stage, we recursively walk the new structure, passing
|
|
// each name/value pair to a reviver function for possible transformation.
|
|
|
|
return typeof reviver === 'function'
|
|
? walk({'': j}, '')
|
|
: j;
|
|
}
|
|
|
|
// If the text is not JSON parseable, then a SyntaxError is thrown.
|
|
|
|
throw new SyntaxError('JSON.parse');
|
|
};
|
|
}
|
|
}());
|
|
/**
|
|
* Wrapper around `console.log` (when available)
|
|
* @param {Any} values Values to log
|
|
*/
|
|
fabric.log = function() { };
|
|
|
|
/**
|
|
* Wrapper around `console.warn` (when available)
|
|
* @param {Any} Values to log as a warning
|
|
*/
|
|
fabric.warn = function() { };
|
|
|
|
if (typeof console !== 'undefined') {
|
|
if (typeof console.log !== 'undefined' && console.log.apply) {
|
|
fabric.log = function() {
|
|
return console.log.apply(console, arguments);
|
|
};
|
|
}
|
|
if (typeof console.warn !== 'undefined' && console.warn.apply) {
|
|
fabric.warn = function() {
|
|
return console.warn.apply(console, arguments);
|
|
};
|
|
}
|
|
}
|
|
|
|
(function(){
|
|
|
|
/**
|
|
* Observes specified event
|
|
* @deprecated `observe` deprecated since 0.8.34 (use `on` instead)
|
|
* @memberOf fabric.Observable
|
|
* @alias on
|
|
* @param {String} eventName
|
|
* @param {Function} handler
|
|
*/
|
|
function observe(eventName, handler) {
|
|
if (!this.__eventListeners) {
|
|
this.__eventListeners = { };
|
|
}
|
|
// one object with key/value pairs was passed
|
|
if (arguments.length === 1) {
|
|
for (var prop in eventName) {
|
|
this.on(prop, eventName[prop]);
|
|
}
|
|
}
|
|
else {
|
|
if (!this.__eventListeners[eventName]) {
|
|
this.__eventListeners[eventName] = [ ];
|
|
}
|
|
this.__eventListeners[eventName].push(handler);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Stops event observing for a particular event handler
|
|
* @deprecated `stopObserving` deprecated since 0.8.34 (use `off` instead)
|
|
* @memberOf fabric.Observable
|
|
* @alias off
|
|
* @param {String} eventName
|
|
* @param {Function} handler
|
|
*/
|
|
function stopObserving(eventName, handler) {
|
|
if (!this.__eventListeners) {
|
|
this.__eventListeners = { };
|
|
}
|
|
if (this.__eventListeners[eventName]) {
|
|
if (handler) {
|
|
fabric.util.removeFromArray(this.__eventListeners[eventName], handler);
|
|
}
|
|
else {
|
|
this.__eventListeners[eventName].length = 0;
|
|
}
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Fires event with an optional options object
|
|
* @deprecated `fire` deprecated since 1.0.7 (use `trigger` instead)
|
|
* @memberOf fabric.Observable
|
|
* @alias trigger
|
|
* @param {String} eventName
|
|
* @param {Object} [options]
|
|
*/
|
|
function fire(eventName, options) {
|
|
if (!this.__eventListeners) {
|
|
this.__eventListeners = { };
|
|
}
|
|
var listenersForEvent = this.__eventListeners[eventName];
|
|
if (!listenersForEvent) return;
|
|
for (var i = 0, len = listenersForEvent.length; i < len; i++) {
|
|
// avoiding try/catch for perf. reasons
|
|
listenersForEvent[i](options || { });
|
|
}
|
|
}
|
|
|
|
/**
|
|
* @namespace fabric.Observable
|
|
*/
|
|
fabric.Observable = {
|
|
observe: observe,
|
|
stopObserving: stopObserving,
|
|
fire: fire,
|
|
|
|
on: observe,
|
|
off: stopObserving,
|
|
trigger: fire
|
|
};
|
|
})();
|
|
|
|
/**
|
|
* @namespace fabric.Collection
|
|
*/
|
|
fabric.Collection = {
|
|
|
|
/**
|
|
* Adds objects to collection, then renders canvas (if `renderOnAddition` is not `false`)
|
|
* Objects should be instances of (or inherit from) fabric.Object
|
|
* @param [...] Zero or more fabric instances
|
|
* @return {Self} thisArg
|
|
*/
|
|
add: function () {
|
|
this._objects.push.apply(this._objects, arguments);
|
|
for (var i = arguments.length; i--; ) {
|
|
this._onObjectAdded(arguments[i]);
|
|
}
|
|
this.renderOnAddition && this.renderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Inserts an object into collection at specified index and renders canvas
|
|
* An object should be an instance of (or inherit from) fabric.Object
|
|
* @param object {Object} Object to insert
|
|
* @param index {Number} index to insert object at
|
|
* @param nonSplicing {Boolean} when `true`, no splicing (shifting) of objects occurs
|
|
* @return {Self} thisArg
|
|
*/
|
|
insertAt: function (object, index, nonSplicing) {
|
|
var objects = this.getObjects();
|
|
if (nonSplicing) {
|
|
objects[index] = object;
|
|
}
|
|
else {
|
|
objects.splice(index, 0, object);
|
|
}
|
|
this._onObjectAdded(object);
|
|
this.renderOnAddition && this.renderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Removes an object from a group
|
|
* @param {Object} object
|
|
* @return {Self} thisArg
|
|
*/
|
|
remove: function(object) {
|
|
|
|
var objects = this.getObjects();
|
|
var index = objects.indexOf(object);
|
|
|
|
// only call onObjectRemoved if an object was actually removed
|
|
if (index !== -1) {
|
|
objects.splice(index, 1);
|
|
this._onObjectRemoved(object);
|
|
}
|
|
|
|
this.renderAll && this.renderAll();
|
|
return object;
|
|
},
|
|
|
|
/**
|
|
* Executes given function for each object in this group
|
|
* @param {Function} callback
|
|
* Callback invoked with current object as first argument,
|
|
* index - as second and an array of all objects - as third.
|
|
* Iteration happens in reverse order (for performance reasons).
|
|
* Callback is invoked in a context of Global Object (e.g. `window`)
|
|
* when no `context` argument is given
|
|
*
|
|
* @param {Object} context Context (aka thisObject)
|
|
* @return {Self} thisArg
|
|
*/
|
|
forEachObject: function(callback, context) {
|
|
var objects = this.getObjects(),
|
|
i = objects.length;
|
|
while (i--) {
|
|
callback.call(context, objects[i], i, objects);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns object at specified index
|
|
* @param {Number} index
|
|
* @return {Self} thisArg
|
|
*/
|
|
item: function (index) {
|
|
return this.getObjects()[index];
|
|
},
|
|
|
|
/**
|
|
* Returns true if collection contains no objects
|
|
* @return {Boolean} true if collection is empty
|
|
*/
|
|
isEmpty: function () {
|
|
return this.getObjects().length === 0;
|
|
},
|
|
|
|
/**
|
|
* Returns a size of a collection (i.e: length of an array containing its objects)
|
|
* @return {Number} Collection size
|
|
*/
|
|
size: function() {
|
|
return this.getObjects().length;
|
|
},
|
|
|
|
/**
|
|
* Returns true if collection contains an object
|
|
* @param {Object} object Object to check against
|
|
* @return {Boolean} `true` if collection contains an object
|
|
*/
|
|
contains: function(object) {
|
|
return this.getObjects().indexOf(object) > -1;
|
|
},
|
|
|
|
/**
|
|
* Returns number representation of a collection complexity
|
|
* @return {Number} complexity
|
|
*/
|
|
complexity: function () {
|
|
return this.getObjects().reduce(function (memo, current) {
|
|
memo += current.complexity ? current.complexity() : 0;
|
|
return memo;
|
|
}, 0);
|
|
},
|
|
|
|
/**
|
|
* Makes all of the collection objects grayscale (i.e. calling `toGrayscale` on them)
|
|
* @return {Self} thisArg
|
|
*/
|
|
toGrayscale: function() {
|
|
return this.forEachObject(function(obj) {
|
|
obj.toGrayscale();
|
|
});
|
|
}
|
|
};
|
|
|
|
(function() {
|
|
|
|
var sqrt = Math.sqrt,
|
|
atan2 = Math.atan2;
|
|
|
|
/**
|
|
* @namespace fabric.util
|
|
*/
|
|
fabric.util = { };
|
|
|
|
/**
|
|
* Removes value from an array.
|
|
* Presence of value (and its position in an array) is determined via `Array.prototype.indexOf`
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Array} array
|
|
* @param {Any} value
|
|
* @return {Array} original array
|
|
*/
|
|
function removeFromArray(array, value) {
|
|
var idx = array.indexOf(value);
|
|
if (idx !== -1) {
|
|
array.splice(idx, 1);
|
|
}
|
|
return array;
|
|
}
|
|
|
|
/**
|
|
* Returns random number between 2 specified ones.
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Number} min lower limit
|
|
* @param {Number} max upper limit
|
|
* @return {Number} random value (between min and max)
|
|
*/
|
|
function getRandomInt(min, max) {
|
|
return Math.floor(Math.random() * (max - min + 1)) + min;
|
|
}
|
|
|
|
var PiBy180 = Math.PI / 180;
|
|
|
|
/**
|
|
* Transforms degrees to radians.
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Number} degrees value in degrees
|
|
* @return {Number} value in radians
|
|
*/
|
|
function degreesToRadians(degrees) {
|
|
return degrees * PiBy180;
|
|
}
|
|
|
|
/**
|
|
* Transforms radians to degrees.
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Number} radians value in radians
|
|
* @return {Number} value in degrees
|
|
*/
|
|
function radiansToDegrees(radians) {
|
|
return radians / PiBy180;
|
|
}
|
|
|
|
/**
|
|
* Rotates `point` around `origin` with `radians`
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {fabric.Point} The point to rotate
|
|
* @param {fabric.Point} The origin of the rotation
|
|
* @param {Number} The radians of the angle for the rotation
|
|
* @return {fabric.Point} The new rotated point
|
|
*/
|
|
function rotatePoint(point, origin, radians) {
|
|
var sin = Math.sin(radians),
|
|
cos = Math.cos(radians);
|
|
|
|
point.subtractEquals(origin);
|
|
|
|
var rx = point.x * cos - point.y * sin;
|
|
var ry = point.x * sin + point.y * cos;
|
|
|
|
return new fabric.Point(rx, ry).addEquals(origin);
|
|
}
|
|
|
|
/**
|
|
* A wrapper around Number#toFixed, which contrary to native method returns number, not string.
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Number | String} number number to operate on
|
|
* @param {Number} fractionDigits number of fraction digits to "leave"
|
|
* @return {Number}
|
|
*/
|
|
function toFixed(number, fractionDigits) {
|
|
return parseFloat(Number(number).toFixed(fractionDigits));
|
|
}
|
|
|
|
/**
|
|
* Function which always returns `false`.
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @return {Boolean}
|
|
*/
|
|
function falseFunction() {
|
|
return false;
|
|
}
|
|
|
|
/**
|
|
* Changes value from one to another within certain period of time, invoking callbacks as value is being changed.
|
|
* @memberOf fabric.util
|
|
* @param {Object} [options] Animation options
|
|
* @param {Function} [options.onChange] Callback; invoked on every value change
|
|
* @param {Function} [options.onComplete] Callback; invoked when value change is completed
|
|
* @param {Number} [options.startValue=0] Starting value
|
|
* @param {Number} [options.endValue=100] Ending value
|
|
* @param {Number} [options.byValue=100] Value to modify the property by
|
|
* @param {Function} [options.easing] Easing function
|
|
* @param {Number} [options.duration=500] Duration of change
|
|
*/
|
|
function animate(options) {
|
|
|
|
options || (options = { });
|
|
|
|
var start = +new Date(),
|
|
duration = options.duration || 500,
|
|
finish = start + duration, time,
|
|
onChange = options.onChange || function() { },
|
|
abort = options.abort || function() { return false; },
|
|
easing = options.easing || function(t, b, c, d) {return -c * Math.cos(t/d * (Math.PI/2)) + c + b;},
|
|
startValue = 'startValue' in options ? options.startValue : 0,
|
|
endValue = 'endValue' in options ? options.endValue : 100,
|
|
byValue = options.byValue || endValue - startValue;
|
|
|
|
options.onStart && options.onStart();
|
|
|
|
(function tick() {
|
|
time = +new Date();
|
|
var currentTime = time > finish ? duration : (time - start);
|
|
onChange(easing(currentTime, startValue, byValue, duration));
|
|
if (time > finish || abort()) {
|
|
options.onComplete && options.onComplete();
|
|
return;
|
|
}
|
|
requestAnimFrame(tick);
|
|
})();
|
|
}
|
|
|
|
var _requestAnimFrame = fabric.window.requestAnimationFrame ||
|
|
fabric.window.webkitRequestAnimationFrame ||
|
|
fabric.window.mozRequestAnimationFrame ||
|
|
fabric.window.oRequestAnimationFrame ||
|
|
fabric.window.msRequestAnimationFrame ||
|
|
function(callback) {
|
|
fabric.window.setTimeout(callback, 1000 / 60);
|
|
};
|
|
/**
|
|
* requestAnimationFrame polyfill based on http://paulirish.com/2011/requestanimationframe-for-smart-animating/
|
|
* @memberOf fabric.util
|
|
* @param {Function} callback Callback to invoke
|
|
* @param {DOMElement} element optional Element to associate with animation
|
|
*/
|
|
var requestAnimFrame = function() {
|
|
return _requestAnimFrame.apply(fabric.window, arguments);
|
|
};
|
|
|
|
/**
|
|
* Loads image element from given url and passes it to a callback
|
|
* @memberOf fabric.util
|
|
* @param {String} url URL representing an image
|
|
* @param {Function} callback Callback; invoked with loaded image
|
|
* @param {Any} context optional Context to invoke callback in
|
|
*/
|
|
function loadImage(url, callback, context) {
|
|
if (url) {
|
|
var img = fabric.util.createImage();
|
|
/** @ignore */
|
|
img.onload = function () {
|
|
callback && callback.call(context, img);
|
|
img = img.onload = null;
|
|
};
|
|
img.src = url;
|
|
}
|
|
else {
|
|
callback && callback.call(context, url);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Creates corresponding fabric instances from their object representations
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Array} objects Objects to enliven
|
|
* @param {Function} callback Callback to invoke when all objects are created
|
|
*/
|
|
function enlivenObjects(objects, callback) {
|
|
|
|
function getKlass(type) {
|
|
return fabric[fabric.util.string.camelize(fabric.util.string.capitalize(type))];
|
|
}
|
|
|
|
function onLoaded() {
|
|
if (++numLoadedObjects === numTotalObjects) {
|
|
if (callback) {
|
|
callback(enlivenedObjects);
|
|
}
|
|
}
|
|
}
|
|
|
|
var enlivenedObjects = [ ],
|
|
numLoadedObjects = 0,
|
|
numTotalObjects = objects.length;
|
|
|
|
objects.forEach(function (o, index) {
|
|
if (!o.type) {
|
|
return;
|
|
}
|
|
var klass = getKlass(o.type);
|
|
if (klass.async) {
|
|
klass.fromObject(o, function (o, error) {
|
|
if (!error) {
|
|
enlivenedObjects[index] = o;
|
|
}
|
|
onLoaded();
|
|
});
|
|
}
|
|
else {
|
|
enlivenedObjects[index] = klass.fromObject(o);
|
|
onLoaded();
|
|
}
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Groups SVG elements (usually those retrieved from SVG document)
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Array} elements SVG elements to group
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Object|fabric.PathGroup}
|
|
*/
|
|
function groupSVGElements(elements, options, path) {
|
|
var object;
|
|
|
|
if (elements.length > 1) {
|
|
//var hasText = elements.some(function(el) { return el.type === 'text'; });
|
|
|
|
// if (hasText) {
|
|
// object = new fabric.Group([ ], options);
|
|
// elements.reverse().forEach(function(obj) {
|
|
// if (obj.cx) {
|
|
// obj.left = obj.cx;
|
|
// }
|
|
// if (obj.cy) {
|
|
// obj.top = obj.cy;
|
|
// }
|
|
// object.addWithUpdate(obj);
|
|
// });
|
|
// }
|
|
// else {
|
|
object = new fabric.PathGroup(elements, options);
|
|
//}
|
|
}
|
|
else {
|
|
object = elements[0];
|
|
}
|
|
|
|
if (typeof path !== 'undefined') {
|
|
object.setSourcePath(path);
|
|
}
|
|
return object;
|
|
}
|
|
|
|
/**
|
|
* Populates an object with properties of another object
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Object} source Source object
|
|
* @param {Object} destination Destination object
|
|
* @return {Array} properties Propertie names to include
|
|
*/
|
|
function populateWithProperties(source, destination, properties) {
|
|
if (properties && Object.prototype.toString.call(properties) === '[object Array]') {
|
|
for (var i = 0, len = properties.length; i < len; i++) {
|
|
destination[properties[i]] = source[properties[i]];
|
|
}
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Draws a dashed line between two points
|
|
*
|
|
* This method is used to draw dashed line around selection area.
|
|
* See <a href="http://stackoverflow.com/questions/4576724/dotted-stroke-in-canvas">dotted stroke in canvas</a>
|
|
*
|
|
* @param ctx {Canvas} context
|
|
* @param x {Number} start x coordinate
|
|
* @param y {Number} start y coordinate
|
|
* @param x2 {Number} end x coordinate
|
|
* @param y2 {Number} end y coordinate
|
|
* @param da {Array} dash array pattern
|
|
*/
|
|
function drawDashedLine(ctx, x, y, x2, y2, da) {
|
|
var dx = x2 - x,
|
|
dy = y2 - y,
|
|
len = sqrt(dx*dx + dy*dy),
|
|
rot = atan2(dy, dx),
|
|
dc = da.length,
|
|
di = 0,
|
|
draw = true;
|
|
|
|
ctx.save();
|
|
ctx.translate(x, y);
|
|
ctx.moveTo(0, 0);
|
|
ctx.rotate(rot);
|
|
|
|
x = 0;
|
|
while (len > x) {
|
|
x += da[di++ % dc];
|
|
if (x > len) {
|
|
x = len;
|
|
}
|
|
ctx[draw ? 'lineTo' : 'moveTo'](x, 0);
|
|
draw = !draw;
|
|
}
|
|
|
|
ctx.restore();
|
|
}
|
|
|
|
/**
|
|
* Creates canvas element and initializes it via excanvas if necessary
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {CanvasElement} [canvasEl] optional canvas element to initialize; when not given, element is created implicitly
|
|
* @return {CanvasElement} initialized canvas element
|
|
*/
|
|
function createCanvasElement(canvasEl) {
|
|
canvasEl || (canvasEl = fabric.document.createElement('canvas'));
|
|
if (!canvasEl.getContext && typeof G_vmlCanvasManager !== 'undefined') {
|
|
G_vmlCanvasManager.initElement(canvasEl);
|
|
}
|
|
return canvasEl;
|
|
}
|
|
|
|
/**
|
|
* Creates image element (works on client and node)
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @return {Image} image element
|
|
*/
|
|
function createImage() {
|
|
return fabric.isLikelyNode
|
|
? new (require('canvas').Image)()
|
|
: fabric.document.createElement('img');
|
|
}
|
|
|
|
/**
|
|
* Creates accessors (getXXX, setXXX) for a "class", based on "stateProperties" array
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Object} klass "Class" to create accessors for
|
|
*/
|
|
function createAccessors(klass) {
|
|
var proto = klass.prototype;
|
|
|
|
for (var i = proto.stateProperties.length; i--; ) {
|
|
|
|
var propName = proto.stateProperties[i],
|
|
capitalizedPropName = propName.charAt(0).toUpperCase() + propName.slice(1),
|
|
setterName = 'set' + capitalizedPropName,
|
|
getterName = 'get' + capitalizedPropName;
|
|
|
|
// using `new Function` for better introspection
|
|
if (!proto[getterName]) {
|
|
proto[getterName] = (function(property) {
|
|
return new Function('return this.get("' + property + '")');
|
|
})(propName);
|
|
}
|
|
if (!proto[setterName]) {
|
|
proto[setterName] = (function(property) {
|
|
return new Function('value', 'return this.set("' + property + '", value)');
|
|
})(propName);
|
|
}
|
|
}
|
|
}
|
|
|
|
/**
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {fabric.Object} receiver Object implementing `clipTo` method
|
|
* @param {CanvasRenderingContext2D} ctx Context to clip
|
|
*/
|
|
function clipContext(receiver, ctx) {
|
|
ctx.save();
|
|
ctx.beginPath();
|
|
receiver.clipTo(ctx);
|
|
ctx.clip();
|
|
}
|
|
|
|
/**
|
|
* Multiply matrix A by matrix B to nest transformations
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Array} matrixA First transformMatrix
|
|
* @param {Array} matrixB Second transformMatrix
|
|
* @return {Array} The product of the two transform matrices
|
|
*/
|
|
function multiplyTransformMatrices(matrixA, matrixB) {
|
|
// Matrix multiply matrixA * matrixB
|
|
var a = [
|
|
[matrixA[0], matrixA[2], matrixA[4]],
|
|
[matrixA[1], matrixA[3], matrixA[5]],
|
|
[0 , 0 , 1 ]
|
|
];
|
|
|
|
var b = [
|
|
[matrixB[0], matrixB[2], matrixB[4]],
|
|
[matrixB[1], matrixB[3], matrixB[5]],
|
|
[0 , 0 , 1 ]
|
|
];
|
|
|
|
var result = [];
|
|
for (var r=0; r<3; r++) {
|
|
result[r] = [];
|
|
for (var c=0; c<3; c++) {
|
|
var sum = 0;
|
|
for (var k=0; k<3; k++) {
|
|
sum += a[r][k]*b[k][c];
|
|
}
|
|
|
|
result[r][c] = sum;
|
|
}
|
|
}
|
|
|
|
return [
|
|
result[0][0],
|
|
result[1][0],
|
|
result[0][1],
|
|
result[1][1],
|
|
result[0][2],
|
|
result[1][2]
|
|
];
|
|
}
|
|
|
|
fabric.util.removeFromArray = removeFromArray;
|
|
fabric.util.degreesToRadians = degreesToRadians;
|
|
fabric.util.radiansToDegrees = radiansToDegrees;
|
|
fabric.util.rotatePoint = rotatePoint;
|
|
fabric.util.toFixed = toFixed;
|
|
fabric.util.getRandomInt = getRandomInt;
|
|
fabric.util.falseFunction = falseFunction;
|
|
fabric.util.animate = animate;
|
|
fabric.util.requestAnimFrame = requestAnimFrame;
|
|
fabric.util.loadImage = loadImage;
|
|
fabric.util.enlivenObjects = enlivenObjects;
|
|
fabric.util.groupSVGElements = groupSVGElements;
|
|
fabric.util.populateWithProperties = populateWithProperties;
|
|
fabric.util.drawDashedLine = drawDashedLine;
|
|
fabric.util.createCanvasElement = createCanvasElement;
|
|
fabric.util.createImage = createImage;
|
|
fabric.util.createAccessors = createAccessors;
|
|
fabric.util.clipContext = clipContext;
|
|
fabric.util.multiplyTransformMatrices = multiplyTransformMatrices;
|
|
|
|
})();
|
|
|
|
(function() {
|
|
|
|
var slice = Array.prototype.slice;
|
|
|
|
/* _ES5_COMPAT_START_ */
|
|
|
|
if (!Array.prototype.indexOf) {
|
|
/**
|
|
* Finds index of an element in an array
|
|
* @param {Any} searchElement
|
|
* @param {Number} [fromIndex]
|
|
* @return {Number}
|
|
*/
|
|
Array.prototype.indexOf = function (searchElement /*, fromIndex */ ) {
|
|
if (this === void 0 || this === null) {
|
|
throw new TypeError();
|
|
}
|
|
var t = Object(this), len = t.length >>> 0;
|
|
if (len === 0) {
|
|
return -1;
|
|
}
|
|
var n = 0;
|
|
if (arguments.length > 0) {
|
|
n = Number(arguments[1]);
|
|
if (n !== n) { // shortcut for verifying if it's NaN
|
|
n = 0;
|
|
}
|
|
else if (n !== 0 && n !== Number.POSITIVE_INFINITY && n !== Number.NEGATIVE_INFINITY) {
|
|
n = (n > 0 || -1) * Math.floor(Math.abs(n));
|
|
}
|
|
}
|
|
if (n >= len) {
|
|
return -1;
|
|
}
|
|
var k = n >= 0 ? n : Math.max(len - Math.abs(n), 0);
|
|
for (; k < len; k++) {
|
|
if (k in t && t[k] === searchElement) {
|
|
return k;
|
|
}
|
|
}
|
|
return -1;
|
|
};
|
|
}
|
|
|
|
if (!Array.prototype.forEach) {
|
|
/**
|
|
* Iterates an array, invoking callback for each element
|
|
* @param {Function} fn Callback to invoke for each element
|
|
* @param {Object} [context] Context to invoke callback in
|
|
* @return {Array}
|
|
*/
|
|
Array.prototype.forEach = function(fn, context) {
|
|
for (var i = 0, len = this.length >>> 0; i < len; i++) {
|
|
if (i in this) {
|
|
fn.call(context, this[i], i, this);
|
|
}
|
|
}
|
|
};
|
|
}
|
|
|
|
if (!Array.prototype.map) {
|
|
/**
|
|
* Returns a result of iterating over an array, invoking callback for each element
|
|
* @param {Function} fn Callback to invoke for each element
|
|
* @param {Object} [context] Context to invoke callback in
|
|
* @return {Array}
|
|
*/
|
|
Array.prototype.map = function(fn, context) {
|
|
var result = [ ];
|
|
for (var i = 0, len = this.length >>> 0; i < len; i++) {
|
|
if (i in this) {
|
|
result[i] = fn.call(context, this[i], i, this);
|
|
}
|
|
}
|
|
return result;
|
|
};
|
|
}
|
|
|
|
if (!Array.prototype.every) {
|
|
/**
|
|
* Returns true if a callback returns truthy value for all elements in an array
|
|
* @param {Function} fn Callback to invoke for each element
|
|
* @param {Object} [context] Context to invoke callback in
|
|
* @return {Boolean}
|
|
*/
|
|
Array.prototype.every = function(fn, context) {
|
|
for (var i = 0, len = this.length >>> 0; i < len; i++) {
|
|
if (i in this && !fn.call(context, this[i], i, this)) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
};
|
|
}
|
|
|
|
if (!Array.prototype.some) {
|
|
/**
|
|
* Returns true if a callback returns truthy value for at least one element in an array
|
|
* @param {Function} fn Callback to invoke for each element
|
|
* @param {Object} [context] Context to invoke callback in
|
|
* @return {Boolean}
|
|
*/
|
|
Array.prototype.some = function(fn, context) {
|
|
for (var i = 0, len = this.length >>> 0; i < len; i++) {
|
|
if (i in this && fn.call(context, this[i], i, this)) {
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
};
|
|
}
|
|
|
|
if (!Array.prototype.filter) {
|
|
/**
|
|
* Returns the result of iterating over elements in an array
|
|
* @param {Function} fn Callback to invoke for each element
|
|
* @param {Object} [context] Context to invoke callback in
|
|
* @return {Array}
|
|
*/
|
|
Array.prototype.filter = function(fn, context) {
|
|
var result = [ ], val;
|
|
for (var i = 0, len = this.length >>> 0; i < len; i++) {
|
|
if (i in this) {
|
|
val = this[i]; // in case fn mutates this
|
|
if (fn.call(context, val, i, this)) {
|
|
result.push(val);
|
|
}
|
|
}
|
|
}
|
|
return result;
|
|
};
|
|
}
|
|
|
|
if (!Array.prototype.reduce) {
|
|
/**
|
|
* Returns "folded" (reduced) result of iterating over elements in an array
|
|
* @param {Function} fn Callback to invoke for each element
|
|
* @param {Object} [context] Context to invoke callback in
|
|
* @return {Any}
|
|
*/
|
|
Array.prototype.reduce = function(fn /*, initial*/) {
|
|
var len = this.length >>> 0,
|
|
i = 0,
|
|
rv;
|
|
|
|
if (arguments.length > 1) {
|
|
rv = arguments[1];
|
|
}
|
|
else {
|
|
do {
|
|
if (i in this) {
|
|
rv = this[i++];
|
|
break;
|
|
}
|
|
// if array contains no values, no initial value to return
|
|
if (++i >= len) {
|
|
throw new TypeError();
|
|
}
|
|
}
|
|
while (true);
|
|
}
|
|
for (; i < len; i++) {
|
|
if (i in this) {
|
|
rv = fn.call(null, rv, this[i], i, this);
|
|
}
|
|
}
|
|
return rv;
|
|
};
|
|
}
|
|
|
|
/* _ES5_COMPAT_END_ */
|
|
|
|
/**
|
|
* Invokes method on all items in a given array
|
|
* @memberOf fabric.util.array
|
|
* @param {Array} array Array to iterate over
|
|
* @param {String} method Name of a method to invoke
|
|
* @return {Array}
|
|
*/
|
|
function invoke(array, method) {
|
|
var args = slice.call(arguments, 2), result = [ ];
|
|
for (var i = 0, len = array.length; i < len; i++) {
|
|
result[i] = args.length ? array[i][method].apply(array[i], args) : array[i][method].call(array[i]);
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Finds maximum value in array (not necessarily "first" one)
|
|
* @memberOf fabric.util.array
|
|
* @param {Array} array Array to iterate over
|
|
* @param {String} byProperty
|
|
* @return {Any}
|
|
*/
|
|
function max(array, byProperty) {
|
|
if (!array || array.length === 0) return undefined;
|
|
|
|
var i = array.length - 1,
|
|
result = byProperty ? array[i][byProperty] : array[i];
|
|
if (byProperty) {
|
|
while (i--) {
|
|
if (array[i][byProperty] >= result) {
|
|
result = array[i][byProperty];
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
while (i--) {
|
|
if (array[i] >= result) {
|
|
result = array[i];
|
|
}
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Finds minimum value in array (not necessarily "first" one)
|
|
* @memberOf fabric.util.array
|
|
* @param {Array} array Array to iterate over
|
|
* @param {String} byProperty
|
|
* @return {Any}
|
|
*/
|
|
function min(array, byProperty) {
|
|
if (!array || array.length === 0) return undefined;
|
|
|
|
var i = array.length - 1,
|
|
result = byProperty ? array[i][byProperty] : array[i];
|
|
|
|
if (byProperty) {
|
|
while (i--) {
|
|
if (array[i][byProperty] < result) {
|
|
result = array[i][byProperty];
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
while (i--) {
|
|
if (array[i] < result) {
|
|
result = array[i];
|
|
}
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* @namespace fabric.util.array
|
|
*/
|
|
fabric.util.array = {
|
|
invoke: invoke,
|
|
min: min,
|
|
max: max
|
|
};
|
|
|
|
})();
|
|
|
|
(function(){
|
|
|
|
/**
|
|
* Copies all enumerable properties of one object to another
|
|
* @memberOf fabric.util.object
|
|
* @param {Object} destination Where to copy to
|
|
* @param {Object} source Where to copy from
|
|
* @return {Object}
|
|
*/
|
|
function extend(destination, source) {
|
|
// JScript DontEnum bug is not taken care of
|
|
for (var property in source) {
|
|
destination[property] = source[property];
|
|
}
|
|
return destination;
|
|
}
|
|
|
|
/**
|
|
* Creates an empty object and copies all enumerable properties of another object to it
|
|
* @memberOf fabric.util.object
|
|
* @param {Object} object Object to clone
|
|
* @return {Object}
|
|
*/
|
|
function clone(object) {
|
|
return extend({ }, object);
|
|
}
|
|
|
|
/** @namespace fabric.util.object */
|
|
fabric.util.object = {
|
|
extend: extend,
|
|
clone: clone
|
|
};
|
|
|
|
})();
|
|
|
|
(function() {
|
|
|
|
/* _ES5_COMPAT_START_ */
|
|
if (!String.prototype.trim) {
|
|
/**
|
|
* Trims a string (removing whitespace from the beginning and the end)
|
|
* @function external:String#trim
|
|
* @see <a href="https://developer.mozilla.org/en/JavaScript/Reference/Global_Objects/String/Trim">String#trim on MDN</a>
|
|
*/
|
|
String.prototype.trim = function () {
|
|
// this trim is not fully ES3 or ES5 compliant, but it should cover most cases for now
|
|
return this.replace(/^[\s\xA0]+/, '').replace(/[\s\xA0]+$/, '');
|
|
};
|
|
}
|
|
/* _ES5_COMPAT_END_ */
|
|
|
|
/**
|
|
* Camelizes a string
|
|
* @memberOf fabric.util.string
|
|
* @param {String} string String to camelize
|
|
* @return {String} Camelized version of a string
|
|
*/
|
|
function camelize(string) {
|
|
return string.replace(/-+(.)?/g, function(match, character) {
|
|
return character ? character.toUpperCase() : '';
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Capitalizes a string
|
|
* @memberOf fabric.util.string
|
|
* @param {String} string String to capitalize
|
|
* @return {String} Capitalized version of a string
|
|
*/
|
|
function capitalize(string) {
|
|
return string.charAt(0).toUpperCase() + string.slice(1).toLowerCase();
|
|
}
|
|
|
|
/**
|
|
* Escapes XML in a string
|
|
* @memberOf fabric.util.string
|
|
* @param {String} string String to escape
|
|
* @return {String} Escaped version of a string
|
|
*/
|
|
function escapeXml(string) {
|
|
return string.replace(/&/g, '&')
|
|
.replace(/"/g, '"')
|
|
.replace(/'/g, ''')
|
|
.replace(/</g, '<')
|
|
.replace(/>/g, '>');
|
|
}
|
|
|
|
/**
|
|
* String utilities
|
|
* @namespace fabric.util.string
|
|
*/
|
|
fabric.util.string = {
|
|
camelize: camelize,
|
|
capitalize: capitalize,
|
|
escapeXml: escapeXml
|
|
};
|
|
}());
|
|
|
|
/* _ES5_COMPAT_START_ */
|
|
(function() {
|
|
|
|
var slice = Array.prototype.slice,
|
|
apply = Function.prototype.apply,
|
|
Dummy = function() { };
|
|
|
|
if (!Function.prototype.bind) {
|
|
/**
|
|
* Cross-browser approximation of ES5 Function.prototype.bind (not fully spec conforming)
|
|
* @see <a href="https://developer.mozilla.org/en/JavaScript/Reference/Global_Objects/Function/bind">Function#bind on MDN</a>
|
|
* @param {Object} thisArg Object to bind function to
|
|
* @param {Any[]} [...] Values to pass to a bound function
|
|
* @return {Function}
|
|
*/
|
|
Function.prototype.bind = function(thisArg) {
|
|
var fn = this, args = slice.call(arguments, 1), bound;
|
|
if (args.length) {
|
|
bound = function() {
|
|
return apply.call(fn, this instanceof Dummy ? this : thisArg, args.concat(slice.call(arguments)));
|
|
};
|
|
}
|
|
else {
|
|
/** @ignore */
|
|
bound = function() {
|
|
return apply.call(fn, this instanceof Dummy ? this : thisArg, arguments);
|
|
};
|
|
}
|
|
Dummy.prototype = this.prototype;
|
|
bound.prototype = new Dummy();
|
|
|
|
return bound;
|
|
};
|
|
}
|
|
|
|
})();
|
|
/* _ES5_COMPAT_END_ */
|
|
|
|
(function() {
|
|
|
|
var slice = Array.prototype.slice, emptyFunction = function() { };
|
|
|
|
var IS_DONTENUM_BUGGY = (function(){
|
|
for (var p in { toString: 1 }) {
|
|
if (p === 'toString') return false;
|
|
}
|
|
return true;
|
|
})();
|
|
|
|
/** @ignore */
|
|
var addMethods = function(klass, source, parent) {
|
|
for (var property in source) {
|
|
|
|
if (property in klass.prototype &&
|
|
typeof klass.prototype[property] === 'function' &&
|
|
(source[property] + '').indexOf('callSuper') > -1) {
|
|
|
|
klass.prototype[property] = (function(property) {
|
|
return function() {
|
|
|
|
var superclass = this.constructor.superclass;
|
|
this.constructor.superclass = parent;
|
|
var returnValue = source[property].apply(this, arguments);
|
|
this.constructor.superclass = superclass;
|
|
|
|
if (property !== 'initialize') {
|
|
return returnValue;
|
|
}
|
|
};
|
|
})(property);
|
|
}
|
|
else {
|
|
klass.prototype[property] = source[property];
|
|
}
|
|
|
|
if (IS_DONTENUM_BUGGY) {
|
|
if (source.toString !== Object.prototype.toString) {
|
|
klass.prototype.toString = source.toString;
|
|
}
|
|
if (source.valueOf !== Object.prototype.valueOf) {
|
|
klass.prototype.valueOf = source.valueOf;
|
|
}
|
|
}
|
|
}
|
|
};
|
|
|
|
function Subclass() { }
|
|
|
|
function callSuper(methodName) {
|
|
var fn = this.constructor.superclass.prototype[methodName];
|
|
return (arguments.length > 1)
|
|
? fn.apply(this, slice.call(arguments, 1))
|
|
: fn.call(this);
|
|
}
|
|
|
|
/**
|
|
* Helper for creation of "classes". Note that pr
|
|
* @param parent optional "Class" to inherit from
|
|
* @param properties Properties shared by all instances of this class
|
|
* (be careful modifying objects defined here as this would affect all instances)
|
|
* @memberOf fabric.util
|
|
*/
|
|
function createClass() {
|
|
var parent = null,
|
|
properties = slice.call(arguments, 0);
|
|
|
|
if (typeof properties[0] === 'function') {
|
|
parent = properties.shift();
|
|
}
|
|
function klass() {
|
|
this.initialize.apply(this, arguments);
|
|
}
|
|
|
|
klass.superclass = parent;
|
|
klass.subclasses = [ ];
|
|
|
|
if (parent) {
|
|
Subclass.prototype = parent.prototype;
|
|
klass.prototype = new Subclass();
|
|
parent.subclasses.push(klass);
|
|
}
|
|
for (var i = 0, length = properties.length; i < length; i++) {
|
|
addMethods(klass, properties[i], parent);
|
|
}
|
|
if (!klass.prototype.initialize) {
|
|
klass.prototype.initialize = emptyFunction;
|
|
}
|
|
klass.prototype.constructor = klass;
|
|
klass.prototype.callSuper = callSuper;
|
|
return klass;
|
|
}
|
|
|
|
fabric.util.createClass = createClass;
|
|
})();
|
|
|
|
(function () {
|
|
|
|
/* EVENT HANDLING */
|
|
|
|
function areHostMethods(object) {
|
|
var methodNames = Array.prototype.slice.call(arguments, 1),
|
|
t, i, len = methodNames.length;
|
|
for (i = 0; i < len; i++) {
|
|
t = typeof object[methodNames[i]];
|
|
if (!(/^(?:function|object|unknown)$/).test(t)) return false;
|
|
}
|
|
return true;
|
|
}
|
|
var getUniqueId = (function () {
|
|
var uid = 0;
|
|
return function (element) {
|
|
return element.__uniqueID || (element.__uniqueID = 'uniqueID__' + uid++);
|
|
};
|
|
})();
|
|
|
|
/** @ignore */
|
|
var getElement, setElement;
|
|
|
|
(function () {
|
|
var elements = { };
|
|
/** @ignore */
|
|
getElement = function (uid) {
|
|
return elements[uid];
|
|
};
|
|
/** @ignore */
|
|
setElement = function (uid, element) {
|
|
elements[uid] = element;
|
|
};
|
|
})();
|
|
|
|
function createListener(uid, handler) {
|
|
return {
|
|
handler: handler,
|
|
wrappedHandler: createWrappedHandler(uid, handler)
|
|
};
|
|
}
|
|
|
|
function createWrappedHandler(uid, handler) {
|
|
return function (e) {
|
|
handler.call(getElement(uid), e || fabric.window.event);
|
|
};
|
|
}
|
|
|
|
function createDispatcher(uid, eventName) {
|
|
return function (e) {
|
|
if (handlers[uid] && handlers[uid][eventName]) {
|
|
var handlersForEvent = handlers[uid][eventName];
|
|
for (var i = 0, len = handlersForEvent.length; i < len; i++) {
|
|
handlersForEvent[i].call(this, e || fabric.window.event);
|
|
}
|
|
}
|
|
};
|
|
}
|
|
|
|
var shouldUseAddListenerRemoveListener = (
|
|
areHostMethods(fabric.document.documentElement, 'addEventListener', 'removeEventListener') &&
|
|
areHostMethods(fabric.window, 'addEventListener', 'removeEventListener')),
|
|
|
|
shouldUseAttachEventDetachEvent = (
|
|
areHostMethods(fabric.document.documentElement, 'attachEvent', 'detachEvent') &&
|
|
areHostMethods(fabric.window, 'attachEvent', 'detachEvent')),
|
|
|
|
// IE branch
|
|
listeners = { },
|
|
|
|
// DOM L0 branch
|
|
handlers = { },
|
|
|
|
addListener, removeListener;
|
|
|
|
if (shouldUseAddListenerRemoveListener) {
|
|
/** @ignore */
|
|
addListener = function (element, eventName, handler) {
|
|
element.addEventListener(eventName, handler, false);
|
|
};
|
|
/** @ignore */
|
|
removeListener = function (element, eventName, handler) {
|
|
element.removeEventListener(eventName, handler, false);
|
|
};
|
|
}
|
|
|
|
else if (shouldUseAttachEventDetachEvent) {
|
|
/** @ignore */
|
|
addListener = function (element, eventName, handler) {
|
|
var uid = getUniqueId(element);
|
|
setElement(uid, element);
|
|
if (!listeners[uid]) {
|
|
listeners[uid] = { };
|
|
}
|
|
if (!listeners[uid][eventName]) {
|
|
listeners[uid][eventName] = [ ];
|
|
|
|
}
|
|
var listener = createListener(uid, handler);
|
|
listeners[uid][eventName].push(listener);
|
|
element.attachEvent('on' + eventName, listener.wrappedHandler);
|
|
};
|
|
/** @ignore */
|
|
removeListener = function (element, eventName, handler) {
|
|
var uid = getUniqueId(element), listener;
|
|
if (listeners[uid] && listeners[uid][eventName]) {
|
|
for (var i = 0, len = listeners[uid][eventName].length; i < len; i++) {
|
|
listener = listeners[uid][eventName][i];
|
|
if (listener && listener.handler === handler) {
|
|
element.detachEvent('on' + eventName, listener.wrappedHandler);
|
|
listeners[uid][eventName][i] = null;
|
|
}
|
|
}
|
|
}
|
|
};
|
|
}
|
|
else {
|
|
/** @ignore */
|
|
addListener = function (element, eventName, handler) {
|
|
var uid = getUniqueId(element);
|
|
if (!handlers[uid]) {
|
|
handlers[uid] = { };
|
|
}
|
|
if (!handlers[uid][eventName]) {
|
|
handlers[uid][eventName] = [ ];
|
|
var existingHandler = element['on' + eventName];
|
|
if (existingHandler) {
|
|
handlers[uid][eventName].push(existingHandler);
|
|
}
|
|
element['on' + eventName] = createDispatcher(uid, eventName);
|
|
}
|
|
handlers[uid][eventName].push(handler);
|
|
};
|
|
/** @ignore */
|
|
removeListener = function (element, eventName, handler) {
|
|
var uid = getUniqueId(element);
|
|
if (handlers[uid] && handlers[uid][eventName]) {
|
|
var handlersForEvent = handlers[uid][eventName];
|
|
for (var i = 0, len = handlersForEvent.length; i < len; i++) {
|
|
if (handlersForEvent[i] === handler) {
|
|
handlersForEvent.splice(i, 1);
|
|
}
|
|
}
|
|
}
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Adds an event listener to an element
|
|
* @mthod addListener
|
|
* @memberOf fabric.util
|
|
* @function
|
|
* @param {HTMLElement} element
|
|
* @param {String} eventName
|
|
* @param {Function} handler
|
|
*/
|
|
fabric.util.addListener = addListener;
|
|
|
|
/**
|
|
* Removes an event listener from an element
|
|
* @mthod removeListener
|
|
* @memberOf fabric.util
|
|
* @function
|
|
* @param {HTMLElement} element
|
|
* @param {String} eventName
|
|
* @param {Function} handler
|
|
*/
|
|
fabric.util.removeListener = removeListener;
|
|
|
|
/**
|
|
* Cross-browser wrapper for getting event's coordinates
|
|
* @memberOf fabric.util
|
|
* @param {Event} event
|
|
* @param {HTMLCanvasElement} upperCanvasEl <canvas> element on which object selection is drawn
|
|
*/
|
|
function getPointer(event, upperCanvasEl) {
|
|
event || (event = fabric.window.event);
|
|
|
|
var element = event.target || (typeof event.srcElement !== 'unknown' ? event.srcElement : null),
|
|
body = fabric.document.body || {scrollLeft: 0, scrollTop: 0},
|
|
docElement = fabric.document.documentElement,
|
|
orgElement = element,
|
|
scrollLeft = 0,
|
|
scrollTop = 0,
|
|
firstFixedAncestor;
|
|
|
|
while (element && element.parentNode && !firstFixedAncestor) {
|
|
element = element.parentNode;
|
|
|
|
if (element !== fabric.document && fabric.util.getElementPosition(element) === 'fixed') firstFixedAncestor = element;
|
|
|
|
if (element !== fabric.document && orgElement !== upperCanvasEl && fabric.util.getElementPosition(element) === 'absolute') {
|
|
scrollLeft = 0;
|
|
scrollTop = 0;
|
|
}
|
|
else if (element === fabric.document && orgElement !== upperCanvasEl) {
|
|
scrollLeft = body.scrollLeft || docElement.scrollLeft || 0;
|
|
scrollTop = body.scrollTop || docElement.scrollTop || 0;
|
|
}
|
|
else {
|
|
scrollLeft += element.scrollLeft || 0;
|
|
scrollTop += element.scrollTop || 0;
|
|
}
|
|
}
|
|
|
|
return {
|
|
x: pointerX(event) + scrollLeft,
|
|
y: pointerY(event) + scrollTop
|
|
};
|
|
}
|
|
|
|
var pointerX = function(event) {
|
|
// looks like in IE (<9) clientX at certain point (apparently when mouseup fires on VML element)
|
|
// is represented as COM object, with all the consequences, like "unknown" type and error on [[Get]]
|
|
// need to investigate later
|
|
return (typeof event.clientX !== 'unknown' ? event.clientX : 0);
|
|
};
|
|
|
|
var pointerY = function(event) {
|
|
return (typeof event.clientY !== 'unknown' ? event.clientY : 0);
|
|
};
|
|
|
|
if (fabric.isTouchSupported) {
|
|
pointerX = function(event) {
|
|
if (event.type !== 'touchend') {
|
|
return (event.touches && event.touches[0] ? (event.touches[0].pageX - (event.touches[0].pageX - event.touches[0].clientX)) || event.clientX : event.clientX);
|
|
}
|
|
return (event.changedTouches && event.changedTouches[0] ? (event.changedTouches[0].pageX - (event.changedTouches[0].pageX - event.changedTouches[0].clientX)) || event.clientX : event.clientX);
|
|
};
|
|
pointerY = function(event) {
|
|
if (event.type !== 'touchend') {
|
|
return (event.touches && event.touches[0] ? (event.touches[0].pageY - (event.touches[0].pageY - event.touches[0].clientY)) || event.clientY : event.clientY);
|
|
}
|
|
return (event.changedTouches && event.changedTouches[0] ? (event.changedTouches[0].pageY - (event.changedTouches[0].pageY - event.changedTouches[0].clientY)) || event.clientY : event.clientY);
|
|
};
|
|
}
|
|
|
|
fabric.util.getPointer = getPointer;
|
|
|
|
fabric.util.object.extend(fabric.util, fabric.Observable);
|
|
|
|
})();
|
|
|
|
(function () {
|
|
|
|
/**
|
|
* Cross-browser wrapper for setting element's style
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element
|
|
* @param {Object} styles
|
|
* @return {HTMLElement} Element that was passed as a first argument
|
|
*/
|
|
function setStyle(element, styles) {
|
|
var elementStyle = element.style;
|
|
if (!elementStyle) {
|
|
return element;
|
|
}
|
|
if (typeof styles === 'string') {
|
|
element.style.cssText += ';' + styles;
|
|
return styles.indexOf('opacity') > -1
|
|
? setOpacity(element, styles.match(/opacity:\s*(\d?\.?\d*)/)[1])
|
|
: element;
|
|
}
|
|
for (var property in styles) {
|
|
if (property === 'opacity') {
|
|
setOpacity(element, styles[property]);
|
|
}
|
|
else {
|
|
var normalizedProperty = (property === 'float' || property === 'cssFloat')
|
|
? (typeof elementStyle.styleFloat === 'undefined' ? 'cssFloat' : 'styleFloat')
|
|
: property;
|
|
elementStyle[normalizedProperty] = styles[property];
|
|
}
|
|
}
|
|
return element;
|
|
}
|
|
|
|
var parseEl = fabric.document.createElement('div'),
|
|
supportsOpacity = typeof parseEl.style.opacity === 'string',
|
|
supportsFilters = typeof parseEl.style.filter === 'string',
|
|
reOpacity = /alpha\s*\(\s*opacity\s*=\s*([^\)]+)\)/,
|
|
|
|
/** @ignore */
|
|
setOpacity = function (element) { return element; };
|
|
|
|
if (supportsOpacity) {
|
|
/** @ignore */
|
|
setOpacity = function(element, value) {
|
|
element.style.opacity = value;
|
|
return element;
|
|
};
|
|
}
|
|
else if (supportsFilters) {
|
|
/** @ignore */
|
|
setOpacity = function(element, value) {
|
|
var es = element.style;
|
|
if (element.currentStyle && !element.currentStyle.hasLayout) {
|
|
es.zoom = 1;
|
|
}
|
|
if (reOpacity.test(es.filter)) {
|
|
value = value >= 0.9999 ? '' : ('alpha(opacity=' + (value * 100) + ')');
|
|
es.filter = es.filter.replace(reOpacity, value);
|
|
}
|
|
else {
|
|
es.filter += ' alpha(opacity=' + (value * 100) + ')';
|
|
}
|
|
return element;
|
|
};
|
|
}
|
|
|
|
fabric.util.setStyle = setStyle;
|
|
|
|
})();
|
|
|
|
(function() {
|
|
|
|
var _slice = Array.prototype.slice;
|
|
|
|
/**
|
|
* Takes id and returns an element with that id (if one exists in a document)
|
|
* @memberOf fabric.util
|
|
* @param {String|HTMLElement} id
|
|
* @return {HTMLElement|null}
|
|
*/
|
|
function getById(id) {
|
|
return typeof id === 'string' ? fabric.document.getElementById(id) : id;
|
|
}
|
|
|
|
/**
|
|
* Converts an array-like object (e.g. arguments or NodeList) to an array
|
|
* @memberOf fabric.util
|
|
* @param {Object} arrayLike
|
|
* @return {Array}
|
|
*/
|
|
var toArray = function(arrayLike) {
|
|
return _slice.call(arrayLike, 0);
|
|
};
|
|
|
|
var sliceCanConvertNodelists;
|
|
try {
|
|
sliceCanConvertNodelists = toArray(fabric.document.childNodes) instanceof Array;
|
|
}
|
|
catch(err) { }
|
|
|
|
if (!sliceCanConvertNodelists) {
|
|
toArray = function(arrayLike) {
|
|
var arr = new Array(arrayLike.length), i = arrayLike.length;
|
|
while (i--) {
|
|
arr[i] = arrayLike[i];
|
|
}
|
|
return arr;
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates specified element with specified attributes
|
|
* @memberOf fabric.util
|
|
* @param {String} tagName Type of an element to create
|
|
* @param {Object} [attributes] Attributes to set on an element
|
|
* @return {HTMLElement} Newly created element
|
|
*/
|
|
function makeElement(tagName, attributes) {
|
|
var el = fabric.document.createElement(tagName);
|
|
for (var prop in attributes) {
|
|
if (prop === 'class') {
|
|
el.className = attributes[prop];
|
|
}
|
|
else if (prop === 'for') {
|
|
el.htmlFor = attributes[prop];
|
|
}
|
|
else {
|
|
el.setAttribute(prop, attributes[prop]);
|
|
}
|
|
}
|
|
return el;
|
|
}
|
|
|
|
/**
|
|
* Adds class to an element
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element Element to add class to
|
|
* @param {String} className Class to add to an element
|
|
*/
|
|
function addClass(element, className) {
|
|
if ((' ' + element.className + ' ').indexOf(' ' + className + ' ') === -1) {
|
|
element.className += (element.className ? ' ' : '') + className;
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Wraps element with another element
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element Element to wrap
|
|
* @param {HTMLElement|String} wrapper Element to wrap with
|
|
* @param {Object} [attributes] Attributes to set on a wrapper
|
|
* @return {HTMLElement} wrapper
|
|
*/
|
|
function wrapElement(element, wrapper, attributes) {
|
|
if (typeof wrapper === 'string') {
|
|
wrapper = makeElement(wrapper, attributes);
|
|
}
|
|
if (element.parentNode) {
|
|
element.parentNode.replaceChild(wrapper, element);
|
|
}
|
|
wrapper.appendChild(element);
|
|
return wrapper;
|
|
}
|
|
|
|
/**
|
|
* Returns offset for a given element
|
|
* @function
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element Element to get offset for
|
|
* @return {Object} Object with "left" and "top" properties
|
|
*/
|
|
function getElementOffset(element) {
|
|
// TODO (kangax): need to fix this method
|
|
var valueT = 0, valueL = 0;
|
|
do {
|
|
valueT += element.offsetTop || 0;
|
|
valueL += element.offsetLeft || 0;
|
|
element = element.offsetParent;
|
|
}
|
|
while (element);
|
|
return ({ left: valueL, top: valueT });
|
|
}
|
|
|
|
/**
|
|
* Returns position of a given element
|
|
* @function
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element Element to get offset for
|
|
* @return {Object} position of the given element.
|
|
*/
|
|
var getElementPosition;
|
|
if (fabric.document.defaultView && fabric.document.defaultView.getComputedStyle) {
|
|
getElementPosition = function (element) {
|
|
return fabric.document.defaultView.getComputedStyle(element, null).position;
|
|
};
|
|
}
|
|
else {
|
|
/** @ignore */
|
|
getElementPosition = function (element) {
|
|
var value = element.style.position;
|
|
if (!value && element.currentStyle) value = element.currentStyle.position;
|
|
return value;
|
|
};
|
|
}
|
|
|
|
(function () {
|
|
var style = fabric.document.documentElement.style;
|
|
|
|
var selectProp = 'userSelect' in style
|
|
? 'userSelect'
|
|
: 'MozUserSelect' in style
|
|
? 'MozUserSelect'
|
|
: 'WebkitUserSelect' in style
|
|
? 'WebkitUserSelect'
|
|
: 'KhtmlUserSelect' in style
|
|
? 'KhtmlUserSelect'
|
|
: '';
|
|
|
|
/**
|
|
* Makes element unselectable
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element Element to make unselectable
|
|
* @return {HTMLElement} Element that was passed in
|
|
*/
|
|
function makeElementUnselectable(element) {
|
|
if (typeof element.onselectstart !== 'undefined') {
|
|
element.onselectstart = fabric.util.falseFunction;
|
|
}
|
|
if (selectProp) {
|
|
element.style[selectProp] = 'none';
|
|
}
|
|
else if (typeof element.unselectable === 'string') {
|
|
element.unselectable = 'on';
|
|
}
|
|
return element;
|
|
}
|
|
|
|
/**
|
|
* Makes element selectable
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element Element to make selectable
|
|
* @return {HTMLElement} Element that was passed in
|
|
*/
|
|
function makeElementSelectable(element) {
|
|
if (typeof element.onselectstart !== 'undefined') {
|
|
element.onselectstart = null;
|
|
}
|
|
if (selectProp) {
|
|
element.style[selectProp] = '';
|
|
}
|
|
else if (typeof element.unselectable === 'string') {
|
|
element.unselectable = '';
|
|
}
|
|
return element;
|
|
}
|
|
|
|
fabric.util.makeElementUnselectable = makeElementUnselectable;
|
|
fabric.util.makeElementSelectable = makeElementSelectable;
|
|
})();
|
|
|
|
(function() {
|
|
|
|
/**
|
|
* Inserts a script element with a given url into a document; invokes callback, when that script is finished loading
|
|
* @memberOf fabric.util
|
|
* @param {String} url URL of a script to load
|
|
* @param {Function} callback Callback to execute when script is finished loading
|
|
*/
|
|
function getScript(url, callback) {
|
|
var headEl = fabric.document.getElementsByTagName("head")[0],
|
|
scriptEl = fabric.document.createElement('script'),
|
|
loading = true;
|
|
|
|
/** @ignore */
|
|
scriptEl.onload = /** @ignore */ scriptEl.onreadystatechange = function(e) {
|
|
if (loading) {
|
|
if (typeof this.readyState === 'string' &&
|
|
this.readyState !== 'loaded' &&
|
|
this.readyState !== 'complete') return;
|
|
loading = false;
|
|
callback(e || fabric.window.event);
|
|
scriptEl = scriptEl.onload = scriptEl.onreadystatechange = null;
|
|
}
|
|
};
|
|
scriptEl.src = url;
|
|
headEl.appendChild(scriptEl);
|
|
// causes issue in Opera
|
|
// headEl.removeChild(scriptEl);
|
|
}
|
|
|
|
fabric.util.getScript = getScript;
|
|
})();
|
|
|
|
fabric.util.getById = getById;
|
|
fabric.util.toArray = toArray;
|
|
fabric.util.makeElement = makeElement;
|
|
fabric.util.addClass = addClass;
|
|
fabric.util.wrapElement = wrapElement;
|
|
fabric.util.getElementOffset = getElementOffset;
|
|
fabric.util.getElementPosition = getElementPosition;
|
|
|
|
})();
|
|
|
|
(function(){
|
|
|
|
function addParamToUrl(url, param) {
|
|
return url + (/\?/.test(url) ? '&' : '?') + param;
|
|
}
|
|
|
|
var makeXHR = (function() {
|
|
var factories = [
|
|
function() { return new ActiveXObject("Microsoft.XMLHTTP"); },
|
|
function() { return new ActiveXObject("Msxml2.XMLHTTP"); },
|
|
function() { return new ActiveXObject("Msxml2.XMLHTTP.3.0"); },
|
|
function() { return new XMLHttpRequest(); }
|
|
];
|
|
for (var i = factories.length; i--; ) {
|
|
try {
|
|
var req = factories[i]();
|
|
if (req) {
|
|
return factories[i];
|
|
}
|
|
}
|
|
catch (err) { }
|
|
}
|
|
})();
|
|
|
|
function emptyFn() { }
|
|
|
|
/**
|
|
* Cross-browser abstraction for sending XMLHttpRequest
|
|
* @memberOf fabric.util
|
|
* @param {String} url URL to send XMLHttpRequest to
|
|
* @param {Object} [options] Options object
|
|
* @param {String} [options.method="GET"]
|
|
* @param {Function} options.onComplete Callback to invoke when request is completed
|
|
* @return {XMLHttpRequest} request
|
|
*/
|
|
function request(url, options) {
|
|
|
|
options || (options = { });
|
|
|
|
var method = options.method ? options.method.toUpperCase() : 'GET',
|
|
onComplete = options.onComplete || function() { },
|
|
xhr = makeXHR(),
|
|
body;
|
|
|
|
/** @ignore */
|
|
xhr.onreadystatechange = function() {
|
|
if (xhr.readyState === 4) {
|
|
onComplete(xhr);
|
|
xhr.onreadystatechange = emptyFn;
|
|
}
|
|
};
|
|
|
|
if (method === 'GET') {
|
|
body = null;
|
|
if (typeof options.parameters === 'string') {
|
|
url = addParamToUrl(url, options.parameters);
|
|
}
|
|
}
|
|
|
|
xhr.open(method, url, true);
|
|
|
|
if (method === 'POST' || method === 'PUT') {
|
|
xhr.setRequestHeader('Content-Type', 'application/x-www-form-urlencoded');
|
|
}
|
|
|
|
xhr.send(body);
|
|
return xhr;
|
|
}
|
|
|
|
fabric.util.request = request;
|
|
})();
|
|
|
|
(function() {
|
|
|
|
/**
|
|
* Quadratic easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInQuad(t, b, c, d) {
|
|
return c*(t/=d)*t + b;
|
|
}
|
|
|
|
/**
|
|
* Quadratic easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutQuad(t, b, c, d) {
|
|
return -c *(t/=d)*(t-2) + b;
|
|
}
|
|
|
|
/**
|
|
* Quadratic easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutQuad(t, b, c, d) {
|
|
t /= (d/2);
|
|
if (t < 1) return c/2*t*t + b;
|
|
return -c/2 * ((--t)*(t-2) - 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Cubic easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInCubic(t, b, c, d) {
|
|
return c*(t/=d)*t*t + b;
|
|
}
|
|
|
|
/**
|
|
* Cubic easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutCubic(t, b, c, d) {
|
|
return c*((t=t/d-1)*t*t + 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Cubic easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutCubic(t, b, c, d) {
|
|
t /= d/2;
|
|
if (t < 1) return c/2*t*t*t + b;
|
|
return c/2*((t-=2)*t*t + 2) + b;
|
|
}
|
|
|
|
/**
|
|
* Quartic easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInQuart(t, b, c, d) {
|
|
return c*(t/=d)*t*t*t + b;
|
|
}
|
|
|
|
/**
|
|
* Quartic easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutQuart(t, b, c, d) {
|
|
return -c * ((t=t/d-1)*t*t*t - 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Quartic easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutQuart(t, b, c, d) {
|
|
t /= d/2;
|
|
if (t < 1) return c/2*t*t*t*t + b;
|
|
return -c/2 * ((t-=2)*t*t*t - 2) + b;
|
|
}
|
|
|
|
/**
|
|
* Quintic easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInQuint(t, b, c, d) {
|
|
return c*(t/=d)*t*t*t*t + b;
|
|
}
|
|
|
|
/**
|
|
* Quintic easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutQuint(t, b, c, d) {
|
|
return c*((t=t/d-1)*t*t*t*t + 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Quintic easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutQuint(t, b, c, d) {
|
|
t /= d/2;
|
|
if (t < 1) return c/2*t*t*t*t*t + b;
|
|
return c/2*((t-=2)*t*t*t*t + 2) + b;
|
|
}
|
|
|
|
/**
|
|
* Sinusoidal easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInSine(t, b, c, d) {
|
|
return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
|
|
}
|
|
|
|
/**
|
|
* Sinusoidal easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutSine(t, b, c, d) {
|
|
return c * Math.sin(t/d * (Math.PI/2)) + b;
|
|
}
|
|
|
|
/**
|
|
* Sinusoidal easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutSine(t, b, c, d) {
|
|
return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Exponential easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInExpo(t, b, c, d) {
|
|
return (t===0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
|
|
}
|
|
|
|
/**
|
|
* Exponential easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutExpo(t, b, c, d) {
|
|
return (t===d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Exponential easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutExpo(t, b, c, d) {
|
|
if (t===0) return b;
|
|
if (t===d) return b+c;
|
|
t /= d/2;
|
|
if (t < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
|
|
return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
|
|
}
|
|
|
|
/**
|
|
* Circular easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInCirc(t, b, c, d) {
|
|
return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Circular easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutCirc(t, b, c, d) {
|
|
return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
|
|
}
|
|
|
|
/**
|
|
* Circular easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutCirc(t, b, c, d) {
|
|
t /= d/2;
|
|
if (t < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
|
|
return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Elastic easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInElastic(t, b, c, d) {
|
|
var s=1.70158;var p=0;var a=c;
|
|
if (t===0) return b;
|
|
t /= d;
|
|
if (t===1) return b+c;
|
|
if (!p) p=d*0.3;
|
|
if (a < Math.abs(c)) { a=c; s=p/4; }
|
|
else s = p/(2*Math.PI) * Math.asin (c/a);
|
|
return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
|
|
}
|
|
|
|
/**
|
|
* Elastic easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutElastic(t, b, c, d) {
|
|
var s=1.70158;var p=0;var a=c;
|
|
if (t===0) return b;
|
|
t /= d;
|
|
if (t===1) return b+c;
|
|
if (!p) p=d*0.3;
|
|
if (a < Math.abs(c)) { a=c; s=p/4; }
|
|
else s = p/(2*Math.PI) * Math.asin (c/a);
|
|
return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
|
|
}
|
|
|
|
/**
|
|
* Elastic easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutElastic(t, b, c, d) {
|
|
var s=1.70158;var p=0;var a=c;
|
|
if (t===0) return b;
|
|
t /= d/2;
|
|
if (t===2) return b+c;
|
|
if (!p) p=d*(0.3*1.5);
|
|
if (a < Math.abs(c)) { a=c; s=p/4; }
|
|
else s = p/(2*Math.PI) * Math.asin (c/a);
|
|
if (t < 1) return -0.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
|
|
return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*0.5 + c + b;
|
|
}
|
|
|
|
/**
|
|
* Backwards easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInBack(t, b, c, d, s) {
|
|
if (s === undefined) s = 1.70158;
|
|
return c*(t/=d)*t*((s+1)*t - s) + b;
|
|
}
|
|
|
|
/**
|
|
* Backwards easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutBack(t, b, c, d, s) {
|
|
if (s === undefined) s = 1.70158;
|
|
return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Backwards easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutBack(t, b, c, d, s) {
|
|
if (s === undefined) s = 1.70158;
|
|
t /= d/2;
|
|
if (t < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
|
|
return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
|
|
}
|
|
|
|
/**
|
|
* Bouncing easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInBounce(t, b, c, d) {
|
|
return c - easeOutBounce (d-t, 0, c, d) + b;
|
|
}
|
|
|
|
/**
|
|
* Bouncing easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutBounce(t, b, c, d) {
|
|
if ((t/=d) < (1/2.75)) {
|
|
return c*(7.5625*t*t) + b;
|
|
} else if (t < (2/2.75)) {
|
|
return c*(7.5625*(t-=(1.5/2.75))*t + 0.75) + b;
|
|
} else if (t < (2.5/2.75)) {
|
|
return c*(7.5625*(t-=(2.25/2.75))*t + 0.9375) + b;
|
|
} else {
|
|
return c*(7.5625*(t-=(2.625/2.75))*t + 0.984375) + b;
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Bouncing easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutBounce(t, b, c, d) {
|
|
if (t < d/2) return easeInBounce (t*2, 0, c, d) * 0.5 + b;
|
|
return easeOutBounce (t*2-d, 0, c, d) * 0.5 + c*0.5 + b;
|
|
}
|
|
|
|
/**
|
|
* Easing functions
|
|
* See <a href="http://gizma.com/easing/">Easing Equations by Robert Penner</a>
|
|
* @namespace fabric.util.ease
|
|
*/
|
|
fabric.util.ease = {
|
|
easeInQuad: easeInQuad,
|
|
easeOutQuad: easeOutQuad,
|
|
easeInOutQuad: easeInOutQuad,
|
|
easeInCubic: easeInCubic,
|
|
easeOutCubic: easeOutCubic,
|
|
easeInOutCubic: easeInOutCubic,
|
|
easeInQuart: easeInQuart,
|
|
easeOutQuart: easeOutQuart,
|
|
easeInOutQuart: easeInOutQuart,
|
|
easeInQuint: easeInQuint,
|
|
easeOutQuint: easeOutQuint,
|
|
easeInOutQuint: easeInOutQuint,
|
|
easeInSine: easeInSine,
|
|
easeOutSine: easeOutSine,
|
|
easeInOutSine: easeInOutSine,
|
|
easeInExpo: easeInExpo,
|
|
easeOutExpo: easeOutExpo,
|
|
easeInOutExpo: easeInOutExpo,
|
|
easeInCirc: easeInCirc,
|
|
easeOutCirc: easeOutCirc,
|
|
easeInOutCirc: easeInOutCirc,
|
|
easeInElastic: easeInElastic,
|
|
easeOutElastic: easeOutElastic,
|
|
easeInOutElastic: easeInOutElastic,
|
|
easeInBack: easeInBack,
|
|
easeOutBack: easeOutBack,
|
|
easeInOutBack: easeInOutBack,
|
|
easeInBounce: easeInBounce,
|
|
easeOutBounce: easeOutBounce,
|
|
easeInOutBounce: easeInOutBounce
|
|
};
|
|
|
|
}());
|
|
|
|
(function(global) {
|
|
|
|
"use strict";
|
|
|
|
/**
|
|
* @name fabric
|
|
* @namespace
|
|
*/
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
extend = fabric.util.object.extend,
|
|
capitalize = fabric.util.string.capitalize,
|
|
clone = fabric.util.object.clone,
|
|
multiplyTransformMatrices = fabric.util.multiplyTransformMatrices;
|
|
|
|
fabric.SHARED_ATTRIBUTES = [
|
|
"transform",
|
|
"fill", "fill-rule", "fill-opacity",
|
|
"opacity",
|
|
"stroke", "stroke-dasharray", "stroke-linecap", "stroke-linejoin", "stroke-miterlimit", "stroke-width"
|
|
];
|
|
|
|
var attributesMap = {
|
|
'cx': 'left',
|
|
'x': 'left',
|
|
'cy': 'top',
|
|
'y': 'top',
|
|
'r': 'radius',
|
|
'fill-opacity': 'opacity',
|
|
'fill-rule': 'fillRule',
|
|
'stroke-width': 'strokeWidth',
|
|
'stroke-dasharray': 'strokeDashArray',
|
|
'stroke-linecap': 'strokeLineCap',
|
|
'stroke-linejoin': 'strokeLineJoin',
|
|
'stroke-miterlimit':'strokeMiterLimit',
|
|
'transform': 'transformMatrix',
|
|
'text-decoration': 'textDecoration',
|
|
'font-size': 'fontSize',
|
|
'font-weight': 'fontWeight',
|
|
'font-style': 'fontStyle',
|
|
'font-family': 'fontFamily'
|
|
};
|
|
|
|
function normalizeAttr(attr) {
|
|
// transform attribute names
|
|
if (attr in attributesMap) {
|
|
return attributesMap[attr];
|
|
}
|
|
return attr;
|
|
}
|
|
|
|
function normalizeValue(attr, value, parentAttributes) {
|
|
var isArray;
|
|
|
|
if ((attr === 'fill' || attr === 'stroke') && value === 'none') {
|
|
value = '';
|
|
}
|
|
else if (attr === 'fillRule') {
|
|
value = (value === 'evenodd') ? 'destination-over' : value;
|
|
}
|
|
else if (attr === 'strokeDashArray') {
|
|
value = value.replace(/,/g, ' ').split(/\s+/);
|
|
}
|
|
else if (attr === 'transformMatrix') {
|
|
if (parentAttributes && parentAttributes.transformMatrix) {
|
|
value = multiplyTransformMatrices(
|
|
parentAttributes.transformMatrix, fabric.parseTransformAttribute(value));
|
|
}
|
|
value = fabric.parseTransformAttribute(value);
|
|
}
|
|
|
|
isArray = Object.prototype.toString.call(value) === '[object Array]';
|
|
|
|
// TODO: need to normalize em, %, pt, etc. to px (!)
|
|
var parsed = isArray ? value.map(parseFloat) : parseFloat(value);
|
|
|
|
return (!isArray && isNaN(parsed) ? value : parsed);
|
|
}
|
|
|
|
/**
|
|
* Returns an object of attributes' name/value, given element and an array of attribute names;
|
|
* Parses parent "g" nodes recursively upwards.
|
|
* @static
|
|
* @memberOf fabric
|
|
* @param {DOMElement} element Element to parse
|
|
* @param {Array} attributes Array of attributes to parse
|
|
* @return {Object} object containing parsed attributes' names/values
|
|
*/
|
|
function parseAttributes(element, attributes) {
|
|
|
|
if (!element) {
|
|
return;
|
|
}
|
|
|
|
var value,
|
|
parentAttributes = { };
|
|
|
|
// if there's a parent container (`g` node), parse its attributes recursively upwards
|
|
if (element.parentNode && /^g$/i.test(element.parentNode.nodeName)) {
|
|
parentAttributes = fabric.parseAttributes(element.parentNode, attributes);
|
|
}
|
|
|
|
var ownAttributes = attributes.reduce(function(memo, attr) {
|
|
value = element.getAttribute(attr);
|
|
if (value) {
|
|
attr = normalizeAttr(attr);
|
|
value = normalizeValue(attr, value, parentAttributes);
|
|
|
|
memo[attr] = value;
|
|
}
|
|
return memo;
|
|
}, { });
|
|
|
|
// add values parsed from style, which take precedence over attributes
|
|
// (see: http://www.w3.org/TR/SVG/styling.html#UsingPresentationAttributes)
|
|
|
|
ownAttributes = extend(ownAttributes,
|
|
extend(getGlobalStylesForElement(element), fabric.parseStyleAttribute(element)));
|
|
return extend(parentAttributes, ownAttributes);
|
|
}
|
|
|
|
/**
|
|
* Parses "transform" attribute, returning an array of values
|
|
* @static
|
|
* @function
|
|
* @memberOf fabric
|
|
* @param attributeValue {String} string containing attribute value
|
|
* @return {Array} array of 6 elements representing transformation matrix
|
|
*/
|
|
fabric.parseTransformAttribute = (function() {
|
|
function rotateMatrix(matrix, args) {
|
|
var angle = args[0];
|
|
|
|
matrix[0] = Math.cos(angle);
|
|
matrix[1] = Math.sin(angle);
|
|
matrix[2] = -Math.sin(angle);
|
|
matrix[3] = Math.cos(angle);
|
|
}
|
|
|
|
function scaleMatrix(matrix, args) {
|
|
var multiplierX = args[0],
|
|
multiplierY = (args.length === 2) ? args[1] : args[0];
|
|
|
|
matrix[0] = multiplierX;
|
|
matrix[3] = multiplierY;
|
|
}
|
|
|
|
function skewXMatrix(matrix, args) {
|
|
matrix[2] = args[0];
|
|
}
|
|
|
|
function skewYMatrix(matrix, args) {
|
|
matrix[1] = args[0];
|
|
}
|
|
|
|
function translateMatrix(matrix, args) {
|
|
matrix[4] = args[0];
|
|
if (args.length === 2) {
|
|
matrix[5] = args[1];
|
|
}
|
|
}
|
|
|
|
// identity matrix
|
|
var iMatrix = [
|
|
1, // a
|
|
0, // b
|
|
0, // c
|
|
1, // d
|
|
0, // e
|
|
0 // f
|
|
],
|
|
|
|
// == begin transform regexp
|
|
number = '(?:[-+]?\\d+(?:\\.\\d+)?(?:e[-+]?\\d+)?)',
|
|
comma_wsp = '(?:\\s+,?\\s*|,\\s*)',
|
|
|
|
skewX = '(?:(skewX)\\s*\\(\\s*(' + number + ')\\s*\\))',
|
|
skewY = '(?:(skewY)\\s*\\(\\s*(' + number + ')\\s*\\))',
|
|
rotate = '(?:(rotate)\\s*\\(\\s*(' + number + ')(?:' + comma_wsp + '(' + number + ')' + comma_wsp + '(' + number + '))?\\s*\\))',
|
|
scale = '(?:(scale)\\s*\\(\\s*(' + number + ')(?:' + comma_wsp + '(' + number + '))?\\s*\\))',
|
|
translate = '(?:(translate)\\s*\\(\\s*(' + number + ')(?:' + comma_wsp + '(' + number + '))?\\s*\\))',
|
|
|
|
matrix = '(?:(matrix)\\s*\\(\\s*' +
|
|
'(' + number + ')' + comma_wsp +
|
|
'(' + number + ')' + comma_wsp +
|
|
'(' + number + ')' + comma_wsp +
|
|
'(' + number + ')' + comma_wsp +
|
|
'(' + number + ')' + comma_wsp +
|
|
'(' + number + ')' +
|
|
'\\s*\\))',
|
|
|
|
transform = '(?:' +
|
|
matrix + '|' +
|
|
translate + '|' +
|
|
scale + '|' +
|
|
rotate + '|' +
|
|
skewX + '|' +
|
|
skewY +
|
|
')',
|
|
|
|
transforms = '(?:' + transform + '(?:' + comma_wsp + transform + ')*' + ')',
|
|
|
|
transform_list = '^\\s*(?:' + transforms + '?)\\s*$',
|
|
|
|
// http://www.w3.org/TR/SVG/coords.html#TransformAttribute
|
|
reTransformList = new RegExp(transform_list),
|
|
// == end transform regexp
|
|
|
|
reTransform = new RegExp(transform, 'g');
|
|
|
|
return function(attributeValue) {
|
|
|
|
// start with identity matrix
|
|
var matrix = iMatrix.concat();
|
|
var matrices = [ ];
|
|
|
|
// return if no argument was given or
|
|
// an argument does not match transform attribute regexp
|
|
if (!attributeValue || (attributeValue && !reTransformList.test(attributeValue))) {
|
|
return matrix;
|
|
}
|
|
|
|
attributeValue.replace(reTransform, function(match) {
|
|
|
|
var m = new RegExp(transform).exec(match).filter(function (match) {
|
|
return (match !== '' && match != null);
|
|
}),
|
|
operation = m[1],
|
|
args = m.slice(2).map(parseFloat);
|
|
|
|
switch(operation) {
|
|
case 'translate':
|
|
translateMatrix(matrix, args);
|
|
break;
|
|
case 'rotate':
|
|
rotateMatrix(matrix, args);
|
|
break;
|
|
case 'scale':
|
|
scaleMatrix(matrix, args);
|
|
break;
|
|
case 'skewX':
|
|
skewXMatrix(matrix, args);
|
|
break;
|
|
case 'skewY':
|
|
skewYMatrix(matrix, args);
|
|
break;
|
|
case 'matrix':
|
|
matrix = args;
|
|
break;
|
|
}
|
|
|
|
// snapshot current matrix into matrices array
|
|
matrices.push(matrix.concat());
|
|
// reset
|
|
matrix = iMatrix.concat();
|
|
});
|
|
|
|
var combinedMatrix = matrices[0];
|
|
while (matrices.length > 1) {
|
|
matrices.shift();
|
|
combinedMatrix = fabric.util.multiplyTransformMatrices(combinedMatrix, matrices[0]);
|
|
}
|
|
return combinedMatrix;
|
|
};
|
|
})();
|
|
|
|
/**
|
|
* Parses "points" attribute, returning an array of values
|
|
* @static
|
|
* @memberOf fabric
|
|
* @param points {String} points attribute string
|
|
* @return {Array} array of points
|
|
*/
|
|
function parsePointsAttribute(points) {
|
|
|
|
// points attribute is required and must not be empty
|
|
if (!points) return null;
|
|
|
|
points = points.trim();
|
|
var asPairs = points.indexOf(',') > -1;
|
|
|
|
points = points.split(/\s+/);
|
|
var parsedPoints = [ ], i, len;
|
|
|
|
// points could look like "10,20 30,40" or "10 20 30 40"
|
|
if (asPairs) {
|
|
i = 0;
|
|
len = points.length;
|
|
for (; i < len; i++) {
|
|
var pair = points[i].split(',');
|
|
parsedPoints.push({ x: parseFloat(pair[0]), y: parseFloat(pair[1]) });
|
|
}
|
|
}
|
|
else {
|
|
i = 0;
|
|
len = points.length;
|
|
for (; i < len; i+=2) {
|
|
parsedPoints.push({ x: parseFloat(points[i]), y: parseFloat(points[i+1]) });
|
|
}
|
|
}
|
|
|
|
// odd number of points is an error
|
|
if (parsedPoints.length % 2 !== 0) {
|
|
// return null;
|
|
}
|
|
|
|
return parsedPoints;
|
|
}
|
|
|
|
function parseFontDeclaration(value, oStyle) {
|
|
|
|
// TODO: support non-px font size
|
|
var match = value.match(/(normal|italic)?\s*(normal|small-caps)?\s*(normal|bold|bolder|lighter|100|200|300|400|500|600|700|800|900)?\s*(\d+)px\s+(.*)/);
|
|
|
|
if (!match) return;
|
|
|
|
var fontStyle = match[1];
|
|
// Font variant is not used
|
|
// var fontVariant = match[2];
|
|
var fontWeight = match[3];
|
|
var fontSize = match[4];
|
|
var fontFamily = match[5];
|
|
|
|
if (fontStyle) {
|
|
oStyle.fontStyle = fontStyle;
|
|
}
|
|
if (fontWeight) {
|
|
oStyle.fontSize = isNaN(parseFloat(fontWeight)) ? fontWeight : parseFloat(fontWeight);
|
|
}
|
|
if (fontSize) {
|
|
oStyle.fontSize = parseFloat(fontSize);
|
|
}
|
|
if (fontFamily) {
|
|
oStyle.fontFamily = fontFamily;
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Parses "style" attribute, retuning an object with values
|
|
* @static
|
|
* @memberOf fabric
|
|
* @param {SVGElement} element Element to parse
|
|
* @return {Object} Objects with values parsed from style attribute of an element
|
|
*/
|
|
function parseStyleAttribute(element) {
|
|
var oStyle = { },
|
|
style = element.getAttribute('style'),
|
|
attr, value;
|
|
|
|
if (!style) return oStyle;
|
|
|
|
if (typeof style === 'string') {
|
|
style.replace(/;$/, '').split(';').forEach(function (chunk) {
|
|
var pair = chunk.split(':');
|
|
|
|
attr = normalizeAttr(pair[0].trim().toLowerCase());
|
|
value = normalizeValue(attr, pair[1].trim());
|
|
|
|
if (attr === 'font') {
|
|
parseFontDeclaration(value, oStyle);
|
|
}
|
|
else {
|
|
oStyle[attr] = value;
|
|
}
|
|
});
|
|
}
|
|
else {
|
|
for (var prop in style) {
|
|
if (typeof style[prop] === 'undefined') continue;
|
|
|
|
attr = normalizeAttr(prop.toLowerCase());
|
|
value = normalizeValue(attr, style[prop]);
|
|
|
|
if (attr === 'font') {
|
|
parseFontDeclaration(value, oStyle);
|
|
}
|
|
else {
|
|
oStyle[attr] = value;
|
|
}
|
|
}
|
|
}
|
|
|
|
return oStyle;
|
|
}
|
|
|
|
function resolveGradients(instances) {
|
|
for (var i = instances.length; i--; ) {
|
|
var instanceFillValue = instances[i].get('fill');
|
|
|
|
if (/^url\(/.test(instanceFillValue)) {
|
|
|
|
var gradientId = instanceFillValue.slice(5, instanceFillValue.length - 1);
|
|
|
|
if (fabric.gradientDefs[gradientId]) {
|
|
instances[i].set('fill',
|
|
fabric.Gradient.fromElement(fabric.gradientDefs[gradientId], instances[i]));
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Transforms an array of svg elements to corresponding fabric.* instances
|
|
* @static
|
|
* @memberOf fabric
|
|
* @param {Array} elements Array of elements to parse
|
|
* @param {Function} callback Being passed an array of fabric instances (transformed from SVG elements)
|
|
* @param {Object} [options] Options object
|
|
* @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created.
|
|
*/
|
|
function parseElements(elements, callback, options, reviver) {
|
|
var instances = new Array(elements.length), i = elements.length;
|
|
|
|
function checkIfDone() {
|
|
if (--i === 0) {
|
|
instances = instances.filter(function(el) {
|
|
return el != null;
|
|
});
|
|
resolveGradients(instances);
|
|
callback(instances);
|
|
}
|
|
}
|
|
|
|
for (var index = 0, el, len = elements.length; index < len; index++) {
|
|
el = elements[index];
|
|
var klass = fabric[capitalize(el.tagName)];
|
|
if (klass && klass.fromElement) {
|
|
try {
|
|
if (klass.async) {
|
|
klass.fromElement(el, (function(index, el) {
|
|
return function(obj) {
|
|
reviver && reviver(el, obj);
|
|
instances.splice(index, 0, obj);
|
|
checkIfDone();
|
|
};
|
|
})(index, el), options);
|
|
}
|
|
else {
|
|
var obj = klass.fromElement(el, options);
|
|
reviver && reviver(el, obj);
|
|
instances.splice(index, 0, obj);
|
|
checkIfDone();
|
|
}
|
|
}
|
|
catch(err) {
|
|
fabric.log(err);
|
|
}
|
|
}
|
|
else {
|
|
checkIfDone();
|
|
}
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Returns CSS rules for a given SVG document
|
|
* @static
|
|
* @function
|
|
* @memberOf fabric
|
|
* @param {SVGDocument} doc SVG document to parse
|
|
* @return {Object} CSS rules of this document
|
|
*/
|
|
function getCSSRules(doc) {
|
|
var styles = doc.getElementsByTagName('style'),
|
|
allRules = { },
|
|
rules;
|
|
|
|
// very crude parsing of style contents
|
|
for (var i = 0, len = styles.length; i < len; i++) {
|
|
var styleContents = styles[0].textContent;
|
|
|
|
// remove comments
|
|
styleContents = styleContents.replace(/\/\*[\s\S]*?\*\//g, '');
|
|
|
|
rules = styleContents.match(/[^{]*\{[\s\S]*?\}/g);
|
|
rules = rules.map(function(rule) { return rule.trim(); });
|
|
|
|
rules.forEach(function(rule) {
|
|
var match = rule.match(/([\s\S]*?)\s*\{([^}]*)\}/);
|
|
rule = match[1];
|
|
var declaration = match[2].trim(),
|
|
propertyValuePairs = declaration.replace(/;$/, '').split(/\s*;\s*/);
|
|
|
|
if (!allRules[rule]) {
|
|
allRules[rule] = { };
|
|
}
|
|
|
|
for (var i = 0, len = propertyValuePairs.length; i < len; i++) {
|
|
var pair = propertyValuePairs[i].split(/\s*:\s*/),
|
|
property = pair[0],
|
|
value = pair[1];
|
|
|
|
allRules[rule][property] = value;
|
|
}
|
|
});
|
|
}
|
|
|
|
return allRules;
|
|
}
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function getGlobalStylesForElement(element) {
|
|
var nodeName = element.nodeName,
|
|
className = element.getAttribute('class'),
|
|
id = element.getAttribute('id'),
|
|
styles = { };
|
|
|
|
for (var rule in fabric.cssRules) {
|
|
var ruleMatchesElement = (className && new RegExp('^\\.' + className).test(rule)) ||
|
|
(id && new RegExp('^#' + id).test(rule)) ||
|
|
(new RegExp('^' + nodeName).test(rule));
|
|
|
|
if (ruleMatchesElement) {
|
|
for (var property in fabric.cssRules[rule]) {
|
|
styles[property] = fabric.cssRules[rule][property];
|
|
}
|
|
}
|
|
}
|
|
|
|
return styles;
|
|
}
|
|
|
|
/**
|
|
* Parses an SVG document, converts it to an array of corresponding fabric.* instances and passes them to a callback
|
|
* @static
|
|
* @function
|
|
* @memberOf fabric
|
|
* @param {SVGDocument} doc SVG document to parse
|
|
* @param {Function} callback Callback to call when parsing is finished; It's being passed an array of elements (parsed from a document).
|
|
* @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created.
|
|
*/
|
|
fabric.parseSVGDocument = (function() {
|
|
|
|
var reAllowedSVGTagNames = /^(path|circle|polygon|polyline|ellipse|rect|line|image|text)$/;
|
|
|
|
// http://www.w3.org/TR/SVG/coords.html#ViewBoxAttribute
|
|
// \d doesn't quite cut it (as we need to match an actual float number)
|
|
|
|
// matches, e.g.: +14.56e-12, etc.
|
|
var reNum = '(?:[-+]?\\d+(?:\\.\\d+)?(?:e[-+]?\\d+)?)';
|
|
|
|
var reViewBoxAttrValue = new RegExp(
|
|
'^' +
|
|
'\\s*(' + reNum + '+)\\s*,?' +
|
|
'\\s*(' + reNum + '+)\\s*,?' +
|
|
'\\s*(' + reNum + '+)\\s*,?' +
|
|
'\\s*(' + reNum + '+)\\s*' +
|
|
'$'
|
|
);
|
|
|
|
function hasAncestorWithNodeName(element, nodeName) {
|
|
while (element && (element = element.parentNode)) {
|
|
if (nodeName.test(element.nodeName)) {
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
|
|
return function(doc, callback, reviver) {
|
|
if (!doc) return;
|
|
|
|
var startTime = new Date(),
|
|
descendants = fabric.util.toArray(doc.getElementsByTagName('*'));
|
|
|
|
if (descendants.length === 0) {
|
|
// we're likely in node, where "o3-xml" library fails to gEBTN("*")
|
|
// https://github.com/ajaxorg/node-o3-xml/issues/21
|
|
descendants = doc.selectNodes("//*[name(.)!='svg']");
|
|
var arr = [ ];
|
|
for (var i = 0, len = descendants.length; i < len; i++) {
|
|
arr[i] = descendants[i];
|
|
}
|
|
descendants = arr;
|
|
}
|
|
|
|
var elements = descendants.filter(function(el) {
|
|
return reAllowedSVGTagNames.test(el.tagName) &&
|
|
!hasAncestorWithNodeName(el, /^(?:pattern|defs)$/); // http://www.w3.org/TR/SVG/struct.html#DefsElement
|
|
});
|
|
|
|
if (!elements || (elements && !elements.length)) return;
|
|
|
|
var viewBoxAttr = doc.getAttribute('viewBox'),
|
|
widthAttr = doc.getAttribute('width'),
|
|
heightAttr = doc.getAttribute('height'),
|
|
width = null,
|
|
height = null,
|
|
minX,
|
|
minY;
|
|
|
|
if (viewBoxAttr && (viewBoxAttr = viewBoxAttr.match(reViewBoxAttrValue))) {
|
|
minX = parseInt(viewBoxAttr[1], 10);
|
|
minY = parseInt(viewBoxAttr[2], 10);
|
|
width = parseInt(viewBoxAttr[3], 10);
|
|
height = parseInt(viewBoxAttr[4], 10);
|
|
}
|
|
|
|
// values of width/height attributes overwrite those extracted from viewbox attribute
|
|
width = widthAttr ? parseFloat(widthAttr) : width;
|
|
height = heightAttr ? parseFloat(heightAttr) : height;
|
|
|
|
var options = {
|
|
width: width,
|
|
height: height
|
|
};
|
|
|
|
fabric.gradientDefs = fabric.getGradientDefs(doc);
|
|
fabric.cssRules = getCSSRules(doc);
|
|
|
|
// Precedence of rules: style > class > attribute
|
|
|
|
fabric.parseElements(elements, function(instances) {
|
|
fabric.documentParsingTime = new Date() - startTime;
|
|
if (callback) {
|
|
callback(instances, options);
|
|
}
|
|
}, clone(options), reviver);
|
|
};
|
|
})();
|
|
|
|
/**
|
|
* Used for caching SVG documents (loaded via `fabric.Canvas#loadSVGFromURL`)
|
|
* @namespace
|
|
*/
|
|
var svgCache = {
|
|
|
|
/**
|
|
* @param {String} name
|
|
* @param {Function} callback
|
|
*/
|
|
has: function (name, callback) {
|
|
callback(false);
|
|
},
|
|
|
|
/**
|
|
* @param {String} url
|
|
* @param {Function} callback
|
|
*/
|
|
get: function () {
|
|
/* NOOP */
|
|
},
|
|
|
|
/**
|
|
* @param {String} url
|
|
* @param {Object} object
|
|
*/
|
|
set: function () {
|
|
/* NOOP */
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Takes url corresponding to an SVG document, and parses it into a set of fabric objects. Note that SVG is fetched via XMLHttpRequest, so it needs to conform to SOP (Same Origin Policy)
|
|
* @memberof fabric
|
|
* @param {String} url
|
|
* @param {Function} callback
|
|
* @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created.
|
|
*/
|
|
function loadSVGFromURL(url, callback, reviver) {
|
|
|
|
url = url.replace(/^\n\s*/, '').trim();
|
|
|
|
svgCache.has(url, function (hasUrl) {
|
|
if (hasUrl) {
|
|
svgCache.get(url, function (value) {
|
|
var enlivedRecord = _enlivenCachedObject(value);
|
|
callback(enlivedRecord.objects, enlivedRecord.options);
|
|
});
|
|
}
|
|
else {
|
|
new fabric.util.request(url, {
|
|
method: 'get',
|
|
onComplete: onComplete
|
|
});
|
|
}
|
|
});
|
|
|
|
function onComplete(r) {
|
|
|
|
var xml = r.responseXML;
|
|
if (!xml.documentElement && fabric.window.ActiveXObject && r.responseText) {
|
|
xml = new ActiveXObject('Microsoft.XMLDOM');
|
|
xml.async = 'false';
|
|
//IE chokes on DOCTYPE
|
|
xml.loadXML(r.responseText.replace(/<!DOCTYPE[\s\S]*?(\[[\s\S]*\])*?>/i,''));
|
|
}
|
|
if (!xml.documentElement) return;
|
|
|
|
fabric.parseSVGDocument(xml.documentElement, function (results, options) {
|
|
svgCache.set(url, {
|
|
objects: fabric.util.array.invoke(results, 'toObject'),
|
|
options: options
|
|
});
|
|
callback(results, options);
|
|
}, reviver);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function _enlivenCachedObject(cachedObject) {
|
|
|
|
var objects = cachedObject.objects,
|
|
options = cachedObject.options;
|
|
|
|
objects = objects.map(function (o) {
|
|
return fabric[capitalize(o.type)].fromObject(o);
|
|
});
|
|
|
|
return ({ objects: objects, options: options });
|
|
}
|
|
|
|
/**
|
|
* Takes string corresponding to an SVG document, and parses it into a set of fabric objects
|
|
* @memberof fabric
|
|
* @param {String} string
|
|
* @param {Function} callback
|
|
* @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created.
|
|
*/
|
|
function loadSVGFromString(string, callback, reviver) {
|
|
string = string.trim();
|
|
var doc;
|
|
if (typeof DOMParser !== 'undefined') {
|
|
var parser = new DOMParser();
|
|
if (parser && parser.parseFromString) {
|
|
doc = parser.parseFromString(string, 'text/xml');
|
|
}
|
|
}
|
|
else if (fabric.window.ActiveXObject) {
|
|
doc = new ActiveXObject('Microsoft.XMLDOM');
|
|
doc.async = 'false';
|
|
//IE chokes on DOCTYPE
|
|
doc.loadXML(string.replace(/<!DOCTYPE[\s\S]*?(\[[\s\S]*\])*?>/i,''));
|
|
}
|
|
|
|
fabric.parseSVGDocument(doc.documentElement, function (results, options) {
|
|
callback(results, options);
|
|
}, reviver);
|
|
}
|
|
|
|
/**
|
|
* Creates markup containing SVG font faces
|
|
* @param {Array} objects Array of fabric objects
|
|
* @return {String}
|
|
*/
|
|
function createSVGFontFacesMarkup(objects) {
|
|
var markup = '';
|
|
|
|
for (var i = 0, len = objects.length; i < len; i++) {
|
|
if (objects[i].type !== 'text' || !objects[i].path) continue;
|
|
|
|
markup += [
|
|
'@font-face {',
|
|
'font-family: ', objects[i].fontFamily, '; ',
|
|
'src: url(\'', objects[i].path, '\')',
|
|
'}'
|
|
].join('');
|
|
}
|
|
|
|
if (markup) {
|
|
markup = [
|
|
'<style type="text/css">',
|
|
'<![CDATA[',
|
|
markup,
|
|
']]>',
|
|
'</style>'
|
|
].join('');
|
|
}
|
|
|
|
return markup;
|
|
}
|
|
|
|
/**
|
|
* Creates markup containing SVG referenced elements like patterns, gradients etc.
|
|
* @param {fabric.Canvas} canvas instance of fabric.Canvas
|
|
* @return {String}
|
|
*/
|
|
function createSVGRefElementsMarkup(canvas) {
|
|
var markup = '';
|
|
|
|
if (canvas.backgroundColor && canvas.backgroundColor.source) {
|
|
markup = [
|
|
'<pattern x="0" y="0" id="backgroundColorPattern" ',
|
|
'width="', canvas.backgroundColor.source.width,
|
|
'" height="', canvas.backgroundColor.source.height,
|
|
'" patternUnits="userSpaceOnUse">',
|
|
'<image x="0" y="0" ',
|
|
'width="', canvas.backgroundColor.source.width,
|
|
'" height="', canvas.backgroundColor.source.height,
|
|
'" xlink:href="', canvas.backgroundColor.source.src,
|
|
'"></image></pattern>'
|
|
].join('');
|
|
}
|
|
|
|
return markup;
|
|
}
|
|
|
|
extend(fabric, {
|
|
|
|
parseAttributes: parseAttributes,
|
|
parseElements: parseElements,
|
|
parseStyleAttribute: parseStyleAttribute,
|
|
parsePointsAttribute: parsePointsAttribute,
|
|
getCSSRules: getCSSRules,
|
|
|
|
loadSVGFromURL: loadSVGFromURL,
|
|
loadSVGFromString: loadSVGFromString,
|
|
|
|
createSVGFontFacesMarkup: createSVGFontFacesMarkup,
|
|
createSVGRefElementsMarkup: createSVGRefElementsMarkup
|
|
});
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
(function() {
|
|
|
|
function getColorStop(el) {
|
|
var style = el.getAttribute('style'),
|
|
offset = el.getAttribute('offset'),
|
|
color, opacity;
|
|
|
|
// convert percents to absolute values
|
|
offset = parseFloat(offset) / (/%$/.test(offset) ? 100 : 1);
|
|
|
|
if (style) {
|
|
var keyValuePairs = style.split(/\s*;\s*/);
|
|
|
|
if (keyValuePairs[keyValuePairs.length-1] === '') {
|
|
keyValuePairs.pop();
|
|
}
|
|
|
|
for (var i = keyValuePairs.length; i--; ) {
|
|
|
|
var split = keyValuePairs[i].split(/\s*:\s*/),
|
|
key = split[0].trim(),
|
|
value = split[1].trim();
|
|
|
|
if (key === 'stop-color') {
|
|
color = value;
|
|
}
|
|
else if (key === 'stop-opacity') {
|
|
opacity = value;
|
|
}
|
|
}
|
|
}
|
|
|
|
if (!color) {
|
|
color = el.getAttribute('stop-color');
|
|
}
|
|
if (!opacity) {
|
|
opacity = el.getAttribute('stop-opacity');
|
|
}
|
|
|
|
// convert rgba color to rgb color - alpha value has no affect in svg
|
|
color = new fabric.Color(color).toRgb();
|
|
|
|
return {
|
|
offset: offset,
|
|
color: color,
|
|
opacity: opacity
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Gradient class
|
|
* @class fabric.Gradient
|
|
*/
|
|
fabric.Gradient = fabric.util.createClass(/** @lends fabric.Gradient.prototype */ {
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} [options] Options object with type, coords, gradientUnits and colorStops
|
|
* @return {fabric.Gradient} thisArg
|
|
*/
|
|
initialize: function(options) {
|
|
options || (options = { });
|
|
|
|
var coords = { };
|
|
|
|
this.id = fabric.Object.__uid++;
|
|
this.type = options.type || 'linear';
|
|
|
|
coords = {
|
|
x1: options.coords.x1 || 0,
|
|
y1: options.coords.y1 || 0,
|
|
x2: options.coords.x2 || 0,
|
|
y2: options.coords.y2 || 0
|
|
};
|
|
|
|
if (this.type === 'radial') {
|
|
coords.r1 = options.coords.r1 || 0;
|
|
coords.r2 = options.coords.r2 || 0;
|
|
}
|
|
|
|
this.coords = coords;
|
|
this.gradientUnits = options.gradientUnits || 'objectBoundingBox';
|
|
this.colorStops = options.colorStops.slice();
|
|
},
|
|
|
|
/**
|
|
* Adds another colorStop
|
|
* @param {Object} colorStop Object with offset and color
|
|
* @return {fabric.Gradient} thisArg
|
|
*/
|
|
addColorStop: function(colorStop) {
|
|
for (var position in colorStop) {
|
|
var color = new fabric.Color(colorStop[position]);
|
|
this.colorStops.push({offset: position, color: color.toRgb(), opacity: color.getAlpha()});
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of a gradient
|
|
* @return {Object}
|
|
*/
|
|
toObject: function() {
|
|
return {
|
|
type: this.type,
|
|
coords: this.coords,
|
|
gradientUnits: this.gradientUnits,
|
|
colorStops: this.colorStops
|
|
};
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns SVG representation of an gradient
|
|
* @param {Object} object Object to create a gradient for
|
|
* @param {Boolean} normalize Whether coords should be normalized
|
|
* @return {String} SVG representation of an gradient (linear/radial)
|
|
*/
|
|
toSVG: function(object, normalize) {
|
|
var coords = fabric.util.object.clone(this.coords),
|
|
markup;
|
|
|
|
// colorStops must be sorted ascending
|
|
this.colorStops.sort(function(a, b) {
|
|
return a.offset - b.offset;
|
|
});
|
|
|
|
if (normalize && this.gradientUnits === 'userSpaceOnUse') {
|
|
coords.x1 += object.width / 2;
|
|
coords.y1 += object.height / 2;
|
|
coords.x2 += object.width / 2;
|
|
coords.y2 += object.height / 2;
|
|
}
|
|
else if (this.gradientUnits === 'objectBoundingBox') {
|
|
_convertValuesToPercentUnits(object, coords);
|
|
}
|
|
|
|
if (this.type === 'linear') {
|
|
markup = [
|
|
'<linearGradient ',
|
|
'id="SVGID_', this.id,
|
|
'" gradientUnits="', this.gradientUnits,
|
|
'" x1="', coords.x1,
|
|
'" y1="', coords.y1,
|
|
'" x2="', coords.x2,
|
|
'" y2="', coords.y2,
|
|
'">'
|
|
];
|
|
}
|
|
else if (this.type === 'radial') {
|
|
markup = [
|
|
'<radialGradient ',
|
|
'id="SVGID_', this.id,
|
|
'" gradientUnits="', this.gradientUnits,
|
|
'" cx="', coords.x2,
|
|
'" cy="', coords.y2,
|
|
'" r="', coords.r2,
|
|
'" fx="', coords.x1,
|
|
'" fy="', coords.y1,
|
|
'">'
|
|
];
|
|
}
|
|
|
|
for (var i = 0; i < this.colorStops.length; i++) {
|
|
markup.push(
|
|
'<stop ',
|
|
'offset="', (this.colorStops[i].offset * 100) + '%',
|
|
'" style="stop-color:', this.colorStops[i].color,
|
|
(this.colorStops[i].opacity ? ';stop-opacity: ' + this.colorStops[i].opacity : ';'),
|
|
'"/>'
|
|
);
|
|
}
|
|
|
|
markup.push((this.type === 'linear' ? '</linearGradient>' : '</radialGradient>'));
|
|
|
|
return markup.join('');
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* Returns an instance of CanvasGradient
|
|
* @param ctx
|
|
* @return {CanvasGradient}
|
|
*/
|
|
toLive: function(ctx) {
|
|
var gradient;
|
|
|
|
if (!this.type) return;
|
|
|
|
if (this.type === 'linear') {
|
|
gradient = ctx.createLinearGradient(
|
|
this.coords.x1, this.coords.y1, this.coords.x2 || ctx.canvas.width, this.coords.y2);
|
|
}
|
|
else if (this.type === 'radial') {
|
|
gradient = ctx.createRadialGradient(
|
|
this.coords.x1, this.coords.y1, this.coords.r1, this.coords.x2, this.coords.y2, this.coords.r2);
|
|
}
|
|
|
|
for (var i = 0; i < this.colorStops.length; i++) {
|
|
var color = this.colorStops[i].color,
|
|
opacity = this.colorStops[i].opacity,
|
|
offset = this.colorStops[i].offset;
|
|
|
|
if (opacity) {
|
|
color = new fabric.Color(color).setAlpha(opacity).toRgba();
|
|
}
|
|
gradient.addColorStop(parseFloat(offset), color);
|
|
}
|
|
|
|
return gradient;
|
|
}
|
|
});
|
|
|
|
fabric.util.object.extend(fabric.Gradient, {
|
|
|
|
/**
|
|
* Returns {@link fabric.Gradient} instance from an SVG element
|
|
* @static
|
|
* @memberof fabric.Gradient
|
|
* @see http://www.w3.org/TR/SVG/pservers.html#LinearGradientElement
|
|
* @see http://www.w3.org/TR/SVG/pservers.html#RadialGradientElement
|
|
*/
|
|
fromElement: function(el, instance) {
|
|
|
|
/**
|
|
* @example:
|
|
*
|
|
* <linearGradient id="linearGrad1">
|
|
* <stop offset="0%" stop-color="white"/>
|
|
* <stop offset="100%" stop-color="black"/>
|
|
* </linearGradient>
|
|
*
|
|
* OR
|
|
*
|
|
* <linearGradient id="linearGrad2">
|
|
* <stop offset="0" style="stop-color:rgb(255,255,255)"/>
|
|
* <stop offset="1" style="stop-color:rgb(0,0,0)"/>
|
|
* </linearGradient>
|
|
*
|
|
* OR
|
|
*
|
|
* <radialGradient id="radialGrad1">
|
|
* <stop offset="0%" stop-color="white" stop-opacity="1" />
|
|
* <stop offset="50%" stop-color="black" stop-opacity="0.5" />
|
|
* <stop offset="100%" stop-color="white" stop-opacity="1" />
|
|
* </radialGradient>
|
|
*
|
|
* OR
|
|
*
|
|
* <radialGradient id="radialGrad2">
|
|
* <stop offset="0" stop-color="rgb(255,255,255)" />
|
|
* <stop offset="0.5" stop-color="rgb(0,0,0)" />
|
|
* <stop offset="1" stop-color="rgb(255,255,255)" />
|
|
* </radialGradient>
|
|
*
|
|
*/
|
|
|
|
var colorStopEls = el.getElementsByTagName('stop'),
|
|
type = (el.nodeName === 'linearGradient' ? 'linear' : 'radial'),
|
|
gradientUnits = el.getAttribute('gradientUnits') || 'objectBoundingBox',
|
|
colorStops = [],
|
|
coords = { };
|
|
|
|
if (type === 'linear') {
|
|
coords = {
|
|
x1: el.getAttribute('x1') || 0,
|
|
y1: el.getAttribute('y1') || 0,
|
|
x2: el.getAttribute('x2') || '100%',
|
|
y2: el.getAttribute('y2') || 0
|
|
};
|
|
}
|
|
else if (type === 'radial') {
|
|
coords = {
|
|
x1: el.getAttribute('fx') || el.getAttribute('cx') || '50%',
|
|
y1: el.getAttribute('fy') || el.getAttribute('cy') || '50%',
|
|
r1: 0,
|
|
x2: el.getAttribute('cx') || '50%',
|
|
y2: el.getAttribute('cy') || '50%',
|
|
r2: el.getAttribute('r') || '50%'
|
|
};
|
|
}
|
|
|
|
for (var i = colorStopEls.length; i--; ) {
|
|
colorStops.push(getColorStop(colorStopEls[i]));
|
|
}
|
|
|
|
_convertPercentUnitsToValues(instance, coords);
|
|
|
|
return new fabric.Gradient({
|
|
type: type,
|
|
coords: coords,
|
|
gradientUnits: gradientUnits,
|
|
colorStops: colorStops
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Returns {@link fabric.Gradient} instance from its object representation
|
|
* @static
|
|
* @param {Object} obj
|
|
* @param {Object} [options] Options object
|
|
* @memberof fabric.Gradient
|
|
*/
|
|
forObject: function(obj, options) {
|
|
options || (options = { });
|
|
_convertPercentUnitsToValues(obj, options);
|
|
return new fabric.Gradient(options);
|
|
}
|
|
});
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function _convertPercentUnitsToValues(object, options) {
|
|
for (var prop in options) {
|
|
if (typeof options[prop] === 'string' && /^\d+%$/.test(options[prop])) {
|
|
var percents = parseFloat(options[prop], 10);
|
|
if (prop === 'x1' || prop === 'x2' || prop === 'r2') {
|
|
options[prop] = fabric.util.toFixed(object.width * percents / 100, 2);
|
|
}
|
|
else if (prop === 'y1' || prop === 'y2') {
|
|
options[prop] = fabric.util.toFixed(object.height * percents / 100, 2);
|
|
}
|
|
}
|
|
// normalize rendering point (should be from top/left corner rather than center of the shape)
|
|
if (prop === 'x1' || prop === 'x2') {
|
|
options[prop] -= fabric.util.toFixed(object.width / 2, 2);
|
|
}
|
|
else if (prop === 'y1' || prop === 'y2') {
|
|
options[prop] -= fabric.util.toFixed(object.height / 2, 2);
|
|
}
|
|
}
|
|
}
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function _convertValuesToPercentUnits(object, options) {
|
|
for (var prop in options) {
|
|
// normalize rendering point (should be from center rather than top/left corner of the shape)
|
|
if (prop === 'x1' || prop === 'x2') {
|
|
options[prop] += fabric.util.toFixed(object.width / 2, 2);
|
|
}
|
|
else if (prop === 'y1' || prop === 'y2') {
|
|
options[prop] += fabric.util.toFixed(object.height / 2, 2);
|
|
}
|
|
// convert to percent units
|
|
if (prop === 'x1' || prop === 'x2' || prop === 'r2') {
|
|
options[prop] = fabric.util.toFixed(options[prop] / object.width * 100, 2) + '%';
|
|
}
|
|
else if (prop === 'y1' || prop === 'y2') {
|
|
options[prop] = fabric.util.toFixed(options[prop] / object.height * 100, 2) + '%';
|
|
}
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Parses an SVG document, returning all of the gradient declarations found in it
|
|
* @static
|
|
* @function
|
|
* @memberOf fabric
|
|
* @param {SVGDocument} doc SVG document to parse
|
|
* @return {Object} Gradient definitions; key corresponds to element id, value -- to gradient definition element
|
|
*/
|
|
function getGradientDefs(doc) {
|
|
var linearGradientEls = doc.getElementsByTagName('linearGradient'),
|
|
radialGradientEls = doc.getElementsByTagName('radialGradient'),
|
|
el, i,
|
|
gradientDefs = { };
|
|
|
|
i = linearGradientEls.length;
|
|
for (; i--; ) {
|
|
el = linearGradientEls[i];
|
|
gradientDefs[el.getAttribute('id')] = el;
|
|
}
|
|
|
|
i = radialGradientEls.length;
|
|
for (; i--; ) {
|
|
el = radialGradientEls[i];
|
|
gradientDefs[el.getAttribute('id')] = el;
|
|
}
|
|
|
|
return gradientDefs;
|
|
}
|
|
|
|
fabric.getGradientDefs = getGradientDefs;
|
|
|
|
})();
|
|
|
|
/**
|
|
* Pattern class
|
|
* @class fabric.Pattern
|
|
*/
|
|
fabric.Pattern = fabric.util.createClass(/** @lends fabric.Pattern.prototype */ {
|
|
|
|
/**
|
|
* Repeat property of a pattern (one of repeat, repeat-x, repeat-y)
|
|
* @type String
|
|
*/
|
|
repeat: 'repeat',
|
|
|
|
/**
|
|
* Pattern horizontal offset from object's left/top corner
|
|
* @type Number
|
|
*/
|
|
offsetX: 0,
|
|
|
|
/**
|
|
* Pattern vertical offset from object's left/top corner
|
|
* @type Number
|
|
*/
|
|
offsetY: 0,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} [options]
|
|
* @return {fabric.Pattern} thisArg
|
|
*/
|
|
initialize: function(options) {
|
|
options || (options = { });
|
|
|
|
if (options.source) {
|
|
this.source = typeof options.source === 'string'
|
|
? new Function(options.source)
|
|
: options.source;
|
|
}
|
|
if (options.repeat) {
|
|
this.repeat = options.repeat;
|
|
}
|
|
if (options.offsetX) {
|
|
this.offsetX = options.offsetX;
|
|
}
|
|
if (options.offsetY) {
|
|
this.offsetY = options.offsetY;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of a pattern
|
|
* @return {Object}
|
|
*/
|
|
toObject: function() {
|
|
|
|
var source;
|
|
|
|
// callback
|
|
if (typeof this.source === 'function') {
|
|
source = String(this.source)
|
|
.match(/function\s+\w*\s*\(.*\)\s+\{([\s\S]*)\}/)[1];
|
|
}
|
|
// <img> element
|
|
else if (typeof this.source.src === 'string') {
|
|
source = this.source.src;
|
|
}
|
|
|
|
return {
|
|
source: source,
|
|
repeat: this.repeat,
|
|
offsetX: this.offsetX,
|
|
offsetY: this.offsetY
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Returns an instance of CanvasPattern
|
|
* @param ctx
|
|
* @return {CanvasPattern}
|
|
*/
|
|
toLive: function(ctx) {
|
|
var source = typeof this.source === 'function' ? this.source() : this.source;
|
|
return ctx.createPattern(source, this.repeat);
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Shadow class
|
|
* @class fabric.Shadow
|
|
*/
|
|
fabric.Shadow = fabric.util.createClass(/** @lends fabric.Shadow.prototype */ {
|
|
|
|
/**
|
|
* Shadow color
|
|
* @type String
|
|
*/
|
|
color: 'rgb(0,0,0)',
|
|
|
|
/**
|
|
* Shadow blur
|
|
* @type Number
|
|
*/
|
|
blur: 0,
|
|
|
|
/**
|
|
* Shadow horizontal offset
|
|
* @type Number
|
|
*/
|
|
offsetX: 0,
|
|
|
|
/**
|
|
* Shadow vertical offset
|
|
* @type Number
|
|
*/
|
|
offsetY: 0,
|
|
|
|
/**
|
|
* Whether the shadow should affect stroke operations
|
|
* @type Boolean
|
|
*/
|
|
affectStroke: false,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param [options] Options object with any of color, blur, offsetX, offsetX properties
|
|
* @return {fabric.Shadow} thisArg
|
|
*/
|
|
initialize: function(options) {
|
|
for (var prop in options) {
|
|
this[prop] = options[prop];
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of a shadow
|
|
* @return {Object}
|
|
*/
|
|
toObject: function() {
|
|
return {
|
|
color: this.color,
|
|
blur: this.blur,
|
|
offsetX: this.offsetX,
|
|
offsetY: this.offsetY
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Returns SVG representation of a shadow
|
|
* @return {String}
|
|
*/
|
|
toSVG: function() {
|
|
|
|
}
|
|
});
|
|
|
|
(function(global) {
|
|
|
|
"use strict";
|
|
|
|
/* Adaptation of work of Kevin Lindsey (kevin@kevlindev.com) */
|
|
|
|
var fabric = global.fabric || (global.fabric = { });
|
|
|
|
if (fabric.Point) {
|
|
fabric.warn('fabric.Point is already defined');
|
|
return;
|
|
}
|
|
|
|
fabric.Point = Point;
|
|
|
|
/**
|
|
* Point class
|
|
* @class fabric.Point
|
|
* @constructor
|
|
* @param {Number} x
|
|
* @param {Number} y
|
|
* @return {fabric.Point} thisArg
|
|
*/
|
|
function Point(x, y) {
|
|
if (arguments.length > 0) {
|
|
this.init(x, y);
|
|
}
|
|
}
|
|
|
|
Point.prototype = /** @lends fabric.Point.prototype */ {
|
|
|
|
constructor: Point,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Number} x left offset
|
|
* @param {Number} y top offset
|
|
*/
|
|
init: function (x, y) {
|
|
this.x = x;
|
|
this.y = y;
|
|
},
|
|
|
|
/**
|
|
* Adds another point to this one and returns another one
|
|
* @param {fabric.Point} that
|
|
* @return {fabric.Point} new Point instance with added values
|
|
*/
|
|
add: function (that) {
|
|
return new Point(this.x + that.x, this.y + that.y);
|
|
},
|
|
|
|
/**
|
|
* Adds another point to this one
|
|
* @param {fabric.Point} that
|
|
* @return {fabric.Point} thisArg
|
|
*/
|
|
addEquals: function (that) {
|
|
this.x += that.x;
|
|
this.y += that.y;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Adds value to this point and returns a new one
|
|
* @param {Number} scalar
|
|
* @return {fabric.Point} new Point with added value
|
|
*/
|
|
scalarAdd: function (scalar) {
|
|
return new Point(this.x + scalar, this.y + scalar);
|
|
},
|
|
|
|
/**
|
|
* Adds value to this point
|
|
* @param {Number} scalar
|
|
* @param {fabric.Point} thisArg
|
|
*/
|
|
scalarAddEquals: function (scalar) {
|
|
this.x += scalar;
|
|
this.y += scalar;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Subtracts another point from this point and returns a new one
|
|
* @param {fabric.Point} that
|
|
* @return {fabric.Point} new Point object with subtracted values
|
|
*/
|
|
subtract: function (that) {
|
|
return new Point(this.x - that.x, this.y - that.y);
|
|
},
|
|
|
|
/**
|
|
* Subtracts another point from this point
|
|
* @param {fabric.Point} that
|
|
* @return {fabric.Point} thisArg
|
|
*/
|
|
subtractEquals: function (that) {
|
|
this.x -= that.x;
|
|
this.y -= that.y;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Subtracts value from this point and returns a new one
|
|
* @param {Number} scalar
|
|
* @return {fabric.Point}
|
|
*/
|
|
scalarSubtract: function (scalar) {
|
|
return new Point(this.x - scalar, this.y - scalar);
|
|
},
|
|
|
|
/**
|
|
* Subtracts value from this point
|
|
* @param {Number} scalar
|
|
* @return {fabric.Point} thisArg
|
|
*/
|
|
scalarSubtractEquals: function (scalar) {
|
|
this.x -= scalar;
|
|
this.y -= scalar;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Miltiplies this point by a value and returns a new one
|
|
* @param {Number} scalar
|
|
* @return {fabric.Point}
|
|
*/
|
|
multiply: function (scalar) {
|
|
return new Point(this.x * scalar, this.y * scalar);
|
|
},
|
|
|
|
/**
|
|
* Miltiplies this point by a value
|
|
* @param {Number} scalar
|
|
* @return {fabric.Point} thisArg
|
|
*/
|
|
multiplyEquals: function (scalar) {
|
|
this.x *= scalar;
|
|
this.y *= scalar;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Divides this point by a value and returns a new one
|
|
* @param {Number} scalar
|
|
* @return {fabric.Point}
|
|
*/
|
|
divide: function (scalar) {
|
|
return new Point(this.x / scalar, this.y / scalar);
|
|
},
|
|
|
|
/**
|
|
* Divides this point by a value
|
|
* @param {Number} scalar
|
|
* @return {fabric.Point} thisArg
|
|
*/
|
|
divideEquals: function (scalar) {
|
|
this.x /= scalar;
|
|
this.y /= scalar;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns true if this point is equal to another one
|
|
* @param {fabric.Point} that
|
|
* @return {Boolean}
|
|
*/
|
|
eq: function (that) {
|
|
return (this.x === that.x && this.y === that.y);
|
|
},
|
|
|
|
/**
|
|
* Returns true if this point is less than another one
|
|
* @param {fabric.Point} that
|
|
* @return {Boolean}
|
|
*/
|
|
lt: function (that) {
|
|
return (this.x < that.x && this.y < that.y);
|
|
},
|
|
|
|
/**
|
|
* Returns true if this point is less than or equal to another one
|
|
* @param {fabric.Point} that
|
|
* @return {Boolean}
|
|
*/
|
|
lte: function (that) {
|
|
return (this.x <= that.x && this.y <= that.y);
|
|
},
|
|
|
|
/**
|
|
|
|
* Returns true if this point is greater another one
|
|
* @param {fabric.Point} that
|
|
* @return {Boolean}
|
|
*/
|
|
gt: function (that) {
|
|
return (this.x > that.x && this.y > that.y);
|
|
},
|
|
|
|
/**
|
|
* Returns true if this point is greater than or equal to another one
|
|
* @param {fabric.Point} that
|
|
* @return {Boolean}
|
|
*/
|
|
gte: function (that) {
|
|
return (this.x >= that.x && this.y >= that.y);
|
|
},
|
|
|
|
/**
|
|
* Returns new point which is the result of linear interpolation with this one and another one
|
|
* @param {fabric.Point} that
|
|
* @param {Number} t
|
|
* @return {fabric.Point}
|
|
*/
|
|
lerp: function (that, t) {
|
|
return new Point(this.x + (that.x - this.x) * t, this.y + (that.y - this.y) * t);
|
|
},
|
|
|
|
/**
|
|
* Returns distance from this point and another one
|
|
* @param {fabric.Point} that
|
|
* @return {Number}
|
|
*/
|
|
distanceFrom: function (that) {
|
|
var dx = this.x - that.x,
|
|
dy = this.y - that.y;
|
|
return Math.sqrt(dx * dx + dy * dy);
|
|
},
|
|
|
|
/**
|
|
* Returns the point between this point and another one
|
|
* @param {fabric.Point} that
|
|
* @return {fabric.Point}
|
|
*/
|
|
midPointFrom: function (that) {
|
|
return new Point(this.x + (that.x - this.x)/2, this.y + (that.y - this.y)/2);
|
|
},
|
|
|
|
/**
|
|
* Returns a new point which is the min of this and another one
|
|
* @param {fabric.Point} that
|
|
* @return {fabric.Point}
|
|
*/
|
|
min: function (that) {
|
|
return new Point(Math.min(this.x, that.x), Math.min(this.y, that.y));
|
|
},
|
|
|
|
/**
|
|
* Returns a new point which is the max of this and another one
|
|
* @param {fabric.Point} that
|
|
* @return {fabric.Point}
|
|
*/
|
|
max: function (that) {
|
|
return new Point(Math.max(this.x, that.x), Math.max(this.y, that.y));
|
|
},
|
|
|
|
/**
|
|
* Returns string representation of this point
|
|
* @return {String}
|
|
*/
|
|
toString: function () {
|
|
return this.x + "," + this.y;
|
|
},
|
|
|
|
/**
|
|
* Sets x/y of this point
|
|
* @param {Number} x
|
|
* @return {Number} y
|
|
*/
|
|
setXY: function (x, y) {
|
|
this.x = x;
|
|
this.y = y;
|
|
},
|
|
|
|
/**
|
|
* Sets x/y of this point from another point
|
|
* @param {fabric.Point} that
|
|
*/
|
|
setFromPoint: function (that) {
|
|
this.x = that.x;
|
|
this.y = that.y;
|
|
},
|
|
|
|
/**
|
|
* Swaps x/y of this point and another point
|
|
* @param {fabric.Point} that
|
|
*/
|
|
swap: function (that) {
|
|
var x = this.x,
|
|
y = this.y;
|
|
this.x = that.x;
|
|
this.y = that.y;
|
|
that.x = x;
|
|
that.y = y;
|
|
}
|
|
};
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
(function(global) {
|
|
|
|
"use strict";
|
|
|
|
/* Adaptation of work of Kevin Lindsey (kevin@kevlindev.com) */
|
|
|
|
var fabric = global.fabric || (global.fabric = { });
|
|
|
|
if (fabric.Intersection) {
|
|
fabric.warn('fabric.Intersection is already defined');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Intersection class
|
|
* @class fabric.Intersection
|
|
* @constructor
|
|
*/
|
|
function Intersection(status) {
|
|
if (arguments.length > 0) {
|
|
this.init(status);
|
|
}
|
|
}
|
|
|
|
fabric.Intersection = Intersection;
|
|
|
|
fabric.Intersection.prototype = /** @lends fabric.Intersection.prototype */ {
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {String} status
|
|
*/
|
|
init: function (status) {
|
|
this.status = status;
|
|
this.points = [];
|
|
},
|
|
|
|
/**
|
|
* Appends a point to intersection
|
|
* @param {fabric.Point} point
|
|
*/
|
|
appendPoint: function (point) {
|
|
this.points.push(point);
|
|
},
|
|
|
|
/**
|
|
* Appends points to intersection
|
|
* @param {Array} points
|
|
*/
|
|
appendPoints: function (points) {
|
|
this.points = this.points.concat(points);
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Checks if one line intersects another
|
|
* @static
|
|
* @param {fabric.Point} a1
|
|
* @param {fabric.Point} a2
|
|
* @param {fabric.Point} b1
|
|
* @param {fabric.Point} b2
|
|
* @return {fabric.Intersection}
|
|
*/
|
|
fabric.Intersection.intersectLineLine = function (a1, a2, b1, b2) {
|
|
var result,
|
|
ua_t = (b2.x - b1.x) * (a1.y - b1.y) - (b2.y - b1.y) * (a1.x - b1.x),
|
|
ub_t = (a2.x - a1.x) * (a1.y - b1.y) - (a2.y - a1.y) * (a1.x - b1.x),
|
|
u_b = (b2.y - b1.y) * (a2.x - a1.x) - (b2.x - b1.x) * (a2.y - a1.y);
|
|
if (u_b !== 0) {
|
|
var ua = ua_t / u_b,
|
|
ub = ub_t / u_b;
|
|
if (0 <= ua && ua <= 1 && 0 <= ub && ub <= 1) {
|
|
result = new Intersection("Intersection");
|
|
result.points.push(new fabric.Point(a1.x + ua * (a2.x - a1.x), a1.y + ua * (a2.y - a1.y)));
|
|
}
|
|
else {
|
|
result = new Intersection("No Intersection");
|
|
}
|
|
}
|
|
else {
|
|
if (ua_t === 0 || ub_t === 0) {
|
|
result = new Intersection("Coincident");
|
|
}
|
|
else {
|
|
result = new Intersection("Parallel");
|
|
}
|
|
}
|
|
return result;
|
|
};
|
|
|
|
/**
|
|
* Checks if line intersects polygon
|
|
* @static
|
|
* @param {fabric.Point} a1
|
|
* @param {fabric.Point} a2
|
|
* @param {Array} points
|
|
* @return {fabric.Intersection}
|
|
*/
|
|
fabric.Intersection.intersectLinePolygon = function(a1,a2,points){
|
|
var result = new Intersection("No Intersection"),
|
|
length = points.length;
|
|
|
|
for (var i = 0; i < length; i++) {
|
|
var b1 = points[i],
|
|
b2 = points[(i+1) % length],
|
|
inter = Intersection.intersectLineLine(a1, a2, b1, b2);
|
|
|
|
result.appendPoints(inter.points);
|
|
}
|
|
if (result.points.length > 0) {
|
|
result.status = "Intersection";
|
|
}
|
|
return result;
|
|
};
|
|
|
|
/**
|
|
* Checks if polygon intersects another polygon
|
|
* @static
|
|
* @param {Array} points1
|
|
* @param {Array} points2
|
|
* @return {fabric.Intersection}
|
|
*/
|
|
fabric.Intersection.intersectPolygonPolygon = function (points1, points2) {
|
|
var result = new Intersection("No Intersection"),
|
|
length = points1.length;
|
|
|
|
for (var i = 0; i < length; i++) {
|
|
var a1 = points1[i],
|
|
a2 = points1[(i+1) % length],
|
|
inter = Intersection.intersectLinePolygon(a1, a2, points2);
|
|
|
|
result.appendPoints(inter.points);
|
|
}
|
|
if (result.points.length > 0) {
|
|
result.status = "Intersection";
|
|
}
|
|
return result;
|
|
};
|
|
|
|
/**
|
|
* Checks if polygon intersects rectangle
|
|
|
|
* @static
|
|
* @param {Array} points
|
|
* @param {Number} r1
|
|
* @param {Number} r2
|
|
* @return {fabric.Intersection}
|
|
*/
|
|
fabric.Intersection.intersectPolygonRectangle = function (points, r1, r2) {
|
|
var min = r1.min(r2),
|
|
max = r1.max(r2),
|
|
topRight = new fabric.Point(max.x, min.y),
|
|
bottomLeft = new fabric.Point(min.x, max.y),
|
|
inter1 = Intersection.intersectLinePolygon(min, topRight, points),
|
|
inter2 = Intersection.intersectLinePolygon(topRight, max, points),
|
|
inter3 = Intersection.intersectLinePolygon(max, bottomLeft, points),
|
|
inter4 = Intersection.intersectLinePolygon(bottomLeft, min, points),
|
|
result = new Intersection("No Intersection");
|
|
|
|
result.appendPoints(inter1.points);
|
|
result.appendPoints(inter2.points);
|
|
result.appendPoints(inter3.points);
|
|
result.appendPoints(inter4.points);
|
|
|
|
if (result.points.length > 0) {
|
|
result.status = "Intersection";
|
|
}
|
|
return result;
|
|
};
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
(function(global) {
|
|
|
|
"use strict";
|
|
|
|
var fabric = global.fabric || (global.fabric = { });
|
|
|
|
if (fabric.Color) {
|
|
fabric.warn('fabric.Color is already defined.');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Color class
|
|
* The purpose of {@link fabric.Color} is to abstract and encapsulate common color operations;
|
|
* {@link fabric.Color} is a constructor and creates instances of {@link fabric.Color} objects.
|
|
*
|
|
* @class fabric.Color
|
|
* @param {String} color optional in hex or rgb(a) format
|
|
* @return {fabric.Color} thisArg
|
|
*/
|
|
function Color(color) {
|
|
if (!color) {
|
|
this.setSource([0, 0, 0, 1]);
|
|
}
|
|
else {
|
|
this._tryParsingColor(color);
|
|
}
|
|
}
|
|
|
|
fabric.Color = Color;
|
|
|
|
fabric.Color.prototype = /** @lends fabric.Color.prototype */ {
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_tryParsingColor: function(color) {
|
|
var source;
|
|
|
|
if (color in Color.colorNameMap) {
|
|
color = Color.colorNameMap[color];
|
|
}
|
|
|
|
source = Color.sourceFromHex(color);
|
|
|
|
if (!source) {
|
|
source = Color.sourceFromRgb(color);
|
|
}
|
|
if (source) {
|
|
this.setSource(source);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Returns source of this color (where source is an array representation; ex: [200, 200, 100, 1])
|
|
* @return {Array}
|
|
*/
|
|
getSource: function() {
|
|
return this._source;
|
|
},
|
|
|
|
/**
|
|
* Sets source of this color (where source is an array representation; ex: [200, 200, 100, 1])
|
|
* @param {Array} source
|
|
*/
|
|
setSource: function(source) {
|
|
this._source = source;
|
|
},
|
|
|
|
/**
|
|
* Returns color represenation in RGB format
|
|
* @return {String} ex: rgb(0-255,0-255,0-255)
|
|
*/
|
|
toRgb: function() {
|
|
var source = this.getSource();
|
|
return 'rgb(' + source[0] + ',' + source[1] + ',' + source[2] + ')';
|
|
},
|
|
|
|
/**
|
|
* Returns color represenation in RGBA format
|
|
* @return {String} ex: rgba(0-255,0-255,0-255,0-1)
|
|
*/
|
|
toRgba: function() {
|
|
var source = this.getSource();
|
|
return 'rgba(' + source[0] + ',' + source[1] + ',' + source[2] + ',' + source[3] + ')';
|
|
},
|
|
|
|
/**
|
|
* Returns color represenation in HEX format
|
|
* @return {String} ex: FF5555
|
|
*/
|
|
toHex: function() {
|
|
var source = this.getSource();
|
|
|
|
var r = source[0].toString(16);
|
|
r = (r.length === 1) ? ('0' + r) : r;
|
|
|
|
var g = source[1].toString(16);
|
|
g = (g.length === 1) ? ('0' + g) : g;
|
|
|
|
var b = source[2].toString(16);
|
|
b = (b.length === 1) ? ('0' + b) : b;
|
|
|
|
return r.toUpperCase() + g.toUpperCase() + b.toUpperCase();
|
|
},
|
|
|
|
/**
|
|
* Gets value of alpha channel for this color
|
|
* @return {Number} 0-1
|
|
*/
|
|
getAlpha: function() {
|
|
return this.getSource()[3];
|
|
},
|
|
|
|
/**
|
|
* Sets value of alpha channel for this color
|
|
* @param {Number} 0-1
|
|
* @return {fabric.Color} thisArg
|
|
*/
|
|
setAlpha: function(alpha) {
|
|
var source = this.getSource();
|
|
source[3] = alpha;
|
|
this.setSource(source);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Transforms color to its grayscale representation
|
|
* @return {fabric.Color} thisArg
|
|
*/
|
|
toGrayscale: function() {
|
|
var source = this.getSource(),
|
|
average = parseInt((source[0] * 0.3 + source[1] * 0.59 + source[2] * 0.11).toFixed(0), 10),
|
|
currentAlpha = source[3];
|
|
this.setSource([average, average, average, currentAlpha]);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Transforms color to its black and white representation
|
|
* @return {fabric.Color} thisArg
|
|
*/
|
|
toBlackWhite: function(threshold) {
|
|
var source = this.getSource(),
|
|
average = (source[0] * 0.3 + source[1] * 0.59 + source[2] * 0.11).toFixed(0),
|
|
currentAlpha = source[3];
|
|
|
|
threshold = threshold || 127;
|
|
|
|
average = (Number(average) < Number(threshold)) ? 0 : 255;
|
|
this.setSource([average, average, average, currentAlpha]);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Overlays color with another color
|
|
* @param {String|fabric.Color} otherColor
|
|
* @return {fabric.Color} thisArg
|
|
*/
|
|
overlayWith: function(otherColor) {
|
|
if (!(otherColor instanceof Color)) {
|
|
otherColor = new Color(otherColor);
|
|
}
|
|
|
|
var result = [],
|
|
alpha = this.getAlpha(),
|
|
otherAlpha = 0.5,
|
|
source = this.getSource(),
|
|
otherSource = otherColor.getSource();
|
|
|
|
for (var i = 0; i < 3; i++) {
|
|
result.push(Math.round((source[i] * (1 - otherAlpha)) + (otherSource[i] * otherAlpha)));
|
|
}
|
|
|
|
result[3] = alpha;
|
|
this.setSource(result);
|
|
return this;
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Regex matching color in RGB or RGBA formats (ex: rgb(0, 0, 0), rgb(255, 100, 10, 0.5), rgb(1,1,1))
|
|
* @static
|
|
* @field
|
|
*/
|
|
fabric.Color.reRGBa = /^rgba?\((\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})(?:\s*,\s*(\d+(?:\.\d+)?))?\)$/;
|
|
|
|
/**
|
|
* Regex matching color in HEX format (ex: #FF5555, 010155, aff)
|
|
* @static
|
|
* @field
|
|
*/
|
|
fabric.Color.reHex = /^#?([0-9a-f]{6}|[0-9a-f]{3})$/i;
|
|
|
|
/**
|
|
* Map of the 16 basic color names with HEX code
|
|
* @static
|
|
* @field
|
|
*/
|
|
fabric.Color.colorNameMap = {
|
|
'aqua': '#00FFFF',
|
|
'black': '#000000',
|
|
'blue': '#0000FF',
|
|
'fuchsia': '#FF00FF',
|
|
'gray': '#808080',
|
|
'green': '#008000',
|
|
'lime': '#00FF00',
|
|
'maroon': '#800000',
|
|
'navy': '#000080',
|
|
'olive': '#808000',
|
|
'purple': '#800080',
|
|
'red': '#FF0000',
|
|
'silver': '#C0C0C0',
|
|
'teal': '#008080',
|
|
'white': '#FFFFFF',
|
|
'yellow': '#FFFF00'
|
|
};
|
|
|
|
/**
|
|
* Returns new color object, when given a color in RGB format
|
|
* @param {String} color ex: rgb(0-255,0-255,0-255)
|
|
* @return {fabric.Color}
|
|
*/
|
|
fabric.Color.fromRgb = function(color) {
|
|
return Color.fromSource(Color.sourceFromRgb(color));
|
|
};
|
|
|
|
/**
|
|
* Returns array represenatation (ex: [100, 100, 200, 1]) of a color that's in RGB or RGBA format
|
|
* @param {String} color ex: rgb(0-255,0-255,0-255)
|
|
* @return {Array} source
|
|
*/
|
|
fabric.Color.sourceFromRgb = function(color) {
|
|
var match = color.match(Color.reRGBa);
|
|
if (match) {
|
|
return [
|
|
parseInt(match[1], 10),
|
|
parseInt(match[2], 10),
|
|
parseInt(match[3], 10),
|
|
match[4] ? parseFloat(match[4]) : 1
|
|
];
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Returns new color object, when given a color in RGBA format
|
|
* @static
|
|
* @function
|
|
* @param {String} color
|
|
* @return {fabric.Color}
|
|
*/
|
|
fabric.Color.fromRgba = Color.fromRgb;
|
|
|
|
/**
|
|
* Returns new color object, when given a color in HEX format
|
|
* @static
|
|
* @return {fabric.Color}
|
|
*/
|
|
fabric.Color.fromHex = function(color) {
|
|
return Color.fromSource(Color.sourceFromHex(color));
|
|
};
|
|
|
|
/**
|
|
* Returns array represenatation (ex: [100, 100, 200, 1]) of a color that's in HEX format
|
|
* @static
|
|
* @param {String} color ex: FF5555
|
|
* @return {Array} source
|
|
*/
|
|
fabric.Color.sourceFromHex = function(color) {
|
|
if (color.match(Color.reHex)) {
|
|
var value = color.slice(color.indexOf('#') + 1),
|
|
isShortNotation = (value.length === 3),
|
|
r = isShortNotation ? (value.charAt(0) + value.charAt(0)) : value.substring(0, 2),
|
|
g = isShortNotation ? (value.charAt(1) + value.charAt(1)) : value.substring(2, 4),
|
|
b = isShortNotation ? (value.charAt(2) + value.charAt(2)) : value.substring(4, 6);
|
|
|
|
return [
|
|
parseInt(r, 16),
|
|
parseInt(g, 16),
|
|
parseInt(b, 16),
|
|
1
|
|
];
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Returns new color object, when given color in array representation (ex: [200, 100, 100, 0.5])
|
|
* @static
|
|
* @return {fabric.Color}
|
|
*/
|
|
fabric.Color.fromSource = function(source) {
|
|
var oColor = new Color();
|
|
oColor.setSource(source);
|
|
return oColor;
|
|
};
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
(function () {
|
|
|
|
"use strict";
|
|
|
|
if (fabric.StaticCanvas) {
|
|
fabric.warn('fabric.StaticCanvas is already defined.');
|
|
return;
|
|
}
|
|
|
|
// aliases for faster resolution
|
|
var extend = fabric.util.object.extend,
|
|
getElementOffset = fabric.util.getElementOffset,
|
|
removeFromArray = fabric.util.removeFromArray,
|
|
removeListener = fabric.util.removeListener,
|
|
|
|
CANVAS_INIT_ERROR = new Error('Could not initialize `canvas` element');
|
|
|
|
/**
|
|
* Static canvas class
|
|
* @class fabric.StaticCanvas
|
|
* @constructor
|
|
*
|
|
* @param {HTMLElement | String} el <canvas> element to initialize instance on
|
|
* @param {Object} [options] Options object
|
|
*
|
|
* @extends fabric.Collection
|
|
* @extends fabric.Observable
|
|
*/
|
|
fabric.StaticCanvas = function (el, options) {
|
|
options || (options = { });
|
|
|
|
this._initStatic(el, options);
|
|
fabric.StaticCanvas.activeInstance = this;
|
|
};
|
|
|
|
extend(fabric.StaticCanvas.prototype, fabric.Observable);
|
|
extend(fabric.StaticCanvas.prototype, fabric.Collection);
|
|
|
|
extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ {
|
|
|
|
/**
|
|
* Background color of canvas instance
|
|
* @type String
|
|
*/
|
|
backgroundColor: '',
|
|
|
|
/**
|
|
* Background image of canvas instance
|
|
* Should be set via {@link fabric.StaticCanvas#setBackgroundImage}
|
|
* @type String
|
|
*/
|
|
backgroundImage: '',
|
|
|
|
/**
|
|
* Opacity of the background image of the canvas instance
|
|
* @type Float
|
|
*/
|
|
backgroundImageOpacity: 1.0,
|
|
|
|
/**
|
|
* Indicates whether the background image should be stretched to fit the
|
|
* dimensions of the canvas instance.
|
|
* @type Boolean
|
|
*/
|
|
backgroundImageStretch: true,
|
|
|
|
/**
|
|
* Overlay image of canvas instance
|
|
* Should be set via {@link fabric.StaticCanvas#setOverlayImage}
|
|
* @type String
|
|
*/
|
|
overlayImage: '',
|
|
|
|
/**
|
|
* Left offset of overlay image (if present)
|
|
* @type Number
|
|
*/
|
|
overlayImageLeft: 0,
|
|
|
|
/**
|
|
* Top offset of overlay image (if present)
|
|
* @type Number
|
|
*/
|
|
overlayImageTop: 0,
|
|
|
|
/**
|
|
* Indicates whether toObject/toDatalessObject should include default values
|
|
* @type Boolean
|
|
*/
|
|
includeDefaultValues: true,
|
|
|
|
/**
|
|
* Indicates whether objects' state should be saved
|
|
* @type Boolean
|
|
*/
|
|
stateful: true,
|
|
|
|
/**
|
|
* Indicates whether {@link fabric.Canvas.prototype.add} should also re-render canvas.
|
|
* Disabling this option could give a great performance boost when adding a lot of objects to canvas at once
|
|
* (followed by a manual rendering after addition)
|
|
* @type Boolean
|
|
*/
|
|
renderOnAddition: true,
|
|
|
|
/**
|
|
* Function that determines clipping of entire canvas area
|
|
* Being passed context as first argument. See clipping canvas area in {@link https://github.com/kangax/fabric.js/wiki/FAQ}
|
|
* @type Function
|
|
*/
|
|
clipTo: null,
|
|
|
|
/**
|
|
* Indicates whether object controls (borders/controls) are rendered above overlay image
|
|
* @type Boolean
|
|
*/
|
|
controlsAboveOverlay: false,
|
|
|
|
/**
|
|
* Callback; invoked right before object is about to be scaled/rotated
|
|
* @param {fabric.Object} target Object that's about to be scaled/rotated
|
|
*/
|
|
onBeforeScaleRotate: function () {
|
|
/* NOOP */
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_initStatic: function(el, options) {
|
|
this._objects = [];
|
|
|
|
this._createLowerCanvas(el);
|
|
this._initOptions(options);
|
|
|
|
if (options.overlayImage) {
|
|
this.setOverlayImage(options.overlayImage, this.renderAll.bind(this));
|
|
}
|
|
if (options.backgroundImage) {
|
|
this.setBackgroundImage(options.backgroundImage, this.renderAll.bind(this));
|
|
}
|
|
if (options.backgroundColor) {
|
|
this.setBackgroundColor(options.backgroundColor, this.renderAll.bind(this));
|
|
}
|
|
this.calcOffset();
|
|
},
|
|
|
|
/**
|
|
* Calculates canvas element offset relative to the document
|
|
* This method is also attached as "resize" event handler of window
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable
|
|
*/
|
|
calcOffset: function () {
|
|
this._offset = getElementOffset(this.lowerCanvasEl);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Sets overlay image for this canvas
|
|
* @param {String} url url of an image to set overlay to
|
|
* @param {Function} callback callback to invoke when image is loaded and set as an overlay
|
|
* @param {Object} [options] optional options to set for the overlay image
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
setOverlayImage: function (url, callback, options) { // TODO (kangax): test callback
|
|
fabric.util.loadImage(url, function(img) {
|
|
this.overlayImage = img;
|
|
if (options && ('overlayImageLeft' in options)) {
|
|
this.overlayImageLeft = options.overlayImageLeft;
|
|
}
|
|
if (options && ('overlayImageTop' in options)) {
|
|
this.overlayImageTop = options.overlayImageTop;
|
|
}
|
|
callback && callback();
|
|
}, this);
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Sets background image for this canvas
|
|
* @param {String} url url of an image to set background to
|
|
* @param {Function} callback callback to invoke when image is loaded and set as background
|
|
* @param {Object} [options] optional options to set for the background image
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
setBackgroundImage: function (url, callback, options) {
|
|
fabric.util.loadImage(url, function(img) {
|
|
this.backgroundImage = img;
|
|
if (options && ('backgroundImageOpacity' in options)) {
|
|
this.backgroundImageOpacity = options.backgroundImageOpacity;
|
|
}
|
|
if (options && ('backgroundImageStretch' in options)) {
|
|
this.backgroundImageStretch = options.backgroundImageStretch;
|
|
}
|
|
callback && callback();
|
|
}, this);
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Sets background color for this canvas
|
|
* @param {String|fabric.Pattern} Color of pattern to set background color to
|
|
* @param {Function} callback callback to invoke when background color is set
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
setBackgroundColor: function(backgroundColor, callback) {
|
|
if (backgroundColor.source) {
|
|
var _this = this;
|
|
fabric.util.loadImage(backgroundColor.source, function(img) {
|
|
_this.backgroundColor = new fabric.Pattern({
|
|
source: img,
|
|
repeat: backgroundColor.repeat
|
|
});
|
|
callback && callback();
|
|
});
|
|
}
|
|
else {
|
|
this.backgroundColor = backgroundColor;
|
|
callback && callback();
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_createCanvasElement: function() {
|
|
var element = fabric.document.createElement('canvas');
|
|
if (!element.style) {
|
|
element.style = { };
|
|
}
|
|
if (!element) {
|
|
throw CANVAS_INIT_ERROR;
|
|
}
|
|
this._initCanvasElement(element);
|
|
return element;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {HTMLElement} element
|
|
*/
|
|
_initCanvasElement: function(element) {
|
|
fabric.util.createCanvasElement(element);
|
|
|
|
if (typeof element.getContext === 'undefined') {
|
|
throw CANVAS_INIT_ERROR;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} [options]
|
|
*/
|
|
_initOptions: function (options) {
|
|
for (var prop in options) {
|
|
this[prop] = options[prop];
|
|
}
|
|
|
|
this.width = parseInt(this.lowerCanvasEl.width, 10) || 0;
|
|
this.height = parseInt(this.lowerCanvasEl.height, 10) || 0;
|
|
|
|
if (!this.lowerCanvasEl.style) return;
|
|
|
|
this.lowerCanvasEl.style.width = this.width + 'px';
|
|
this.lowerCanvasEl.style.height = this.height + 'px';
|
|
},
|
|
|
|
/**
|
|
* Creates a bottom canvas
|
|
* @private
|
|
*/
|
|
_createLowerCanvas: function (canvasEl) {
|
|
this.lowerCanvasEl = fabric.util.getById(canvasEl) || this._createCanvasElement();
|
|
this._initCanvasElement(this.lowerCanvasEl);
|
|
|
|
fabric.util.addClass(this.lowerCanvasEl, 'lower-canvas');
|
|
|
|
if (this.interactive) {
|
|
this._applyCanvasStyle(this.lowerCanvasEl);
|
|
}
|
|
|
|
this.contextContainer = this.lowerCanvasEl.getContext('2d');
|
|
},
|
|
|
|
/**
|
|
* Returns canvas width (in px)
|
|
* @return {Number}
|
|
*/
|
|
getWidth: function () {
|
|
return this.width;
|
|
},
|
|
|
|
/**
|
|
* Returns canvas height (in px)
|
|
* @return {Number}
|
|
*/
|
|
getHeight: function () {
|
|
return this.height;
|
|
},
|
|
|
|
/**
|
|
* Sets width of this canvas instance
|
|
* @param {Number} width value to set width to
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable true
|
|
*/
|
|
setWidth: function (value) {
|
|
return this._setDimension('width', value);
|
|
},
|
|
|
|
/**
|
|
* Sets height of this canvas instance
|
|
* @param {Number} height value to set height to
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable true
|
|
*/
|
|
setHeight: function (value) {
|
|
return this._setDimension('height', value);
|
|
},
|
|
|
|
/**
|
|
* Sets dimensions (width, height) of this canvas instance
|
|
* @param {Object} dimensions
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
setDimensions: function(dimensions) {
|
|
for (var prop in dimensions) {
|
|
this._setDimension(prop, dimensions[prop]);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Helper for setting width/height
|
|
* @private
|
|
* @param {String} prop property (width|height)
|
|
* @param {Number} value value to set property to
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable true
|
|
*/
|
|
_setDimension: function (prop, value) {
|
|
this.lowerCanvasEl[prop] = value;
|
|
this.lowerCanvasEl.style[prop] = value + 'px';
|
|
|
|
if (this.upperCanvasEl) {
|
|
this.upperCanvasEl[prop] = value;
|
|
this.upperCanvasEl.style[prop] = value + 'px';
|
|
}
|
|
|
|
if (this.cacheCanvasEl) {
|
|
this.cacheCanvasEl[prop] = value;
|
|
}
|
|
|
|
if (this.wrapperEl) {
|
|
this.wrapperEl.style[prop] = value + 'px';
|
|
}
|
|
|
|
this[prop] = value;
|
|
|
|
this.calcOffset();
|
|
this.renderAll();
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns <canvas> element corresponding to this instance
|
|
* @return {HTMLCanvasElement}
|
|
*/
|
|
getElement: function () {
|
|
return this.lowerCanvasEl;
|
|
},
|
|
|
|
/**
|
|
* Returns currently selected object, if any
|
|
* @return {fabric.Object}
|
|
*/
|
|
getActiveObject: function() {
|
|
return null;
|
|
},
|
|
|
|
/**
|
|
* Returns currently selected group of object, if any
|
|
* @return {fabric.Group}
|
|
*/
|
|
getActiveGroup: function() {
|
|
return null;
|
|
},
|
|
|
|
/**
|
|
* Given a context, renders an object on that context
|
|
* @param ctx {Object} context to render object on
|
|
* @param object {Object} object to render
|
|
* @private
|
|
*/
|
|
_draw: function (ctx, object) {
|
|
if (!object) return;
|
|
|
|
if (this.controlsAboveOverlay) {
|
|
var hasBorders = object.hasBorders, hasControls = object.hasControls;
|
|
object.hasBorders = object.hasControls = false;
|
|
object.render(ctx);
|
|
object.hasBorders = hasBorders;
|
|
object.hasControls = hasControls;
|
|
}
|
|
else {
|
|
object.render(ctx);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_onObjectAdded: function(obj) {
|
|
this.stateful && obj.setupState();
|
|
obj.setCoords();
|
|
obj.canvas = this;
|
|
this.fire('object:added', { target: obj });
|
|
obj.fire('added');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_onObjectRemoved: function(obj) {
|
|
this.fire('object:removed', { target: obj });
|
|
obj.fire('removed');
|
|
},
|
|
|
|
/**
|
|
* Returns an array of objects this instance has
|
|
* @return {Array}
|
|
*/
|
|
getObjects: function () {
|
|
return this._objects;
|
|
},
|
|
|
|
/**
|
|
* Clears specified context of canvas element
|
|
* @param context {Object} ctx context to clear
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
clearContext: function(ctx) {
|
|
ctx.clearRect(0, 0, this.width, this.height);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns context of canvas where objects are drawn
|
|
* @return {CanvasRenderingContext2D}
|
|
*/
|
|
getContext: function () {
|
|
return this.contextContainer;
|
|
},
|
|
|
|
/**
|
|
* Clears all contexts (background, main, top) of an instance
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
clear: function () {
|
|
this._objects.length = 0;
|
|
if (this.discardActiveGroup) {
|
|
this.discardActiveGroup();
|
|
}
|
|
if (this.discardActiveObject) {
|
|
this.discardActiveObject();
|
|
}
|
|
this.clearContext(this.contextContainer);
|
|
if (this.contextTop) {
|
|
this.clearContext(this.contextTop);
|
|
}
|
|
this.fire('canvas:cleared');
|
|
this.renderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Renders both the top canvas and the secondary container canvas.
|
|
* @param allOnTop {Boolean} optional Whether we want to force all images to be rendered on the top canvas
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable
|
|
*/
|
|
renderAll: function (allOnTop) {
|
|
|
|
var canvasToDrawOn = this[(allOnTop === true && this.interactive) ? 'contextTop' : 'contextContainer'];
|
|
|
|
if (this.contextTop && this.selection && !this._groupSelector) {
|
|
this.clearContext(this.contextTop);
|
|
}
|
|
|
|
if (!allOnTop) {
|
|
this.clearContext(canvasToDrawOn);
|
|
}
|
|
|
|
this.fire('before:render');
|
|
|
|
if (this.clipTo) {
|
|
fabric.util.clipContext(this, canvasToDrawOn);
|
|
}
|
|
|
|
if (this.backgroundColor) {
|
|
canvasToDrawOn.fillStyle = this.backgroundColor.toLive
|
|
? this.backgroundColor.toLive(canvasToDrawOn)
|
|
: this.backgroundColor;
|
|
|
|
canvasToDrawOn.fillRect(
|
|
this.backgroundColor.offsetX || 0,
|
|
this.backgroundColor.offsetY || 0,
|
|
this.width,
|
|
this.height);
|
|
}
|
|
|
|
if (typeof this.backgroundImage === 'object') {
|
|
this._drawBackroundImage(canvasToDrawOn);
|
|
}
|
|
|
|
var activeGroup = this.getActiveGroup();
|
|
for (var i = 0, length = this._objects.length; i < length; ++i) {
|
|
if (!activeGroup ||
|
|
(activeGroup && this._objects[i] && !activeGroup.contains(this._objects[i]))) {
|
|
this._draw(canvasToDrawOn, this._objects[i]);
|
|
}
|
|
}
|
|
|
|
// delegate rendering to group selection (if one exists)
|
|
if (activeGroup) {
|
|
//Store objects in group preserving order, then replace
|
|
var sortedObjects = [];
|
|
this.forEachObject(function (object) {
|
|
if (activeGroup.contains(object)) {
|
|
sortedObjects.push(object);
|
|
}
|
|
});
|
|
activeGroup._set('objects', sortedObjects);
|
|
this._draw(canvasToDrawOn, activeGroup);
|
|
}
|
|
|
|
if (this.clipTo) {
|
|
canvasToDrawOn.restore();
|
|
}
|
|
|
|
if (this.overlayImage) {
|
|
canvasToDrawOn.drawImage(this.overlayImage, this.overlayImageLeft, this.overlayImageTop);
|
|
}
|
|
|
|
if (this.controlsAboveOverlay) {
|
|
this.drawControls(canvasToDrawOn);
|
|
}
|
|
|
|
this.fire('after:render');
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_drawBackroundImage: function(canvasToDrawOn) {
|
|
canvasToDrawOn.save();
|
|
canvasToDrawOn.globalAlpha = this.backgroundImageOpacity;
|
|
|
|
if (this.backgroundImageStretch) {
|
|
canvasToDrawOn.drawImage(this.backgroundImage, 0, 0, this.width, this.height);
|
|
}
|
|
else {
|
|
canvasToDrawOn.drawImage(this.backgroundImage, 0, 0);
|
|
}
|
|
canvasToDrawOn.restore();
|
|
},
|
|
|
|
/**
|
|
* Method to render only the top canvas.
|
|
* Also used to render the group selection box.
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
renderTop: function () {
|
|
var ctx = this.contextTop || this.contextContainer;
|
|
this.clearContext(ctx);
|
|
|
|
// we render the top context - last object
|
|
if (this.selection && this._groupSelector) {
|
|
this._drawSelection();
|
|
}
|
|
|
|
// delegate rendering to group selection if one exists
|
|
// used for drawing selection borders/controls
|
|
var activeGroup = this.getActiveGroup();
|
|
if (activeGroup) {
|
|
activeGroup.render(ctx);
|
|
}
|
|
|
|
if (this.overlayImage) {
|
|
ctx.drawImage(this.overlayImage, this.overlayImageLeft, this.overlayImageTop);
|
|
}
|
|
|
|
this.fire('after:render');
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Draws objects' controls (borders/controls)
|
|
* @param {Object} ctx context to render controls on
|
|
*/
|
|
drawControls: function(ctx) {
|
|
var activeGroup = this.getActiveGroup();
|
|
if (activeGroup) {
|
|
ctx.save();
|
|
fabric.Group.prototype.transform.call(activeGroup, ctx);
|
|
activeGroup.drawBorders(ctx).drawControls(ctx);
|
|
ctx.restore();
|
|
}
|
|
else {
|
|
for (var i = 0, len = this._objects.length; i < len; ++i) {
|
|
if (!this._objects[i] || !this._objects[i].active) continue;
|
|
|
|
ctx.save();
|
|
fabric.Object.prototype.transform.call(this._objects[i], ctx);
|
|
this._objects[i].drawBorders(ctx).drawControls(ctx);
|
|
ctx.restore();
|
|
|
|
this.lastRenderedObjectWithControlsAboveOverlay = this._objects[i];
|
|
}
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Exports canvas element to a dataurl image.
|
|
* @param {Object} options
|
|
*
|
|
* `format` the format of the output image. Either "jpeg" or "png".
|
|
* `quality` quality level (0..1)
|
|
* `multiplier` multiplier to scale by {Number}
|
|
*
|
|
* @return {String}
|
|
*/
|
|
toDataURL: function (options) {
|
|
options || (options = { });
|
|
|
|
var format = options.format || 'png',
|
|
quality = options.quality || 1,
|
|
multiplier = options.multiplier || 1;
|
|
|
|
if (multiplier !== 1) {
|
|
return this.__toDataURLWithMultiplier(format, quality, multiplier);
|
|
}
|
|
else {
|
|
return this.__toDataURL(format, quality);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
__toDataURL: function(format, quality) {
|
|
this.renderAll(true);
|
|
var canvasEl = this.upperCanvasEl || this.lowerCanvasEl;
|
|
var data = (fabric.StaticCanvas.supports('toDataURLWithQuality'))
|
|
? canvasEl.toDataURL('image/' + format, quality)
|
|
: canvasEl.toDataURL('image/' + format);
|
|
|
|
this.contextTop && this.clearContext(this.contextTop);
|
|
this.renderAll();
|
|
return data;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
__toDataURLWithMultiplier: function(format, quality, multiplier) {
|
|
|
|
var origWidth = this.getWidth(),
|
|
origHeight = this.getHeight(),
|
|
scaledWidth = origWidth * multiplier,
|
|
scaledHeight = origHeight * multiplier,
|
|
activeObject = this.getActiveObject(),
|
|
activeGroup = this.getActiveGroup(),
|
|
|
|
ctx = this.contextTop || this.contextContainer;
|
|
|
|
this.setWidth(scaledWidth).setHeight(scaledHeight);
|
|
ctx.scale(multiplier, multiplier);
|
|
|
|
if (activeGroup) {
|
|
// not removing group due to complications with restoring it with correct state afterwords
|
|
this._tempRemoveBordersControlsFromGroup(activeGroup);
|
|
}
|
|
else if (activeObject && this.deactivateAll) {
|
|
this.deactivateAll();
|
|
}
|
|
|
|
// restoring width, height for `renderAll` to draw
|
|
// background properly (while context is scaled)
|
|
this.width = origWidth;
|
|
this.height = origHeight;
|
|
|
|
this.renderAll(true);
|
|
|
|
var data = this.__toDataURL(format, quality);
|
|
|
|
ctx.scale(1 / multiplier, 1 / multiplier);
|
|
this.setWidth(origWidth).setHeight(origHeight);
|
|
|
|
if (activeGroup) {
|
|
this._restoreBordersControlsOnGroup(activeGroup);
|
|
}
|
|
else if (activeObject && this.setActiveObject) {
|
|
this.setActiveObject(activeObject);
|
|
}
|
|
|
|
this.contextTop && this.clearContext(this.contextTop);
|
|
this.renderAll();
|
|
|
|
return data;
|
|
},
|
|
|
|
/**
|
|
* Exports canvas element to a dataurl image (allowing to change image size via multiplier).
|
|
* @deprecated since 1.0.13
|
|
* @param {String} format (png|jpeg)
|
|
* @param {Number} multiplier
|
|
* @param {Number} quality (0..1)
|
|
* @return {String}
|
|
*/
|
|
toDataURLWithMultiplier: function (format, multiplier, quality) {
|
|
return this.toDataURL({
|
|
format: format,
|
|
multiplier: multiplier,
|
|
quality: quality
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_tempRemoveBordersControlsFromGroup: function(group) {
|
|
group.origHasControls = group.hasControls;
|
|
group.origBorderColor = group.borderColor;
|
|
|
|
group.hasControls = true;
|
|
group.borderColor = 'rgba(0,0,0,0)';
|
|
|
|
group.forEachObject(function(o) {
|
|
o.origBorderColor = o.borderColor;
|
|
o.borderColor = 'rgba(0,0,0,0)';
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_restoreBordersControlsOnGroup: function(group) {
|
|
group.hideControls = group.origHideControls;
|
|
group.borderColor = group.origBorderColor;
|
|
|
|
group.forEachObject(function(o) {
|
|
o.borderColor = o.origBorderColor;
|
|
delete o.origBorderColor;
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Returns coordinates of a center of canvas.
|
|
* Returned value is an object with top and left properties
|
|
* @return {Object} object with "top" and "left" number values
|
|
*/
|
|
getCenter: function () {
|
|
return {
|
|
top: this.getHeight() / 2,
|
|
left: this.getWidth() / 2
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Centers object horizontally.
|
|
* @param {fabric.Object} object Object to center
|
|
* @return {fabric.Canvas} thisArg
|
|
*/
|
|
centerObjectH: function (object) {
|
|
object.set('left', this.getCenter().left);
|
|
this.renderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Centers object vertically.
|
|
* @param {fabric.Object} object Object to center
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
centerObjectV: function (object) {
|
|
object.set('top', this.getCenter().top);
|
|
this.renderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Centers object vertically and horizontally.
|
|
* @param {fabric.Object} object Object to center
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
centerObject: function (object) {
|
|
return this.centerObjectH(object).centerObjectV(object);
|
|
},
|
|
|
|
/**
|
|
* Returs dataless JSON representation of canvas
|
|
* @param {Array} propertiesToInclude
|
|
* @return {String} json string
|
|
*/
|
|
toDatalessJSON: function (propertiesToInclude) {
|
|
return this.toDatalessObject(propertiesToInclude);
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of canvas
|
|
* @param {Array} propertiesToInclude
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function (propertiesToInclude) {
|
|
return this._toObjectMethod('toObject', propertiesToInclude);
|
|
},
|
|
|
|
/**
|
|
* Returns dataless object representation of canvas
|
|
* @param {Array} propertiesToInclude
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toDatalessObject: function (propertiesToInclude) {
|
|
return this._toObjectMethod('toDatalessObject', propertiesToInclude);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_toObjectMethod: function (methodName, propertiesToInclude) {
|
|
var data = {
|
|
objects: this._objects.map(function (instance) {
|
|
// TODO (kangax): figure out how to clean this up
|
|
var originalValue;
|
|
if (!this.includeDefaultValues) {
|
|
originalValue = instance.includeDefaultValues;
|
|
instance.includeDefaultValues = false;
|
|
}
|
|
var object = instance[methodName](propertiesToInclude);
|
|
if (!this.includeDefaultValues) {
|
|
instance.includeDefaultValues = originalValue;
|
|
}
|
|
return object;
|
|
}, this),
|
|
background: (this.backgroundColor && this.backgroundColor.toObject)
|
|
? this.backgroundColor.toObject()
|
|
: this.backgroundColor
|
|
};
|
|
if (this.backgroundImage) {
|
|
data.backgroundImage = this.backgroundImage.src;
|
|
data.backgroundImageOpacity = this.backgroundImageOpacity;
|
|
data.backgroundImageStretch = this.backgroundImageStretch;
|
|
}
|
|
if (this.overlayImage) {
|
|
data.overlayImage = this.overlayImage.src;
|
|
data.overlayImageLeft = this.overlayImageLeft;
|
|
data.overlayImageTop = this.overlayImageTop;
|
|
}
|
|
fabric.util.populateWithProperties(this, data, propertiesToInclude);
|
|
return data;
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns SVG representation of canvas
|
|
* @function
|
|
* @param {Object} [options] Options for SVG output (suppressPreamble: true/false (if true xml tag is not included),
|
|
* viewBox: {x, y, width, height} to define the svg output viewBox)
|
|
* @return {String}
|
|
*/
|
|
toSVG: function(options) {
|
|
options || (options = { });
|
|
var markup = [];
|
|
|
|
if (!options.suppressPreamble) {
|
|
markup.push(
|
|
'<?xml version="1.0" standalone="no" ?>',
|
|
'<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ',
|
|
'"http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd">'
|
|
);
|
|
}
|
|
markup.push(
|
|
'<svg ',
|
|
'xmlns="http://www.w3.org/2000/svg" ',
|
|
'xmlns:xlink="http://www.w3.org/1999/xlink" ',
|
|
'version="1.1" ',
|
|
'width="', (options.viewBox ? options.viewBox.width : this.width), '" ',
|
|
'height="', (options.viewBox ? options.viewBox.height : this.height), '" ',
|
|
(this.backgroundColor && !this.backgroundColor.source ? 'style="background-color: ' + this.backgroundColor +'" ' : null),
|
|
(options.viewBox ? 'viewBox="' + options.viewBox.x + ' ' + options.viewBox.y + ' ' + options.viewBox.width + ' ' + options.viewBox.height + '" ' : null),
|
|
'xml:space="preserve">',
|
|
'<desc>Created with Fabric.js ', fabric.version, '</desc>',
|
|
'<defs>', fabric.createSVGFontFacesMarkup(this.getObjects()), fabric.createSVGRefElementsMarkup(this), '</defs>'
|
|
);
|
|
|
|
if (this.backgroundColor && this.backgroundColor.source) {
|
|
markup.push(
|
|
'<rect x="0" y="0" ',
|
|
'width="', (this.backgroundColor.repeat === 'repeat-y' || this.backgroundColor.repeat === 'no-repeat' ? this.backgroundColor.source.width : this.width),
|
|
'" height="', (this.backgroundColor.repeat === 'repeat-x' || this.backgroundColor.repeat === 'no-repeat' ? this.backgroundColor.source.height : this.height),
|
|
'" fill="url(#backgroundColorPattern)"',
|
|
'></rect>'
|
|
);
|
|
}
|
|
|
|
if (this.backgroundImage) {
|
|
markup.push(
|
|
'<image x="0" y="0" ',
|
|
'width="', (this.backgroundImageStretch ? this.width : this.backgroundImage.width),
|
|
'" height="', (this.backgroundImageStretch ? this.height : this.backgroundImage.height),
|
|
'" preserveAspectRatio="', (this.backgroundImageStretch ? 'none' : 'defer'),
|
|
'" xlink:href="', this.backgroundImage.src,
|
|
'" style="opacity:', this.backgroundImageOpacity,
|
|
'"></image>'
|
|
);
|
|
}
|
|
|
|
if (this.overlayImage) {
|
|
markup.push(
|
|
'<image x="', this.overlayImageLeft,
|
|
'" y="', this.overlayImageTop,
|
|
'" width="', this.overlayImage.width,
|
|
'" height="', this.overlayImage.height,
|
|
'" xlink:href="', this.overlayImage.src,
|
|
'"></image>'
|
|
);
|
|
}
|
|
|
|
for (var i = 0, objects = this.getObjects(), len = objects.length; i < len; i++) {
|
|
markup.push(objects[i].toSVG());
|
|
}
|
|
markup.push('</svg>');
|
|
|
|
return markup.join('');
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* Removes an object from canvas and returns it
|
|
* @param object {Object} Object to remove
|
|
* @return {Object} removed object
|
|
*/
|
|
remove: function (object) {
|
|
// removing active object should fire "selection:cleared" events
|
|
if (this.getActiveObject() === object) {
|
|
this.fire('before:selection:cleared', { target: object });
|
|
this.discardActiveObject();
|
|
this.fire('selection:cleared');
|
|
}
|
|
|
|
return fabric.Collection.remove.call(this, object);
|
|
},
|
|
|
|
/**
|
|
* Moves an object to the bottom of the stack of drawn objects
|
|
* @param object {fabric.Object} Object to send to back
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
sendToBack: function (object) {
|
|
removeFromArray(this._objects, object);
|
|
this._objects.unshift(object);
|
|
return this.renderAll && this.renderAll();
|
|
},
|
|
|
|
/**
|
|
* Moves an object to the top of the stack of drawn objects
|
|
* @param object {fabric.Object} Object to send
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
bringToFront: function (object) {
|
|
removeFromArray(this._objects, object);
|
|
this._objects.push(object);
|
|
return this.renderAll && this.renderAll();
|
|
},
|
|
|
|
/**
|
|
* Moves an object one level down in stack of drawn objects
|
|
* @param object {fabric.Object} Object to send
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
sendBackwards: function (object) {
|
|
var idx = this._objects.indexOf(object),
|
|
nextIntersectingIdx = idx;
|
|
|
|
// if object is not on the bottom of stack
|
|
if (idx !== 0) {
|
|
|
|
// traverse down the stack looking for the nearest intersecting object
|
|
for (var i=idx-1; i>=0; --i) {
|
|
|
|
var isIntersecting = object.intersectsWithObject(this._objects[i]) ||
|
|
object.isContainedWithinObject(this._objects[i]) ||
|
|
this._objects[i].isContainedWithinObject(object);
|
|
|
|
if (isIntersecting) {
|
|
nextIntersectingIdx = i;
|
|
break;
|
|
}
|
|
}
|
|
removeFromArray(this._objects, object);
|
|
this._objects.splice(nextIntersectingIdx, 0, object);
|
|
}
|
|
return this.renderAll && this.renderAll();
|
|
},
|
|
|
|
/**
|
|
* Moves an object one level up in stack of drawn objects
|
|
* @param object {fabric.Object} Object to send
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
bringForward: function (object) {
|
|
var objects = this.getObjects(),
|
|
idx = objects.indexOf(object),
|
|
nextIntersectingIdx = idx;
|
|
|
|
|
|
// if object is not on top of stack (last item in an array)
|
|
if (idx !== objects.length-1) {
|
|
|
|
// traverse up the stack looking for the nearest intersecting object
|
|
for (var i = idx + 1, l = this._objects.length; i < l; ++i) {
|
|
|
|
var isIntersecting = object.intersectsWithObject(objects[i]) ||
|
|
object.isContainedWithinObject(this._objects[i]) ||
|
|
this._objects[i].isContainedWithinObject(object);
|
|
|
|
if (isIntersecting) {
|
|
nextIntersectingIdx = i;
|
|
break;
|
|
}
|
|
}
|
|
removeFromArray(objects, object);
|
|
objects.splice(nextIntersectingIdx, 0, object);
|
|
}
|
|
return this.renderAll && this.renderAll();
|
|
},
|
|
|
|
/**
|
|
* Moves an object to specified level in stack of drawn objects
|
|
* @param object {fabric.Object} Object to send
|
|
* @param {Number} index Position to move to
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
moveTo: function (object, index) {
|
|
removeFromArray(this._objects, object);
|
|
this._objects.splice(index, 0, object);
|
|
return this.renderAll && this.renderAll();
|
|
},
|
|
|
|
/**
|
|
* Clears a canvas element and removes all event handlers.
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
dispose: function () {
|
|
this.clear();
|
|
|
|
if (!this.interactive) return this;
|
|
|
|
if (fabric.isTouchSupported) {
|
|
removeListener(this.upperCanvasEl, 'touchstart', this._onMouseDown);
|
|
removeListener(this.upperCanvasEl, 'touchmove', this._onMouseMove);
|
|
if (typeof Event !== 'undefined' && 'remove' in Event) {
|
|
Event.remove(this.upperCanvasEl, 'gesture', this._onGesture);
|
|
}
|
|
}
|
|
else {
|
|
removeListener(this.upperCanvasEl, 'mousedown', this._onMouseDown);
|
|
removeListener(this.upperCanvasEl, 'mousemove', this._onMouseMove);
|
|
removeListener(fabric.window, 'resize', this._onResize);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {HTMLImageElement} imgEl
|
|
*/
|
|
_resizeImageToFit: function (imgEl) {
|
|
|
|
var imageWidth = imgEl.width || imgEl.offsetWidth,
|
|
widthScaleFactor = this.getWidth() / imageWidth;
|
|
|
|
// scale image down so that it has original dimensions when printed in large resolution
|
|
if (imageWidth) {
|
|
imgEl.width = imageWidth * widthScaleFactor;
|
|
}
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns a string representation of an instance
|
|
* @return {String} string representation of an instance
|
|
*/
|
|
fabric.StaticCanvas.prototype.toString = function () { // Assign explicitly since `extend` doesn't take care of DontEnum bug yet
|
|
return '#<fabric.Canvas (' + this.complexity() + '): '+
|
|
'{ objects: ' + this.getObjects().length + ' }>';
|
|
};
|
|
|
|
extend(fabric.StaticCanvas, /** @lends fabric.StaticCanvas */ {
|
|
|
|
/**
|
|
* @static
|
|
* @type String
|
|
*/
|
|
EMPTY_JSON: '{"objects": [], "background": "white"}',
|
|
|
|
/**
|
|
* Takes <canvas> element and transforms its data in such way that it becomes grayscale
|
|
* @static
|
|
* @param {HTMLCanvasElement} canvasEl
|
|
*/
|
|
toGrayscale: function (canvasEl) {
|
|
var context = canvasEl.getContext('2d'),
|
|
imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height),
|
|
data = imageData.data,
|
|
iLen = imageData.width,
|
|
jLen = imageData.height,
|
|
index, average, i, j;
|
|
|
|
for (i = 0; i < iLen; i++) {
|
|
for (j = 0; j < jLen; j++) {
|
|
|
|
index = (i * 4) * jLen + (j * 4);
|
|
average = (data[index] + data[index + 1] + data[index + 2]) / 3;
|
|
|
|
data[index] = average;
|
|
data[index + 1] = average;
|
|
data[index + 2] = average;
|
|
}
|
|
}
|
|
|
|
context.putImageData(imageData, 0, 0);
|
|
},
|
|
|
|
/**
|
|
* Provides a way to check support of some of the canvas methods
|
|
* (either those of HTMLCanvasElement itself, or rendering context)
|
|
*
|
|
* @param methodName {String} Method to check support for;
|
|
* Could be one of "getImageData", "toDataURL", "toDataURLWithQuality" or "setLineDash"
|
|
* @return {Boolean | null} `true` if method is supported (or at least exists),
|
|
* `null` if canvas element or context can not be initialized
|
|
*/
|
|
supports: function (methodName) {
|
|
var el = fabric.util.createCanvasElement();
|
|
|
|
if (!el || !el.getContext) {
|
|
return null;
|
|
}
|
|
|
|
var ctx = el.getContext('2d');
|
|
if (!ctx) {
|
|
return null;
|
|
}
|
|
|
|
switch (methodName) {
|
|
|
|
case 'getImageData':
|
|
return typeof ctx.getImageData !== 'undefined';
|
|
|
|
case 'setLineDash':
|
|
return typeof ctx.setLineDash !== 'undefined';
|
|
|
|
case 'toDataURL':
|
|
return typeof el.toDataURL !== 'undefined';
|
|
|
|
case 'toDataURLWithQuality':
|
|
try {
|
|
el.toDataURL('image/jpeg', 0);
|
|
return true;
|
|
}
|
|
catch (e) { }
|
|
return false;
|
|
|
|
default:
|
|
return null;
|
|
}
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returs JSON representation of canvas
|
|
* @function
|
|
* @param {Array} propertiesToInclude
|
|
* @return {String} json string
|
|
*/
|
|
fabric.StaticCanvas.prototype.toJSON = fabric.StaticCanvas.prototype.toObject;
|
|
|
|
})();
|
|
|
|
/**
|
|
* BaseBrush class
|
|
* @class fabric.BaseBrush
|
|
*/
|
|
fabric.BaseBrush = fabric.util.createClass(/** @lends fabric.BaseBrush.prototype */ {
|
|
|
|
/**
|
|
* Color of a brush
|
|
* @type String
|
|
* @default
|
|
*/
|
|
color: 'rgb(0, 0, 0)',
|
|
|
|
/**
|
|
* Width of a brush
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
width: 1,
|
|
|
|
/**
|
|
* Shadow blur of a brush
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
shadowBlur: 0,
|
|
|
|
/**
|
|
* Shadow color of a brush
|
|
* @type String
|
|
* @default
|
|
*/
|
|
shadowColor: '',
|
|
|
|
/**
|
|
* Shadow offset x of a brush
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
shadowOffsetX: 0,
|
|
|
|
/**
|
|
* Shadow offset y of a brush
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
shadowOffsetY: 0,
|
|
|
|
/**
|
|
* Line endings style of a brush (one of "butt", "round", "square")
|
|
* @type String
|
|
* @default
|
|
*/
|
|
strokeLineCap: 'round',
|
|
|
|
/**
|
|
* Corner style of a brush (one of "bevil", "round", "miter")
|
|
* @type String
|
|
* @default
|
|
*/
|
|
strokeLineJoin: 'round',
|
|
|
|
/**
|
|
* Sets brush styles
|
|
*/
|
|
setBrushStyles: function() {
|
|
var ctx = this.canvas.contextTop;
|
|
|
|
ctx.strokeStyle = this.color;
|
|
ctx.lineWidth = this.width;
|
|
ctx.lineCap = this.strokeLineCap;
|
|
ctx.lineJoin = this.strokeLineJoin;
|
|
},
|
|
|
|
/**
|
|
* Sets brush shadow styles
|
|
*/
|
|
setShadowStyles: function() {
|
|
var ctx = this.canvas.contextTop;
|
|
|
|
ctx.shadowBlur = this.shadowBlur;
|
|
ctx.shadowColor = this.shadowColor || this.color;
|
|
ctx.shadowOffsetX = this.shadowOffsetX;
|
|
ctx.shadowOffsetY = this.shadowOffsetY;
|
|
},
|
|
|
|
/**
|
|
* Remove brush shadow styles
|
|
*/
|
|
removeShadowStyles: function() {
|
|
var ctx = this.canvas.contextTop;
|
|
|
|
ctx.shadowColor = '';
|
|
ctx.shadowBlur = ctx.shadowOffsetX = ctx.shadowOffsetY = 0;
|
|
}
|
|
});
|
|
|
|
(function() {
|
|
|
|
var utilMin = fabric.util.array.min,
|
|
utilMax = fabric.util.array.max;
|
|
|
|
/**
|
|
* PencilBrush class
|
|
* @class fabric.PencilBrush
|
|
* @extends fabric.BaseBrush
|
|
*/
|
|
fabric.PencilBrush = fabric.util.createClass( fabric.BaseBrush, /** @lends fabric.PencilBrush.prototype */ {
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {fabric.Canvas} canvas
|
|
* @return {fabric.PencilBrush} Instance of a pencil brush
|
|
*/
|
|
initialize: function(canvas) {
|
|
this.canvas = canvas;
|
|
this._points = [ ];
|
|
},
|
|
|
|
/**
|
|
* Inovoked on mouse down
|
|
* @param {Object} pointer
|
|
*/
|
|
onMouseDown: function(pointer) {
|
|
this._prepareForDrawing(pointer);
|
|
// capture coordinates immediately
|
|
// this allows to draw dots (when movement never occurs)
|
|
this._captureDrawingPath(pointer);
|
|
},
|
|
|
|
/**
|
|
* Inovoked on mouse move
|
|
* @param {Object} pointer
|
|
*/
|
|
onMouseMove: function(pointer) {
|
|
this._captureDrawingPath(pointer);
|
|
// redraw curve
|
|
// clear top canvas
|
|
this.canvas.clearContext(this.canvas.contextTop);
|
|
this._render(this.canvas.contextTop);
|
|
},
|
|
|
|
/**
|
|
* Invoked on mouse up
|
|
*/
|
|
onMouseUp: function() {
|
|
this._finalizeAndAddPath();
|
|
},
|
|
|
|
/**
|
|
* @param {Object} pointer
|
|
*/
|
|
_prepareForDrawing: function(pointer) {
|
|
|
|
var p = new fabric.Point(pointer.x, pointer.y);
|
|
|
|
this._reset();
|
|
this._addPoint(p);
|
|
|
|
this.canvas.contextTop.moveTo(p.x, p.y);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {fabric.Point} point
|
|
*/
|
|
_addPoint: function(point) {
|
|
this._points.push(point);
|
|
},
|
|
|
|
/**
|
|
* Clear points array and set contextTop canvas
|
|
* style.
|
|
*
|
|
* @private
|
|
*
|
|
*/
|
|
_reset: function() {
|
|
this._points.length = 0;
|
|
|
|
this.setBrushStyles();
|
|
this.setShadowStyles();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*
|
|
* @param point {pointer} (fabric.util.pointer) actual mouse position
|
|
* related to the canvas.
|
|
*/
|
|
_captureDrawingPath: function(pointer) {
|
|
var pointerPoint = new fabric.Point(pointer.x, pointer.y);
|
|
this._addPoint(pointerPoint);
|
|
},
|
|
|
|
/**
|
|
* Draw a smooth path on the topCanvas using quadraticCurveTo
|
|
*
|
|
* @private
|
|
*/
|
|
_render: function() {
|
|
var ctx = this.canvas.contextTop;
|
|
ctx.beginPath();
|
|
|
|
var p1 = this._points[0];
|
|
var p2 = this._points[1];
|
|
|
|
ctx.moveTo(p1.x, p1.y);
|
|
|
|
for (var i = 1, len = this._points.length; i < len; i++) {
|
|
// we pick the point between pi+1 & pi+2 as the
|
|
// end point and p1 as our control point.
|
|
var midPoint = p1.midPointFrom(p2);
|
|
ctx.quadraticCurveTo(p1.x, p1.y, midPoint.x, midPoint.y);
|
|
|
|
p1 = this._points[i];
|
|
p2 = this._points[i+1];
|
|
}
|
|
// Draw last line as a straight line while
|
|
// we wait for the next point to be able to calculate
|
|
// the bezier control point
|
|
ctx.lineTo(p1.x, p1.y);
|
|
ctx.stroke();
|
|
},
|
|
|
|
/**
|
|
* Return an SVG path based on our captured points and their bounding box
|
|
*
|
|
* @private
|
|
*/
|
|
_getSVGPathData: function() {
|
|
this.box = this.getPathBoundingBox(this._points);
|
|
return this.convertPointsToSVGPath(
|
|
this._points, this.box.minx, this.box.maxx, this.box.miny, this.box.maxy);
|
|
},
|
|
|
|
/**
|
|
* Returns bounding box of a path based on given points
|
|
* @param {Array} points
|
|
* @return {Object} object with minx, miny, maxx, maxy
|
|
*/
|
|
getPathBoundingBox: function(points) {
|
|
var xBounds = [],
|
|
yBounds = [],
|
|
p1 = points[0],
|
|
p2 = points[1],
|
|
startPoint = p1;
|
|
|
|
for (var i = 1, len = points.length; i < len; i++) {
|
|
var midPoint = p1.midPointFrom(p2);
|
|
// with startPoint, p1 as control point, midpoint as end point
|
|
xBounds.push(startPoint.x);
|
|
xBounds.push(midPoint.x);
|
|
yBounds.push(startPoint.y);
|
|
yBounds.push(midPoint.y);
|
|
|
|
p1 = points[i];
|
|
p2 = points[i+1];
|
|
startPoint = midPoint;
|
|
} // end for
|
|
|
|
xBounds.push(p1.x);
|
|
yBounds.push(p1.y);
|
|
|
|
return {
|
|
minx: utilMin(xBounds),
|
|
miny: utilMin(yBounds),
|
|
maxx: utilMax(xBounds),
|
|
maxy: utilMax(yBounds)
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Converts points to SVG path
|
|
* @param {Array} points Array of points
|
|
* @return {String} SVG path
|
|
*/
|
|
convertPointsToSVGPath: function(points, minX, maxX, minY) {
|
|
var path = [];
|
|
var p1 = new fabric.Point(points[0].x - minX, points[0].y - minY);
|
|
var p2 = new fabric.Point(points[1].x - minX, points[1].y - minY);
|
|
|
|
path.push('M ', points[0].x - minX, ' ', points[0].y - minY, ' ');
|
|
for (var i = 1, len = points.length; i < len; i++) {
|
|
var midPoint = p1.midPointFrom(p2);
|
|
// p1 is our bezier control point
|
|
// midpoint is our endpoint
|
|
// start point is p(i-1) value.
|
|
path.push('Q ', p1.x, ' ', p1.y, ' ', midPoint.x, ' ', midPoint.y, ' ');
|
|
p1 = new fabric.Point(points[i].x - minX, points[i].y - minY);
|
|
if ((i+1) < points.length) {
|
|
p2 = new fabric.Point(points[i+1].x - minX, points[i+1].y - minY);
|
|
}
|
|
}
|
|
path.push('L ', p1.x, ' ', p1.y, ' ');
|
|
return path;
|
|
},
|
|
|
|
/**
|
|
* Creates fabric.Path object to add on canvas
|
|
* @param {String} pathData Path data
|
|
* @return {fabric.Path} path to add on canvas
|
|
*/
|
|
createPath: function(pathData) {
|
|
var path = new fabric.Path(pathData);
|
|
path.fill = null;
|
|
path.stroke = this.color;
|
|
path.strokeWidth = this.width;
|
|
path.strokeLineCap = this.strokeLineCap;
|
|
path.strokeLineJoin = this.strokeLineJoin;
|
|
path.setShadow({
|
|
color: this.shadowColor || this.color,
|
|
blur: this.shadowBlur,
|
|
offsetX: this.shadowOffsetX,
|
|
offsetY: this.shadowOffsetY,
|
|
affectStroke: true
|
|
});
|
|
return path;
|
|
},
|
|
|
|
/**
|
|
* On mouseup after drawing the path on contextTop canvas
|
|
* we use the points captured to create an new fabric path object
|
|
* and add it to the fabric canvas.
|
|
*
|
|
*/
|
|
_finalizeAndAddPath: function() {
|
|
var ctx = this.canvas.contextTop;
|
|
ctx.closePath();
|
|
|
|
var pathData = this._getSVGPathData().join('');
|
|
if (pathData === "M 0 0 Q 0 0 0 0 L 0 0") {
|
|
// do not create 0 width/height paths, as they are
|
|
// rendered inconsistently across browsers
|
|
// Firefox 4, for example, renders a dot,
|
|
// whereas Chrome 10 renders nothing
|
|
this.canvas.renderAll();
|
|
return;
|
|
}
|
|
|
|
// set path origin coordinates based on our bounding box
|
|
var originLeft = this.box.minx + (this.box.maxx - this.box.minx) /2;
|
|
var originTop = this.box.miny + (this.box.maxy - this.box.miny) /2;
|
|
|
|
this.canvas.contextTop.arc(originLeft, originTop, 3, 0, Math.PI * 2, false);
|
|
|
|
var path = this.createPath(pathData);
|
|
path.set({ left: originLeft, top: originTop });
|
|
|
|
this.canvas.add(path);
|
|
path.setCoords();
|
|
|
|
this.canvas.clearContext(this.canvas.contextTop);
|
|
this.removeShadowStyles();
|
|
this.canvas.renderAll();
|
|
|
|
// fire event 'path' created
|
|
this.canvas.fire('path:created', { path: path });
|
|
}
|
|
});
|
|
})();
|
|
|
|
/**
|
|
* CircleBrush class
|
|
* @class fabric.CircleBrush
|
|
*/
|
|
fabric.CircleBrush = fabric.util.createClass( fabric.BaseBrush, /** @lends fabric.CircleBrush.prototype */ {
|
|
|
|
/**
|
|
* Width of a brush
|
|
* @type Number
|
|
*/
|
|
width: 10,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {fabric.Canvas} canvas
|
|
* @return {fabric.CircleBrush} Instance of a circle brush
|
|
*/
|
|
initialize: function(canvas) {
|
|
this.canvas = canvas;
|
|
this.points = [ ];
|
|
},
|
|
|
|
/**
|
|
* Invoked on mouse down
|
|
* @param {Object} pointer
|
|
*/
|
|
onMouseDown: function() {
|
|
this.points.length = 0;
|
|
this.canvas.clearContext(this.canvas.contextTop);
|
|
this.setShadowStyles();
|
|
},
|
|
|
|
/**
|
|
* Invoked on mouse move
|
|
* @param {Object} pointer
|
|
*/
|
|
onMouseMove: function(pointer) {
|
|
var point = this.addPoint(pointer);
|
|
var ctx = this.canvas.contextTop;
|
|
|
|
ctx.fillStyle = point.fill;
|
|
ctx.beginPath();
|
|
ctx.arc(point.x, point.y, point.radius, 0, Math.PI * 2, false);
|
|
ctx.closePath();
|
|
ctx.fill();
|
|
},
|
|
|
|
/**
|
|
* Invoked on mouse up
|
|
*/
|
|
onMouseUp: function() {
|
|
var originalRenderOnAddition = this.canvas.renderOnAddition;
|
|
this.canvas.renderOnAddition = false;
|
|
|
|
for (var i = 0, len = this.points.length; i < len; i++) {
|
|
var point = this.points[i];
|
|
var circle = new fabric.Circle({
|
|
radius: point.radius,
|
|
left: point.x,
|
|
top: point.y,
|
|
fill: point.fill,
|
|
shadow: {
|
|
color: this.shadowColor || this.color,
|
|
blur: this.shadowBlur,
|
|
offsetX: this.shadowOffsetX,
|
|
offsetY: this.shadowOffsetY
|
|
}
|
|
});
|
|
this.canvas.add(circle);
|
|
}
|
|
|
|
this.canvas.clearContext(this.canvas.contextTop);
|
|
this.removeShadowStyles();
|
|
this.canvas.renderOnAddition = originalRenderOnAddition;
|
|
this.canvas.renderAll();
|
|
},
|
|
|
|
/**
|
|
* @param {Object} pointer
|
|
* @return {fabric.Point} Just added pointer point
|
|
*/
|
|
addPoint: function(pointer) {
|
|
var pointerPoint = new fabric.Point(pointer.x, pointer.y);
|
|
|
|
var circleRadius = fabric.util.getRandomInt(
|
|
Math.max(0, this.width - 20), this.width + 20) / 2;
|
|
|
|
var circleColor = new fabric.Color(this.color)
|
|
.setAlpha(fabric.util.getRandomInt(0, 100) / 100)
|
|
.toRgba();
|
|
|
|
pointerPoint.radius = circleRadius;
|
|
pointerPoint.fill = circleColor;
|
|
|
|
this.points.push(pointerPoint);
|
|
|
|
return pointerPoint;
|
|
}
|
|
});
|
|
|
|
/**
|
|
* SprayBrush class
|
|
* @class fabric.SprayBrush
|
|
*/
|
|
fabric.SprayBrush = fabric.util.createClass( fabric.BaseBrush, /** @lends fabric.SprayBrush.prototype */ {
|
|
|
|
/**
|
|
* Width of a spray
|
|
* @type Number
|
|
*/
|
|
width: 10,
|
|
|
|
/**
|
|
* Density of a spray (number of dots per chunk)
|
|
* @type Number
|
|
*/
|
|
density: 20,
|
|
|
|
/**
|
|
* Width of spray dots
|
|
* @type Number
|
|
*/
|
|
dotWidth: 1,
|
|
|
|
/**
|
|
* Width variance of spray dots
|
|
* @type Number
|
|
*/
|
|
dotWidthVariance: 1,
|
|
|
|
/**
|
|
* Whether opacity of a dot should be random
|
|
* @type Boolean
|
|
*/
|
|
randomOpacity: false,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {fabric.Canvas} canvas
|
|
* @return {fabric.SprayBrush} Instance of a spray brush
|
|
*/
|
|
initialize: function(canvas) {
|
|
this.canvas = canvas;
|
|
this.sprayChunks = [ ];
|
|
},
|
|
|
|
/**
|
|
* Invoked on mouse down
|
|
* @param {Object} pointer
|
|
*/
|
|
onMouseDown: function(pointer) {
|
|
this.sprayChunks.length = 0;
|
|
this.canvas.clearContext(this.canvas.contextTop);
|
|
this.setShadowStyles();
|
|
|
|
this.addSprayChunk(pointer);
|
|
this.render();
|
|
},
|
|
|
|
/**
|
|
* Invoked on mouse move
|
|
* @param {Object} pointer
|
|
*/
|
|
onMouseMove: function(pointer) {
|
|
this.addSprayChunk(pointer);
|
|
this.render();
|
|
},
|
|
|
|
/**
|
|
* Invoked on mouse up
|
|
*/
|
|
onMouseUp: function() {
|
|
var originalRenderOnAddition = this.canvas.renderOnAddition;
|
|
this.canvas.renderOnAddition = false;
|
|
|
|
for (var i = 0, ilen = this.sprayChunks.length; i < ilen; i++) {
|
|
var sprayChunk = this.sprayChunks[i];
|
|
|
|
for (var j = 0, jlen = sprayChunk.length; j < jlen; j++) {
|
|
|
|
var rect = new fabric.Rect({
|
|
width: sprayChunk[j].width,
|
|
height: sprayChunk[j].width,
|
|
left: sprayChunk[j].x + 1,
|
|
top: sprayChunk[j].y + 1,
|
|
fill: this.color,
|
|
shadow: {
|
|
color: this.shadowColor || this.color,
|
|
blur: this.shadowBlur,
|
|
offsetX: this.shadowOffsetX,
|
|
offsetY: this.shadowOffsetY
|
|
}
|
|
});
|
|
|
|
this.canvas.add(rect);
|
|
}
|
|
}
|
|
|
|
this.canvas.clearContext(this.canvas.contextTop);
|
|
this.removeShadowStyles();
|
|
this.canvas.renderOnAddition = originalRenderOnAddition;
|
|
this.canvas.renderAll();
|
|
},
|
|
|
|
/**
|
|
* Renders brush
|
|
*/
|
|
render: function() {
|
|
var ctx = this.canvas.contextTop;
|
|
ctx.fillStyle = this.color;
|
|
ctx.save();
|
|
|
|
for (var i = 0, len = this.sprayChunkPoints.length; i < len; i++) {
|
|
var point = this.sprayChunkPoints[i];
|
|
if (typeof point.opacity !== 'undefined') {
|
|
ctx.globalAlpha = point.opacity;
|
|
}
|
|
ctx.fillRect(point.x, point.y, point.width, point.width);
|
|
}
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* @param {Object} pointer
|
|
*/
|
|
addSprayChunk: function(pointer) {
|
|
this.sprayChunkPoints = [ ];
|
|
|
|
var x, y, width, radius = this.width / 2;
|
|
|
|
for (var i = 0; i < this.density; i++) {
|
|
|
|
x = fabric.util.getRandomInt(pointer.x - radius, pointer.x + radius);
|
|
y = fabric.util.getRandomInt(pointer.y - radius, pointer.y + radius);
|
|
|
|
if (this.dotWidthVariance) {
|
|
width = fabric.util.getRandomInt(
|
|
// bottom clamp width to 1
|
|
Math.max(1, this.dotWidth - this.dotWidthVariance),
|
|
this.dotWidth + this.dotWidthVariance);
|
|
}
|
|
else {
|
|
width = this.dotWidth;
|
|
}
|
|
|
|
var point = { x: x, y: y, width: width };
|
|
|
|
if (this.randomOpacity) {
|
|
point.opacity = fabric.util.getRandomInt(0, 100) / 100;
|
|
}
|
|
|
|
this.sprayChunkPoints.push(point);
|
|
}
|
|
|
|
this.sprayChunks.push(this.sprayChunkPoints);
|
|
}
|
|
});
|
|
|
|
/**
|
|
* PatternBrush class
|
|
* @class fabric.PatternBrush
|
|
* @extends fabric.BaseBrush
|
|
*/
|
|
fabric.PatternBrush = fabric.util.createClass(fabric.PencilBrush, /** @lends fabric.PatternBrush.prototype */ {
|
|
|
|
getPatternSrc: function() {
|
|
|
|
var dotWidth = 20,
|
|
dotDistance = 5,
|
|
patternCanvas = fabric.document.createElement('canvas'),
|
|
patternCtx = patternCanvas.getContext('2d');
|
|
|
|
patternCanvas.width = patternCanvas.height = dotWidth + dotDistance;
|
|
|
|
patternCtx.fillStyle = this.color;
|
|
patternCtx.beginPath();
|
|
patternCtx.arc(dotWidth / 2, dotWidth / 2, dotWidth / 2, 0, Math.PI * 2, false);
|
|
patternCtx.closePath();
|
|
patternCtx.fill();
|
|
|
|
return patternCanvas;
|
|
},
|
|
|
|
getPatternSrcBody: function() {
|
|
return String(this.getPatternSrc)
|
|
.match(/function\s+\w*\s*\(.*\)\s+\{([\s\S]*)\}/)[1]
|
|
.replace('this.color', '"' + this.color + '"');
|
|
},
|
|
|
|
/**
|
|
* Creates "pattern" instance property
|
|
*/
|
|
getPattern: function() {
|
|
return this.canvas.contextTop.createPattern(this.source || this.getPatternSrc(), 'repeat');
|
|
},
|
|
|
|
/**
|
|
* Sets brush styles
|
|
*/
|
|
setBrushStyles: function() {
|
|
this.callSuper('setBrushStyles');
|
|
this.canvas.contextTop.strokeStyle = this.getPattern();
|
|
},
|
|
|
|
/**
|
|
* Creates path
|
|
*/
|
|
createPath: function(pathData) {
|
|
var path = this.callSuper('createPath', pathData);
|
|
path.stroke = new fabric.Pattern({
|
|
source: this.source || this.getPatternSrcBody()
|
|
});
|
|
return path;
|
|
}
|
|
});
|
|
|
|
(function() {
|
|
|
|
var extend = fabric.util.object.extend,
|
|
getPointer = fabric.util.getPointer,
|
|
degreesToRadians = fabric.util.degreesToRadians,
|
|
radiansToDegrees = fabric.util.radiansToDegrees,
|
|
atan2 = Math.atan2,
|
|
abs = Math.abs,
|
|
min = Math.min,
|
|
max = Math.max,
|
|
|
|
STROKE_OFFSET = 0.5;
|
|
|
|
/**
|
|
* Canvas class
|
|
* @class fabric.Canvas
|
|
* @constructor
|
|
* @extends fabric.StaticCanvas
|
|
* @param {HTMLElement | String} el <canvas> element to initialize instance on
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
fabric.Canvas = function(el, options) {
|
|
options || (options = { });
|
|
|
|
this._initStatic(el, options);
|
|
this._initInteractive();
|
|
this._createCacheCanvas();
|
|
|
|
fabric.Canvas.activeInstance = this;
|
|
};
|
|
|
|
function ProtoProxy(){ }
|
|
ProtoProxy.prototype = fabric.StaticCanvas.prototype;
|
|
fabric.Canvas.prototype = new ProtoProxy();
|
|
|
|
var InteractiveMethods = /** @lends fabric.Canvas.prototype */ {
|
|
|
|
/**
|
|
* When true, objects can be transformed by one side (unproportionally)
|
|
* @type Boolean
|
|
*/
|
|
uniScaleTransform: false,
|
|
|
|
/**
|
|
* When true, objects use center point as the origin of transformation
|
|
* @type Boolean
|
|
*/
|
|
centerTransform: false,
|
|
|
|
/**
|
|
* Indicates that canvas is interactive. This property should not be changed.
|
|
* @type Boolean
|
|
*/
|
|
interactive: true,
|
|
|
|
/**
|
|
* Indicates whether group selection should be enabled
|
|
* @type Boolean
|
|
*/
|
|
selection: true,
|
|
|
|
/**
|
|
* Color of selection
|
|
* @type String
|
|
*/
|
|
selectionColor: 'rgba(100, 100, 255, 0.3)', // blue
|
|
|
|
/**
|
|
* Default dash array pattern
|
|
* If not empty the selection border is dashed
|
|
* @type Array
|
|
*/
|
|
selectionDashArray: [ ],
|
|
|
|
/**
|
|
* Color of the border of selection (usually slightly darker than color of selection itself)
|
|
* @type String
|
|
*/
|
|
selectionBorderColor: 'rgba(255, 255, 255, 0.3)',
|
|
|
|
/**
|
|
* Width of a line used in object/group selection
|
|
* @type Number
|
|
*/
|
|
selectionLineWidth: 1,
|
|
|
|
/**
|
|
* Default cursor value used when hovering over an object on canvas
|
|
* @type String
|
|
*/
|
|
hoverCursor: 'move',
|
|
|
|
/**
|
|
* Default cursor value used when moving an object on canvas
|
|
* @type String
|
|
*/
|
|
moveCursor: 'move',
|
|
|
|
/**
|
|
* Default cursor value used for the entire canvas
|
|
* @type String
|
|
*/
|
|
defaultCursor: 'default',
|
|
|
|
/**
|
|
* Cursor value used during free drawing
|
|
* @type String
|
|
*/
|
|
freeDrawingCursor: 'crosshair',
|
|
|
|
/**
|
|
* Cursor value used for rotation point
|
|
* @type String
|
|
*/
|
|
rotationCursor: 'crosshair',
|
|
|
|
/**
|
|
* Default element class that's given to wrapper (div) element of canvas
|
|
* @type String
|
|
*/
|
|
containerClass: 'canvas-container',
|
|
|
|
/**
|
|
* When true, object detection happens on per-pixel basis rather than on per-bounding-box
|
|
* @type Boolean
|
|
*/
|
|
perPixelTargetFind: false,
|
|
|
|
/**
|
|
* Number of pixels around target pixel to tolerate (consider active) during object detection
|
|
* @type Number
|
|
*/
|
|
targetFindTolerance: 0,
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_initInteractive: function() {
|
|
this._currentTransform = null;
|
|
this._groupSelector = null;
|
|
this._initWrapperElement();
|
|
this._createUpperCanvas();
|
|
this._initEvents();
|
|
|
|
this.freeDrawingBrush = fabric.PencilBrush && new fabric.PencilBrush(this);
|
|
|
|
this.calcOffset();
|
|
},
|
|
|
|
/**
|
|
* Resets the current transform to its original values and chooses the type of resizing based on the event
|
|
* @private
|
|
* @param e {Event} Event object fired on mousemove
|
|
*/
|
|
_resetCurrentTransform: function(e) {
|
|
var t = this._currentTransform;
|
|
|
|
t.target.set('scaleX', t.original.scaleX);
|
|
t.target.set('scaleY', t.original.scaleY);
|
|
t.target.set('left', t.original.left);
|
|
t.target.set('top', t.original.top);
|
|
|
|
if (e.altKey || this.centerTransform) {
|
|
if (t.originX !== 'center') {
|
|
if (t.originX === 'right') {
|
|
t.mouseXSign = -1;
|
|
}
|
|
else {
|
|
t.mouseXSign = 1;
|
|
}
|
|
}
|
|
if (t.originY !== 'center') {
|
|
if (t.originY === 'bottom') {
|
|
t.mouseYSign = -1;
|
|
}
|
|
else {
|
|
t.mouseYSign = 1;
|
|
}
|
|
}
|
|
|
|
t.originX = 'center';
|
|
t.originY = 'center';
|
|
}
|
|
else {
|
|
t.originX = t.original.originX;
|
|
t.originY = t.original.originY;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Checks if point is contained within an area of given object
|
|
* @param {Event} e Event object
|
|
* @param {fabric.Object} target Object to test against
|
|
* @return {Boolean} true if point is contained within an area of given object
|
|
*/
|
|
containsPoint: function (e, target) {
|
|
var pointer = this.getPointer(e),
|
|
xy = this._normalizePointer(target, pointer);
|
|
|
|
// http://www.geog.ubc.ca/courses/klink/gis.notes/ncgia/u32.html
|
|
// http://idav.ucdavis.edu/~okreylos/TAship/Spring2000/PointInPolygon.html
|
|
return (target.containsPoint(xy) || target._findTargetCorner(e, this._offset));
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_normalizePointer: function (object, pointer) {
|
|
|
|
var activeGroup = this.getActiveGroup(),
|
|
x = pointer.x,
|
|
y = pointer.y;
|
|
|
|
var isObjectInGroup = (
|
|
activeGroup &&
|
|
object.type !== 'group' &&
|
|
activeGroup.contains(object)
|
|
);
|
|
|
|
if (isObjectInGroup) {
|
|
x -= activeGroup.left;
|
|
y -= activeGroup.top;
|
|
}
|
|
return { x: x, y: y };
|
|
},
|
|
|
|
/**
|
|
* Returns true if object is transparent at a certain location
|
|
* @param {fabric.Object} target Object to check
|
|
* @param {Number} x Left coordinate
|
|
* @param {Number} y Top coordinate
|
|
* @return {Boolean}
|
|
*/
|
|
isTargetTransparent: function (target, x, y) {
|
|
var cacheContext = this.contextCache;
|
|
|
|
var hasBorders = target.hasBorders,
|
|
transparentCorners = target.transparentCorners;
|
|
|
|
target.hasBorders = target.transparentCorners = false;
|
|
|
|
this._draw(cacheContext, target);
|
|
|
|
target.hasBorders = hasBorders;
|
|
target.transparentCorners = transparentCorners;
|
|
|
|
// If tolerance is > 0 adjust start coords to take into account. If moves off Canvas fix to 0
|
|
if (this.targetFindTolerance > 0) {
|
|
if (x > this.targetFindTolerance) {
|
|
x -= this.targetFindTolerance;
|
|
}
|
|
else {
|
|
x = 0;
|
|
}
|
|
if (y > this.targetFindTolerance) {
|
|
y -= this.targetFindTolerance;
|
|
}
|
|
else {
|
|
y = 0;
|
|
}
|
|
}
|
|
|
|
var isTransparent = true;
|
|
var imageData = cacheContext.getImageData(
|
|
x, y, (this.targetFindTolerance * 2) || 1, (this.targetFindTolerance * 2) || 1);
|
|
|
|
// Split image data - for tolerance > 1, pixelDataSize = 4;
|
|
for (var i = 3, l = imageData.data.length; i < l; i += 4) {
|
|
var temp = imageData.data[i];
|
|
isTransparent = temp <= 0;
|
|
if (isTransparent === false) break; //Stop if colour found
|
|
}
|
|
|
|
imageData = null;
|
|
this.clearContext(cacheContext);
|
|
|
|
return isTransparent;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_shouldClearSelection: function (e, target) {
|
|
var activeGroup = this.getActiveGroup();
|
|
|
|
return (
|
|
!target || (
|
|
target &&
|
|
activeGroup &&
|
|
!activeGroup.contains(target) &&
|
|
activeGroup !== target &&
|
|
!e.shiftKey) || (
|
|
target &&
|
|
!target.selectable)
|
|
);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_setupCurrentTransform: function (e, target) {
|
|
if (!target) return;
|
|
|
|
var action = 'drag',
|
|
corner,
|
|
pointer = getPointer(e, target.canvas.upperCanvasEl);
|
|
|
|
corner = target._findTargetCorner(e, this._offset);
|
|
if (corner) {
|
|
action = (corner === 'ml' || corner === 'mr')
|
|
? 'scaleX'
|
|
: (corner === 'mt' || corner === 'mb')
|
|
? 'scaleY'
|
|
: corner === 'mtr'
|
|
? 'rotate'
|
|
: 'scale';
|
|
}
|
|
|
|
var originX = "center", originY = "center";
|
|
|
|
if (corner === 'ml' || corner === 'tl' || corner === 'bl') {
|
|
originX = "right";
|
|
}
|
|
else if (corner === 'mr' || corner === 'tr' || corner === 'br') {
|
|
originX = "left";
|
|
}
|
|
|
|
if (corner === 'tl' || corner === 'mt' || corner === 'tr') {
|
|
originY = "bottom";
|
|
}
|
|
else if (corner === 'bl' || corner === 'mb' || corner === 'br') {
|
|
originY = "top";
|
|
}
|
|
|
|
if (corner === 'mtr') {
|
|
originX = 'center';
|
|
originY = 'center';
|
|
}
|
|
|
|
// var center = target.getCenterPoint();
|
|
this._currentTransform = {
|
|
target: target,
|
|
action: action,
|
|
scaleX: target.scaleX,
|
|
scaleY: target.scaleY,
|
|
offsetX: pointer.x - target.left,
|
|
offsetY: pointer.y - target.top,
|
|
originX: originX,
|
|
originY: originY,
|
|
ex: pointer.x,
|
|
ey: pointer.y,
|
|
left: target.left,
|
|
top: target.top,
|
|
theta: degreesToRadians(target.angle),
|
|
width: target.width * target.scaleX,
|
|
mouseXSign: 1,
|
|
mouseYSign: 1
|
|
};
|
|
|
|
this._currentTransform.original = {
|
|
left: target.left,
|
|
top: target.top,
|
|
scaleX: target.scaleX,
|
|
scaleY: target.scaleY,
|
|
originX: originX,
|
|
originY: originY
|
|
};
|
|
|
|
this._resetCurrentTransform(e);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param e {Event}
|
|
* @param target {fabric.Object}
|
|
* @return {Boolean}
|
|
*/
|
|
_shouldHandleGroupLogic: function(e, target) {
|
|
var activeObject = this.getActiveObject();
|
|
return e.shiftKey &&
|
|
(this.getActiveGroup() || (activeObject && activeObject !== target))
|
|
&& this.selection;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_handleGroupLogic: function (e, target) {
|
|
if (target === this.getActiveGroup()) {
|
|
// if it's a group, find target again, this time skipping group
|
|
target = this.findTarget(e, true);
|
|
// if even object is not found, bail out
|
|
if (!target || target.isType('group')) {
|
|
return;
|
|
}
|
|
}
|
|
var activeGroup = this.getActiveGroup();
|
|
if (activeGroup) {
|
|
if (activeGroup.contains(target)) {
|
|
activeGroup.removeWithUpdate(target);
|
|
this._resetObjectTransform(activeGroup);
|
|
target.set('active', false);
|
|
if (activeGroup.size() === 1) {
|
|
// remove group alltogether if after removal it only contains 1 object
|
|
this.discardActiveGroup();
|
|
}
|
|
}
|
|
else {
|
|
activeGroup.addWithUpdate(target);
|
|
this._resetObjectTransform(activeGroup);
|
|
}
|
|
this.fire('selection:created', { target: activeGroup, e: e });
|
|
activeGroup.set('active', true);
|
|
}
|
|
else {
|
|
// group does not exist
|
|
if (this._activeObject) {
|
|
// only if there's an active object
|
|
if (target !== this._activeObject) {
|
|
// and that object is not the actual target
|
|
var group = new fabric.Group([ this._activeObject, target ]);
|
|
this.setActiveGroup(group);
|
|
activeGroup = this.getActiveGroup();
|
|
}
|
|
}
|
|
// activate target object in any case
|
|
target.set('active', true);
|
|
}
|
|
|
|
if (activeGroup) {
|
|
activeGroup.saveCoords();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Translates object by "setting" its left/top
|
|
* @private
|
|
* @param x {Number} pointer's x coordinate
|
|
* @param y {Number} pointer's y coordinate
|
|
*/
|
|
_translateObject: function (x, y) {
|
|
var target = this._currentTransform.target;
|
|
|
|
if (!target.get('lockMovementX')) {
|
|
target.set('left', x - this._currentTransform.offsetX);
|
|
}
|
|
if (!target.get('lockMovementY')) {
|
|
target.set('top', y - this._currentTransform.offsetY);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Scales object by invoking its scaleX/scaleY methods
|
|
* @private
|
|
* @param x {Number} pointer's x coordinate
|
|
* @param y {Number} pointer's y coordinate
|
|
* @param by {String} Either 'x' or 'y' - specifies dimension constraint by which to scale an object.
|
|
* When not provided, an object is scaled by both dimensions equally
|
|
*/
|
|
_scaleObject: function (x, y, by) {
|
|
var t = this._currentTransform,
|
|
offset = this._offset,
|
|
target = t.target;
|
|
|
|
var lockScalingX = target.get('lockScalingX'),
|
|
lockScalingY = target.get('lockScalingY');
|
|
|
|
if (lockScalingX && lockScalingY) return;
|
|
|
|
// Get the constraint point
|
|
var constraintPosition = target.translateToOriginPoint(target.getCenterPoint(), t.originX, t.originY);
|
|
var localMouse = target.toLocalPoint(new fabric.Point(x - offset.left, y - offset.top), t.originX, t.originY);
|
|
|
|
if (t.originX === 'right') {
|
|
localMouse.x *= -1;
|
|
}
|
|
else if (t.originX === 'center') {
|
|
localMouse.x *= t.mouseXSign * 2;
|
|
|
|
if (localMouse.x < 0) {
|
|
t.mouseXSign = -t.mouseXSign;
|
|
}
|
|
}
|
|
|
|
if (t.originY === 'bottom') {
|
|
localMouse.y *= -1;
|
|
}
|
|
else if (t.originY === 'center') {
|
|
localMouse.y *= t.mouseYSign * 2;
|
|
|
|
if (localMouse.y < 0) {
|
|
t.mouseYSign = -t.mouseYSign;
|
|
}
|
|
}
|
|
|
|
// Actually scale the object
|
|
var newScaleX = target.scaleX, newScaleY = target.scaleY;
|
|
if (by === 'equally' && !lockScalingX && !lockScalingY) {
|
|
var dist = localMouse.y + localMouse.x;
|
|
var lastDist = (target.height) * t.original.scaleY +
|
|
(target.width) * t.original.scaleX +
|
|
(target.padding * 2) -
|
|
(target.strokeWidth * 2) + 1 /* additional offset needed probably due to subpixel rendering, and avoids jerk when scaling an object */;
|
|
|
|
// We use t.scaleX/Y instead of target.scaleX/Y because the object may have a min scale and we'll loose the proportions
|
|
newScaleX = t.original.scaleX * dist/lastDist;
|
|
newScaleY = t.original.scaleY * dist/lastDist;
|
|
|
|
target.set('scaleX', newScaleX);
|
|
target.set('scaleY', newScaleY);
|
|
}
|
|
else if (!by) {
|
|
newScaleX = localMouse.x/(target.width+target.padding);
|
|
newScaleY = localMouse.y/(target.height+target.padding);
|
|
|
|
lockScalingX || target.set('scaleX', newScaleX);
|
|
lockScalingY || target.set('scaleY', newScaleY);
|
|
}
|
|
else if (by === 'x' && !target.get('lockUniScaling')) {
|
|
newScaleX = localMouse.x/(target.width+target.padding);
|
|
lockScalingX || target.set('scaleX', newScaleX);
|
|
}
|
|
else if (by === 'y' && !target.get('lockUniScaling')) {
|
|
newScaleY = localMouse.y/(target.height+target.padding);
|
|
lockScalingY || target.set('scaleY', newScaleY);
|
|
}
|
|
|
|
// Check if we flipped
|
|
if (newScaleX < 0)
|
|
{
|
|
if (t.originX === 'left')
|
|
t.originX = 'right';
|
|
else if (t.originX === 'right')
|
|
t.originX = 'left';
|
|
}
|
|
|
|
if (newScaleY < 0)
|
|
{
|
|
if (t.originY === 'top')
|
|
t.originY = 'bottom';
|
|
else if (t.originY === 'bottom')
|
|
t.originY = 'top';
|
|
}
|
|
|
|
// Make sure the constraints apply
|
|
target.setPositionByOrigin(constraintPosition, t.originX, t.originY);
|
|
},
|
|
|
|
/**
|
|
* Rotates object by invoking its rotate method
|
|
* @private
|
|
* @param x {Number} pointer's x coordinate
|
|
* @param y {Number} pointer's y coordinate
|
|
*/
|
|
_rotateObject: function (x, y) {
|
|
|
|
var t = this._currentTransform,
|
|
o = this._offset;
|
|
|
|
if (t.target.get('lockRotation')) return;
|
|
|
|
var lastAngle = atan2(t.ey - t.top - o.top, t.ex - t.left - o.left),
|
|
curAngle = atan2(y - t.top - o.top, x - t.left - o.left);
|
|
|
|
t.target.angle = radiansToDegrees(curAngle - lastAngle + t.theta);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_setCursor: function (value) {
|
|
this.upperCanvasEl.style.cursor = value;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_resetObjectTransform: function (target) {
|
|
target.scaleX = 1;
|
|
target.scaleY = 1;
|
|
target.setAngle(0);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_drawSelection: function () {
|
|
var ctx = this.contextTop,
|
|
groupSelector = this._groupSelector,
|
|
left = groupSelector.left,
|
|
top = groupSelector.top,
|
|
aleft = abs(left),
|
|
atop = abs(top);
|
|
|
|
ctx.fillStyle = this.selectionColor;
|
|
|
|
ctx.fillRect(
|
|
groupSelector.ex - ((left > 0) ? 0 : -left),
|
|
groupSelector.ey - ((top > 0) ? 0 : -top),
|
|
aleft,
|
|
atop
|
|
);
|
|
|
|
ctx.lineWidth = this.selectionLineWidth;
|
|
ctx.strokeStyle = this.selectionBorderColor;
|
|
|
|
// selection border
|
|
if (this.selectionDashArray.length > 1) {
|
|
|
|
var px = groupSelector.ex + STROKE_OFFSET - ((left > 0) ? 0: aleft);
|
|
var py = groupSelector.ey + STROKE_OFFSET - ((top > 0) ? 0: atop);
|
|
|
|
ctx.beginPath();
|
|
|
|
fabric.util.drawDashedLine(ctx, px, py, px+aleft, py, this.selectionDashArray);
|
|
fabric.util.drawDashedLine(ctx, px, py+atop-1, px+aleft, py+atop-1, this.selectionDashArray);
|
|
fabric.util.drawDashedLine(ctx, px, py, px, py+atop, this.selectionDashArray);
|
|
fabric.util.drawDashedLine(ctx, px+aleft-1, py, px+aleft-1, py+atop, this.selectionDashArray);
|
|
|
|
ctx.closePath();
|
|
ctx.stroke();
|
|
}
|
|
else {
|
|
ctx.strokeRect(
|
|
groupSelector.ex + STROKE_OFFSET - ((left > 0) ? 0 : aleft),
|
|
groupSelector.ey + STROKE_OFFSET - ((top > 0) ? 0 : atop),
|
|
aleft,
|
|
atop
|
|
);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_findSelectedObjects: function (e) {
|
|
var group = [ ],
|
|
x1 = this._groupSelector.ex,
|
|
y1 = this._groupSelector.ey,
|
|
x2 = x1 + this._groupSelector.left,
|
|
y2 = y1 + this._groupSelector.top,
|
|
currentObject,
|
|
selectionX1Y1 = new fabric.Point(min(x1, x2), min(y1, y2)),
|
|
selectionX2Y2 = new fabric.Point(max(x1, x2), max(y1, y2));
|
|
|
|
for (var i = 0, len = this._objects.length; i < len; ++i) {
|
|
currentObject = this._objects[i];
|
|
|
|
if (!currentObject) continue;
|
|
|
|
if (currentObject.intersectsWithRect(selectionX1Y1, selectionX2Y2) ||
|
|
currentObject.isContainedWithinRect(selectionX1Y1, selectionX2Y2) ||
|
|
currentObject.containsPoint(selectionX1Y1) ||
|
|
currentObject.containsPoint(selectionX2Y2)) {
|
|
|
|
if (this.selection && currentObject.selectable) {
|
|
currentObject.set('active', true);
|
|
group.push(currentObject);
|
|
}
|
|
}
|
|
}
|
|
|
|
// do not create group for 1 element only
|
|
if (group.length === 1) {
|
|
this.setActiveObject(group[0], e);
|
|
}
|
|
else if (group.length > 1) {
|
|
group = new fabric.Group(group);
|
|
this.setActiveGroup(group);
|
|
group.saveCoords();
|
|
this.fire('selection:created', { target: group });
|
|
this.renderAll();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Method that determines what object we are clicking on
|
|
* @param {Event} e mouse event
|
|
* @param {Boolean} skipGroup when true, group is skipped and only objects are traversed through
|
|
*/
|
|
findTarget: function (e, skipGroup) {
|
|
|
|
var target,
|
|
pointer = this.getPointer(e);
|
|
|
|
if (this.controlsAboveOverlay &&
|
|
this.lastRenderedObjectWithControlsAboveOverlay &&
|
|
this.lastRenderedObjectWithControlsAboveOverlay.visible &&
|
|
this.containsPoint(e, this.lastRenderedObjectWithControlsAboveOverlay) &&
|
|
this.lastRenderedObjectWithControlsAboveOverlay._findTargetCorner(e, this._offset)) {
|
|
target = this.lastRenderedObjectWithControlsAboveOverlay;
|
|
return target;
|
|
}
|
|
|
|
// first check current group (if one exists)
|
|
var activeGroup = this.getActiveGroup();
|
|
if (activeGroup && !skipGroup && this.containsPoint(e, activeGroup)) {
|
|
target = activeGroup;
|
|
return target;
|
|
}
|
|
|
|
// then check all of the objects on canvas
|
|
// Cache all targets where their bounding box contains point.
|
|
var possibleTargets = [];
|
|
for (var i = this._objects.length; i--; ) {
|
|
if (this._objects[i] && this._objects[i].visible && this.containsPoint(e, this._objects[i])) {
|
|
if (this.perPixelTargetFind || this._objects[i].perPixelTargetFind) {
|
|
possibleTargets[possibleTargets.length] = this._objects[i];
|
|
}
|
|
else {
|
|
target = this._objects[i];
|
|
this.relatedTarget = target;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
for (var j = 0, len = possibleTargets.length; j < len; j++) {
|
|
pointer = this.getPointer(e);
|
|
var isTransparent = this.isTargetTransparent(possibleTargets[j], pointer.x, pointer.y);
|
|
if (!isTransparent) {
|
|
target = possibleTargets[j];
|
|
this.relatedTarget = target;
|
|
break;
|
|
}
|
|
}
|
|
|
|
return target;
|
|
},
|
|
|
|
/**
|
|
* Returns pointer coordinates relative to canvas.
|
|
* @param {Event} e
|
|
* @return {Object} object with "x" and "y" number values
|
|
*/
|
|
getPointer: function (e) {
|
|
var pointer = getPointer(e, this.upperCanvasEl);
|
|
return {
|
|
x: pointer.x - this._offset.left,
|
|
y: pointer.y - this._offset.top
|
|
};
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {HTMLElement|String} canvasEl Canvas element
|
|
* @throws {CANVAS_INIT_ERROR} If canvas can not be initialized
|
|
*/
|
|
_createUpperCanvas: function () {
|
|
this.upperCanvasEl = this._createCanvasElement();
|
|
this.upperCanvasEl.className = 'upper-canvas';
|
|
|
|
this.wrapperEl.appendChild(this.upperCanvasEl);
|
|
|
|
this._applyCanvasStyle(this.upperCanvasEl);
|
|
this.contextTop = this.upperCanvasEl.getContext('2d');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_createCacheCanvas: function () {
|
|
this.cacheCanvasEl = this._createCanvasElement();
|
|
this.cacheCanvasEl.setAttribute('width', this.width);
|
|
this.cacheCanvasEl.setAttribute('height', this.height);
|
|
this.contextCache = this.cacheCanvasEl.getContext('2d');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Number} width
|
|
* @param {Number} height
|
|
*/
|
|
_initWrapperElement: function () {
|
|
this.wrapperEl = fabric.util.wrapElement(this.lowerCanvasEl, 'div', {
|
|
'class': this.containerClass
|
|
});
|
|
fabric.util.setStyle(this.wrapperEl, {
|
|
width: this.getWidth() + 'px',
|
|
height: this.getHeight() + 'px',
|
|
position: 'relative'
|
|
});
|
|
fabric.util.makeElementUnselectable(this.wrapperEl);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Element} element
|
|
*/
|
|
_applyCanvasStyle: function (element) {
|
|
var width = this.getWidth() || element.width,
|
|
height = this.getHeight() || element.height;
|
|
|
|
fabric.util.setStyle(element, {
|
|
position: 'absolute',
|
|
width: width + 'px',
|
|
height: height + 'px',
|
|
left: 0,
|
|
top: 0
|
|
});
|
|
element.width = width;
|
|
element.height = height;
|
|
fabric.util.makeElementUnselectable(element);
|
|
},
|
|
|
|
/**
|
|
* Returns context of canvas where object selection is drawn
|
|
* @return {CanvasRenderingContext2D}
|
|
*/
|
|
getSelectionContext: function() {
|
|
return this.contextTop;
|
|
},
|
|
|
|
/**
|
|
* Returns <canvas> element on which object selection is drawn
|
|
* @return {HTMLCanvasElement}
|
|
*/
|
|
getSelectionElement: function () {
|
|
return this.upperCanvasEl;
|
|
},
|
|
|
|
/**
|
|
* Sets given object as the only active object on canvas
|
|
* @param object {fabric.Object} Object to set as an active one
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
setActiveObject: function (object, e) {
|
|
if (this._activeObject) {
|
|
this._activeObject.set('active', false);
|
|
}
|
|
this._activeObject = object;
|
|
object.set('active', true);
|
|
|
|
this.renderAll();
|
|
|
|
this.fire('object:selected', { target: object, e: e });
|
|
object.fire('selected', { e: e });
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns currently active object
|
|
* @return {fabric.Object} active object
|
|
*/
|
|
getActiveObject: function () {
|
|
return this._activeObject;
|
|
},
|
|
|
|
/**
|
|
* Discards currently active object
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
discardActiveObject: function () {
|
|
if (this._activeObject) {
|
|
this._activeObject.set('active', false);
|
|
}
|
|
this._activeObject = null;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Sets active group to a speicified one
|
|
* @param {fabric.Group} group Group to set as a current one
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
setActiveGroup: function (group) {
|
|
this._activeGroup = group;
|
|
if (group) {
|
|
group.canvas = this;
|
|
group.set('active', true);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns currently active group
|
|
* @return {fabric.Group} Current group
|
|
*/
|
|
getActiveGroup: function () {
|
|
return this._activeGroup;
|
|
},
|
|
|
|
/**
|
|
* Removes currently active group
|
|
* @return {fabric.Canvas} thisArg
|
|
*/
|
|
discardActiveGroup: function () {
|
|
var g = this.getActiveGroup();
|
|
if (g) {
|
|
g.destroy();
|
|
}
|
|
return this.setActiveGroup(null);
|
|
},
|
|
|
|
/**
|
|
* Deactivates all objects on canvas, removing any active group or object
|
|
* @return {fabric.Canvas} thisArg
|
|
*/
|
|
deactivateAll: function () {
|
|
var allObjects = this.getObjects(),
|
|
i = 0,
|
|
len = allObjects.length;
|
|
for ( ; i < len; i++) {
|
|
allObjects[i].set('active', false);
|
|
}
|
|
this.discardActiveGroup();
|
|
this.discardActiveObject();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Deactivates all objects and dispatches appropriate events
|
|
* @return {fabric.Canvas} thisArg
|
|
*/
|
|
deactivateAllWithDispatch: function () {
|
|
var activeObject = this.getActiveGroup() || this.getActiveObject();
|
|
if (activeObject) {
|
|
this.fire('before:selection:cleared', { target: activeObject });
|
|
}
|
|
this.deactivateAll();
|
|
if (activeObject) {
|
|
this.fire('selection:cleared');
|
|
}
|
|
return this;
|
|
}
|
|
};
|
|
|
|
fabric.Canvas.prototype.toString = fabric.StaticCanvas.prototype.toString;
|
|
extend(fabric.Canvas.prototype, InteractiveMethods);
|
|
|
|
// iterating manually to workaround Opera's bug
|
|
// where "prototype" property is enumerable and overrides existing prototype
|
|
for (var prop in fabric.StaticCanvas) {
|
|
if (prop !== 'prototype') {
|
|
fabric.Canvas[prop] = fabric.StaticCanvas[prop];
|
|
}
|
|
}
|
|
|
|
if (fabric.isTouchSupported) {
|
|
/** @ignore */
|
|
fabric.Canvas.prototype._setCursorFromEvent = function() { };
|
|
}
|
|
|
|
/**
|
|
* @class fabric.Element
|
|
* @alias fabric.Canvas
|
|
* @deprecated Use {@link fabric.Canvas} instead.
|
|
* @constructor
|
|
*/
|
|
fabric.Element = fabric.Canvas;
|
|
})();
|
|
|
|
(function(){
|
|
|
|
var cursorMap = {
|
|
'tr': 'ne-resize',
|
|
'br': 'se-resize',
|
|
'bl': 'sw-resize',
|
|
'tl': 'nw-resize',
|
|
'ml': 'w-resize',
|
|
'mt': 'n-resize',
|
|
'mr': 'e-resize',
|
|
'mb': 's-resize'
|
|
},
|
|
addListener = fabric.util.addListener,
|
|
removeListener = fabric.util.removeListener,
|
|
getPointer = fabric.util.getPointer;
|
|
|
|
fabric.util.object.extend(fabric.Canvas.prototype, /** @lends fabric.Canvas.prototype */ {
|
|
|
|
/**
|
|
* Adds mouse listeners to canvas
|
|
* @private
|
|
*/
|
|
_initEvents: function () {
|
|
var _this = this;
|
|
|
|
this._onMouseDown = this._onMouseDown.bind(this);
|
|
this._onMouseMove = this._onMouseMove.bind(this);
|
|
this._onMouseUp = this._onMouseUp.bind(this);
|
|
this._onResize = this._onResize.bind(this);
|
|
|
|
this._onGesture = function(e, s) {
|
|
_this.__onTransformGesture(e, s);
|
|
};
|
|
|
|
addListener(fabric.window, 'resize', this._onResize);
|
|
|
|
if (fabric.isTouchSupported) {
|
|
addListener(this.upperCanvasEl, 'touchstart', this._onMouseDown);
|
|
addListener(this.upperCanvasEl, 'touchmove', this._onMouseMove);
|
|
|
|
if (typeof Event !== 'undefined' && 'add' in Event) {
|
|
Event.add(this.upperCanvasEl, 'gesture', this._onGesture);
|
|
}
|
|
}
|
|
else {
|
|
addListener(this.upperCanvasEl, 'mousedown', this._onMouseDown);
|
|
addListener(this.upperCanvasEl, 'mousemove', this._onMouseMove);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object fired on mousedown
|
|
*/
|
|
_onMouseDown: function (e) {
|
|
this.__onMouseDown(e);
|
|
|
|
!fabric.isTouchSupported && addListener(fabric.document, 'mouseup', this._onMouseUp);
|
|
fabric.isTouchSupported && addListener(fabric.document, 'touchend', this._onMouseUp);
|
|
|
|
!fabric.isTouchSupported && addListener(fabric.document, 'mousemove', this._onMouseMove);
|
|
fabric.isTouchSupported && addListener(fabric.document, 'touchmove', this._onMouseMove);
|
|
|
|
!fabric.isTouchSupported && removeListener(this.upperCanvasEl, 'mousemove', this._onMouseMove);
|
|
fabric.isTouchSupported && removeListener(this.upperCanvasEl, 'touchmove', this._onMouseMove);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object fired on mouseup
|
|
*/
|
|
_onMouseUp: function (e) {
|
|
this.__onMouseUp(e);
|
|
|
|
!fabric.isTouchSupported && removeListener(fabric.document, 'mouseup', this._onMouseUp);
|
|
fabric.isTouchSupported && removeListener(fabric.document, 'touchend', this._onMouseUp);
|
|
|
|
!fabric.isTouchSupported && removeListener(fabric.document, 'mousemove', this._onMouseMove);
|
|
fabric.isTouchSupported && removeListener(fabric.document, 'touchmove', this._onMouseMove);
|
|
|
|
!fabric.isTouchSupported && addListener(this.upperCanvasEl, 'mousemove', this._onMouseMove);
|
|
fabric.isTouchSupported && addListener(this.upperCanvasEl, 'touchmove', this._onMouseMove);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object fired on mousemove
|
|
*/
|
|
_onMouseMove: function (e) {
|
|
e.preventDefault && e.preventDefault();
|
|
this.__onMouseMove(e);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_onResize: function () {
|
|
this.calcOffset();
|
|
},
|
|
|
|
/**
|
|
* Method that defines the actions when mouse is released on canvas.
|
|
* The method resets the currentTransform parameters, store the image corner
|
|
* position in the image object and render the canvas on top.
|
|
* @private
|
|
* @param {Event} e Event object fired on mouseup
|
|
*/
|
|
__onMouseUp: function (e) {
|
|
|
|
var target;
|
|
|
|
if (this.isDrawingMode && this._isCurrentlyDrawing) {
|
|
this._isCurrentlyDrawing = false;
|
|
this.freeDrawingBrush.onMouseUp();
|
|
this.fire('mouse:up', { e: e });
|
|
return;
|
|
}
|
|
|
|
if (this._currentTransform) {
|
|
|
|
var transform = this._currentTransform;
|
|
|
|
target = transform.target;
|
|
if (target._scaling) {
|
|
target._scaling = false;
|
|
}
|
|
|
|
target.isMoving = false;
|
|
target.setCoords();
|
|
|
|
// only fire :modified event if target coordinates were changed during mousedown-mouseup
|
|
if (this.stateful && target.hasStateChanged()) {
|
|
this.fire('object:modified', { target: target });
|
|
target.fire('modified');
|
|
}
|
|
|
|
if (this._previousOriginX) {
|
|
this._currentTransform.target.adjustPosition(this._previousOriginX);
|
|
this._previousOriginX = null;
|
|
}
|
|
}
|
|
|
|
this._currentTransform = null;
|
|
|
|
if (this.selection && this._groupSelector) {
|
|
// group selection was completed, determine its bounds
|
|
this._findSelectedObjects(e);
|
|
}
|
|
var activeGroup = this.getActiveGroup();
|
|
if (activeGroup) {
|
|
activeGroup.setObjectsCoords();
|
|
activeGroup.set('isMoving', false);
|
|
this._setCursor(this.defaultCursor);
|
|
}
|
|
|
|
// clear selection
|
|
this._groupSelector = null;
|
|
this.renderAll();
|
|
|
|
this._setCursorFromEvent(e, target);
|
|
|
|
// fix for FF
|
|
this._setCursor('');
|
|
|
|
var _this = this;
|
|
setTimeout(function () {
|
|
_this._setCursorFromEvent(e, target);
|
|
}, 50);
|
|
|
|
this.fire('mouse:up', { target: target, e: e });
|
|
target && target.fire('mouseup', { e: e });
|
|
},
|
|
|
|
/**
|
|
* Method that defines the actions when mouse is clic ked on canvas.
|
|
* The method inits the currentTransform parameters and renders all the
|
|
* canvas so the current image can be placed on the top canvas and the rest
|
|
* in on the container one.
|
|
* @private
|
|
* @param {Event} e Event object fired on mousedown
|
|
*/
|
|
__onMouseDown: function (e) {
|
|
|
|
var pointer;
|
|
|
|
// accept only left clicks
|
|
var isLeftClick = 'which' in e ? e.which === 1 : e.button === 1;
|
|
if (!isLeftClick && !fabric.isTouchSupported) return;
|
|
|
|
if (this.isDrawingMode) {
|
|
pointer = this.getPointer(e);
|
|
this._isCurrentlyDrawing = true;
|
|
this.discardActiveObject().renderAll();
|
|
this.freeDrawingBrush.onMouseDown(pointer);
|
|
this.fire('mouse:down', { e: e });
|
|
return;
|
|
}
|
|
|
|
// ignore if some object is being transformed at this moment
|
|
if (this._currentTransform) return;
|
|
|
|
var target = this.findTarget(e), corner;
|
|
pointer = this.getPointer(e);
|
|
|
|
if (this._shouldClearSelection(e, target)) {
|
|
this._groupSelector = {
|
|
ex: pointer.x,
|
|
ey: pointer.y,
|
|
top: 0,
|
|
left: 0
|
|
};
|
|
this.deactivateAllWithDispatch();
|
|
target && target.selectable && this.setActiveObject(target, e);
|
|
}
|
|
else if (this._shouldHandleGroupLogic(e, target)) {
|
|
this._handleGroupLogic(e, target);
|
|
target = this.getActiveGroup();
|
|
}
|
|
else {
|
|
// determine if it's a drag or rotate case
|
|
this.stateful && target.saveState();
|
|
|
|
if ((corner = target._findTargetCorner(e, this._offset))) {
|
|
this.onBeforeScaleRotate(target);
|
|
}
|
|
|
|
if (target !== this.getActiveGroup() && target !== this.getActiveObject()) {
|
|
this.deactivateAll();
|
|
this.setActiveObject(target, e);
|
|
}
|
|
|
|
this._setupCurrentTransform(e, target);
|
|
}
|
|
// we must renderAll so that active image is placed on the top canvas
|
|
this.renderAll();
|
|
|
|
this.fire('mouse:down', { target: target, e: e });
|
|
target && target.fire('mousedown', { e: e });
|
|
|
|
// center origin when rotating
|
|
if (corner === 'mtr') {
|
|
this._previousOriginX = this._currentTransform.target.originX;
|
|
this._currentTransform.target.adjustPosition('center');
|
|
this._currentTransform.left = this._currentTransform.target.left;
|
|
this._currentTransform.top = this._currentTransform.target.top;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Method that defines the actions when mouse is hovering the canvas.
|
|
* The currentTransform parameter will definde whether the user is rotating/scaling/translating
|
|
* an image or neither of them (only hovering). A group selection is also possible and would cancel
|
|
* all any other type of action.
|
|
* In case of an image transformation only the top canvas will be rendered.
|
|
* @private
|
|
* @param {Event} e Event object fired on mousemove
|
|
*/
|
|
__onMouseMove: function (e) {
|
|
|
|
var target, pointer;
|
|
|
|
if (this.isDrawingMode) {
|
|
if (this._isCurrentlyDrawing) {
|
|
pointer = this.getPointer(e);
|
|
this.freeDrawingBrush.onMouseMove(pointer);
|
|
}
|
|
this.upperCanvasEl.style.cursor = this.freeDrawingCursor;
|
|
this.fire('mouse:move', { e: e });
|
|
return;
|
|
}
|
|
|
|
var groupSelector = this._groupSelector;
|
|
|
|
// We initially clicked in an empty area, so we draw a box for multiple selection.
|
|
if (groupSelector) {
|
|
pointer = getPointer(e, this.upperCanvasEl);
|
|
|
|
groupSelector.left = pointer.x - this._offset.left - groupSelector.ex;
|
|
groupSelector.top = pointer.y - this._offset.top - groupSelector.ey;
|
|
this.renderTop();
|
|
}
|
|
else if (!this._currentTransform) {
|
|
|
|
// alias style to elimintate unnecessary lookup
|
|
var style = this.upperCanvasEl.style;
|
|
|
|
// Here we are hovering the canvas then we will determine
|
|
// what part of the pictures we are hovering to change the caret symbol.
|
|
// We won't do that while dragging or rotating in order to improve the
|
|
// performance.
|
|
target = this.findTarget(e);
|
|
|
|
if (!target || target && !target.selectable) {
|
|
// image/text was hovered-out from, we remove its borders
|
|
for (var i = this._objects.length; i--; ) {
|
|
if (this._objects[i] && !this._objects[i].active) {
|
|
this._objects[i].set('active', false);
|
|
}
|
|
}
|
|
style.cursor = this.defaultCursor;
|
|
}
|
|
else {
|
|
// set proper cursor
|
|
this._setCursorFromEvent(e, target);
|
|
}
|
|
}
|
|
else {
|
|
// object is being transformed (scaled/rotated/moved/etc.)
|
|
pointer = getPointer(e, this.upperCanvasEl);
|
|
|
|
var x = pointer.x,
|
|
y = pointer.y,
|
|
reset = false,
|
|
transform = this._currentTransform;
|
|
|
|
target = transform.target;
|
|
target.isMoving = true;
|
|
|
|
if ((transform.action === 'scale' || transform.action === 'scaleX' || transform.action === 'scaleY') &&
|
|
// Switch from a normal resize to center-based
|
|
((e.altKey && (transform.originX !== 'center' || transform.originY !== 'center')) ||
|
|
// Switch from center-based resize to normal one
|
|
(!e.altKey && transform.originX === 'center' && transform.originY === 'center'))
|
|
) {
|
|
this._resetCurrentTransform(e);
|
|
reset = true;
|
|
}
|
|
|
|
if (transform.action === 'rotate') {
|
|
this._rotateObject(x, y);
|
|
|
|
this.fire('object:rotating', { target: target, e: e });
|
|
target.fire('rotating', { e: e });
|
|
}
|
|
else if (transform.action === 'scale') {
|
|
// rotate object only if shift key is not pressed
|
|
// and if it is not a group we are transforming
|
|
if ((e.shiftKey || this.uniScaleTransform) && !target.get('lockUniScaling')) {
|
|
transform.currentAction = 'scale';
|
|
this._scaleObject(x, y);
|
|
}
|
|
else {
|
|
// Switch from a normal resize to proportional
|
|
if (!reset && transform.currentAction === 'scale') {
|
|
this._resetCurrentTransform(e);
|
|
}
|
|
|
|
transform.currentAction = 'scaleEqually';
|
|
this._scaleObject(x, y, 'equally');
|
|
}
|
|
|
|
this.fire('object:scaling', { target: target, e: e });
|
|
target.fire('scaling', { e: e });
|
|
}
|
|
else if (transform.action === 'scaleX') {
|
|
this._scaleObject(x, y, 'x');
|
|
|
|
this.fire('object:scaling', { target: target, e: e});
|
|
target.fire('scaling', { e: e });
|
|
}
|
|
else if (transform.action === 'scaleY') {
|
|
this._scaleObject(x, y, 'y');
|
|
|
|
this.fire('object:scaling', { target: target, e: e});
|
|
target.fire('scaling', { e: e });
|
|
}
|
|
else {
|
|
this._translateObject(x, y);
|
|
|
|
this.fire('object:moving', { target: target, e: e});
|
|
target.fire('moving', { e: e });
|
|
this._setCursor(this.moveCursor);
|
|
}
|
|
|
|
this.renderAll();
|
|
}
|
|
this.fire('mouse:move', { target: target, e: e });
|
|
target && target.fire('mousemove', { e: e });
|
|
},
|
|
/**
|
|
* Sets the cursor depending on where the canvas is being hovered.
|
|
* Note: very buggy in Opera
|
|
* @param {Event} e Event object
|
|
* @param {Object} target Object that the mouse is hovering, if so.
|
|
*/
|
|
_setCursorFromEvent: function (e, target) {
|
|
var s = this.upperCanvasEl.style;
|
|
if (!target) {
|
|
s.cursor = this.defaultCursor;
|
|
return false;
|
|
}
|
|
else {
|
|
var activeGroup = this.getActiveGroup();
|
|
// only show proper corner when group selection is not active
|
|
var corner = target._findTargetCorner
|
|
&& (!activeGroup || !activeGroup.contains(target))
|
|
&& target._findTargetCorner(e, this._offset);
|
|
|
|
if (!corner) {
|
|
s.cursor = this.hoverCursor;
|
|
}
|
|
else {
|
|
if (corner in cursorMap) {
|
|
s.cursor = cursorMap[corner];
|
|
}
|
|
else if (corner === 'mtr' && target.hasRotatingPoint) {
|
|
s.cursor = this.rotationCursor;
|
|
}
|
|
else {
|
|
s.cursor = this.defaultCursor;
|
|
return false;
|
|
}
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
});
|
|
})();
|
|
|
|
fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ {
|
|
|
|
/**
|
|
* Animation duration (in ms) for fx* methods
|
|
* @type Number
|
|
*/
|
|
FX_DURATION: 500,
|
|
|
|
/**
|
|
* Centers object horizontally with animation.
|
|
* @param {fabric.Object} object Object to center
|
|
* @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
fxCenterObjectH: function (object, callbacks) {
|
|
callbacks = callbacks || { };
|
|
|
|
var empty = function() { },
|
|
onComplete = callbacks.onComplete || empty,
|
|
onChange = callbacks.onChange || empty,
|
|
_this = this;
|
|
|
|
fabric.util.animate({
|
|
startValue: object.get('left'),
|
|
endValue: this.getCenter().left,
|
|
duration: this.FX_DURATION,
|
|
onChange: function(value) {
|
|
object.set('left', value);
|
|
_this.renderAll();
|
|
onChange();
|
|
},
|
|
onComplete: function() {
|
|
object.setCoords();
|
|
onComplete();
|
|
}
|
|
});
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Centers object vertically with animation.
|
|
* @param {fabric.Object} object Object to center
|
|
* @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
fxCenterObjectV: function (object, callbacks) {
|
|
callbacks = callbacks || { };
|
|
|
|
var empty = function() { },
|
|
onComplete = callbacks.onComplete || empty,
|
|
onChange = callbacks.onChange || empty,
|
|
_this = this;
|
|
|
|
fabric.util.animate({
|
|
startValue: object.get('top'),
|
|
endValue: this.getCenter().top,
|
|
duration: this.FX_DURATION,
|
|
onChange: function(value) {
|
|
object.set('top', value);
|
|
_this.renderAll();
|
|
onChange();
|
|
},
|
|
onComplete: function() {
|
|
object.setCoords();
|
|
onComplete();
|
|
}
|
|
});
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Same as `fabric.Canvas#remove` but animated
|
|
* @param {fabric.Object} object Object to remove
|
|
* @param {Function} callback Callback, invoked on effect completion
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
fxRemove: function (object, callbacks) {
|
|
callbacks = callbacks || { };
|
|
|
|
var empty = function() { },
|
|
onComplete = callbacks.onComplete || empty,
|
|
onChange = callbacks.onChange || empty,
|
|
_this = this;
|
|
|
|
fabric.util.animate({
|
|
startValue: object.get('opacity'),
|
|
endValue: 0,
|
|
duration: this.FX_DURATION,
|
|
onStart: function() {
|
|
object.set('active', false);
|
|
},
|
|
onChange: function(value) {
|
|
object.set('opacity', value);
|
|
_this.renderAll();
|
|
onChange();
|
|
},
|
|
onComplete: function () {
|
|
_this.remove(object);
|
|
onComplete();
|
|
}
|
|
});
|
|
|
|
return this;
|
|
}
|
|
});
|
|
|
|
fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ {
|
|
|
|
/**
|
|
* Populates canvas with data from the specified dataless JSON
|
|
* JSON format must conform to the one of `fabric.Canvas#toDatalessJSON`
|
|
* @param {String|Object} json JSON string or object
|
|
* @param {Function} callback Callback, invoked when json is parsed
|
|
* and corresponding objects (e.g: fabric.Image)
|
|
* are initialized
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable
|
|
*/
|
|
loadFromDatalessJSON: function (json, callback) {
|
|
|
|
if (!json) return;
|
|
|
|
// serialize if it wasn't already
|
|
var serialized = (typeof json === 'string')
|
|
? JSON.parse(json)
|
|
: json;
|
|
|
|
if (!serialized) return;
|
|
|
|
if (!serialized.objects) {
|
|
serialized.objects = [];
|
|
}
|
|
|
|
this.clear();
|
|
|
|
var _this = this;
|
|
this._enlivenDatalessObjects(serialized.objects, function() {
|
|
_this._setBgOverlayImages(serialized, callback);
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Array} objects
|
|
* @param {Function} callback
|
|
*/
|
|
_enlivenDatalessObjects: function (objects, callback) {
|
|
var _this = this,
|
|
numLoadedObjects = 0,
|
|
numTotalObjects = objects.length;
|
|
|
|
/** @ignore */
|
|
function onObjectLoaded(object, index) {
|
|
_this.insertAt(object, index, true);
|
|
object.setCoords();
|
|
if (++numLoadedObjects === numTotalObjects) {
|
|
callback && callback();
|
|
}
|
|
}
|
|
|
|
/** @ignore */
|
|
function loadObject(obj, index) {
|
|
|
|
var pathProp = obj.paths ? 'paths' : 'path';
|
|
var path = obj[pathProp];
|
|
|
|
delete obj[pathProp];
|
|
|
|
if (typeof path !== 'string') {
|
|
if (obj.type === 'image' || obj.type === 'group') {
|
|
fabric[fabric.util.string.capitalize(obj.type)].fromObject(obj, function (o) {
|
|
onObjectLoaded(o, index);
|
|
});
|
|
}
|
|
else {
|
|
var klass = fabric[fabric.util.string.camelize(fabric.util.string.capitalize(obj.type))];
|
|
if (!klass || !klass.fromObject) return;
|
|
|
|
// restore path
|
|
if (path) {
|
|
obj[pathProp] = path;
|
|
}
|
|
onObjectLoaded(klass.fromObject(obj), index);
|
|
}
|
|
}
|
|
else {
|
|
if (obj.type === 'image') {
|
|
fabric.util.loadImage(path, function (image) {
|
|
var oImg = new fabric.Image(image);
|
|
|
|
oImg.setSourcePath(path);
|
|
|
|
fabric.util.object.extend(oImg, obj);
|
|
oImg.setAngle(obj.angle);
|
|
|
|
onObjectLoaded(oImg, index);
|
|
});
|
|
}
|
|
else if (obj.type === 'text') {
|
|
|
|
if (obj.useNative) {
|
|
onObjectLoaded(fabric.Text.fromObject(obj), index);
|
|
}
|
|
else {
|
|
obj.path = path;
|
|
var object = fabric.Text.fromObject(obj);
|
|
/** @ignore */
|
|
var onscriptload = function () {
|
|
// TODO (kangax): find out why Opera refuses to work without this timeout
|
|
if (Object.prototype.toString.call(fabric.window.opera) === '[object Opera]') {
|
|
setTimeout(function () {
|
|
onObjectLoaded(object, index);
|
|
}, 500);
|
|
}
|
|
else {
|
|
onObjectLoaded(object, index);
|
|
}
|
|
};
|
|
|
|
fabric.util.getScript(path, onscriptload);
|
|
}
|
|
}
|
|
else {
|
|
fabric.loadSVGFromURL(path, function (elements) {
|
|
var object = fabric.util.groupSVGElements(elements, obj, path);
|
|
|
|
// copy parameters from serialied json to object (left, top, scaleX, scaleY, etc.)
|
|
// skip this step if an object is a PathGroup, since we already passed it options object before
|
|
if (!(object instanceof fabric.PathGroup)) {
|
|
fabric.util.object.extend(object, obj);
|
|
if (typeof obj.angle !== 'undefined') {
|
|
object.setAngle(obj.angle);
|
|
}
|
|
}
|
|
|
|
onObjectLoaded(object, index);
|
|
});
|
|
}
|
|
}
|
|
}
|
|
|
|
if (numTotalObjects === 0 && callback) {
|
|
callback();
|
|
}
|
|
|
|
try {
|
|
objects.forEach(loadObject, this);
|
|
}
|
|
catch(e) {
|
|
fabric.log(e);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Populates canvas with data from the specified JSON
|
|
* JSON format must conform to the one of `fabric.Canvas#toJSON`
|
|
* @param {String|Object} json JSON string or object
|
|
* @param {Function} callback Callback, invoked when json is parsed
|
|
* and corresponding objects (e.g: fabric.Image)
|
|
* are initialized
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable
|
|
*/
|
|
loadFromJSON: function (json, callback) {
|
|
if (!json) return;
|
|
|
|
// serialize if it wasn't already
|
|
var serialized = (typeof json === 'string')
|
|
? JSON.parse(json)
|
|
: json;
|
|
|
|
var _this = this;
|
|
this._enlivenObjects(serialized.objects, function () {
|
|
_this._setBgOverlayImages(serialized, callback);
|
|
});
|
|
|
|
return this;
|
|
},
|
|
|
|
_setBgOverlayImages: function(serialized, callback) {
|
|
|
|
var _this = this,
|
|
backgroundPatternLoaded,
|
|
backgroundImageLoaded,
|
|
overlayImageLoaded;
|
|
|
|
var cbIfLoaded = function () {
|
|
callback && backgroundImageLoaded && overlayImageLoaded && backgroundPatternLoaded && callback();
|
|
};
|
|
|
|
if (serialized.backgroundImage) {
|
|
this.setBackgroundImage(serialized.backgroundImage, function() {
|
|
|
|
_this.backgroundImageOpacity = serialized.backgroundImageOpacity;
|
|
_this.backgroundImageStretch = serialized.backgroundImageStretch;
|
|
|
|
_this.renderAll();
|
|
|
|
backgroundImageLoaded = true;
|
|
|
|
cbIfLoaded();
|
|
});
|
|
}
|
|
else {
|
|
backgroundImageLoaded = true;
|
|
}
|
|
|
|
if (serialized.overlayImage) {
|
|
this.setOverlayImage(serialized.overlayImage, function() {
|
|
|
|
_this.overlayImageLeft = serialized.overlayImageLeft || 0;
|
|
_this.overlayImageTop = serialized.overlayImageTop || 0;
|
|
|
|
_this.renderAll();
|
|
overlayImageLoaded = true;
|
|
|
|
cbIfLoaded();
|
|
});
|
|
}
|
|
else {
|
|
overlayImageLoaded = true;
|
|
}
|
|
|
|
if (serialized.background) {
|
|
this.setBackgroundColor(serialized.background, function() {
|
|
|
|
_this.renderAll();
|
|
backgroundPatternLoaded = true;
|
|
|
|
cbIfLoaded();
|
|
});
|
|
}
|
|
else {
|
|
backgroundPatternLoaded = true;
|
|
}
|
|
|
|
if (!serialized.backgroundImage && !serialized.overlayImage && !serialized.background) {
|
|
callback && callback();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Array} objects
|
|
* @param {Function} callback
|
|
*/
|
|
_enlivenObjects: function (objects, callback) {
|
|
var _this = this;
|
|
fabric.util.enlivenObjects(objects, function(enlivenedObjects) {
|
|
enlivenedObjects.forEach(function(obj, index) {
|
|
_this.insertAt(obj, index, true);
|
|
});
|
|
callback && callback();
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} format
|
|
* @param {Function} callback
|
|
*/
|
|
_toDataURL: function (format, callback) {
|
|
this.clone(function (clone) {
|
|
callback(clone.toDataURL(format));
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} format
|
|
* @param {Number} multiplier
|
|
* @param {Function} callback
|
|
*/
|
|
_toDataURLWithMultiplier: function (format, multiplier, callback) {
|
|
this.clone(function (clone) {
|
|
callback(clone.toDataURLWithMultiplier(format, multiplier));
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Clones canvas instance
|
|
* @param {Object} [callback] Receives cloned instance as a first argument
|
|
*/
|
|
clone: function (callback) {
|
|
var data = JSON.stringify(this);
|
|
this.cloneWithoutData(function(clone) {
|
|
clone.loadFromJSON(data, function() {
|
|
callback && callback(clone);
|
|
});
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Clones canvas instance without cloning existing data.
|
|
* This essentially copies canvas dimensions, clipping properties, etc.
|
|
* but leaves data empty (so that you can populate it with your own)
|
|
* @param {Object} [callback] Receives cloned instance as a first argument
|
|
*/
|
|
cloneWithoutData: function(callback) {
|
|
var el = fabric.document.createElement('canvas');
|
|
|
|
el.width = this.getWidth();
|
|
el.height = this.getHeight();
|
|
|
|
var clone = new fabric.Canvas(el);
|
|
clone.clipTo = this.clipTo;
|
|
if (this.backgroundImage) {
|
|
clone.setBackgroundImage(this.backgroundImage.src, function() {
|
|
clone.renderAll();
|
|
callback && callback(clone);
|
|
});
|
|
clone.backgroundImageOpacity = this.backgroundImageOpacity;
|
|
clone.backgroundImageStretch = this.backgroundImageStretch;
|
|
}
|
|
else {
|
|
callback && callback(clone);
|
|
}
|
|
}
|
|
});
|
|
|
|
(function(global) {
|
|
|
|
"use strict";
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
extend = fabric.util.object.extend,
|
|
toFixed = fabric.util.toFixed,
|
|
capitalize = fabric.util.string.capitalize,
|
|
degreesToRadians = fabric.util.degreesToRadians,
|
|
supportsLineDash = fabric.StaticCanvas.supports('setLineDash');
|
|
|
|
if (fabric.Object) {
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Root object class from which all 2d shape classes inherit from
|
|
* @class fabric.Object
|
|
*/
|
|
fabric.Object = fabric.util.createClass(/** @lends fabric.Object.prototype */ {
|
|
|
|
/**
|
|
* Type of an object (rect, circle, path, etc.)
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'object',
|
|
|
|
/**
|
|
* Horizontal origin of transformation of an object (one of "left", "right", "center")
|
|
* @type String
|
|
* @default
|
|
*/
|
|
originX: 'center',
|
|
|
|
/**
|
|
* Vertical origin of transformation of an object (one of "top", "bottom", "center")
|
|
* @type String
|
|
* @default
|
|
*/
|
|
originY: 'center',
|
|
|
|
/**
|
|
* Top position of an object. Note that by default it's relative to object center. You can change this by setting originY={top/center/bottom}
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
top: 0,
|
|
|
|
/**
|
|
* Left position of an object. Note that by default it's relative to object center. You can change this by setting originX={left/center/right}
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
left: 0,
|
|
|
|
/**
|
|
* Object width
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
width: 0,
|
|
|
|
/**
|
|
* Object height
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
height: 0,
|
|
|
|
/**
|
|
* Object scale factor (horizontal)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
scaleX: 1,
|
|
|
|
/**
|
|
* Object scale factor (vertical)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
scaleY: 1,
|
|
|
|
/**
|
|
* When true, an object is rendered as flipped horizontally
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
flipX: false,
|
|
|
|
/**
|
|
* When true, an object is rendered as flipped vertically
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
flipY: false,
|
|
|
|
/**
|
|
* Opacity of an object
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
opacity: 1,
|
|
|
|
/**
|
|
* Angle of rotation of an object (in degrees)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
angle: 0,
|
|
|
|
/**
|
|
* Size of object's corners (in pixels)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
cornerSize: 12,
|
|
|
|
/**
|
|
* When true, object's corners are rendered as transparent inside (i.e. stroke instead of fill)
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
transparentCorners: true,
|
|
|
|
/**
|
|
* Padding between object and its borders (in pixels)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
padding: 0,
|
|
|
|
/**
|
|
* Border color of an object (when it's active)
|
|
* @type String
|
|
* @default
|
|
*/
|
|
borderColor: 'rgba(102,153,255,0.75)',
|
|
|
|
/**
|
|
* Corner color of an object (when it's active)
|
|
* @type String
|
|
* @default
|
|
*/
|
|
cornerColor: 'rgba(102,153,255,0.5)',
|
|
|
|
/**
|
|
* Color of object's fill
|
|
* @type String
|
|
* @default
|
|
*/
|
|
fill: 'rgb(0,0,0)',
|
|
|
|
/**
|
|
* Fill rule used to fill an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
fillRule: 'source-over',
|
|
|
|
/**
|
|
* Overlay fill (takes precedence over fill value)
|
|
* @type String
|
|
* @default
|
|
*/
|
|
overlayFill: null,
|
|
|
|
/**
|
|
* When `true`, an object is rendered via stroke and this property specifies its color
|
|
* @type String
|
|
* @default
|
|
*/
|
|
stroke: null,
|
|
|
|
/**
|
|
* Width of a stroke used to render this object
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
strokeWidth: 1,
|
|
|
|
/**
|
|
* Array specifying dash pattern of an object's stroke (stroke must be defined)
|
|
* @type Array
|
|
*/
|
|
strokeDashArray: null,
|
|
|
|
/**
|
|
* Line endings style of an object's stroke (one of "butt", "round", "square")
|
|
* @type String
|
|
* @default
|
|
*/
|
|
strokeLineCap: 'butt',
|
|
|
|
/**
|
|
* Corner style of an object's stroke (one of "bevil", "round", "miter")
|
|
* @type String
|
|
* @default
|
|
*/
|
|
strokeLineJoin: 'miter',
|
|
|
|
/**
|
|
* Maximum miter length (used for strokeLineJoin = "miter") of an object's stroke
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
strokeMiterLimit: 10,
|
|
|
|
/**
|
|
* Shadow object representing shadow of this shape
|
|
* @type fabric.Shadow
|
|
*/
|
|
shadow: null,
|
|
|
|
/**
|
|
* Border opacity when object is active and moving
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
borderOpacityWhenMoving: 0.4,
|
|
|
|
/**
|
|
* Border scale factor
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
borderScaleFactor: 1,
|
|
|
|
/**
|
|
* Transform matrix (similar to SVG's transform matrix)
|
|
* @type Array
|
|
*/
|
|
transformMatrix: null,
|
|
|
|
/**
|
|
* Minimum allowed scale value of an object
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
minScaleLimit: 0.01,
|
|
|
|
/**
|
|
* When set to `false`, an object can not be selected for modification (using either point-click-based or group-based selection)
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
selectable: true,
|
|
|
|
/**
|
|
* When set to `false`, an object is not rendered on canvas
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
visible: true,
|
|
|
|
/**
|
|
* When set to `false`, object's controls are not displayed and can not be used to manipulate object
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
hasControls: true,
|
|
|
|
/**
|
|
* When set to `false`, object's borders are not rendered
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
hasBorders: true,
|
|
|
|
/**
|
|
* When set to `false`, object's rotating point will not be visible or selectable
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
hasRotatingPoint: true,
|
|
|
|
/**
|
|
* Offset for object's rotating point (when enabled via `hasRotatingPoint`)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
rotatingPointOffset: 40,
|
|
|
|
/**
|
|
* When set to `true`, objects are "found" on canvas on per-pixel basis rather than according to bounding box
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
perPixelTargetFind: false,
|
|
|
|
/**
|
|
* When `false`, default object's values are not included in its serialization
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
includeDefaultValues: true,
|
|
|
|
/**
|
|
* Function that determines clipping of an object (context is passed as a first argument)
|
|
* @type Function
|
|
*/
|
|
clipTo: null,
|
|
|
|
/**
|
|
* When `true`, object horizontal movement is locked
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
lockMovementX: false,
|
|
|
|
/**
|
|
* When `true`, object vertical movement is locked
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
lockMovementY: false,
|
|
|
|
/**
|
|
* When `true`, object rotation is locked
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
lockRotation: false,
|
|
|
|
/**
|
|
* When `true`, object horizontal scaling is locked
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
lockScalingX: false,
|
|
|
|
/**
|
|
* When `true`, object vertical scaling is locked
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
lockScalingY: false,
|
|
|
|
/**
|
|
* When `true`, object non-uniform scaling is locked
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
lockUniScaling: false,
|
|
|
|
/**
|
|
* List of properties to consider when checking if state
|
|
* of an object is changed (fabric.Object#hasStateChanged)
|
|
* as well as for history (undo/redo) purposes
|
|
* @type Array
|
|
*/
|
|
stateProperties: (
|
|
'top left width height scaleX scaleY flipX flipY ' +
|
|
'angle opacity cornerSize fill overlayFill originX originY ' +
|
|
'stroke strokeWidth strokeDashArray fillRule ' +
|
|
'borderScaleFactor transformMatrix selectable shadow visible'
|
|
).split(' '),
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
initialize: function(options) {
|
|
if (options) {
|
|
this.setOptions(options);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_initGradient: function(options) {
|
|
if (options.fill && options.fill.colorStops && !(options.fill instanceof fabric.Gradient)) {
|
|
this.set('fill', new fabric.Gradient(options.fill));
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_initPattern: function(options) {
|
|
if (options.fill && options.fill.source && !(options.fill instanceof fabric.Pattern)) {
|
|
this.set('fill', new fabric.Pattern(options.fill));
|
|
}
|
|
if (options.stroke && options.stroke.source && !(options.stroke instanceof fabric.Pattern)) {
|
|
this.set('stroke', new fabric.Pattern(options.stroke));
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_initShadow: function(options) {
|
|
if (options.shadow && !(options.shadow instanceof fabric.Shadow)) {
|
|
this.setShadow(options.shadow);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Sets object's properties from options
|
|
* @param {Object} [options]
|
|
*/
|
|
setOptions: function(options) {
|
|
for (var prop in options) {
|
|
this.set(prop, options[prop]);
|
|
}
|
|
this._initGradient(options);
|
|
this._initPattern(options);
|
|
this._initShadow(options);
|
|
},
|
|
|
|
/**
|
|
* Transforms context when rendering an object
|
|
* @param {CanvasRenderingContext2D} ctx Context
|
|
* @param {Boolean} when true, context is transformed to object's top/left corner. This is used when rendering text on Node
|
|
*/
|
|
transform: function(ctx, fromLeft) {
|
|
ctx.globalAlpha = this.opacity;
|
|
|
|
var center = fromLeft ? this._getLeftTopCoords() : this.getCenterPoint();
|
|
ctx.translate(center.x, center.y);
|
|
ctx.rotate(degreesToRadians(this.angle));
|
|
ctx.scale(
|
|
this.scaleX * (this.flipX ? -1 : 1),
|
|
this.scaleY * (this.flipY ? -1 : 1)
|
|
);
|
|
},
|
|
|
|
/**
|
|
* Returns an object representation of an instance
|
|
* @param {Array} propertiesToInclude
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
|
|
var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS;
|
|
|
|
var object = {
|
|
type: this.type,
|
|
originX: this.originX,
|
|
originY: this.originY,
|
|
left: toFixed(this.left, NUM_FRACTION_DIGITS),
|
|
top: toFixed(this.top, NUM_FRACTION_DIGITS),
|
|
width: toFixed(this.width, NUM_FRACTION_DIGITS),
|
|
height: toFixed(this.height, NUM_FRACTION_DIGITS),
|
|
fill: (this.fill && this.fill.toObject) ? this.fill.toObject() : this.fill,
|
|
overlayFill: this.overlayFill,
|
|
stroke: (this.stroke && this.stroke.toObject) ? this.stroke.toObject() : this.stroke,
|
|
strokeWidth: toFixed(this.strokeWidth, NUM_FRACTION_DIGITS),
|
|
strokeDashArray: this.strokeDashArray,
|
|
strokeLineCap: this.strokeLineCap,
|
|
strokeLineJoin: this.strokeLineJoin,
|
|
strokeMiterLimit: toFixed(this.strokeMiterLimit, NUM_FRACTION_DIGITS),
|
|
scaleX: toFixed(this.scaleX, NUM_FRACTION_DIGITS),
|
|
scaleY: toFixed(this.scaleY, NUM_FRACTION_DIGITS),
|
|
angle: toFixed(this.getAngle(), NUM_FRACTION_DIGITS),
|
|
flipX: this.flipX,
|
|
flipY: this.flipY,
|
|
opacity: toFixed(this.opacity, NUM_FRACTION_DIGITS),
|
|
selectable: this.selectable,
|
|
hasControls: this.hasControls,
|
|
hasBorders: this.hasBorders,
|
|
hasRotatingPoint: this.hasRotatingPoint,
|
|
transparentCorners: this.transparentCorners,
|
|
perPixelTargetFind: this.perPixelTargetFind,
|
|
shadow: (this.shadow && this.shadow.toObject) ? this.shadow.toObject() : this.shadow,
|
|
visible: this.visible
|
|
};
|
|
|
|
if (!this.includeDefaultValues) {
|
|
object = this._removeDefaultValues(object);
|
|
}
|
|
fabric.util.populateWithProperties(this, object, propertiesToInclude);
|
|
|
|
return object;
|
|
},
|
|
|
|
/**
|
|
* Returns (dataless) object representation of an instance
|
|
* @param {Array} [propertiesToInclude]
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toDatalessObject: function(propertiesToInclude) {
|
|
// will be overwritten by subclasses
|
|
return this.toObject(propertiesToInclude);
|
|
},
|
|
|
|
/**
|
|
* Returns styles-string for svg-export
|
|
* @return {String}
|
|
*/
|
|
getSvgStyles: function() {
|
|
return [
|
|
"stroke: ", (this.stroke ? this.stroke : 'none'), "; ",
|
|
"stroke-width: ", (this.strokeWidth ? this.strokeWidth : '0'), "; ",
|
|
"stroke-dasharray: ", (this.strokeDashArray ? this.strokeDashArray.join(' ') : ''), "; ",
|
|
"stroke-linecap: ", (this.strokeLineCap ? this.strokeLineCap : 'butt'), "; ",
|
|
"stroke-linejoin: ", (this.strokeLineJoin ? this.strokeLineJoin : 'miter'), "; ",
|
|
"stroke-miterlimit: ", (this.strokeMiterLimit ? this.strokeMiterLimit : '4'), "; ",
|
|
"fill: ", (this.fill ? (this.fill && this.fill.toLive ? 'url(#SVGID_' + this.fill.id + ')' : this.fill) : 'none'), "; ",
|
|
"opacity: ", (typeof this.opacity !== 'undefined' ? this.opacity : '1'), ";",
|
|
(this.visible ? '' : " visibility: hidden;")
|
|
].join("");
|
|
},
|
|
|
|
/**
|
|
* Returns transform-string for svg-export
|
|
* @return {String}
|
|
*/
|
|
getSvgTransform: function() {
|
|
var angle = this.getAngle();
|
|
var center = this.getCenterPoint();
|
|
|
|
var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS;
|
|
|
|
var translatePart = "translate(" +
|
|
toFixed(center.x, NUM_FRACTION_DIGITS) +
|
|
" " +
|
|
toFixed(center.y, NUM_FRACTION_DIGITS) +
|
|
")";
|
|
|
|
var anglePart = angle !== 0
|
|
? (" rotate(" + toFixed(angle, NUM_FRACTION_DIGITS) + ")")
|
|
: '';
|
|
|
|
var scalePart = (this.scaleX === 1 && this.scaleY === 1)
|
|
? '' :
|
|
(" scale(" +
|
|
toFixed(this.scaleX, NUM_FRACTION_DIGITS) +
|
|
" " +
|
|
toFixed(this.scaleY, NUM_FRACTION_DIGITS) +
|
|
")");
|
|
|
|
var flipXPart = this.flipX ? "matrix(-1 0 0 1 0 0) " : "";
|
|
var flipYPart = this.flipY ? "matrix(1 0 0 -1 0 0)" : "";
|
|
|
|
return [ translatePart, anglePart, scalePart, flipXPart, flipYPart ].join('');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_removeDefaultValues: function(object) {
|
|
var defaultOptions = fabric.Object.prototype.options;
|
|
if (defaultOptions) {
|
|
this.stateProperties.forEach(function(prop) {
|
|
if (object[prop] === defaultOptions[prop]) {
|
|
delete object[prop];
|
|
}
|
|
});
|
|
}
|
|
return object;
|
|
},
|
|
|
|
/**
|
|
* Returns a string representation of an instance
|
|
* @return {String}
|
|
*/
|
|
toString: function() {
|
|
return "#<fabric." + capitalize(this.type) + ">";
|
|
},
|
|
|
|
/**
|
|
* Basic getter
|
|
* @param {String} property
|
|
* @return {Any} value of a property
|
|
*/
|
|
get: function(property) {
|
|
return this[property];
|
|
},
|
|
|
|
/**
|
|
* Sets property to a given value. When changing position/dimension -related properties (left, top, scale, angle, etc.) `set` does not update position of object's borders/controls. If you need to update those, call `setCoords()`.
|
|
* @param {String} name
|
|
* @param {Object|Function} value (if function, the value is passed into it and its return value is used as a new one)
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
set: function(key, value) {
|
|
if (typeof key === 'object') {
|
|
for (var prop in key) {
|
|
this._set(prop, key[prop]);
|
|
}
|
|
}
|
|
else {
|
|
if (typeof value === 'function') {
|
|
this._set(key, value(this.get(key)));
|
|
}
|
|
else {
|
|
this._set(key, value);
|
|
}
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param key
|
|
* @param value
|
|
*/
|
|
_set: function(key, value) {
|
|
var shouldConstrainValue = (key === 'scaleX' || key === 'scaleY');
|
|
|
|
if (shouldConstrainValue) {
|
|
value = this._constrainScale(value);
|
|
}
|
|
if (key === 'scaleX' && value < 0) {
|
|
this.flipX = !this.flipX;
|
|
value *= -1;
|
|
}
|
|
else if (key === 'scaleY' && value < 0) {
|
|
this.flipY = !this.flipY;
|
|
value *= -1;
|
|
}
|
|
else if (key === 'width' || key === 'height') {
|
|
this.minScaleLimit = toFixed(Math.min(0.1, 1/Math.max(this.width, this.height)), 2);
|
|
}
|
|
|
|
this[key] = value;
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Toggles specified property from `true` to `false` or from `false` to `true`
|
|
* @param {String} property property to toggle
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
toggle: function(property) {
|
|
var value = this.get(property);
|
|
if (typeof value === 'boolean') {
|
|
this.set(property, !value);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Sets sourcePath of an object
|
|
* @param {String} value
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
setSourcePath: function(value) {
|
|
this.sourcePath = value;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Renders an object on a specified context
|
|
* @param {CanvasRenderingContext2D} ctx context to render on
|
|
* @param {Boolean} [noTransform] When true, context is not transformed
|
|
*/
|
|
render: function(ctx, noTransform) {
|
|
// do not render if width/height are zeros or object is not visible
|
|
if (this.width === 0 || this.height === 0 || !this.visible) return;
|
|
|
|
ctx.save();
|
|
|
|
var m = this.transformMatrix;
|
|
if (m && !this.group) {
|
|
ctx.setTransform(m[0], m[1], m[2], m[3], m[4], m[5]);
|
|
}
|
|
|
|
if (!noTransform) {
|
|
this.transform(ctx);
|
|
}
|
|
|
|
ctx.save();
|
|
if (this.stroke) {
|
|
ctx.lineWidth = this.strokeWidth;
|
|
ctx.lineCap = this.strokeLineCap;
|
|
ctx.lineJoin = this.strokeLineJoin;
|
|
ctx.miterLimit = this.strokeMiterLimit;
|
|
ctx.strokeStyle = this.stroke.toLive
|
|
? this.stroke.toLive(ctx)
|
|
: this.stroke;
|
|
}
|
|
|
|
if (this.overlayFill) {
|
|
ctx.fillStyle = this.overlayFill;
|
|
}
|
|
else if (this.fill) {
|
|
ctx.fillStyle = this.fill.toLive
|
|
? this.fill.toLive(ctx)
|
|
: this.fill;
|
|
}
|
|
|
|
if (m && this.group) {
|
|
ctx.translate(-this.group.width/2, -this.group.height/2);
|
|
ctx.transform(m[0], m[1], m[2], m[3], m[4], m[5]);
|
|
}
|
|
|
|
this._setShadow(ctx);
|
|
this.clipTo && fabric.util.clipContext(this, ctx);
|
|
this._render(ctx, noTransform);
|
|
this.clipTo && ctx.restore();
|
|
this._removeShadow(ctx);
|
|
ctx.restore();
|
|
|
|
if (this.active && !noTransform) {
|
|
this.drawBorders(ctx);
|
|
this.drawControls(ctx);
|
|
}
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_setShadow: function(ctx) {
|
|
if (!this.shadow) return;
|
|
|
|
ctx.shadowColor = this.shadow.color;
|
|
ctx.shadowBlur = this.shadow.blur;
|
|
ctx.shadowOffsetX = this.shadow.offsetX;
|
|
ctx.shadowOffsetY = this.shadow.offsetY;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_removeShadow: function(ctx) {
|
|
ctx.shadowColor = '';
|
|
ctx.shadowBlur = ctx.shadowOffsetX = ctx.shadowOffsetY = 0;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderFill: function(ctx) {
|
|
if (!this.fill) return;
|
|
|
|
if (this.fill.toLive) {
|
|
ctx.save();
|
|
ctx.translate(
|
|
-this.width / 2 + this.fill.offsetX || 0,
|
|
-this.height / 2 + this.fill.offsetY || 0);
|
|
}
|
|
ctx.fill();
|
|
if (this.fill.toLive) {
|
|
ctx.restore();
|
|
}
|
|
if (this.shadow && !this.shadow.affectStroke) {
|
|
this._removeShadow(ctx);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderStroke: function(ctx) {
|
|
if (!this.stroke) return;
|
|
|
|
if (this.strokeDashArray) {
|
|
// Spec requires the concatenation of two copies the dash list when the number of elements is odd
|
|
if (1 & this.strokeDashArray.length) {
|
|
this.strokeDashArray.push.apply(this.strokeDashArray, this.strokeDashArray);
|
|
}
|
|
|
|
if (supportsLineDash) {
|
|
ctx.setLineDash(this.strokeDashArray);
|
|
this._stroke && this._stroke(ctx);
|
|
}
|
|
else {
|
|
this._renderDashedStroke && this._renderDashedStroke(ctx);
|
|
}
|
|
ctx.stroke();
|
|
}
|
|
else {
|
|
this._stroke ? this._stroke(ctx) : ctx.stroke();
|
|
}
|
|
this._removeShadow(ctx);
|
|
},
|
|
|
|
/**
|
|
* Clones an instance
|
|
* @param {Function} callback Callback is invoked with a clone as a first argument
|
|
* @param {Array} propertiesToInclude
|
|
* @return {fabric.Object} clone of an instance
|
|
*/
|
|
clone: function(callback, propertiesToInclude) {
|
|
if (this.constructor.fromObject) {
|
|
return this.constructor.fromObject(this.toObject(propertiesToInclude), callback);
|
|
}
|
|
return new fabric.Object(this.toObject(propertiesToInclude));
|
|
},
|
|
|
|
/**
|
|
* Creates an instance of fabric.Image out of an object
|
|
* @param callback {Function} callback, invoked with an instance as a first argument
|
|
* @return {fabric.Object} thisArg
|
|
*/
|
|
cloneAsImage: function(callback) {
|
|
var dataUrl = this.toDataURL();
|
|
fabric.util.loadImage(dataUrl, function(img) {
|
|
if (callback) {
|
|
callback(new fabric.Image(img));
|
|
}
|
|
});
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Converts an object into a data-url-like string
|
|
* @param {Object} options
|
|
*
|
|
* `format` the format of the output image. Either "jpeg" or "png".
|
|
* `quality` quality level (0..1)
|
|
* `multiplier` multiplier to scale by {Number}
|
|
*
|
|
* @return {String} data url representing an image of this object
|
|
*/
|
|
toDataURL: function(options) {
|
|
options || (options = { });
|
|
|
|
var el = fabric.util.createCanvasElement();
|
|
el.width = this.getBoundingRectWidth();
|
|
el.height = this.getBoundingRectHeight();
|
|
|
|
fabric.util.wrapElement(el, 'div');
|
|
|
|
var canvas = new fabric.Canvas(el);
|
|
if (options.format === 'jpeg') {
|
|
canvas.backgroundColor = '#fff';
|
|
}
|
|
|
|
var origParams = {
|
|
active: this.get('active'),
|
|
left: this.getLeft(),
|
|
top: this.getTop()
|
|
};
|
|
|
|
this.set({
|
|
'active': false,
|
|
left: el.width / 2,
|
|
top: el.height / 2
|
|
});
|
|
|
|
canvas.add(this);
|
|
var data = canvas.toDataURL(options);
|
|
|
|
this.set(origParams).setCoords();
|
|
|
|
canvas.dispose();
|
|
canvas = null;
|
|
|
|
return data;
|
|
},
|
|
|
|
/**
|
|
* Returns true if specified type is identical to the type of an instance
|
|
* @param type {String} type to check against
|
|
* @return {Boolean}
|
|
*/
|
|
isType: function(type) {
|
|
return this.type === type;
|
|
},
|
|
|
|
/**
|
|
* Makes object's color grayscale
|
|
* @return {fabric.Object} thisArg
|
|
*/
|
|
toGrayscale: function() {
|
|
var fillValue = this.get('fill');
|
|
if (fillValue) {
|
|
this.set('overlayFill', new fabric.Color(fillValue).toGrayscale().toRgb());
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns complexity of an instance
|
|
* @return {Number} complexity
|
|
*/
|
|
complexity: function() {
|
|
return 0;
|
|
},
|
|
|
|
/**
|
|
* Returns a JSON representation of an instance
|
|
* @param {Array} propertiesToInclude Any properties that you might want to additionally include in the output
|
|
* @return {Object} JSON
|
|
*/
|
|
toJSON: function(propertiesToInclude) {
|
|
// delegate, not alias
|
|
return this.toObject(propertiesToInclude);
|
|
},
|
|
|
|
/**
|
|
* Sets gradient (fill or stroke) of an object
|
|
* @param {String} property Property name 'stroke' or 'fill'
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
setGradient: function(property, options) {
|
|
options || (options = { });
|
|
|
|
var gradient = {colorStops: []};
|
|
|
|
gradient.type = options.type || (options.r1 || options.r2 ? 'radial' : 'linear');
|
|
gradient.coords = {
|
|
x1: options.x1,
|
|
y1: options.y1,
|
|
x2: options.x2,
|
|
y2: options.y2
|
|
};
|
|
|
|
if (options.r1 || options.r2) {
|
|
gradient.coords.r1 = options.r1;
|
|
gradient.coords.r2 = options.r2;
|
|
}
|
|
|
|
for (var position in options.colorStops) {
|
|
var color = new fabric.Color(options.colorStops[position]);
|
|
gradient.colorStops.push({offset: position, color: color.toRgb(), opacity: color.getAlpha()});
|
|
}
|
|
|
|
this.set(property, fabric.Gradient.forObject(this, gradient));
|
|
},
|
|
|
|
/**
|
|
* Sets pattern fill of an object
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
setPatternFill: function(options) {
|
|
return this.set('fill', new fabric.Pattern(options));
|
|
},
|
|
|
|
/**
|
|
* Sets shadow of an object
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
setShadow: function(options) {
|
|
return this.set('shadow', new fabric.Shadow(options));
|
|
},
|
|
|
|
/**
|
|
* Animates object's properties
|
|
* @param {String|Object} property to animate (if string) or properties to animate (if object)
|
|
* @param {Number|Object} value to animate property to (if string was given first) or options object
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*
|
|
* As object — multiple properties
|
|
*
|
|
* object.animate({ left: ..., top: ... });
|
|
* object.animate({ left: ..., top: ... }, { duration: ... });
|
|
*
|
|
* As string — one property
|
|
*
|
|
* object.animate('left', ...);
|
|
* object.animate('left', { duration: ... });
|
|
*
|
|
*/
|
|
animate: function() {
|
|
if (arguments[0] && typeof arguments[0] === 'object') {
|
|
var propsToAnimate = [ ], prop, skipCallbacks;
|
|
for (prop in arguments[0]) {
|
|
propsToAnimate.push(prop);
|
|
}
|
|
for (var i = 0, len = propsToAnimate.length; i<len; i++) {
|
|
prop = propsToAnimate[i];
|
|
skipCallbacks = i !== len - 1;
|
|
this._animate(prop, arguments[0][prop], arguments[1], skipCallbacks);
|
|
}
|
|
}
|
|
else {
|
|
this._animate.apply(this, arguments);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} property
|
|
* @param {String} to
|
|
* @param {Object} [options]
|
|
* @param {Boolean} [skipCallbacks]
|
|
*/
|
|
_animate: function(property, to, options, skipCallbacks) {
|
|
var obj = this, propPair;
|
|
|
|
to = to.toString();
|
|
|
|
if (!options) {
|
|
options = { };
|
|
}
|
|
else {
|
|
options = fabric.util.object.clone(options);
|
|
}
|
|
|
|
if (~property.indexOf('.')) {
|
|
propPair = property.split('.');
|
|
}
|
|
|
|
var currentValue = propPair
|
|
? this.get(propPair[0])[propPair[1]]
|
|
: this.get(property);
|
|
|
|
if (!('from' in options)) {
|
|
options.from = currentValue;
|
|
}
|
|
|
|
if (~to.indexOf('=')) {
|
|
to = currentValue + parseFloat(to.replace('=', ''));
|
|
}
|
|
else {
|
|
to = parseFloat(to);
|
|
}
|
|
|
|
fabric.util.animate({
|
|
startValue: options.from,
|
|
endValue: to,
|
|
byValue: options.by,
|
|
easing: options.easing,
|
|
duration: options.duration,
|
|
onChange: function(value) {
|
|
if (propPair) {
|
|
obj[propPair[0]][propPair[1]] = value;
|
|
}
|
|
else {
|
|
obj.set(property, value);
|
|
}
|
|
if (skipCallbacks) return;
|
|
options.onChange && options.onChange();
|
|
},
|
|
onComplete: function() {
|
|
if (skipCallbacks) return;
|
|
|
|
obj.setCoords();
|
|
options.onComplete && options.onComplete();
|
|
}
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Centers object horizontally on canvas to which it was added last
|
|
* @return {fabric.Object} thisArg
|
|
*/
|
|
centerH: function () {
|
|
this.canvas.centerObjectH(this);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Centers object vertically on canvas to which it was added last
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
centerV: function () {
|
|
this.canvas.centerObjectV(this);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Centers object vertically and horizontally on canvas to which is was added last
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
center: function () {
|
|
return this.centerH().centerV();
|
|
},
|
|
|
|
/**
|
|
* Removes object from canvas to which it was added last
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
remove: function() {
|
|
return this.canvas.remove(this);
|
|
},
|
|
|
|
/**
|
|
* Moves an object to the bottom of the stack of drawn objects
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
sendToBack: function() {
|
|
if (this.group) {
|
|
fabric.StaticCanvas.prototype.sendToBack.call(this.group, this);
|
|
}
|
|
else {
|
|
this.canvas.sendToBack(this);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Moves an object to the top of the stack of drawn objects
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
bringToFront: function() {
|
|
if (this.group) {
|
|
fabric.StaticCanvas.prototype.bringToFront.call(this.group, this);
|
|
}
|
|
else {
|
|
this.canvas.bringToFront(this);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Moves an object one level down in stack of drawn objects
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
sendBackwards: function() {
|
|
if (this.group) {
|
|
fabric.StaticCanvas.prototype.sendBackwards.call(this.group, this);
|
|
}
|
|
else {
|
|
this.canvas.sendBackwards(this);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Moves an object one level up in stack of drawn objects
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
bringForward: function() {
|
|
if (this.group) {
|
|
fabric.StaticCanvas.prototype.bringForward.call(this.group, this);
|
|
}
|
|
else {
|
|
this.canvas.bringForward(this);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Moves an object to specified level in stack of drawn objects
|
|
* @param {Number} index New position of object
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
moveTo: function(index) {
|
|
if (this.group) {
|
|
fabric.StaticCanvas.prototype.moveTo.call(this.group, this, index);
|
|
}
|
|
else {
|
|
this.canvas.moveTo(this, index);
|
|
}
|
|
return this;
|
|
}
|
|
});
|
|
|
|
fabric.util.createAccessors(fabric.Object);
|
|
|
|
/**
|
|
* Alias for {@link fabric.Object.prototype.setAngle}
|
|
* @alias rotate -> setAngle
|
|
*/
|
|
fabric.Object.prototype.rotate = fabric.Object.prototype.setAngle;
|
|
|
|
extend(fabric.Object.prototype, fabric.Observable);
|
|
|
|
/**
|
|
* Defines the number of fraction digits when serializing object values. You can use it to increase/decrease precision of such values like left, top, scaleX, scaleY, etc.
|
|
* @static
|
|
* @constant
|
|
* @type Number
|
|
*/
|
|
fabric.Object.NUM_FRACTION_DIGITS = 2;
|
|
|
|
/**
|
|
* @static
|
|
* @type Number
|
|
*/
|
|
fabric.Object.__uid = 0;
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
(function() {
|
|
|
|
var degreesToRadians = fabric.util.degreesToRadians;
|
|
|
|
fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ {
|
|
|
|
/**
|
|
* Translates the coordinates from origin to center coordinates (based on the object's dimensions)
|
|
* @param {fabric.Point} point The point which corresponds to the originX and originY params
|
|
* @param {string} enum('left', 'center', 'right') Horizontal origin
|
|
* @param {string} enum('top', 'center', 'bottom') Vertical origin
|
|
* @return {fabric.Point}
|
|
*/
|
|
translateToCenterPoint: function(point, originX, originY) {
|
|
var cx = point.x, cy = point.y;
|
|
|
|
if ( originX === "left" ) {
|
|
cx = point.x + this.getWidth() / 2;
|
|
}
|
|
else if ( originX === "right" ) {
|
|
cx = point.x - this.getWidth() / 2;
|
|
}
|
|
|
|
if ( originY === "top" ) {
|
|
cy = point.y + this.getHeight() / 2;
|
|
}
|
|
else if ( originY === "bottom" ) {
|
|
cy = point.y - this.getHeight() / 2;
|
|
}
|
|
|
|
// Apply the reverse rotation to the point (it's already scaled properly)
|
|
return fabric.util.rotatePoint(new fabric.Point(cx, cy), point, degreesToRadians(this.angle));
|
|
},
|
|
|
|
/**
|
|
* Translates the coordinates from center to origin coordinates (based on the object's dimensions)
|
|
* @param {fabric.Point} point The point which corresponds to center of the object
|
|
* @param {string} enum('left', 'center', 'right') Horizontal origin
|
|
* @param {string} enum('top', 'center', 'bottom') Vertical origin
|
|
* @return {fabric.Point}
|
|
*/
|
|
translateToOriginPoint: function(center, originX, originY) {
|
|
var x = center.x, y = center.y;
|
|
|
|
// Get the point coordinates
|
|
if ( originX === "left" ) {
|
|
x = center.x - this.getWidth() / 2;
|
|
}
|
|
else if ( originX === "right" ) {
|
|
x = center.x + this.getWidth() / 2;
|
|
}
|
|
if ( originY === "top" ) {
|
|
y = center.y - this.getHeight() / 2;
|
|
}
|
|
else if ( originY === "bottom" ) {
|
|
y = center.y + this.getHeight() / 2;
|
|
}
|
|
|
|
// Apply the rotation to the point (it's already scaled properly)
|
|
return fabric.util.rotatePoint(new fabric.Point(x, y), center, degreesToRadians(this.angle));
|
|
},
|
|
|
|
/**
|
|
* Returns the real center coordinates of the object
|
|
* @return {fabric.Point}
|
|
*/
|
|
getCenterPoint: function() {
|
|
return this.translateToCenterPoint(
|
|
new fabric.Point(this.left, this.top), this.originX, this.originY);
|
|
},
|
|
|
|
/**
|
|
* Returns the coordinates of the object based on center coordinates
|
|
* @param {fabric.Point} point The point which corresponds to the originX and originY params
|
|
* @return {fabric.Point}
|
|
*/
|
|
// getOriginPoint: function(center) {
|
|
// return this.translateToOriginPoint(center, this.originX, this.originY);
|
|
// },
|
|
|
|
/**
|
|
* Returns the coordinates of the object as if it has a different origin
|
|
* @param {string} enum('left', 'center', 'right') Horizontal origin
|
|
* @param {string} enum('top', 'center', 'bottom') Vertical origin
|
|
* @return {fabric.Point}
|
|
*/
|
|
// getPointByOrigin: function(originX, originY) {
|
|
// var center = this.getCenterPoint();
|
|
|
|
// return this.translateToOriginPoint(center, originX, originY);
|
|
// },
|
|
|
|
/**
|
|
* Returns the point in local coordinates
|
|
* @param {fabric.Point} The point relative to the global coordinate system
|
|
* @return {fabric.Point}
|
|
*/
|
|
toLocalPoint: function(point, originX, originY) {
|
|
var center = this.getCenterPoint();
|
|
|
|
var x, y;
|
|
if (originX !== undefined && originY !== undefined) {
|
|
if ( originX === "left" ) {
|
|
x = center.x - this.getWidth() / 2;
|
|
}
|
|
else if ( originX === "right" ) {
|
|
x = center.x + this.getWidth() / 2;
|
|
}
|
|
else {
|
|
x = center.x;
|
|
}
|
|
|
|
if ( originY === "top" ) {
|
|
y = center.y - this.getHeight() / 2;
|
|
}
|
|
else if ( originY === "bottom" ) {
|
|
y = center.y + this.getHeight() / 2;
|
|
}
|
|
else {
|
|
y = center.y;
|
|
}
|
|
}
|
|
else {
|
|
x = this.left;
|
|
y = this.top;
|
|
}
|
|
|
|
return fabric.util.rotatePoint(new fabric.Point(point.x, point.y), center, -degreesToRadians(this.angle)).subtractEquals(new fabric.Point(x, y));
|
|
},
|
|
|
|
/**
|
|
* Returns the point in global coordinates
|
|
* @param {fabric.Point} The point relative to the local coordinate system
|
|
* @return {fabric.Point}
|
|
*/
|
|
// toGlobalPoint: function(point) {
|
|
// return fabric.util.rotatePoint(point, this.getCenterPoint(), degreesToRadians(this.angle)).addEquals(new fabric.Point(this.left, this.top));
|
|
// },
|
|
|
|
/**
|
|
* Sets the position of the object taking into consideration the object's origin
|
|
* @param {fabric.Point} point The new position of the object
|
|
* @param {string} enum('left', 'center', 'right') Horizontal origin
|
|
* @param {string} enum('top', 'center', 'bottom') Vertical origin
|
|
* @return {void}
|
|
*/
|
|
setPositionByOrigin: function(pos, originX, originY) {
|
|
var center = this.translateToCenterPoint(pos, originX, originY);
|
|
var position = this.translateToOriginPoint(center, this.originX, this.originY);
|
|
|
|
this.set('left', position.x);
|
|
this.set('top', position.y);
|
|
},
|
|
|
|
/**
|
|
* @param {String} to One of left, center, right
|
|
*/
|
|
adjustPosition: function(to) {
|
|
var angle = degreesToRadians(this.angle);
|
|
var hypotHalf = this.getWidth() / 2;
|
|
var xHalf = Math.cos(angle) * hypotHalf;
|
|
var hypotFull = this.getWidth();
|
|
var xFull = Math.cos(angle) * hypotFull;
|
|
|
|
if (this.originX === 'center' && to === 'left' ||
|
|
this.originX === 'right' && to === 'center') {
|
|
// move half left
|
|
this.left -= xHalf;
|
|
}
|
|
else if (this.originX === 'left' && to === 'center' ||
|
|
this.originX === 'center' && to === 'right') {
|
|
// move half right
|
|
this.left += xHalf;
|
|
}
|
|
else if (this.originX === 'left' && to === 'right') {
|
|
// move full right
|
|
this.left += xFull;
|
|
}
|
|
else if (this.originX === 'right' && to === 'left') {
|
|
// move full left
|
|
this.left -= xFull;
|
|
}
|
|
|
|
this.setCoords();
|
|
this.originX = to;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_getLeftTopCoords: function() {
|
|
var angle = degreesToRadians(this.angle);
|
|
|
|
var hypotHalf = this.getWidth() / 2;
|
|
var xHalf = Math.cos(angle) * hypotHalf;
|
|
var yHalf = Math.sin(angle) * hypotHalf;
|
|
var x = this.left;
|
|
var y = this.top;
|
|
|
|
if (this.originX === 'center' || this.originX === 'right') {
|
|
x -= xHalf;
|
|
}
|
|
if (this.originY === 'center' || this.originY === 'bottom') {
|
|
y -= yHalf;
|
|
}
|
|
|
|
return { x: x, y: y };
|
|
}
|
|
});
|
|
|
|
})();
|
|
|
|
(function() {
|
|
|
|
var degreesToRadians = fabric.util.degreesToRadians;
|
|
|
|
fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ {
|
|
|
|
/**
|
|
* Checks if object intersects with an area formed by 2 points
|
|
* @param {Object} pointTL top-left point of area
|
|
* @param {Object} pointBR bottom-right point of area
|
|
* @return {Boolean} true if object intersects with an area formed by 2 points
|
|
*/
|
|
intersectsWithRect: function(pointTL, pointBR) {
|
|
var oCoords = this.oCoords,
|
|
tl = new fabric.Point(oCoords.tl.x, oCoords.tl.y),
|
|
tr = new fabric.Point(oCoords.tr.x, oCoords.tr.y),
|
|
bl = new fabric.Point(oCoords.bl.x, oCoords.bl.y),
|
|
br = new fabric.Point(oCoords.br.x, oCoords.br.y);
|
|
|
|
var intersection = fabric.Intersection.intersectPolygonRectangle(
|
|
[tl, tr, br, bl],
|
|
pointTL,
|
|
pointBR
|
|
);
|
|
return intersection.status === 'Intersection';
|
|
},
|
|
|
|
/**
|
|
* Checks if object intersects with another object
|
|
* @param {Object} other Object to test
|
|
* @return {Boolean} true if object intersects with another object
|
|
*/
|
|
intersectsWithObject: function(other) {
|
|
// extracts coords
|
|
function getCoords(oCoords) {
|
|
return {
|
|
tl: new fabric.Point(oCoords.tl.x, oCoords.tl.y),
|
|
tr: new fabric.Point(oCoords.tr.x, oCoords.tr.y),
|
|
bl: new fabric.Point(oCoords.bl.x, oCoords.bl.y),
|
|
br: new fabric.Point(oCoords.br.x, oCoords.br.y)
|
|
};
|
|
}
|
|
var thisCoords = getCoords(this.oCoords),
|
|
otherCoords = getCoords(other.oCoords);
|
|
|
|
var intersection = fabric.Intersection.intersectPolygonPolygon(
|
|
[thisCoords.tl, thisCoords.tr, thisCoords.br, thisCoords.bl],
|
|
[otherCoords.tl, otherCoords.tr, otherCoords.br, otherCoords.bl]
|
|
);
|
|
|
|
return intersection.status === 'Intersection';
|
|
},
|
|
|
|
/**
|
|
* Checks if object is fully contained within area of another object
|
|
* @param {Object} other Object to test
|
|
* @return {Boolean} true if object is fully contained within area of another object
|
|
*/
|
|
isContainedWithinObject: function(other) {
|
|
var boundingRect = other.getBoundingRect(),
|
|
point1 = new fabric.Point(boundingRect.left, boundingRect.top),
|
|
point2 = new fabric.Point(boundingRect.left + boundingRect.width, boundingRect.top + boundingRect.height);
|
|
|
|
return this.isContainedWithinRect(point1, point2);
|
|
},
|
|
|
|
/**
|
|
* Checks if object is fully contained within area formed by 2 points
|
|
* @param {Object} pointTL top-left point of area
|
|
* @param {Object} pointBR bottom-right point of area
|
|
* @return {Boolean} true if object is fully contained within area formed by 2 points
|
|
*/
|
|
isContainedWithinRect: function(pointTL, pointBR) {
|
|
var boundingRect = this.getBoundingRect();
|
|
|
|
return (
|
|
boundingRect.left > pointTL.x &&
|
|
boundingRect.left + boundingRect.width < pointBR.x &&
|
|
boundingRect.top > pointTL.y &&
|
|
boundingRect.top + boundingRect.height < pointBR.y
|
|
);
|
|
},
|
|
|
|
/**
|
|
* Checks if point is inside the object
|
|
* @param {Object} point
|
|
* @return {Boolean} true if point is inside the object
|
|
*/
|
|
containsPoint: function(point) {
|
|
var lines = this._getImageLines(this.oCoords),
|
|
xPoints = this._findCrossPoints(point, lines);
|
|
|
|
// if xPoints is odd then point is inside the object
|
|
return (xPoints !== 0 && xPoints % 2 === 1);
|
|
},
|
|
|
|
/**
|
|
* Method that returns an object with the object edges in it, given the coordinates of the corners
|
|
* @private
|
|
* @param {Object} oCoords Coordinates of the object corners
|
|
*/
|
|
_getImageLines: function(oCoords) {
|
|
return {
|
|
topline: {
|
|
o: oCoords.tl,
|
|
d: oCoords.tr
|
|
},
|
|
rightline: {
|
|
o: oCoords.tr,
|
|
d: oCoords.br
|
|
},
|
|
bottomline: {
|
|
o: oCoords.br,
|
|
d: oCoords.bl
|
|
},
|
|
leftline: {
|
|
o: oCoords.bl,
|
|
d: oCoords.tl
|
|
}
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Helper method to determine how many cross points are between the 4 object edges
|
|
* and the horizontal line determined by a point on canvas
|
|
* @private
|
|
* @param {Object} point
|
|
* @param {Object} oCoords Coordinates of the image being evaluated
|
|
*/
|
|
_findCrossPoints: function(point, oCoords) {
|
|
var b1, b2, a1, a2, xi, yi,
|
|
xcount = 0,
|
|
iLine;
|
|
|
|
for (var lineKey in oCoords) {
|
|
iLine = oCoords[lineKey];
|
|
// optimisation 1: line below point. no cross
|
|
if ((iLine.o.y < point.y) && (iLine.d.y < point.y)) {
|
|
continue;
|
|
}
|
|
// optimisation 2: line above point. no cross
|
|
if ((iLine.o.y >= point.y) && (iLine.d.y >= point.y)) {
|
|
continue;
|
|
}
|
|
// optimisation 3: vertical line case
|
|
if ((iLine.o.x === iLine.d.x) && (iLine.o.x >= point.x)) {
|
|
xi = iLine.o.x;
|
|
yi = point.y;
|
|
}
|
|
// calculate the intersection point
|
|
else {
|
|
b1 = 0;
|
|
b2 = (iLine.d.y - iLine.o.y) / (iLine.d.x - iLine.o.x);
|
|
a1 = point.y- b1 * point.x;
|
|
a2 = iLine.o.y - b2 * iLine.o.x;
|
|
|
|
xi = - (a1 - a2) / (b1 - b2);
|
|
yi = a1 + b1 * xi;
|
|
}
|
|
// dont count xi < point.x cases
|
|
if (xi >= point.x) {
|
|
xcount += 1;
|
|
}
|
|
// optimisation 4: specific for square images
|
|
if (xcount === 2) {
|
|
break;
|
|
}
|
|
}
|
|
return xcount;
|
|
},
|
|
|
|
/**
|
|
* Returns width of an object's bounding rectangle
|
|
* @deprecated since 1.0.4
|
|
* @return {Number} width value
|
|
*/
|
|
getBoundingRectWidth: function() {
|
|
return this.getBoundingRect().width;
|
|
},
|
|
|
|
/**
|
|
* Returns height of an object's bounding rectangle
|
|
* @deprecated since 1.0.4
|
|
* @return {Number} height value
|
|
*/
|
|
getBoundingRectHeight: function() {
|
|
return this.getBoundingRect().height;
|
|
},
|
|
|
|
/**
|
|
* Returns coordinates of object's bounding rectangle (left, top, width, height)
|
|
* @return {Object} Object with left, top, width, height properties
|
|
*/
|
|
getBoundingRect: function() {
|
|
this.oCoords || this.setCoords();
|
|
|
|
var xCoords = [this.oCoords.tl.x, this.oCoords.tr.x, this.oCoords.br.x, this.oCoords.bl.x];
|
|
var minX = fabric.util.array.min(xCoords);
|
|
var maxX = fabric.util.array.max(xCoords);
|
|
var width = Math.abs(minX - maxX);
|
|
|
|
var yCoords = [this.oCoords.tl.y, this.oCoords.tr.y, this.oCoords.br.y, this.oCoords.bl.y];
|
|
var minY = fabric.util.array.min(yCoords);
|
|
var maxY = fabric.util.array.max(yCoords);
|
|
var height = Math.abs(minY - maxY);
|
|
|
|
return {
|
|
left: minX,
|
|
top: minY,
|
|
width: width,
|
|
height: height
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Returns width of an object
|
|
* @return {Number} width value
|
|
*/
|
|
getWidth: function() {
|
|
return this.width * this.scaleX;
|
|
},
|
|
|
|
/**
|
|
* Returns height of an object
|
|
* @return {Number} height value
|
|
*/
|
|
getHeight: function() {
|
|
return this.height * this.scaleY;
|
|
},
|
|
|
|
/**
|
|
* Makes sure the scale is valid and modifies it if necessary
|
|
* @private
|
|
* @param {Number} value
|
|
* @return {Number}
|
|
*/
|
|
_constrainScale: function(value) {
|
|
if (Math.abs(value) < this.minScaleLimit) {
|
|
if (value < 0)
|
|
return -this.minScaleLimit;
|
|
else
|
|
return this.minScaleLimit;
|
|
}
|
|
|
|
return value;
|
|
},
|
|
|
|
/**
|
|
* Scales an object (equally by x and y)
|
|
* @param value {Number} scale factor
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
scale: function(value) {
|
|
value = this._constrainScale(value);
|
|
|
|
if (value < 0) {
|
|
this.flipX = !this.flipX;
|
|
this.flipY = !this.flipY;
|
|
value *= -1;
|
|
}
|
|
|
|
this.scaleX = value;
|
|
this.scaleY = value;
|
|
this.setCoords();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Scales an object to a given width, with respect to bounding box (scaling by x/y equally)
|
|
* @param value {Number} new width value
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
scaleToWidth: function(value) {
|
|
// adjust to bounding rect factor so that rotated shapes would fit as well
|
|
var boundingRectFactor = this.getBoundingRectWidth() / this.getWidth();
|
|
return this.scale(value / this.width / boundingRectFactor);
|
|
},
|
|
|
|
/**
|
|
* Scales an object to a given height, with respect to bounding box (scaling by x/y equally)
|
|
* @param value {Number} new height value
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
scaleToHeight: function(value) {
|
|
// adjust to bounding rect factor so that rotated shapes would fit as well
|
|
var boundingRectFactor = this.getBoundingRectHeight() / this.getHeight();
|
|
return this.scale(value / this.height / boundingRectFactor);
|
|
},
|
|
|
|
/**
|
|
* Sets corner position coordinates based on current angle, width and height
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
setCoords: function() {
|
|
|
|
var strokeWidth = this.strokeWidth > 1 ? this.strokeWidth : 0,
|
|
padding = this.padding,
|
|
theta = degreesToRadians(this.angle);
|
|
|
|
this.currentWidth = (this.width + strokeWidth) * this.scaleX + padding * 2;
|
|
this.currentHeight = (this.height + strokeWidth) * this.scaleY + padding * 2;
|
|
|
|
// If width is negative, make postive. Fixes path selection issue
|
|
if (this.currentWidth < 0) {
|
|
this.currentWidth = Math.abs(this.currentWidth);
|
|
}
|
|
|
|
var _hypotenuse = Math.sqrt(
|
|
Math.pow(this.currentWidth / 2, 2) +
|
|
Math.pow(this.currentHeight / 2, 2));
|
|
|
|
var _angle = Math.atan(isFinite(this.currentHeight / this.currentWidth) ? this.currentHeight / this.currentWidth : 0);
|
|
|
|
// offset added for rotate and scale actions
|
|
var offsetX = Math.cos(_angle + theta) * _hypotenuse,
|
|
offsetY = Math.sin(_angle + theta) * _hypotenuse,
|
|
sinTh = Math.sin(theta),
|
|
cosTh = Math.cos(theta);
|
|
|
|
var coords = this.getCenterPoint();
|
|
var tl = {
|
|
x: coords.x - offsetX,
|
|
y: coords.y - offsetY
|
|
};
|
|
var tr = {
|
|
x: tl.x + (this.currentWidth * cosTh),
|
|
y: tl.y + (this.currentWidth * sinTh)
|
|
};
|
|
var br = {
|
|
x: tr.x - (this.currentHeight * sinTh),
|
|
y: tr.y + (this.currentHeight * cosTh)
|
|
};
|
|
var bl = {
|
|
x: tl.x - (this.currentHeight * sinTh),
|
|
y: tl.y + (this.currentHeight * cosTh)
|
|
};
|
|
var ml = {
|
|
x: tl.x - (this.currentHeight/2 * sinTh),
|
|
y: tl.y + (this.currentHeight/2 * cosTh)
|
|
};
|
|
var mt = {
|
|
x: tl.x + (this.currentWidth/2 * cosTh),
|
|
y: tl.y + (this.currentWidth/2 * sinTh)
|
|
};
|
|
var mr = {
|
|
x: tr.x - (this.currentHeight/2 * sinTh),
|
|
y: tr.y + (this.currentHeight/2 * cosTh)
|
|
};
|
|
var mb = {
|
|
x: bl.x + (this.currentWidth/2 * cosTh),
|
|
y: bl.y + (this.currentWidth/2 * sinTh)
|
|
};
|
|
var mtr = {
|
|
x: mt.x,
|
|
y: mt.y
|
|
};
|
|
|
|
// debugging
|
|
|
|
// setTimeout(function() {
|
|
// canvas.contextTop.fillStyle = 'green';
|
|
// canvas.contextTop.fillRect(mb.x, mb.y, 3, 3);
|
|
// canvas.contextTop.fillRect(bl.x, bl.y, 3, 3);
|
|
// canvas.contextTop.fillRect(br.x, br.y, 3, 3);
|
|
// canvas.contextTop.fillRect(tl.x, tl.y, 3, 3);
|
|
// canvas.contextTop.fillRect(tr.x, tr.y, 3, 3);
|
|
// canvas.contextTop.fillRect(ml.x, ml.y, 3, 3);
|
|
// canvas.contextTop.fillRect(mr.x, mr.y, 3, 3);
|
|
// canvas.contextTop.fillRect(mt.x, mt.y, 3, 3);
|
|
// }, 50);
|
|
|
|
this.oCoords = {
|
|
// corners
|
|
tl: tl, tr: tr, br: br, bl: bl,
|
|
// middle
|
|
ml: ml, mt: mt, mr: mr, mb: mb,
|
|
// rotating point
|
|
mtr: mtr
|
|
};
|
|
|
|
// set coordinates of the draggable boxes in the corners used to scale/rotate the image
|
|
this._setCornerCoords();
|
|
|
|
return this;
|
|
}
|
|
});
|
|
})();
|
|
|
|
/*
|
|
Depends on `stateProperties`
|
|
*/
|
|
fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ {
|
|
|
|
/**
|
|
* Returns true if object state (one of its state properties) was changed
|
|
* @return {Boolean} true if instance' state has changed since `{@link fabric.Object#saveState}` was called
|
|
*/
|
|
hasStateChanged: function() {
|
|
return this.stateProperties.some(function(prop) {
|
|
return this[prop] !== this.originalState[prop];
|
|
}, this);
|
|
},
|
|
|
|
/**
|
|
* Saves state of an object
|
|
* @param {Object} [options] Object with additional `stateProperties` array to include when saving state
|
|
* @return {fabric.Object} thisArg
|
|
*/
|
|
saveState: function(options) {
|
|
this.stateProperties.forEach(function(prop) {
|
|
this.originalState[prop] = this.get(prop);
|
|
}, this);
|
|
|
|
if (options && options.stateProperties) {
|
|
options.stateProperties.forEach(function(prop) {
|
|
this.originalState[prop] = this.get(prop);
|
|
}, this);
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Setups state of an object
|
|
* @return {fabric.Object} thisArg
|
|
*/
|
|
setupState: function() {
|
|
this.originalState = { };
|
|
this.saveState();
|
|
|
|
return this;
|
|
}
|
|
});
|
|
|
|
(function(){
|
|
|
|
var getPointer = fabric.util.getPointer,
|
|
degreesToRadians = fabric.util.degreesToRadians;
|
|
|
|
fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ {
|
|
|
|
/**
|
|
* Determines which one of the four corners has been clicked
|
|
* @private
|
|
* @param {Event} e Event object
|
|
* @param {Object} offset Canvas offset
|
|
* @return {String|Boolean} corner code (tl, tr, bl, br, etc.), or false if nothing is found
|
|
*/
|
|
_findTargetCorner: function(e, offset) {
|
|
if (!this.hasControls || !this.active) return false;
|
|
|
|
var pointer = getPointer(e, this.canvas.upperCanvasEl),
|
|
ex = pointer.x - offset.left,
|
|
ey = pointer.y - offset.top,
|
|
xPoints,
|
|
lines;
|
|
|
|
for (var i in this.oCoords) {
|
|
|
|
if (i === 'mtr' && !this.hasRotatingPoint) {
|
|
continue;
|
|
}
|
|
|
|
if (this.get('lockUniScaling') && (i === 'mt' || i === 'mr' || i === 'mb' || i === 'ml')) {
|
|
continue;
|
|
}
|
|
|
|
lines = this._getImageLines(this.oCoords[i].corner);
|
|
|
|
// debugging
|
|
|
|
// canvas.contextTop.fillRect(lines.bottomline.d.x, lines.bottomline.d.y, 2, 2);
|
|
// canvas.contextTop.fillRect(lines.bottomline.o.x, lines.bottomline.o.y, 2, 2);
|
|
|
|
// canvas.contextTop.fillRect(lines.leftline.d.x, lines.leftline.d.y, 2, 2);
|
|
// canvas.contextTop.fillRect(lines.leftline.o.x, lines.leftline.o.y, 2, 2);
|
|
|
|
// canvas.contextTop.fillRect(lines.topline.d.x, lines.topline.d.y, 2, 2);
|
|
// canvas.contextTop.fillRect(lines.topline.o.x, lines.topline.o.y, 2, 2);
|
|
|
|
// canvas.contextTop.fillRect(lines.rightline.d.x, lines.rightline.d.y, 2, 2);
|
|
// canvas.contextTop.fillRect(lines.rightline.o.x, lines.rightline.o.y, 2, 2);
|
|
|
|
xPoints = this._findCrossPoints({x: ex, y: ey}, lines);
|
|
if (xPoints !== 0 && xPoints % 2 === 1) {
|
|
this.__corner = i;
|
|
return i;
|
|
}
|
|
}
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* Sets the coordinates of the draggable boxes in the corners of
|
|
* the image used to scale/rotate it.
|
|
* @private
|
|
*/
|
|
_setCornerCoords: function() {
|
|
var coords = this.oCoords,
|
|
theta = degreesToRadians(this.angle),
|
|
newTheta = degreesToRadians(45 - this.angle),
|
|
cornerHypotenuse = Math.sqrt(2 * Math.pow(this.cornerSize, 2)) / 2,
|
|
cosHalfOffset = cornerHypotenuse * Math.cos(newTheta),
|
|
sinHalfOffset = cornerHypotenuse * Math.sin(newTheta),
|
|
sinTh = Math.sin(theta),
|
|
cosTh = Math.cos(theta);
|
|
|
|
coords.tl.corner = {
|
|
tl: {
|
|
x: coords.tl.x - sinHalfOffset,
|
|
y: coords.tl.y - cosHalfOffset
|
|
},
|
|
tr: {
|
|
x: coords.tl.x + cosHalfOffset,
|
|
y: coords.tl.y - sinHalfOffset
|
|
},
|
|
bl: {
|
|
x: coords.tl.x - cosHalfOffset,
|
|
y: coords.tl.y + sinHalfOffset
|
|
},
|
|
br: {
|
|
x: coords.tl.x + sinHalfOffset,
|
|
y: coords.tl.y + cosHalfOffset
|
|
}
|
|
};
|
|
|
|
coords.tr.corner = {
|
|
tl: {
|
|
x: coords.tr.x - sinHalfOffset,
|
|
y: coords.tr.y - cosHalfOffset
|
|
},
|
|
tr: {
|
|
x: coords.tr.x + cosHalfOffset,
|
|
y: coords.tr.y - sinHalfOffset
|
|
},
|
|
br: {
|
|
x: coords.tr.x + sinHalfOffset,
|
|
y: coords.tr.y + cosHalfOffset
|
|
},
|
|
bl: {
|
|
x: coords.tr.x - cosHalfOffset,
|
|
y: coords.tr.y + sinHalfOffset
|
|
}
|
|
};
|
|
|
|
coords.bl.corner = {
|
|
tl: {
|
|
x: coords.bl.x - sinHalfOffset,
|
|
y: coords.bl.y - cosHalfOffset
|
|
},
|
|
bl: {
|
|
x: coords.bl.x - cosHalfOffset,
|
|
y: coords.bl.y + sinHalfOffset
|
|
},
|
|
br: {
|
|
x: coords.bl.x + sinHalfOffset,
|
|
y: coords.bl.y + cosHalfOffset
|
|
},
|
|
tr: {
|
|
x: coords.bl.x + cosHalfOffset,
|
|
y: coords.bl.y - sinHalfOffset
|
|
}
|
|
};
|
|
|
|
coords.br.corner = {
|
|
tr: {
|
|
x: coords.br.x + cosHalfOffset,
|
|
y: coords.br.y - sinHalfOffset
|
|
},
|
|
bl: {
|
|
x: coords.br.x - cosHalfOffset,
|
|
y: coords.br.y + sinHalfOffset
|
|
},
|
|
br: {
|
|
x: coords.br.x + sinHalfOffset,
|
|
y: coords.br.y + cosHalfOffset
|
|
},
|
|
tl: {
|
|
x: coords.br.x - sinHalfOffset,
|
|
y: coords.br.y - cosHalfOffset
|
|
}
|
|
};
|
|
|
|
coords.ml.corner = {
|
|
tl: {
|
|
x: coords.ml.x - sinHalfOffset,
|
|
y: coords.ml.y - cosHalfOffset
|
|
},
|
|
tr: {
|
|
x: coords.ml.x + cosHalfOffset,
|
|
y: coords.ml.y - sinHalfOffset
|
|
},
|
|
bl: {
|
|
x: coords.ml.x - cosHalfOffset,
|
|
y: coords.ml.y + sinHalfOffset
|
|
},
|
|
br: {
|
|
x: coords.ml.x + sinHalfOffset,
|
|
y: coords.ml.y + cosHalfOffset
|
|
}
|
|
};
|
|
|
|
coords.mt.corner = {
|
|
tl: {
|
|
x: coords.mt.x - sinHalfOffset,
|
|
y: coords.mt.y - cosHalfOffset
|
|
},
|
|
tr: {
|
|
x: coords.mt.x + cosHalfOffset,
|
|
y: coords.mt.y - sinHalfOffset
|
|
},
|
|
bl: {
|
|
x: coords.mt.x - cosHalfOffset,
|
|
y: coords.mt.y + sinHalfOffset
|
|
},
|
|
br: {
|
|
x: coords.mt.x + sinHalfOffset,
|
|
y: coords.mt.y + cosHalfOffset
|
|
}
|
|
};
|
|
|
|
coords.mr.corner = {
|
|
tl: {
|
|
x: coords.mr.x - sinHalfOffset,
|
|
y: coords.mr.y - cosHalfOffset
|
|
},
|
|
tr: {
|
|
x: coords.mr.x + cosHalfOffset,
|
|
y: coords.mr.y - sinHalfOffset
|
|
},
|
|
bl: {
|
|
x: coords.mr.x - cosHalfOffset,
|
|
y: coords.mr.y + sinHalfOffset
|
|
},
|
|
br: {
|
|
x: coords.mr.x + sinHalfOffset,
|
|
y: coords.mr.y + cosHalfOffset
|
|
}
|
|
};
|
|
|
|
coords.mb.corner = {
|
|
tl: {
|
|
x: coords.mb.x - sinHalfOffset,
|
|
y: coords.mb.y - cosHalfOffset
|
|
},
|
|
tr: {
|
|
x: coords.mb.x + cosHalfOffset,
|
|
y: coords.mb.y - sinHalfOffset
|
|
},
|
|
bl: {
|
|
x: coords.mb.x - cosHalfOffset,
|
|
y: coords.mb.y + sinHalfOffset
|
|
},
|
|
br: {
|
|
x: coords.mb.x + sinHalfOffset,
|
|
y: coords.mb.y + cosHalfOffset
|
|
}
|
|
};
|
|
|
|
coords.mtr.corner = {
|
|
tl: {
|
|
x: coords.mtr.x - sinHalfOffset + (sinTh * this.rotatingPointOffset),
|
|
y: coords.mtr.y - cosHalfOffset - (cosTh * this.rotatingPointOffset)
|
|
},
|
|
tr: {
|
|
x: coords.mtr.x + cosHalfOffset + (sinTh * this.rotatingPointOffset),
|
|
y: coords.mtr.y - sinHalfOffset - (cosTh * this.rotatingPointOffset)
|
|
},
|
|
bl: {
|
|
x: coords.mtr.x - cosHalfOffset + (sinTh * this.rotatingPointOffset),
|
|
y: coords.mtr.y + sinHalfOffset - (cosTh * this.rotatingPointOffset)
|
|
},
|
|
br: {
|
|
x: coords.mtr.x + sinHalfOffset + (sinTh * this.rotatingPointOffset),
|
|
y: coords.mtr.y + cosHalfOffset - (cosTh * this.rotatingPointOffset)
|
|
}
|
|
};
|
|
},
|
|
/**
|
|
* Draws borders of an object's bounding box.
|
|
* Requires public properties: width, height
|
|
* Requires public options: padding, borderColor
|
|
* @param {CanvasRenderingContext2D} ctx Context to draw on
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
drawBorders: function(ctx) {
|
|
if (!this.hasBorders) return this;
|
|
|
|
var padding = this.padding,
|
|
padding2 = padding * 2,
|
|
strokeWidth = this.strokeWidth > 1 ? this.strokeWidth : 0;
|
|
|
|
ctx.save();
|
|
|
|
ctx.globalAlpha = this.isMoving ? this.borderOpacityWhenMoving : 1;
|
|
ctx.strokeStyle = this.borderColor;
|
|
|
|
var scaleX = 1 / this._constrainScale(this.scaleX),
|
|
scaleY = 1 / this._constrainScale(this.scaleY);
|
|
|
|
ctx.lineWidth = 1 / this.borderScaleFactor;
|
|
|
|
ctx.scale(scaleX, scaleY);
|
|
|
|
var w = this.getWidth(),
|
|
h = this.getHeight();
|
|
|
|
ctx.strokeRect(
|
|
~~(-(w / 2) - padding - strokeWidth / 2 * this.scaleX) + 0.5, // offset needed to make lines look sharper
|
|
~~(-(h / 2) - padding - strokeWidth / 2 * this.scaleY) + 0.5,
|
|
~~(w + padding2 + strokeWidth * this.scaleX),
|
|
~~(h + padding2 + strokeWidth * this.scaleY)
|
|
);
|
|
|
|
if (this.hasRotatingPoint && !this.get('lockRotation') && this.hasControls) {
|
|
|
|
var rotateHeight = (
|
|
this.flipY
|
|
? h + (strokeWidth * this.scaleY) + (padding * 2)
|
|
: -h - (strokeWidth * this.scaleY) - (padding * 2)
|
|
) / 2;
|
|
|
|
ctx.beginPath();
|
|
ctx.moveTo(0, rotateHeight);
|
|
ctx.lineTo(0, rotateHeight + (this.flipY ? this.rotatingPointOffset : -this.rotatingPointOffset));
|
|
ctx.closePath();
|
|
ctx.stroke();
|
|
}
|
|
|
|
ctx.restore();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Draws corners of an object's bounding box.
|
|
* Requires public properties: width, height, scaleX, scaleY
|
|
* Requires public options: cornerSize, padding
|
|
* @param {CanvasRenderingContext2D} ctx Context to draw on
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
drawControls: function(ctx) {
|
|
if (!this.hasControls) return this;
|
|
|
|
var size = this.cornerSize,
|
|
size2 = size / 2,
|
|
strokeWidth2 = this.strokeWidth / 2,
|
|
left = -(this.width / 2),
|
|
top = -(this.height / 2),
|
|
_left,
|
|
_top,
|
|
sizeX = size / this.scaleX,
|
|
sizeY = size / this.scaleY,
|
|
paddingX = this.padding / this.scaleX,
|
|
paddingY = this.padding / this.scaleY,
|
|
scaleOffsetY = size2 / this.scaleY,
|
|
scaleOffsetX = size2 / this.scaleX,
|
|
scaleOffsetSizeX = (size2 - size) / this.scaleX,
|
|
scaleOffsetSizeY = (size2 - size) / this.scaleY,
|
|
height = this.height,
|
|
width = this.width,
|
|
methodName = this.transparentCorners ? 'strokeRect' : 'fillRect',
|
|
isVML = typeof G_vmlCanvasManager !== 'undefined';
|
|
|
|
ctx.save();
|
|
|
|
ctx.lineWidth = 1 / Math.max(this.scaleX, this.scaleY);
|
|
|
|
ctx.globalAlpha = this.isMoving ? this.borderOpacityWhenMoving : 1;
|
|
ctx.strokeStyle = ctx.fillStyle = this.cornerColor;
|
|
|
|
// top-left
|
|
_left = left - scaleOffsetX - strokeWidth2 - paddingX;
|
|
_top = top - scaleOffsetY - strokeWidth2 - paddingY;
|
|
|
|
isVML || ctx.clearRect(_left, _top, sizeX, sizeY);
|
|
ctx[methodName](_left, _top, sizeX, sizeY);
|
|
|
|
// top-right
|
|
_left = left + width - scaleOffsetX + strokeWidth2 + paddingX;
|
|
_top = top - scaleOffsetY - strokeWidth2 - paddingY;
|
|
|
|
isVML || ctx.clearRect(_left, _top, sizeX, sizeY);
|
|
ctx[methodName](_left, _top, sizeX, sizeY);
|
|
|
|
// bottom-left
|
|
_left = left - scaleOffsetX - strokeWidth2 - paddingX;
|
|
_top = top + height + scaleOffsetSizeY + strokeWidth2 + paddingY;
|
|
|
|
isVML || ctx.clearRect(_left, _top, sizeX, sizeY);
|
|
ctx[methodName](_left, _top, sizeX, sizeY);
|
|
|
|
// bottom-right
|
|
_left = left + width + scaleOffsetSizeX + strokeWidth2 + paddingX;
|
|
_top = top + height + scaleOffsetSizeY + strokeWidth2 + paddingY;
|
|
|
|
isVML || ctx.clearRect(_left, _top, sizeX, sizeY);
|
|
ctx[methodName](_left, _top, sizeX, sizeY);
|
|
|
|
if (!this.get('lockUniScaling')) {
|
|
// middle-top
|
|
_left = left + width/2 - scaleOffsetX;
|
|
_top = top - scaleOffsetY - strokeWidth2 - paddingY;
|
|
|
|
isVML || ctx.clearRect(_left, _top, sizeX, sizeY);
|
|
ctx[methodName](_left, _top, sizeX, sizeY);
|
|
|
|
// middle-bottom
|
|
_left = left + width/2 - scaleOffsetX;
|
|
_top = top + height + scaleOffsetSizeY + strokeWidth2 + paddingY;
|
|
|
|
isVML || ctx.clearRect(_left, _top, sizeX, sizeY);
|
|
ctx[methodName](_left, _top, sizeX, sizeY);
|
|
|
|
// middle-right
|
|
_left = left + width + scaleOffsetSizeX + strokeWidth2 + paddingX;
|
|
_top = top + height/2 - scaleOffsetY;
|
|
|
|
isVML || ctx.clearRect(_left, _top, sizeX, sizeY);
|
|
ctx[methodName](_left, _top, sizeX, sizeY);
|
|
|
|
// middle-left
|
|
_left = left - scaleOffsetX - strokeWidth2 - paddingX;
|
|
_top = top + height/2 - scaleOffsetY;
|
|
|
|
isVML || ctx.clearRect(_left, _top, sizeX, sizeY);
|
|
ctx[methodName](_left, _top, sizeX, sizeY);
|
|
}
|
|
|
|
// middle-top-rotate
|
|
if (this.hasRotatingPoint) {
|
|
|
|
_left = left + width/2 - scaleOffsetX;
|
|
_top = this.flipY ?
|
|
(top + height + (this.rotatingPointOffset / this.scaleY) - sizeY/2 + strokeWidth2 + paddingY)
|
|
: (top - (this.rotatingPointOffset / this.scaleY) - sizeY/2 - strokeWidth2 - paddingY);
|
|
|
|
isVML || ctx.clearRect(_left, _top, sizeX, sizeY);
|
|
ctx[methodName](_left, _top, sizeX, sizeY);
|
|
}
|
|
|
|
ctx.restore();
|
|
|
|
return this;
|
|
}
|
|
});
|
|
})();
|
|
|
|
(function(global) {
|
|
|
|
"use strict";
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
extend = fabric.util.object.extend,
|
|
coordProps = { 'x1': 1, 'x2': 1, 'y1': 1, 'y2': 1 },
|
|
supportsLineDash = fabric.StaticCanvas.supports('setLineDash');
|
|
|
|
if (fabric.Line) {
|
|
fabric.warn('fabric.Line is already defined');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Line class
|
|
* @class fabric.Line
|
|
* @extends fabric.Object
|
|
*/
|
|
fabric.Line = fabric.util.createClass(fabric.Object, /** @lends fabric.Line.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'line',
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Array} [points] Array of points
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Line} thisArg
|
|
*/
|
|
initialize: function(points, options) {
|
|
options = options || { };
|
|
|
|
if (!points) {
|
|
points = [0, 0, 0, 0];
|
|
}
|
|
|
|
this.callSuper('initialize', options);
|
|
|
|
this.set('x1', points[0]);
|
|
this.set('y1', points[1]);
|
|
this.set('x2', points[2]);
|
|
this.set('y2', points[3]);
|
|
|
|
this._setWidthHeight(options);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} [options] Options
|
|
*/
|
|
_setWidthHeight: function(options) {
|
|
options || (options = { });
|
|
|
|
this.set('width', (this.x2 - this.x1) || 1);
|
|
this.set('height', (this.y2 - this.y1) || 1);
|
|
|
|
this.set('left', 'left' in options ? options.left : (this.x1 + this.width / 2));
|
|
this.set('top', 'top' in options ? options.top : (this.y1 + this.height / 2));
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} key
|
|
* @param {Any} value
|
|
*/
|
|
_set: function(key, value) {
|
|
this[key] = value;
|
|
if (key in coordProps) {
|
|
this._setWidthHeight();
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_render: function(ctx) {
|
|
ctx.beginPath();
|
|
|
|
var isInPathGroup = this.group && this.group.type !== 'group';
|
|
if (isInPathGroup && !this.transformMatrix) {
|
|
ctx.translate(-this.group.width/2 + this.left, -this.group.height / 2 + this.top);
|
|
}
|
|
else {
|
|
ctx.translate(this.left, this.top);
|
|
}
|
|
|
|
if (!this.strokeDashArray || this.strokeDashArray && supportsLineDash) {
|
|
// move from center (of virtual box) to its left/top corner
|
|
ctx.moveTo(this.width === 1 ? 0 : (-this.width / 2), this.height === 1 ? 0 : (-this.height / 2));
|
|
ctx.lineTo(this.width === 1 ? 0 : (this.width / 2), this.height === 1 ? 0 : (this.height / 2));
|
|
}
|
|
|
|
ctx.lineWidth = this.strokeWidth;
|
|
|
|
// TODO: test this
|
|
// make sure setting "fill" changes color of a line
|
|
// (by copying fillStyle to strokeStyle, since line is stroked, not filled)
|
|
var origStrokeStyle = ctx.strokeStyle;
|
|
ctx.strokeStyle = this.stroke || ctx.fillStyle;
|
|
this._renderStroke(ctx);
|
|
ctx.strokeStyle = origStrokeStyle;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderDashedStroke: function(ctx) {
|
|
var x = this.width === 1 ? 0 : -this.width / 2,
|
|
y = this.height === 1 ? 0 : -this.height / 2;
|
|
|
|
ctx.beginPath();
|
|
fabric.util.drawDashedLine(ctx, x, y, -x, -y, this.strokeDashArray);
|
|
ctx.closePath();
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @methd toObject
|
|
* @param {Array} propertiesToInclude
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return extend(this.callSuper('toObject', propertiesToInclude), {
|
|
x1: this.get('x1'),
|
|
y1: this.get('y1'),
|
|
x2: this.get('x2'),
|
|
y2: this.get('y2')
|
|
});
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns SVG representation of an instance
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toSVG: function() {
|
|
var markup = [];
|
|
|
|
if (this.stroke && this.stroke.toLive) {
|
|
markup.push(this.stroke.toSVG(this, true));
|
|
}
|
|
|
|
markup.push(
|
|
'<line ',
|
|
'x1="', this.get('x1'),
|
|
'" y1="', this.get('y1'),
|
|
'" x2="', this.get('x2'),
|
|
'" y2="', this.get('y2'),
|
|
'" style="', this.getSvgStyles(),
|
|
'"/>'
|
|
);
|
|
|
|
return markup.join('');
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* Returns complexity of an instance
|
|
* @return {Number} complexity
|
|
*/
|
|
complexity: function() {
|
|
return 1;
|
|
}
|
|
});
|
|
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by {@link fabric.Line.fromElement})
|
|
* @static
|
|
* @see http://www.w3.org/TR/SVG/shapes.html#LineElement
|
|
*/
|
|
fabric.Line.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('x1 y1 x2 y2'.split(' '));
|
|
|
|
/**
|
|
* Returns fabric.Line instance from an SVG element
|
|
* @static
|
|
* @param {SVGElement} element Element to parse
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Line} instance of fabric.Line
|
|
*/
|
|
fabric.Line.fromElement = function(element, options) {
|
|
var parsedAttributes = fabric.parseAttributes(element, fabric.Line.ATTRIBUTE_NAMES);
|
|
var points = [
|
|
parsedAttributes.x1 || 0,
|
|
parsedAttributes.y1 || 0,
|
|
parsedAttributes.x2 || 0,
|
|
parsedAttributes.y2 || 0
|
|
];
|
|
return new fabric.Line(points, extend(parsedAttributes, options));
|
|
};
|
|
|
|
/**
|
|
* Returns fabric.Line instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @return {fabric.Line} instance of fabric.Line
|
|
*/
|
|
fabric.Line.fromObject = function(object) {
|
|
var points = [object.x1, object.y1, object.x2, object.y2];
|
|
return new fabric.Line(points, object);
|
|
};
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
(function(global) {
|
|
|
|
"use strict";
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
piBy2 = Math.PI * 2,
|
|
extend = fabric.util.object.extend;
|
|
|
|
if (fabric.Circle) {
|
|
fabric.warn('fabric.Circle is already defined.');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Circle class
|
|
* @class fabric.Circle
|
|
* @extends fabric.Object
|
|
*/
|
|
fabric.Circle = fabric.util.createClass(fabric.Object, /** @lends fabric.Circle.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'circle',
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Circle} thisArg
|
|
*/
|
|
initialize: function(options) {
|
|
options = options || { };
|
|
|
|
this.set('radius', options.radius || 0);
|
|
this.callSuper('initialize', options);
|
|
|
|
var diameter = this.get('radius') * 2;
|
|
this.set('width', diameter).set('height', diameter);
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} propertiesToInclude
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return extend(this.callSuper('toObject', propertiesToInclude), {
|
|
radius: this.get('radius')
|
|
});
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toSVG: function() {
|
|
var markup = [];
|
|
|
|
if (this.fill && this.fill.toLive) {
|
|
markup.push(this.fill.toSVG(this, false));
|
|
}
|
|
if (this.stroke && this.stroke.toLive) {
|
|
markup.push(this.stroke.toSVG(this, false));
|
|
}
|
|
|
|
markup.push(
|
|
'<circle ',
|
|
'cx="0" cy="0" ',
|
|
'r="', this.radius,
|
|
'" style="', this.getSvgStyles(),
|
|
'" transform="', this.getSvgTransform(),
|
|
'"/>'
|
|
);
|
|
|
|
return markup.join('');
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* @private
|
|
* @param ctx {CanvasRenderingContext2D} context to render on
|
|
*/
|
|
_render: function(ctx, noTransform) {
|
|
ctx.beginPath();
|
|
// multiply by currently set alpha (the one that was set by path group where this object is contained, for example)
|
|
ctx.globalAlpha = this.group ? (ctx.globalAlpha * this.opacity) : this.opacity;
|
|
ctx.arc(noTransform ? this.left : 0, noTransform ? this.top : 0, this.radius, 0, piBy2, false);
|
|
ctx.closePath();
|
|
|
|
this._renderFill(ctx);
|
|
this._renderStroke(ctx);
|
|
},
|
|
|
|
/**
|
|
* Returns horizontal radius of an object (according to how an object is scaled)
|
|
* @return {Number}
|
|
*/
|
|
getRadiusX: function() {
|
|
return this.get('radius') * this.get('scaleX');
|
|
},
|
|
|
|
/**
|
|
* Returns vertical radius of an object (according to how an object is scaled)
|
|
* @return {Number}
|
|
*/
|
|
getRadiusY: function() {
|
|
return this.get('radius') * this.get('scaleY');
|
|
},
|
|
|
|
/**
|
|
* Sets radius of an object (and updates width accordingly)
|
|
* @return {Number}
|
|
*/
|
|
setRadius: function(value) {
|
|
this.radius = value;
|
|
this.set('width', value * 2).set('height', value * 2);
|
|
},
|
|
|
|
/**
|
|
* Returns complexity of an instance
|
|
* @return {Number} complexity of this instance
|
|
*/
|
|
complexity: function() {
|
|
return 1;
|
|
}
|
|
});
|
|
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by {@link fabric.Circle.fromElement})
|
|
* @static
|
|
* @see: http://www.w3.org/TR/SVG/shapes.html#CircleElement
|
|
*/
|
|
fabric.Circle.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('cx cy r'.split(' '));
|
|
|
|
/**
|
|
* Returns {@link fabric.Circle} instance from an SVG element
|
|
* @static
|
|
* @param {SVGElement} element Element to parse
|
|
* @param {Object} [options] Options object
|
|
* @throws {Error} If value of `r` attribute is missing or invalid
|
|
* @return {fabric.Circle} Instance of fabric.Circle
|
|
*/
|
|
fabric.Circle.fromElement = function(element, options) {
|
|
options || (options = { });
|
|
var parsedAttributes = fabric.parseAttributes(element, fabric.Circle.ATTRIBUTE_NAMES);
|
|
if (!isValidRadius(parsedAttributes)) {
|
|
throw new Error('value of `r` attribute is required and can not be negative');
|
|
}
|
|
if ('left' in parsedAttributes) {
|
|
parsedAttributes.left -= (options.width / 2) || 0;
|
|
}
|
|
if ('top' in parsedAttributes) {
|
|
parsedAttributes.top -= (options.height / 2) || 0;
|
|
}
|
|
var obj = new fabric.Circle(extend(parsedAttributes, options));
|
|
|
|
obj.cx = parseFloat(element.getAttribute('cx')) || 0;
|
|
obj.cy = parseFloat(element.getAttribute('cy')) || 0;
|
|
|
|
return obj;
|
|
};
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function isValidRadius(attributes) {
|
|
return (('radius' in attributes) && (attributes.radius > 0));
|
|
}
|
|
|
|
/**
|
|
* Returns {@link fabric.Circle} instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @return {Object} Instance of fabric.Circle
|
|
*/
|
|
fabric.Circle.fromObject = function(object) {
|
|
return new fabric.Circle(object);
|
|
};
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
(function(global) {
|
|
|
|
"use strict";
|
|
|
|
var fabric = global.fabric || (global.fabric = { });
|
|
|
|
if (fabric.Triangle) {
|
|
fabric.warn('fabric.Triangle is already defined');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Triangle class
|
|
* @class fabric.Triangle
|
|
* @extends fabric.Object
|
|
* @return {fabric.Triangle} thisArg
|
|
*/
|
|
fabric.Triangle = fabric.util.createClass(fabric.Object, /** @lends fabric.Triangle.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'triangle',
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} [options] Options object
|
|
* @return {Object} thisArg
|
|
*/
|
|
initialize: function(options) {
|
|
options = options || { };
|
|
|
|
this.callSuper('initialize', options);
|
|
|
|
this.set('width', options.width || 100)
|
|
.set('height', options.height || 100);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param ctx {CanvasRenderingContext2D} Context to render on
|
|
*/
|
|
_render: function(ctx) {
|
|
var widthBy2 = this.width / 2,
|
|
heightBy2 = this.height / 2;
|
|
|
|
ctx.beginPath();
|
|
ctx.moveTo(-widthBy2, heightBy2);
|
|
ctx.lineTo(0, -heightBy2);
|
|
ctx.lineTo(widthBy2, heightBy2);
|
|
ctx.closePath();
|
|
|
|
this._renderFill(ctx);
|
|
this._renderStroke(ctx);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param ctx {CanvasRenderingContext2D} Context to render on
|
|
*/
|
|
_renderDashedStroke: function(ctx) {
|
|
var widthBy2 = this.width / 2,
|
|
heightBy2 = this.height / 2;
|
|
|
|
ctx.beginPath();
|
|
fabric.util.drawDashedLine(ctx, -widthBy2, heightBy2, 0, -heightBy2, this.strokeDashArray);
|
|
fabric.util.drawDashedLine(ctx, 0, -heightBy2, widthBy2, heightBy2, this.strokeDashArray);
|
|
fabric.util.drawDashedLine(ctx, widthBy2, heightBy2, -widthBy2, heightBy2, this.strokeDashArray);
|
|
ctx.closePath();
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns SVG representation of an instance
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toSVG: function() {
|
|
var markup = [],
|
|
widthBy2 = this.width / 2,
|
|
heightBy2 = this.height / 2;
|
|
|
|
var points = [
|
|
-widthBy2 + " " + heightBy2,
|
|
"0 " + -heightBy2,
|
|
widthBy2 + " " + heightBy2
|
|
].join(",");
|
|
|
|
if (this.fill && this.fill.toLive) {
|
|
markup.push(this.fill.toSVG(this, true));
|
|
}
|
|
if (this.stroke && this.stroke.toLive) {
|
|
markup.push(this.stroke.toSVG(this, true));
|
|
}
|
|
|
|
markup.push(
|
|
'<polygon ',
|
|
'points="', points,
|
|
'" style="', this.getSvgStyles(),
|
|
'" transform="', this.getSvgTransform(),
|
|
'"/>'
|
|
);
|
|
|
|
return markup.join('');
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* Returns complexity of an instance
|
|
* @return {Number} complexity of this instance
|
|
*/
|
|
complexity: function() {
|
|
return 1;
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns fabric.Triangle instance from an object representation
|
|
* @static
|
|
* @param object {Object} object to create an instance from
|
|
* @return {Object} instance of Canvas.Triangle
|
|
*/
|
|
fabric.Triangle.fromObject = function(object) {
|
|
return new fabric.Triangle(object);
|
|
};
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
(function(global){
|
|
|
|
"use strict";
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
piBy2 = Math.PI * 2,
|
|
extend = fabric.util.object.extend;
|
|
|
|
if (fabric.Ellipse) {
|
|
fabric.warn('fabric.Ellipse is already defined.');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Ellipse class
|
|
* @class fabric.Ellipse
|
|
* @extends fabric.Object
|
|
* @return {fabric.Ellipse} thisArg
|
|
*/
|
|
fabric.Ellipse = fabric.util.createClass(fabric.Object, /** @lends fabric.Ellipse.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'ellipse',
|
|
|
|
/**
|
|
* Horizontal radius
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
rx: 0,
|
|
|
|
/**
|
|
* Vertical radius
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
ry: 0,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Ellipse} thisArg
|
|
*/
|
|
initialize: function(options) {
|
|
options = options || { };
|
|
|
|
this.callSuper('initialize', options);
|
|
|
|
this.set('rx', options.rx || 0);
|
|
this.set('ry', options.ry || 0);
|
|
|
|
this.set('width', this.get('rx') * 2);
|
|
this.set('height', this.get('ry') * 2);
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} propertiesToInclude
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return extend(this.callSuper('toObject', propertiesToInclude), {
|
|
rx: this.get('rx'),
|
|
ry: this.get('ry')
|
|
});
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toSVG: function() {
|
|
var markup = [];
|
|
|
|
if (this.fill && this.fill.toLive) {
|
|
markup.push(this.fill.toSVG(this, false));
|
|
}
|
|
if (this.stroke && this.stroke.toLive) {
|
|
markup.push(this.stroke.toSVG(this, false));
|
|
}
|
|
|
|
markup.push(
|
|
'<ellipse ',
|
|
'rx="', this.get('rx'),
|
|
'" ry="', this.get('ry'),
|
|
'" style="', this.getSvgStyles(),
|
|
'" transform="', this.getSvgTransform(),
|
|
'"/>'
|
|
);
|
|
|
|
return markup.join('');
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* Renders this instance on a given context
|
|
* @param ctx {CanvasRenderingContext2D} context to render on
|
|
* @param noTransform {Boolean} context is not transformed when set to true
|
|
*/
|
|
render: function(ctx, noTransform) {
|
|
// do not use `get` for perf. reasons
|
|
if (this.rx === 0 || this.ry === 0) return;
|
|
return this.callSuper('render', ctx, noTransform);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param ctx {CanvasRenderingContext2D} context to render on
|
|
*/
|
|
_render: function(ctx, noTransform) {
|
|
ctx.beginPath();
|
|
ctx.save();
|
|
ctx.globalAlpha = this.group ? (ctx.globalAlpha * this.opacity) : this.opacity;
|
|
if (this.transformMatrix && this.group) {
|
|
ctx.translate(this.cx, this.cy);
|
|
}
|
|
ctx.transform(1, 0, 0, this.ry/this.rx, 0, 0);
|
|
ctx.arc(noTransform ? this.left : 0, noTransform ? this.top : 0, this.rx, 0, piBy2, false);
|
|
|
|
this._renderFill(ctx);
|
|
this._renderStroke(ctx);
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* Returns complexity of an instance
|
|
* @return {Number} complexity
|
|
*/
|
|
complexity: function() {
|
|
return 1;
|
|
}
|
|
});
|
|
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by {@link fabric.Ellipse.fromElement})
|
|
* @static
|
|
* @see http://www.w3.org/TR/SVG/shapes.html#EllipseElement
|
|
*/
|
|
fabric.Ellipse.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('cx cy rx ry'.split(' '));
|
|
|
|
/**
|
|
* Returns {@link fabric.Ellipse} instance from an SVG element
|
|
* @static
|
|
* @param {SVGElement} element Element to parse
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Ellipse}
|
|
*/
|
|
fabric.Ellipse.fromElement = function(element, options) {
|
|
options || (options = { });
|
|
|
|
var parsedAttributes = fabric.parseAttributes(element, fabric.Ellipse.ATTRIBUTE_NAMES);
|
|
var cx = parsedAttributes.left;
|
|
var cy = parsedAttributes.top;
|
|
|
|
if ('left' in parsedAttributes) {
|
|
parsedAttributes.left -= (options.width / 2) || 0;
|
|
}
|
|
if ('top' in parsedAttributes) {
|
|
parsedAttributes.top -= (options.height / 2) || 0;
|
|
}
|
|
|
|
var ellipse = new fabric.Ellipse(extend(parsedAttributes, options));
|
|
|
|
ellipse.cx = cx || 0;
|
|
ellipse.cy = cy || 0;
|
|
|
|
return ellipse;
|
|
};
|
|
|
|
/**
|
|
* Returns {@link fabric.Ellipse} instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @return {fabric.Ellipse}
|
|
*/
|
|
fabric.Ellipse.fromObject = function(object) {
|
|
return new fabric.Ellipse(object);
|
|
};
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
(function(global) {
|
|
|
|
"use strict";
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
extend = fabric.util.object.extend;
|
|
|
|
if (fabric.Rect) {
|
|
console.warn('fabric.Rect is already defined');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Rectangle class
|
|
* @class fabric.Rect
|
|
* @extends fabric.Object
|
|
* @return {fabric.Rect} thisArg
|
|
*/
|
|
fabric.Rect = fabric.util.createClass(fabric.Object, /** @lends fabric.Rect.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'rect',
|
|
|
|
/**
|
|
* Horizontal border radius
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
rx: 0,
|
|
|
|
/**
|
|
* Vertical border radius
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
ry: 0,
|
|
|
|
/**
|
|
* Used to specify dash pattern for stroke on this object
|
|
* @type Array
|
|
*/
|
|
strokeDashArray: null,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} [options] Options object
|
|
* @return {Object} thisArg
|
|
*/
|
|
initialize: function(options) {
|
|
options = options || { };
|
|
|
|
this._initStateProperties();
|
|
this.callSuper('initialize', options);
|
|
this._initRxRy();
|
|
|
|
this.x = 0;
|
|
this.y = 0;
|
|
},
|
|
|
|
/**
|
|
* Creates `stateProperties` list on an instance, and adds `fabric.Rect` -specific ones to it
|
|
* (such as "rx", "ry", etc.)
|
|
* @private
|
|
*/
|
|
_initStateProperties: function() {
|
|
this.stateProperties = this.stateProperties.concat(['rx', 'ry']);
|
|
},
|
|
|
|
/**
|
|
* Initializes rx/ry attributes
|
|
* @private
|
|
*/
|
|
_initRxRy: function() {
|
|
if (this.rx && !this.ry) {
|
|
this.ry = this.rx;
|
|
}
|
|
else if (this.ry && !this.rx) {
|
|
this.rx = this.ry;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param ctx {CanvasRenderingContext2D} context to render on
|
|
*/
|
|
_render: function(ctx) {
|
|
var rx = this.rx || 0,
|
|
ry = this.ry || 0,
|
|
x = -this.width / 2,
|
|
y = -this.height / 2,
|
|
w = this.width,
|
|
h = this.height,
|
|
isInPathGroup = this.group && this.group.type !== 'group';
|
|
|
|
ctx.beginPath();
|
|
ctx.globalAlpha = isInPathGroup ? (ctx.globalAlpha * this.opacity) : this.opacity;
|
|
|
|
if (this.transformMatrix && isInPathGroup) {
|
|
ctx.translate(
|
|
this.width / 2 + this.x,
|
|
this.height / 2 + this.y);
|
|
}
|
|
if (!this.transformMatrix && isInPathGroup) {
|
|
ctx.translate(
|
|
-this.group.width / 2 + this.width / 2 + this.x,
|
|
-this.group.height / 2 + this.height / 2 + this.y);
|
|
}
|
|
|
|
ctx.moveTo(x+rx, y);
|
|
ctx.lineTo(x+w-rx, y);
|
|
ctx.quadraticCurveTo(x+w, y, x+w, y+ry, x+w, y+ry);
|
|
ctx.lineTo(x+w, y+h-ry);
|
|
ctx.quadraticCurveTo(x+w,y+h,x+w-rx,y+h,x+w-rx,y+h);
|
|
ctx.lineTo(x+rx,y+h);
|
|
ctx.quadraticCurveTo(x,y+h,x,y+h-ry,x,y+h-ry);
|
|
ctx.lineTo(x,y+ry);
|
|
ctx.quadraticCurveTo(x,y,x+rx,y,x+rx,y);
|
|
ctx.closePath();
|
|
|
|
this._renderFill(ctx);
|
|
this._renderStroke(ctx);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param ctx {CanvasRenderingContext2D} context to render on
|
|
*/
|
|
_renderDashedStroke: function(ctx) {
|
|
var x = -this.width/2,
|
|
y = -this.height/2,
|
|
w = this.width,
|
|
h = this.height;
|
|
|
|
ctx.beginPath();
|
|
fabric.util.drawDashedLine(ctx, x, y, x+w, y, this.strokeDashArray);
|
|
fabric.util.drawDashedLine(ctx, x+w, y, x+w, y+h, this.strokeDashArray);
|
|
fabric.util.drawDashedLine(ctx, x+w, y+h, x, y+h, this.strokeDashArray);
|
|
fabric.util.drawDashedLine(ctx, x, y+h, x, y, this.strokeDashArray);
|
|
ctx.closePath();
|
|
},
|
|
|
|
/**
|
|
* Since coordinate system differs from that of SVG
|
|
* @private
|
|
*/
|
|
_normalizeLeftTopProperties: function(parsedAttributes) {
|
|
if ('left' in parsedAttributes) {
|
|
this.set('left', parsedAttributes.left + this.getWidth() / 2);
|
|
}
|
|
this.set('x', parsedAttributes.left || 0);
|
|
if ('top' in parsedAttributes) {
|
|
this.set('top', parsedAttributes.top + this.getHeight() / 2);
|
|
}
|
|
this.set('y', parsedAttributes.top || 0);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} propertiesToInclude
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return extend(this.callSuper('toObject', propertiesToInclude), {
|
|
rx: this.get('rx') || 0,
|
|
ry: this.get('ry') || 0
|
|
});
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toSVG: function() {
|
|
var markup = [];
|
|
|
|
if (this.fill && this.fill.toLive) {
|
|
markup.push(this.fill.toSVG(this, false));
|
|
}
|
|
if (this.stroke && this.stroke.toLive) {
|
|
markup.push(this.stroke.toSVG(this, false));
|
|
}
|
|
|
|
markup.push(
|
|
'<rect ',
|
|
'x="', (-1 * this.width / 2), '" y="', (-1 * this.height / 2),
|
|
'" rx="', this.get('rx'), '" ry="', this.get('ry'),
|
|
'" width="', this.width, '" height="', this.height,
|
|
'" style="', this.getSvgStyles(),
|
|
'" transform="', this.getSvgTransform(),
|
|
'"/>'
|
|
);
|
|
|
|
return markup.join('');
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* Returns complexity of an instance
|
|
* @return {Number} complexity
|
|
*/
|
|
complexity: function() {
|
|
return 1;
|
|
}
|
|
});
|
|
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by `fabric.Rect.fromElement`)
|
|
* @static
|
|
*/
|
|
fabric.Rect.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('x y rx ry width height'.split(' '));
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function _setDefaultLeftTopValues(attributes) {
|
|
attributes.left = attributes.left || 0;
|
|
attributes.top = attributes.top || 0;
|
|
return attributes;
|
|
}
|
|
|
|
/**
|
|
* Returns {@link fabric.Rect} instance from an SVG element
|
|
* @static
|
|
* @param {SVGElement} element Element to parse
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Rect} Instance of fabric.Rect
|
|
*/
|
|
fabric.Rect.fromElement = function(element, options) {
|
|
if (!element) {
|
|
return null;
|
|
}
|
|
|
|
var parsedAttributes = fabric.parseAttributes(element, fabric.Rect.ATTRIBUTE_NAMES);
|
|
parsedAttributes = _setDefaultLeftTopValues(parsedAttributes);
|
|
|
|
var rect = new fabric.Rect(extend((options ? fabric.util.object.clone(options) : { }), parsedAttributes));
|
|
rect._normalizeLeftTopProperties(parsedAttributes);
|
|
|
|
return rect;
|
|
};
|
|
|
|
/**
|
|
* Returns {@link fabric.Rect} instance from an object representation
|
|
* @static
|
|
* @param object {Object} object to create an instance from
|
|
* @return {Object} instance of fabric.Rect
|
|
*/
|
|
fabric.Rect.fromObject = function(object) {
|
|
return new fabric.Rect(object);
|
|
};
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
(function(global) {
|
|
|
|
"use strict";
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
toFixed = fabric.util.toFixed;
|
|
|
|
if (fabric.Polyline) {
|
|
fabric.warn('fabric.Polyline is already defined');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Polyline class
|
|
* @class fabric.Polyline
|
|
* @extends fabric.Object
|
|
*/
|
|
fabric.Polyline = fabric.util.createClass(fabric.Object, /** @lends fabric.Polyline.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'polyline',
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Array} points array of points
|
|
* @param {Object} [options] Options object
|
|
* @param {Boolean} skipOffset Whether points offsetting should be skipped
|
|
* @return {fabric.Polyline} thisArg
|
|
*/
|
|
initialize: function(points, options, skipOffset) {
|
|
options = options || { };
|
|
this.set('points', points);
|
|
this.callSuper('initialize', options);
|
|
this._calcDimensions(skipOffset);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Boolean} skipOffset Whether points offsetting should be skipped
|
|
*/
|
|
_calcDimensions: function(skipOffset) {
|
|
return fabric.Polygon.prototype._calcDimensions.call(this, skipOffset);
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} propertiesToInclude
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return fabric.Polygon.prototype.toObject.call(this, propertiesToInclude);
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns SVG representation of an instance
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toSVG: function() {
|
|
var points = [],
|
|
markup = [];
|
|
|
|
for (var i = 0, len = this.points.length; i < len; i++) {
|
|
points.push(toFixed(this.points[i].x, 2), ',', toFixed(this.points[i].y, 2), ' ');
|
|
}
|
|
|
|
if (this.fill && this.fill.toLive) {
|
|
markup.push(this.fill.toSVG(this, false));
|
|
}
|
|
if (this.stroke && this.stroke.toLive) {
|
|
markup.push(this.stroke.toSVG(this, false));
|
|
}
|
|
|
|
markup.push(
|
|
'<polyline ',
|
|
'points="', points.join(''),
|
|
'" style="', this.getSvgStyles(),
|
|
'" transform="', this.getSvgTransform(),
|
|
'"/>'
|
|
);
|
|
|
|
return markup.join('');
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_render: function(ctx) {
|
|
var point;
|
|
ctx.beginPath();
|
|
ctx.moveTo(this.points[0].x, this.points[0].y);
|
|
for (var i = 0, len = this.points.length; i < len; i++) {
|
|
point = this.points[i];
|
|
ctx.lineTo(point.x, point.y);
|
|
}
|
|
|
|
this._renderFill(ctx);
|
|
this._renderStroke(ctx);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderDashedStroke: function(ctx) {
|
|
var p1, p2;
|
|
|
|
ctx.beginPath();
|
|
for (var i = 0, len = this.points.length; i < len; i++) {
|
|
p1 = this.points[i];
|
|
p2 = this.points[i+1] || p1;
|
|
fabric.util.drawDashedLine(ctx, p1.x, p1.y, p2.x, p2.y, this.strokeDashArray);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Returns complexity of an instance
|
|
* @return {Number} complexity
|
|
*/
|
|
complexity: function() {
|
|
return this.get('points').length;
|
|
}
|
|
});
|
|
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by {@link fabric.Polyline.fromElement})
|
|
* @static
|
|
* @see: http://www.w3.org/TR/SVG/shapes.html#PolylineElement
|
|
*/
|
|
fabric.Polyline.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat();
|
|
|
|
/**
|
|
* Returns fabric.Polyline instance from an SVG element
|
|
* @static
|
|
* @param {SVGElement} element Element to parse
|
|
* @param {Object} [options] Options object
|
|
* @return {Object} instance of fabric.Polyline
|
|
*/
|
|
fabric.Polyline.fromElement = function(element, options) {
|
|
if (!element) {
|
|
return null;
|
|
}
|
|
options || (options = { });
|
|
|
|
var points = fabric.parsePointsAttribute(element.getAttribute('points')),
|
|
parsedAttributes = fabric.parseAttributes(element, fabric.Polyline.ATTRIBUTE_NAMES);
|
|
|
|
for (var i = 0, len = points.length; i < len; i++) {
|
|
// normalize coordinates, according to containing box (dimensions of which are passed via `options`)
|
|
points[i].x -= (options.width / 2) || 0;
|
|
points[i].y -= (options.height / 2) || 0;
|
|
}
|
|
|
|
return new fabric.Polyline(points, fabric.util.object.extend(parsedAttributes, options), true);
|
|
};
|
|
|
|
/**
|
|
* Returns fabric.Polyline instance from an object representation
|
|
* @static
|
|
* @param {Object} [object] Object to create an instance from
|
|
* @return {fabric.Polyline}
|
|
*/
|
|
fabric.Polyline.fromObject = function(object) {
|
|
var points = object.points;
|
|
return new fabric.Polyline(points, object, true);
|
|
};
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
(function(global) {
|
|
|
|
"use strict";
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
extend = fabric.util.object.extend,
|
|
min = fabric.util.array.min,
|
|
max = fabric.util.array.max,
|
|
toFixed = fabric.util.toFixed;
|
|
|
|
if (fabric.Polygon) {
|
|
fabric.warn('fabric.Polygon is already defined');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Polygon class
|
|
* @class fabric.Polygon
|
|
* @extends fabric.Object
|
|
*/
|
|
fabric.Polygon = fabric.util.createClass(fabric.Object, /** @lends fabric.Polygon.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'polygon',
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Array} points Array of points
|
|
* @param {Object} [options] Options object
|
|
* @param {Boolean} Whether points offsetting should be skipped
|
|
* @return {fabric.Polygon} thisArg
|
|
*/
|
|
initialize: function(points, options, skipOffset) {
|
|
options = options || { };
|
|
this.points = points;
|
|
this.callSuper('initialize', options);
|
|
this._calcDimensions(skipOffset);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_calcDimensions: function(skipOffset) {
|
|
|
|
var points = this.points,
|
|
minX = min(points, 'x'),
|
|
minY = min(points, 'y'),
|
|
maxX = max(points, 'x'),
|
|
maxY = max(points, 'y');
|
|
|
|
this.width = (maxX - minX) || 1;
|
|
this.height = (maxY - minY) || 1;
|
|
|
|
this.minX = minX;
|
|
this.minY = minY;
|
|
|
|
if (skipOffset) return;
|
|
|
|
var halfWidth = this.width / 2,
|
|
halfHeight = this.height / 2;
|
|
|
|
// change points to offset polygon into a bounding box
|
|
this.points.forEach(function(p) {
|
|
p.x -= halfWidth;
|
|
p.y -= halfHeight;
|
|
}, this);
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} propertiesToInclude
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return extend(this.callSuper('toObject', propertiesToInclude), {
|
|
points: this.points.concat()
|
|
});
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toSVG: function() {
|
|
var points = [],
|
|
markup = [];
|
|
|
|
for (var i = 0, len = this.points.length; i < len; i++) {
|
|
points.push(toFixed(this.points[i].x, 2), ',', toFixed(this.points[i].y, 2), ' ');
|
|
}
|
|
|
|
if (this.fill && this.fill.toLive) {
|
|
markup.push(this.fill.toSVG(this, false));
|
|
}
|
|
if (this.stroke && this.stroke.toLive) {
|
|
markup.push(this.stroke.toSVG(this, false));
|
|
}
|
|
|
|
markup.push(
|
|
'<polygon ',
|
|
'points="', points.join(''),
|
|
'" style="', this.getSvgStyles(),
|
|
'" transform="', this.getSvgTransform(),
|
|
'"/>'
|
|
);
|
|
|
|
return markup.join('');
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* @private
|
|
* @param ctx {CanvasRenderingContext2D} context to render on
|
|
*/
|
|
_render: function(ctx) {
|
|
var point;
|
|
ctx.beginPath();
|
|
ctx.moveTo(this.points[0].x, this.points[0].y);
|
|
for (var i = 0, len = this.points.length; i < len; i++) {
|
|
point = this.points[i];
|
|
ctx.lineTo(point.x, point.y);
|
|
}
|
|
this._renderFill(ctx);
|
|
if (this.stroke || this.strokeDashArray) {
|
|
ctx.closePath();
|
|
this._renderStroke(ctx);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param ctx {CanvasRenderingContext2D} context to render on
|
|
*/
|
|
_renderDashedStroke: function(ctx) {
|
|
var p1, p2;
|
|
|
|
ctx.beginPath();
|
|
for (var i = 0, len = this.points.length; i < len; i++) {
|
|
p1 = this.points[i];
|
|
p2 = this.points[i+1] || this.points[0];
|
|
fabric.util.drawDashedLine(ctx, p1.x, p1.y, p2.x, p2.y, this.strokeDashArray);
|
|
}
|
|
ctx.closePath();
|
|
},
|
|
|
|
/**
|
|
* Returns complexity of an instance
|
|
* @return {Number} complexity of this instance
|
|
*/
|
|
complexity: function() {
|
|
return this.points.length;
|
|
}
|
|
});
|
|
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by `fabric.Polygon.fromElement`)
|
|
* @static
|
|
* @see: http://www.w3.org/TR/SVG/shapes.html#PolygonElement
|
|
*/
|
|
fabric.Polygon.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat();
|
|
|
|
/**
|
|
* Returns {@link fabric.Polygon} instance from an SVG element
|
|
* @static
|
|
* @param {SVGElement} element Element to parse
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Polygon}
|
|
*/
|
|
fabric.Polygon.fromElement = function(element, options) {
|
|
if (!element) {
|
|
return null;
|
|
}
|
|
options || (options = { });
|
|
|
|
var points = fabric.parsePointsAttribute(element.getAttribute('points')),
|
|
parsedAttributes = fabric.parseAttributes(element, fabric.Polygon.ATTRIBUTE_NAMES);
|
|
|
|
for (var i = 0, len = points.length; i < len; i++) {
|
|
// normalize coordinates, according to containing box (dimensions of which are passed via `options`)
|
|
points[i].x -= (options.width / 2) || 0;
|
|
points[i].y -= (options.height / 2) || 0;
|
|
}
|
|
|
|
return new fabric.Polygon(points, extend(parsedAttributes, options), true);
|
|
};
|
|
|
|
/**
|
|
* Returns fabric.Polygon instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @return {fabric.Polygon}
|
|
*/
|
|
fabric.Polygon.fromObject = function(object) {
|
|
return new fabric.Polygon(object.points, object, true);
|
|
};
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
(function(global) {
|
|
|
|
var commandLengths = {
|
|
m: 2,
|
|
l: 2,
|
|
h: 1,
|
|
v: 1,
|
|
c: 6,
|
|
s: 4,
|
|
q: 4,
|
|
t: 2,
|
|
a: 7
|
|
};
|
|
|
|
function drawArc(ctx, x, y, coords) {
|
|
var rx = coords[0];
|
|
var ry = coords[1];
|
|
var rot = coords[2];
|
|
var large = coords[3];
|
|
var sweep = coords[4];
|
|
var ex = coords[5];
|
|
var ey = coords[6];
|
|
var segs = arcToSegments(ex, ey, rx, ry, large, sweep, rot, x, y);
|
|
for (var i=0; i<segs.length; i++) {
|
|
var bez = segmentToBezier.apply(this, segs[i]);
|
|
ctx.bezierCurveTo.apply(ctx, bez);
|
|
}
|
|
}
|
|
|
|
var arcToSegmentsCache = { },
|
|
segmentToBezierCache = { },
|
|
_join = Array.prototype.join,
|
|
argsString;
|
|
|
|
// Generous contribution by Raph Levien, from libsvg-0.1.0.tar.gz
|
|
function arcToSegments(x, y, rx, ry, large, sweep, rotateX, ox, oy) {
|
|
argsString = _join.call(arguments);
|
|
if (arcToSegmentsCache[argsString]) {
|
|
return arcToSegmentsCache[argsString];
|
|
}
|
|
|
|
var th = rotateX * (Math.PI/180);
|
|
var sin_th = Math.sin(th);
|
|
var cos_th = Math.cos(th);
|
|
rx = Math.abs(rx);
|
|
ry = Math.abs(ry);
|
|
var px = cos_th * (ox - x) * 0.5 + sin_th * (oy - y) * 0.5;
|
|
var py = cos_th * (oy - y) * 0.5 - sin_th * (ox - x) * 0.5;
|
|
var pl = (px*px) / (rx*rx) + (py*py) / (ry*ry);
|
|
if (pl > 1) {
|
|
pl = Math.sqrt(pl);
|
|
rx *= pl;
|
|
ry *= pl;
|
|
}
|
|
|
|
var a00 = cos_th / rx;
|
|
var a01 = sin_th / rx;
|
|
var a10 = (-sin_th) / ry;
|
|
var a11 = (cos_th) / ry;
|
|
var x0 = a00 * ox + a01 * oy;
|
|
var y0 = a10 * ox + a11 * oy;
|
|
var x1 = a00 * x + a01 * y;
|
|
var y1 = a10 * x + a11 * y;
|
|
|
|
var d = (x1-x0) * (x1-x0) + (y1-y0) * (y1-y0);
|
|
var sfactor_sq = 1 / d - 0.25;
|
|
if (sfactor_sq < 0) sfactor_sq = 0;
|
|
var sfactor = Math.sqrt(sfactor_sq);
|
|
if (sweep === large) sfactor = -sfactor;
|
|
var xc = 0.5 * (x0 + x1) - sfactor * (y1-y0);
|
|
var yc = 0.5 * (y0 + y1) + sfactor * (x1-x0);
|
|
|
|
var th0 = Math.atan2(y0-yc, x0-xc);
|
|
var th1 = Math.atan2(y1-yc, x1-xc);
|
|
|
|
var th_arc = th1-th0;
|
|
if (th_arc < 0 && sweep === 1){
|
|
th_arc += 2*Math.PI;
|
|
} else if (th_arc > 0 && sweep === 0) {
|
|
th_arc -= 2 * Math.PI;
|
|
}
|
|
|
|
var segments = Math.ceil(Math.abs(th_arc / (Math.PI * 0.5 + 0.001)));
|
|
var result = [];
|
|
for (var i=0; i<segments; i++) {
|
|
var th2 = th0 + i * th_arc / segments;
|
|
var th3 = th0 + (i+1) * th_arc / segments;
|
|
result[i] = [xc, yc, th2, th3, rx, ry, sin_th, cos_th];
|
|
}
|
|
|
|
arcToSegmentsCache[argsString] = result;
|
|
return result;
|
|
}
|
|
|
|
function segmentToBezier(cx, cy, th0, th1, rx, ry, sin_th, cos_th) {
|
|
argsString = _join.call(arguments);
|
|
if (segmentToBezierCache[argsString]) {
|
|
return segmentToBezierCache[argsString];
|
|
}
|
|
|
|
var a00 = cos_th * rx;
|
|
var a01 = -sin_th * ry;
|
|
var a10 = sin_th * rx;
|
|
var a11 = cos_th * ry;
|
|
|
|
var th_half = 0.5 * (th1 - th0);
|
|
var t = (8/3) * Math.sin(th_half * 0.5) * Math.sin(th_half * 0.5) / Math.sin(th_half);
|
|
var x1 = cx + Math.cos(th0) - t * Math.sin(th0);
|
|
var y1 = cy + Math.sin(th0) + t * Math.cos(th0);
|
|
var x3 = cx + Math.cos(th1);
|
|
var y3 = cy + Math.sin(th1);
|
|
var x2 = x3 + t * Math.sin(th1);
|
|
var y2 = y3 - t * Math.cos(th1);
|
|
|
|
segmentToBezierCache[argsString] = [
|
|
a00 * x1 + a01 * y1, a10 * x1 + a11 * y1,
|
|
a00 * x2 + a01 * y2, a10 * x2 + a11 * y2,
|
|
a00 * x3 + a01 * y3, a10 * x3 + a11 * y3
|
|
];
|
|
|
|
return segmentToBezierCache[argsString];
|
|
}
|
|
|
|
"use strict";
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
min = fabric.util.array.min,
|
|
max = fabric.util.array.max,
|
|
extend = fabric.util.object.extend,
|
|
_toString = Object.prototype.toString;
|
|
|
|
if (fabric.Path) {
|
|
fabric.warn('fabric.Path is already defined');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function getX(item) {
|
|
if (item[0] === 'H') {
|
|
return item[1];
|
|
}
|
|
return item[item.length - 2];
|
|
}
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function getY(item) {
|
|
if (item[0] === 'V') {
|
|
return item[1];
|
|
}
|
|
return item[item.length - 1];
|
|
}
|
|
|
|
/**
|
|
* Path class
|
|
* @class fabric.Path
|
|
* @extends fabric.Object
|
|
*/
|
|
fabric.Path = fabric.util.createClass(fabric.Object, /** @lends fabric.Path.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'path',
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Array|String} path Path data (sequence of coordinates and corresponding "command" tokens)
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
initialize: function(path, options) {
|
|
options = options || { };
|
|
|
|
this.setOptions(options);
|
|
|
|
if (!path) {
|
|
throw new Error('`path` argument is required');
|
|
}
|
|
|
|
var fromArray = _toString.call(path) === '[object Array]';
|
|
|
|
this.path = fromArray
|
|
? path
|
|
// one of commands (m,M,l,L,q,Q,c,C,etc.) followed by non-command characters (i.e. command values)
|
|
: path.match && path.match(/[mzlhvcsqta][^mzlhvcsqta]*/gi);
|
|
|
|
if (!this.path) return;
|
|
|
|
if (!fromArray) {
|
|
this.path = this._parsePath();
|
|
}
|
|
this._initializePath(options);
|
|
|
|
if (options.sourcePath) {
|
|
this.setSourcePath(options.sourcePath);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_initializePath: function (options) {
|
|
var isWidthSet = 'width' in options,
|
|
isHeightSet = 'height' in options,
|
|
isLeftSet = 'left' in options,
|
|
isTopSet = 'top' in options;
|
|
|
|
if (!isWidthSet || !isHeightSet) {
|
|
extend(this, this._parseDimensions());
|
|
if (isWidthSet) {
|
|
this.width = options.width;
|
|
}
|
|
if (isHeightSet) {
|
|
this.height = options.height;
|
|
}
|
|
}
|
|
else { //Set center location relative to given height/width if not specified
|
|
if (!isTopSet) {
|
|
this.top = this.height / 2;
|
|
}
|
|
if (!isLeftSet) {
|
|
this.left = this.width / 2;
|
|
}
|
|
}
|
|
this.pathOffset = this.pathOffset || this._calculatePathOffset(isTopSet || isLeftSet); //Save top-left coords as offset
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_calculatePathOffset: function (positionSet) {
|
|
return {
|
|
x: positionSet ? 0 : this.left - (this.width / 2),
|
|
y: positionSet ? 0 : this.top - (this.height / 2)
|
|
};
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_render: function(ctx) {
|
|
var current, // current instruction
|
|
previous = null,
|
|
x = 0, // current x
|
|
y = 0, // current y
|
|
controlX = 0, // current control point x
|
|
controlY = 0, // current control point y
|
|
tempX,
|
|
tempY,
|
|
tempControlX,
|
|
tempControlY,
|
|
l = -((this.width / 2) + this.pathOffset.x),
|
|
t = -((this.height / 2) + this.pathOffset.y);
|
|
|
|
for (var i = 0, len = this.path.length; i < len; ++i) {
|
|
|
|
current = this.path[i];
|
|
|
|
switch (current[0]) { // first letter
|
|
|
|
case 'l': // lineto, relative
|
|
x += current[1];
|
|
y += current[2];
|
|
ctx.lineTo(x + l, y + t);
|
|
break;
|
|
|
|
case 'L': // lineto, absolute
|
|
x = current[1];
|
|
y = current[2];
|
|
ctx.lineTo(x + l, y + t);
|
|
break;
|
|
|
|
case 'h': // horizontal lineto, relative
|
|
x += current[1];
|
|
ctx.lineTo(x + l, y + t);
|
|
break;
|
|
|
|
case 'H': // horizontal lineto, absolute
|
|
x = current[1];
|
|
ctx.lineTo(x + l, y + t);
|
|
break;
|
|
|
|
case 'v': // vertical lineto, relative
|
|
y += current[1];
|
|
ctx.lineTo(x + l, y + t);
|
|
break;
|
|
|
|
case 'V': // verical lineto, absolute
|
|
y = current[1];
|
|
ctx.lineTo(x + l, y + t);
|
|
break;
|
|
|
|
case 'm': // moveTo, relative
|
|
x += current[1];
|
|
y += current[2];
|
|
// draw a line if previous command was moveTo as well (otherwise, it will have no effect)
|
|
ctx[(previous && (previous[0] === 'm' || previous[0] === 'M')) ? 'lineTo' : 'moveTo'](x + l, y + t);
|
|
break;
|
|
|
|
case 'M': // moveTo, absolute
|
|
x = current[1];
|
|
y = current[2];
|
|
// draw a line if previous command was moveTo as well (otherwise, it will have no effect)
|
|
ctx[(previous && (previous[0] === 'm' || previous[0] === 'M')) ? 'lineTo' : 'moveTo'](x + l, y + t);
|
|
break;
|
|
|
|
case 'c': // bezierCurveTo, relative
|
|
tempX = x + current[5];
|
|
tempY = y + current[6];
|
|
controlX = x + current[3];
|
|
controlY = y + current[4];
|
|
ctx.bezierCurveTo(
|
|
x + current[1] + l, // x1
|
|
y + current[2] + t, // y1
|
|
controlX + l, // x2
|
|
controlY + t, // y2
|
|
tempX + l,
|
|
tempY + t
|
|
);
|
|
x = tempX;
|
|
y = tempY;
|
|
break;
|
|
|
|
case 'C': // bezierCurveTo, absolute
|
|
x = current[5];
|
|
y = current[6];
|
|
controlX = current[3];
|
|
controlY = current[4];
|
|
ctx.bezierCurveTo(
|
|
current[1] + l,
|
|
current[2] + t,
|
|
controlX + l,
|
|
controlY + t,
|
|
x + l,
|
|
y + t
|
|
);
|
|
break;
|
|
|
|
case 's': // shorthand cubic bezierCurveTo, relative
|
|
|
|
// transform to absolute x,y
|
|
tempX = x + current[3];
|
|
tempY = y + current[4];
|
|
|
|
// calculate reflection of previous control points
|
|
controlX = controlX ? (2 * x - controlX) : x;
|
|
controlY = controlY ? (2 * y - controlY) : y;
|
|
|
|
ctx.bezierCurveTo(
|
|
controlX + l,
|
|
controlY + t,
|
|
x + current[1] + l,
|
|
y + current[2] + t,
|
|
tempX + l,
|
|
tempY + t
|
|
);
|
|
// set control point to 2nd one of this command
|
|
// "... the first control point is assumed to be the reflection of the second control point on the previous command relative to the current point."
|
|
controlX = x + current[1];
|
|
controlY = y + current[2];
|
|
|
|
x = tempX;
|
|
y = tempY;
|
|
break;
|
|
|
|
case 'S': // shorthand cubic bezierCurveTo, absolute
|
|
tempX = current[3];
|
|
tempY = current[4];
|
|
// calculate reflection of previous control points
|
|
controlX = 2*x - controlX;
|
|
controlY = 2*y - controlY;
|
|
ctx.bezierCurveTo(
|
|
controlX + l,
|
|
controlY + t,
|
|
current[1] + l,
|
|
current[2] + t,
|
|
tempX + l,
|
|
tempY + t
|
|
);
|
|
x = tempX;
|
|
y = tempY;
|
|
|
|
// set control point to 2nd one of this command
|
|
// "... the first control point is assumed to be the reflection of the second control point on the previous command relative to the current point."
|
|
controlX = current[1];
|
|
controlY = current[2];
|
|
|
|
break;
|
|
|
|
case 'q': // quadraticCurveTo, relative
|
|
// transform to absolute x,y
|
|
tempX = x + current[3];
|
|
tempY = y + current[4];
|
|
|
|
controlX = x + current[1];
|
|
controlY = y + current[2];
|
|
|
|
ctx.quadraticCurveTo(
|
|
controlX + l,
|
|
controlY + t,
|
|
tempX + l,
|
|
tempY + t
|
|
);
|
|
x = tempX;
|
|
y = tempY;
|
|
break;
|
|
|
|
case 'Q': // quadraticCurveTo, absolute
|
|
tempX = current[3];
|
|
tempY = current[4];
|
|
|
|
ctx.quadraticCurveTo(
|
|
current[1] + l,
|
|
current[2] + t,
|
|
tempX + l,
|
|
tempY + t
|
|
);
|
|
x = tempX;
|
|
y = tempY;
|
|
controlX = current[1];
|
|
controlY = current[2];
|
|
break;
|
|
|
|
case 't': // shorthand quadraticCurveTo, relative
|
|
|
|
// transform to absolute x,y
|
|
tempX = x + current[1];
|
|
tempY = y + current[2];
|
|
|
|
|
|
if (previous[0].match(/[QqTt]/) === null) {
|
|
// If there is no previous command or if the previous command was not a Q, q, T or t,
|
|
// assume the control point is coincident with the current point
|
|
controlX = x;
|
|
controlY = y;
|
|
}
|
|
else if (previous[0] === 't') {
|
|
// calculate reflection of previous control points for t
|
|
controlX = 2 * x - tempControlX;
|
|
controlY = 2 * y - tempControlY;
|
|
}
|
|
else if (previous[0] === 'q') {
|
|
// calculate reflection of previous control points for q
|
|
controlX = 2 * x - controlX;
|
|
controlY = 2 * y - controlY;
|
|
}
|
|
|
|
tempControlX = controlX;
|
|
tempControlY = controlY;
|
|
|
|
ctx.quadraticCurveTo(
|
|
controlX + l,
|
|
controlY + t,
|
|
tempX + l,
|
|
tempY + t
|
|
);
|
|
x = tempX;
|
|
y = tempY;
|
|
controlX = x + current[1];
|
|
controlY = y + current[2];
|
|
break;
|
|
|
|
case 'T':
|
|
tempX = current[1];
|
|
tempY = current[2];
|
|
|
|
// calculate reflection of previous control points
|
|
controlX = 2 * x - controlX;
|
|
controlY = 2 * y - controlY;
|
|
ctx.quadraticCurveTo(
|
|
controlX + l,
|
|
controlY + t,
|
|
tempX + l,
|
|
tempY + t
|
|
);
|
|
x = tempX;
|
|
y = tempY;
|
|
break;
|
|
|
|
case 'a':
|
|
// TODO: optimize this
|
|
drawArc(ctx, x + l, y + t, [
|
|
current[1],
|
|
current[2],
|
|
current[3],
|
|
current[4],
|
|
current[5],
|
|
current[6] + x + l,
|
|
current[7] + y + t
|
|
]);
|
|
x += current[6];
|
|
y += current[7];
|
|
break;
|
|
|
|
case 'A':
|
|
// TODO: optimize this
|
|
drawArc(ctx, x + l, y + t, [
|
|
current[1],
|
|
current[2],
|
|
current[3],
|
|
current[4],
|
|
current[5],
|
|
current[6] + l,
|
|
current[7] + t
|
|
]);
|
|
x = current[6];
|
|
y = current[7];
|
|
break;
|
|
|
|
case 'z':
|
|
case 'Z':
|
|
ctx.closePath();
|
|
break;
|
|
}
|
|
previous = current;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Renders path on a specified context
|
|
* @param {CanvasRenderingContext2D} ctx context to render path on
|
|
* @param {Boolean} [noTransform] When true, context is not transformed
|
|
*/
|
|
render: function(ctx, noTransform) {
|
|
// do not render if object is not visible
|
|
if (!this.visible) return;
|
|
|
|
ctx.save();
|
|
var m = this.transformMatrix;
|
|
if (m) {
|
|
ctx.transform(m[0], m[1], m[2], m[3], m[4], m[5]);
|
|
}
|
|
if (!noTransform) {
|
|
this.transform(ctx);
|
|
}
|
|
// ctx.globalCompositeOperation = this.fillRule;
|
|
|
|
ctx.save();
|
|
if (this.overlayFill) {
|
|
ctx.fillStyle = this.overlayFill;
|
|
}
|
|
else if (this.fill) {
|
|
ctx.fillStyle = this.fill.toLive
|
|
? this.fill.toLive(ctx)
|
|
: this.fill;
|
|
}
|
|
|
|
if (this.stroke) {
|
|
ctx.lineWidth = this.strokeWidth;
|
|
ctx.lineCap = this.strokeLineCap;
|
|
ctx.lineJoin = this.strokeLineJoin;
|
|
ctx.miterLimit = this.strokeMiterLimit;
|
|
ctx.strokeStyle = this.stroke.toLive
|
|
? this.stroke.toLive(ctx)
|
|
: this.stroke;
|
|
}
|
|
|
|
this._setShadow(ctx);
|
|
this.clipTo && fabric.util.clipContext(this, ctx);
|
|
ctx.beginPath();
|
|
|
|
this._render(ctx);
|
|
this._renderFill(ctx);
|
|
this._renderStroke(ctx);
|
|
this.clipTo && ctx.restore();
|
|
this._removeShadow(ctx);
|
|
ctx.restore();
|
|
|
|
if (!noTransform && this.active) {
|
|
this.drawBorders(ctx);
|
|
this.drawControls(ctx);
|
|
}
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* Returns string representation of an instance
|
|
* @return {String} string representation of an instance
|
|
*/
|
|
toString: function() {
|
|
return '#<fabric.Path (' + this.complexity() +
|
|
'): { "top": ' + this.top + ', "left": ' + this.left + ' }>';
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} propertiesToInclude
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
var o = extend(this.callSuper('toObject', propertiesToInclude), {
|
|
path: this.path
|
|
});
|
|
if (this.sourcePath) {
|
|
o.sourcePath = this.sourcePath;
|
|
}
|
|
if (this.transformMatrix) {
|
|
o.transformMatrix = this.transformMatrix;
|
|
}
|
|
return o;
|
|
},
|
|
|
|
/**
|
|
* Returns dataless object representation of an instance
|
|
* @param {Array} propertiesToInclude
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toDatalessObject: function(propertiesToInclude) {
|
|
var o = this.toObject(propertiesToInclude);
|
|
if (this.sourcePath) {
|
|
o.path = this.sourcePath;
|
|
}
|
|
delete o.sourcePath;
|
|
return o;
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toSVG: function() {
|
|
var chunks = [],
|
|
markup = [];
|
|
|
|
for (var i = 0, len = this.path.length; i < len; i++) {
|
|
chunks.push(this.path[i].join(' '));
|
|
}
|
|
var path = chunks.join(' ');
|
|
|
|
if (this.fill && this.fill.toLive) {
|
|
markup.push(this.fill.toSVG(this, true));
|
|
}
|
|
if (this.stroke && this.stroke.toLive) {
|
|
markup.push(this.stroke.toSVG(this, true));
|
|
}
|
|
|
|
markup.push(
|
|
'<g transform="', (this.group ? '' : this.getSvgTransform()), '">',
|
|
'<path ',
|
|
'd="', path,
|
|
'" style="', this.getSvgStyles(),
|
|
'" transform="translate(', (-this.width / 2), ' ', (-this.height/2), ')',
|
|
'" stroke-linecap="round" ',
|
|
'/>',
|
|
'</g>'
|
|
);
|
|
|
|
return markup.join('');
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* Returns number representation of an instance complexity
|
|
* @return {Number} complexity
|
|
*/
|
|
complexity: function() {
|
|
return this.path.length;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_parsePath: function() {
|
|
var result = [ ],
|
|
coords = [ ],
|
|
currentPath,
|
|
parsed,
|
|
re = /(-?\.\d+)|(-?\d+(\.\d+)?)/g,
|
|
match,
|
|
coordsStr;
|
|
|
|
for (var i = 0, coordsParsed, len = this.path.length; i < len; i++) {
|
|
currentPath = this.path[i];
|
|
|
|
coordsStr = currentPath.slice(1).trim();
|
|
coords.length = 0;
|
|
|
|
while ((match = re.exec(coordsStr))) {
|
|
coords.push(match[0]);
|
|
}
|
|
|
|
coordsParsed = [ currentPath.charAt(0) ];
|
|
|
|
for (var j = 0, jlen = coords.length; j < jlen; j++) {
|
|
parsed = parseFloat(coords[j]);
|
|
if (!isNaN(parsed)) {
|
|
coordsParsed.push(parsed);
|
|
}
|
|
}
|
|
|
|
var command = coordsParsed[0].toLowerCase(),
|
|
commandLength = commandLengths[command];
|
|
|
|
if (coordsParsed.length - 1 > commandLength) {
|
|
for (var k = 1, klen = coordsParsed.length; k < klen; k += commandLength) {
|
|
result.push([ coordsParsed[0] ].concat(coordsParsed.slice(k, k + commandLength)));
|
|
}
|
|
}
|
|
else {
|
|
result.push(coordsParsed);
|
|
}
|
|
}
|
|
|
|
return result;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_parseDimensions: function() {
|
|
var aX = [],
|
|
aY = [],
|
|
previousX,
|
|
previousY,
|
|
isLowerCase = false,
|
|
x,
|
|
y;
|
|
|
|
this.path.forEach(function(item, i) {
|
|
if (item[0] !== 'H') {
|
|
previousX = (i === 0) ? getX(item) : getX(this.path[i-1]);
|
|
}
|
|
if (item[0] !== 'V') {
|
|
previousY = (i === 0) ? getY(item) : getY(this.path[i-1]);
|
|
}
|
|
|
|
// lowercased letter denotes relative position;
|
|
// transform to absolute
|
|
if (item[0] === item[0].toLowerCase()) {
|
|
isLowerCase = true;
|
|
}
|
|
|
|
// last 2 items in an array of coordinates are the actualy x/y (except H/V);
|
|
// collect them
|
|
|
|
// TODO (kangax): support relative h/v commands
|
|
|
|
x = isLowerCase
|
|
? previousX + getX(item)
|
|
: item[0] === 'V'
|
|
? previousX
|
|
: getX(item);
|
|
|
|
y = isLowerCase
|
|
? previousY + getY(item)
|
|
: item[0] === 'H'
|
|
? previousY
|
|
: getY(item);
|
|
|
|
var val = parseInt(x, 10);
|
|
if (!isNaN(val)) aX.push(val);
|
|
|
|
val = parseInt(y, 10);
|
|
if (!isNaN(val)) aY.push(val);
|
|
|
|
}, this);
|
|
|
|
var minX = min(aX),
|
|
minY = min(aY),
|
|
maxX = max(aX),
|
|
maxY = max(aY),
|
|
deltaX = maxX - minX,
|
|
deltaY = maxY - minY;
|
|
|
|
var o = {
|
|
top: minY + deltaY / 2,
|
|
left: minX + deltaX / 2,
|
|
bottom: max(aY) - deltaY,
|
|
right: max(aX) - deltaX
|
|
};
|
|
|
|
o.width = deltaX;
|
|
o.height = deltaY;
|
|
|
|
return o;
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Creates an instance of fabric.Path from an object
|
|
* @static
|
|
* @return {fabric.Path} Instance of fabric.Path
|
|
*/
|
|
fabric.Path.fromObject = function(object) {
|
|
return new fabric.Path(object.path, object);
|
|
};
|
|
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by `fabric.Path.fromElement`)
|
|
* @static
|
|
* @see http://www.w3.org/TR/SVG/paths.html#PathElement
|
|
*/
|
|
fabric.Path.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(['d']);
|
|
|
|
/**
|
|
* Creates an instance of fabric.Path from an SVG <path> element
|
|
* @static
|
|
* @param {SVGElement} element to parse
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Path} Instance of fabric.Path
|
|
*/
|
|
fabric.Path.fromElement = function(element, options) {
|
|
var parsedAttributes = fabric.parseAttributes(element, fabric.Path.ATTRIBUTE_NAMES);
|
|
return new fabric.Path(parsedAttributes.d, extend(parsedAttributes, options));
|
|
};
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
(function(global) {
|
|
|
|
"use strict";
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
extend = fabric.util.object.extend,
|
|
invoke = fabric.util.array.invoke,
|
|
parentToObject = fabric.Object.prototype.toObject,
|
|
camelize = fabric.util.string.camelize,
|
|
capitalize = fabric.util.string.capitalize;
|
|
|
|
if (fabric.PathGroup) {
|
|
fabric.warn('fabric.PathGroup is already defined');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Path group class
|
|
* @class fabric.PathGroup
|
|
* @extends fabric.Path
|
|
*/
|
|
fabric.PathGroup = fabric.util.createClass(fabric.Path, /** @lends fabric.PathGroup.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'path-group',
|
|
|
|
/**
|
|
* Fill value
|
|
* @type String
|
|
* @default
|
|
*/
|
|
fill: '',
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Array} paths
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.PathGroup} thisArg
|
|
*/
|
|
initialize: function(paths, options) {
|
|
|
|
options = options || { };
|
|
this.paths = paths || [ ];
|
|
|
|
for (var i = this.paths.length; i--; ) {
|
|
this.paths[i].group = this;
|
|
}
|
|
|
|
this.setOptions(options);
|
|
this.setCoords();
|
|
|
|
if (options.sourcePath) {
|
|
this.setSourcePath(options.sourcePath);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Renders this group on a specified context
|
|
* @param {CanvasRenderingContext2D} ctx Context to render this instance on
|
|
*/
|
|
render: function(ctx) {
|
|
// do not render if object is not visible
|
|
if (!this.visible) return;
|
|
|
|
ctx.save();
|
|
|
|
var m = this.transformMatrix;
|
|
if (m) {
|
|
ctx.transform(m[0], m[1], m[2], m[3], m[4], m[5]);
|
|
}
|
|
|
|
this.transform(ctx);
|
|
|
|
this._setShadow(ctx);
|
|
this.clipTo && fabric.util.clipContext(this, ctx);
|
|
for (var i = 0, l = this.paths.length; i < l; ++i) {
|
|
this.paths[i].render(ctx, true);
|
|
}
|
|
this.clipTo && ctx.restore();
|
|
this._removeShadow(ctx);
|
|
|
|
if (this.active) {
|
|
this.drawBorders(ctx);
|
|
this.drawControls(ctx);
|
|
}
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* Sets certain property to a certain value
|
|
* @param {String} prop
|
|
* @param {Any} value
|
|
* @return {fabric.PathGroup} thisArg
|
|
*/
|
|
_set: function(prop, value) {
|
|
|
|
if ((prop === 'fill' || prop === 'overlayFill') && value && this.isSameColor()) {
|
|
var i = this.paths.length;
|
|
while (i--) {
|
|
this.paths[i]._set(prop, value);
|
|
}
|
|
}
|
|
|
|
return this.callSuper('_set', prop, value);
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of this path group
|
|
* @param {Array} [propertiesToInclude]
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return extend(parentToObject.call(this, propertiesToInclude), {
|
|
paths: invoke(this.getObjects(), 'toObject', propertiesToInclude),
|
|
sourcePath: this.sourcePath
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Returns dataless object representation of this path group
|
|
* @param {Array} [propertiesToInclude]
|
|
* @return {Object} dataless object representation of an instance
|
|
*/
|
|
toDatalessObject: function(propertiesToInclude) {
|
|
var o = this.toObject(propertiesToInclude);
|
|
if (this.sourcePath) {
|
|
o.paths = this.sourcePath;
|
|
}
|
|
return o;
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toSVG: function() {
|
|
var objects = this.getObjects();
|
|
var markup = [
|
|
'<g ',
|
|
'style="', this.getSvgStyles(), '" ',
|
|
'transform="', this.getSvgTransform(), '" ',
|
|
'>'
|
|
];
|
|
|
|
for (var i = 0, len = objects.length; i < len; i++) {
|
|
markup.push(objects[i].toSVG());
|
|
}
|
|
markup.push('</g>');
|
|
|
|
return markup.join('');
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* Returns a string representation of this path group
|
|
* @return {String} string representation of an object
|
|
*/
|
|
toString: function() {
|
|
return '#<fabric.PathGroup (' + this.complexity() +
|
|
'): { top: ' + this.top + ', left: ' + this.left + ' }>';
|
|
},
|
|
|
|
/**
|
|
* Returns true if all paths in this group are of same color
|
|
* @return {Boolean} true if all paths are of the same color (`fill`)
|
|
*/
|
|
isSameColor: function() {
|
|
var firstPathFill = this.getObjects()[0].get('fill');
|
|
return this.getObjects().every(function(path) {
|
|
return path.get('fill') === firstPathFill;
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Returns number representation of object's complexity
|
|
* @return {Number} complexity
|
|
*/
|
|
complexity: function() {
|
|
return this.paths.reduce(function(total, path) {
|
|
return total + ((path && path.complexity) ? path.complexity() : 0);
|
|
}, 0);
|
|
},
|
|
|
|
/**
|
|
* Makes path group grayscale
|
|
* @return {fabric.PathGroup} thisArg
|
|
*/
|
|
toGrayscale: function() {
|
|
var i = this.paths.length;
|
|
while (i--) {
|
|
this.paths[i].toGrayscale();
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns all paths in this path group
|
|
* @return {Array} array of path objects included in this path group
|
|
*/
|
|
getObjects: function() {
|
|
return this.paths;
|
|
}
|
|
});
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function instantiatePaths(paths) {
|
|
for (var i = 0, len = paths.length; i < len; i++) {
|
|
if (!(paths[i] instanceof fabric.Object)) {
|
|
var klassName = camelize(capitalize(paths[i].type));
|
|
paths[i] = fabric[klassName].fromObject(paths[i]);
|
|
}
|
|
}
|
|
return paths;
|
|
}
|
|
|
|
/**
|
|
* Creates fabric.PathGroup instance from an object representation
|
|
* @static
|
|
* @param {Object} object
|
|
* @return {fabric.PathGroup}
|
|
*/
|
|
fabric.PathGroup.fromObject = function(object) {
|
|
var paths = instantiatePaths(object.paths);
|
|
return new fabric.PathGroup(paths, object);
|
|
};
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
(function(global){
|
|
|
|
"use strict";
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
extend = fabric.util.object.extend,
|
|
min = fabric.util.array.min,
|
|
max = fabric.util.array.max,
|
|
invoke = fabric.util.array.invoke;
|
|
|
|
if (fabric.Group) {
|
|
return;
|
|
}
|
|
|
|
// lock-related properties, for use in fabric.Group#get
|
|
// to enable locking behavior on group
|
|
// when one of its objects has lock-related properties set
|
|
var _lockProperties = {
|
|
lockMovementX: true,
|
|
lockMovementY: true,
|
|
lockRotation: true,
|
|
lockScalingX: true,
|
|
lockScalingY: true,
|
|
lockUniScaling: true
|
|
};
|
|
|
|
/**
|
|
* Group class
|
|
* @class fabric.Group
|
|
* @extends fabric.Object
|
|
* @extends fabric.Collection
|
|
*/
|
|
fabric.Group = fabric.util.createClass(fabric.Object, fabric.Collection, /** @lends fabric.Group.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'group',
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} objects Group objects
|
|
* @param {Object} [options] Options object
|
|
* @return {Object} thisArg
|
|
*/
|
|
initialize: function(objects, options) {
|
|
options = options || { };
|
|
|
|
this._objects = objects || [];
|
|
for (var i = this._objects.length; i--; ) {
|
|
this._objects[i].group = this;
|
|
}
|
|
|
|
this.originalState = { };
|
|
this.callSuper('initialize');
|
|
|
|
this._calcBounds();
|
|
this._updateObjectsCoords();
|
|
|
|
if (options) {
|
|
extend(this, options);
|
|
}
|
|
this._setOpacityIfSame();
|
|
|
|
this.setCoords(true);
|
|
this.saveCoords();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_updateObjectsCoords: function() {
|
|
var groupDeltaX = this.left,
|
|
groupDeltaY = this.top;
|
|
|
|
this.forEachObject(function(object) {
|
|
|
|
var objectLeft = object.get('left'),
|
|
objectTop = object.get('top');
|
|
|
|
object.set('originalLeft', objectLeft);
|
|
object.set('originalTop', objectTop);
|
|
|
|
object.set('left', objectLeft - groupDeltaX);
|
|
object.set('top', objectTop - groupDeltaY);
|
|
|
|
object.setCoords();
|
|
|
|
// do not display corners of objects enclosed in a group
|
|
object.__origHasControls = object.hasControls;
|
|
object.hasControls = false;
|
|
}, this);
|
|
},
|
|
|
|
/**
|
|
* Returns string represenation of a group
|
|
* @return {String}
|
|
*/
|
|
toString: function() {
|
|
return '#<fabric.Group: (' + this.complexity() + ')>';
|
|
},
|
|
|
|
/**
|
|
* Returns an array of all objects in this group
|
|
* @return {Array} group objects
|
|
*/
|
|
getObjects: function() {
|
|
return this._objects;
|
|
},
|
|
|
|
/**
|
|
* Adds an object to a group; Then recalculates group's dimension, position.
|
|
* @param {Object} object
|
|
* @return {fabric.Group} thisArg
|
|
* @chainable
|
|
*/
|
|
addWithUpdate: function(object) {
|
|
this._restoreObjectsState();
|
|
this._objects.push(object);
|
|
object.group = this;
|
|
// since _restoreObjectsState set objects inactive
|
|
this.forEachObject(function(o){ o.set('active', true); o.group = this; }, this);
|
|
this._calcBounds();
|
|
this._updateObjectsCoords();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Removes an object from a group; Then recalculates group's dimension, position.
|
|
* @param {Object} object
|
|
* @return {fabric.Group} thisArg
|
|
* @chainable
|
|
*/
|
|
removeWithUpdate: function(object) {
|
|
this._restoreObjectsState();
|
|
// since _restoreObjectsState set objects inactive
|
|
this.forEachObject(function(o){ o.set('active', true); o.group = this; }, this);
|
|
|
|
this.remove(object);
|
|
this._calcBounds();
|
|
this._updateObjectsCoords();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_onObjectAdded: function(object) {
|
|
object.group = this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_onObjectRemoved: function(object) {
|
|
delete object.group;
|
|
object.set('active', false);
|
|
},
|
|
|
|
/**
|
|
* @param delegatedProperties
|
|
* @type Object
|
|
* Properties that are delegated to group objects when reading/writing
|
|
*/
|
|
delegatedProperties: {
|
|
fill: true,
|
|
opacity: true,
|
|
fontFamily: true,
|
|
fontWeight: true,
|
|
fontSize: true,
|
|
fontStyle: true,
|
|
lineHeight: true,
|
|
textDecoration: true,
|
|
textShadow: true,
|
|
textAlign: true,
|
|
backgroundColor: true
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_set: function(key, value) {
|
|
if (key in this.delegatedProperties) {
|
|
var i = this._objects.length;
|
|
this[key] = value;
|
|
while (i--) {
|
|
this._objects[i].set(key, value);
|
|
}
|
|
}
|
|
else {
|
|
this[key] = value;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} propertiesToInclude
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return extend(this.callSuper('toObject', propertiesToInclude), {
|
|
objects: invoke(this._objects, 'toObject', propertiesToInclude)
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Renders instance on a given context
|
|
* @param {CanvasRenderingContext2D} ctx context to render instance on
|
|
* @param {Boolean} [noTransform] When true, context is not transformed
|
|
*/
|
|
render: function(ctx, noTransform) {
|
|
// do not render if object is not visible
|
|
if (!this.visible) return;
|
|
|
|
ctx.save();
|
|
this.transform(ctx);
|
|
|
|
var groupScaleFactor = Math.max(this.scaleX, this.scaleY);
|
|
|
|
this.clipTo && fabric.util.clipContext(this, ctx);
|
|
|
|
//The array is now sorted in order of highest first, so start from end.
|
|
for (var i = 0, len = this._objects.length; i < len; i++) {
|
|
|
|
var object = this._objects[i],
|
|
originalScaleFactor = object.borderScaleFactor,
|
|
originalHasRotatingPoint = object.hasRotatingPoint;
|
|
|
|
// do not render if object is not visible
|
|
if (!object.visible) continue;
|
|
|
|
object.borderScaleFactor = groupScaleFactor;
|
|
object.hasRotatingPoint = false;
|
|
|
|
object.render(ctx);
|
|
|
|
object.borderScaleFactor = originalScaleFactor;
|
|
object.hasRotatingPoint = originalHasRotatingPoint;
|
|
}
|
|
this.clipTo && ctx.restore();
|
|
|
|
if (!noTransform && this.active) {
|
|
this.drawBorders(ctx);
|
|
this.drawControls(ctx);
|
|
}
|
|
ctx.restore();
|
|
this.setCoords();
|
|
},
|
|
|
|
/**
|
|
* Retores original state of each of group objects (original state is that which was before group was created).
|
|
* @private
|
|
* @return {fabric.Group} thisArg
|
|
* @chainable
|
|
*/
|
|
_restoreObjectsState: function() {
|
|
this._objects.forEach(this._restoreObjectState, this);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Restores original state of a specified object in group
|
|
* @private
|
|
* @param {fabric.Object} object
|
|
* @return {fabric.Group} thisArg
|
|
*/
|
|
_restoreObjectState: function(object) {
|
|
|
|
var groupLeft = this.get('left'),
|
|
groupTop = this.get('top'),
|
|
groupAngle = this.getAngle() * (Math.PI / 180),
|
|
rotatedTop = Math.cos(groupAngle) * object.get('top') + Math.sin(groupAngle) * object.get('left'),
|
|
rotatedLeft = -Math.sin(groupAngle) * object.get('top') + Math.cos(groupAngle) * object.get('left');
|
|
|
|
object.setAngle(object.getAngle() + this.getAngle());
|
|
|
|
object.set('left', groupLeft + rotatedLeft * this.get('scaleX'));
|
|
object.set('top', groupTop + rotatedTop * this.get('scaleY'));
|
|
|
|
object.set('scaleX', object.get('scaleX') * this.get('scaleX'));
|
|
object.set('scaleY', object.get('scaleY') * this.get('scaleY'));
|
|
|
|
object.setCoords();
|
|
object.hasControls = object.__origHasControls;
|
|
delete object.__origHasControls;
|
|
object.set('active', false);
|
|
object.setCoords();
|
|
delete object.group;
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Destroys a group (restoring state of its objects)
|
|
* @return {fabric.Group} thisArg
|
|
* @chainable
|
|
*/
|
|
destroy: function() {
|
|
return this._restoreObjectsState();
|
|
},
|
|
|
|
/**
|
|
* Saves coordinates of this instance (to be used together with `hasMoved`)
|
|
* @saveCoords
|
|
* @return {fabric.Group} thisArg
|
|
* @chainable
|
|
*/
|
|
saveCoords: function() {
|
|
this._originalLeft = this.get('left');
|
|
this._originalTop = this.get('top');
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Checks whether this group was moved (since `saveCoords` was called last)
|
|
* @return {Boolean} true if an object was moved (since fabric.Group#saveCoords was called)
|
|
*/
|
|
hasMoved: function() {
|
|
return this._originalLeft !== this.get('left') ||
|
|
this._originalTop !== this.get('top');
|
|
},
|
|
|
|
/**
|
|
* Sets coordinates of all group objects
|
|
* @return {fabric.Group} thisArg
|
|
* @chainable
|
|
*/
|
|
setObjectsCoords: function() {
|
|
this.forEachObject(function(object) {
|
|
object.setCoords();
|
|
});
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_setOpacityIfSame: function() {
|
|
var objects = this.getObjects(),
|
|
firstValue = objects[0] ? objects[0].get('opacity') : 1;
|
|
|
|
var isSameOpacity = objects.every(function(o) {
|
|
return o.get('opacity') === firstValue;
|
|
});
|
|
|
|
if (isSameOpacity) {
|
|
this.opacity = firstValue;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_calcBounds: function() {
|
|
var aX = [],
|
|
aY = [],
|
|
minX, minY, maxX, maxY, o, width, height,
|
|
i = 0,
|
|
len = this._objects.length;
|
|
|
|
for (; i < len; ++i) {
|
|
o = this._objects[i];
|
|
o.setCoords();
|
|
for (var prop in o.oCoords) {
|
|
aX.push(o.oCoords[prop].x);
|
|
aY.push(o.oCoords[prop].y);
|
|
}
|
|
}
|
|
|
|
minX = min(aX);
|
|
maxX = max(aX);
|
|
minY = min(aY);
|
|
maxY = max(aY);
|
|
|
|
width = (maxX - minX) || 0;
|
|
height = (maxY - minY) || 0;
|
|
|
|
this.width = width;
|
|
this.height = height;
|
|
|
|
this.left = (minX + width / 2) || 0;
|
|
this.top = (minY + height / 2) || 0;
|
|
},
|
|
|
|
/**
|
|
* Checks if point is contained within the group
|
|
* @param {fabric.Point} point point with `x` and `y` properties
|
|
* @return {Boolean} true if point is contained within group
|
|
*/
|
|
containsPoint: function(point) {
|
|
|
|
var halfWidth = this.get('width') / 2,
|
|
halfHeight = this.get('height') / 2,
|
|
centerX = this.get('left'),
|
|
centerY = this.get('top');
|
|
|
|
return centerX - halfWidth < point.x &&
|
|
centerX + halfWidth > point.x &&
|
|
centerY - halfHeight < point.y &&
|
|
centerY + halfHeight > point.y;
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toSVG: function() {
|
|
var objectsMarkup = [ ];
|
|
for (var i = this._objects.length; i--; ) {
|
|
objectsMarkup.push(this._objects[i].toSVG());
|
|
}
|
|
|
|
return (
|
|
'<g transform="' + this.getSvgTransform() + '">' +
|
|
objectsMarkup.join('') +
|
|
'</g>');
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* Returns requested property
|
|
* @param {String} prop Property to get
|
|
* @return {Any}
|
|
*/
|
|
get: function(prop) {
|
|
if (prop in _lockProperties) {
|
|
if (this[prop]) {
|
|
return this[prop];
|
|
}
|
|
else {
|
|
for (var i = 0, len = this._objects.length; i < len; i++) {
|
|
if (this._objects[i][prop]) {
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
}
|
|
else {
|
|
if (prop in this.delegatedProperties) {
|
|
return this._objects[0] && this._objects[0].get(prop);
|
|
}
|
|
return this[prop];
|
|
}
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns {@link fabric.Group} instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create a group from
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Group} An instance of fabric.Group
|
|
*/
|
|
fabric.Group.fromObject = function(object, callback) {
|
|
fabric.util.enlivenObjects(object.objects, function(enlivenedObjects) {
|
|
delete object.objects;
|
|
callback && callback(new fabric.Group(enlivenedObjects, object));
|
|
});
|
|
};
|
|
|
|
/**
|
|
* Indicates that instances of this type are async
|
|
* @static
|
|
* @type Boolean
|
|
*/
|
|
fabric.Group.async = true;
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
(function(global) {
|
|
|
|
"use strict";
|
|
|
|
var extend = fabric.util.object.extend;
|
|
|
|
if (!global.fabric) {
|
|
global.fabric = { };
|
|
}
|
|
|
|
if (global.fabric.Image) {
|
|
fabric.warn('fabric.Image is already defined.');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Image class
|
|
* @class fabric.Image
|
|
* @extends fabric.Object
|
|
*/
|
|
fabric.Image = fabric.util.createClass(fabric.Object, /** @lends fabric.Image.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'image',
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {HTMLImageElement | String} element Image element
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Image}
|
|
*/
|
|
initialize: function(element, options) {
|
|
options || (options = { });
|
|
|
|
this.callSuper('initialize', options);
|
|
this._initElement(element);
|
|
this._originalImage = this.getElement();
|
|
this._initConfig(options);
|
|
|
|
this.filters = [ ];
|
|
|
|
if (options.filters) {
|
|
this.filters = options.filters;
|
|
this.applyFilters();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Returns image element which this instance if based on
|
|
* @return {HTMLImageElement} image element
|
|
*/
|
|
getElement: function() {
|
|
return this._element;
|
|
},
|
|
|
|
/**
|
|
* Sets image element for this instance to a specified one
|
|
* @param {HTMLImageElement} element
|
|
* @return {fabric.Image} thisArg
|
|
* @chainable
|
|
*/
|
|
setElement: function(element) {
|
|
this._element = element;
|
|
this._initConfig();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns original size of an image
|
|
* @return {Object} object with "width" and "height" properties
|
|
*/
|
|
getOriginalSize: function() {
|
|
var element = this.getElement();
|
|
return {
|
|
width: element.width,
|
|
height: element.height
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Renders image on a specified context
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
* @param {Boolean} [noTransform] When true, context is not transformed
|
|
*/
|
|
render: function(ctx, noTransform) {
|
|
// do not render if object is not visible
|
|
if (!this.visible) return;
|
|
|
|
ctx.save();
|
|
var m = this.transformMatrix;
|
|
var isInPathGroup = this.group && this.group.type !== 'group';
|
|
|
|
// this._resetWidthHeight();
|
|
if (isInPathGroup) {
|
|
ctx.translate(-this.group.width/2 + this.width/2, -this.group.height/2 + this.height/2);
|
|
}
|
|
if (m) {
|
|
ctx.transform(m[0], m[1], m[2], m[3], m[4], m[5]);
|
|
}
|
|
if (!noTransform) {
|
|
this.transform(ctx);
|
|
}
|
|
|
|
ctx.save();
|
|
this._setShadow(ctx);
|
|
this.clipTo && fabric.util.clipContext(this, ctx);
|
|
this._render(ctx);
|
|
if (this.shadow && !this.shadow.affectStroke) {
|
|
this._removeShadow(ctx);
|
|
}
|
|
this._renderStroke(ctx);
|
|
this.clipTo && ctx.restore();
|
|
ctx.restore();
|
|
|
|
if (this.active && !noTransform) {
|
|
this.drawBorders(ctx);
|
|
this.drawControls(ctx);
|
|
}
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_stroke: function(ctx) {
|
|
ctx.save();
|
|
ctx.lineWidth = this.strokeWidth;
|
|
ctx.lineCap = this.strokeLineCap;
|
|
ctx.lineJoin = this.strokeLineJoin;
|
|
ctx.miterLimit = this.strokeMiterLimit;
|
|
ctx.strokeStyle = this.stroke.toLive
|
|
? this.stroke.toLive(ctx)
|
|
: this.stroke;
|
|
ctx.beginPath();
|
|
ctx.strokeRect(-this.width / 2, -this.height / 2, this.width, this.height);
|
|
ctx.beginPath();
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderDashedStroke: function(ctx) {
|
|
var x = -this.width/2,
|
|
y = -this.height/2,
|
|
w = this.width,
|
|
h = this.height;
|
|
|
|
ctx.lineWidth = this.strokeWidth;
|
|
ctx.lineCap = this.strokeLineCap;
|
|
ctx.lineJoin = this.strokeLineJoin;
|
|
ctx.miterLimit = this.strokeMiterLimit;
|
|
ctx.strokeStyle = this.stroke.toLive
|
|
? this.stroke.toLive(ctx)
|
|
: this.stroke;
|
|
ctx.beginPath();
|
|
fabric.util.drawDashedLine(ctx, x, y, x+w, y, this.strokeDashArray);
|
|
fabric.util.drawDashedLine(ctx, x+w, y, x+w, y+h, this.strokeDashArray);
|
|
fabric.util.drawDashedLine(ctx, x+w, y+h, x, y+h, this.strokeDashArray);
|
|
fabric.util.drawDashedLine(ctx, x, y+h, x, y, this.strokeDashArray);
|
|
ctx.closePath();
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} propertiesToInclude
|
|
* @return {Object} propertiesToInclude Object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return extend(this.callSuper('toObject', propertiesToInclude), {
|
|
src: this._originalImage.src || this._originalImage._src,
|
|
filters: this.filters.concat()
|
|
});
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns SVG representation of an instance
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toSVG: function() {
|
|
var markup = [];
|
|
|
|
markup.push(
|
|
'<g transform="', this.getSvgTransform(), '">',
|
|
'<image xlink:href="', this.getSvgSrc(),
|
|
'" style="', this.getSvgStyles(),
|
|
// we're essentially moving origin of transformation from top/left corner to the center of the shape
|
|
// by wrapping it in container <g> element with actual transformation, then offsetting object to the top/left
|
|
// so that object's center aligns with container's left/top
|
|
'" transform="translate(' + (-this.width/2) + ' ' + (-this.height/2) + ')',
|
|
'" width="', this.width,
|
|
'" height="', this.height,
|
|
'"></image>'
|
|
);
|
|
|
|
if (this.stroke || this.strokeDashArray) {
|
|
var origFill = this.fill;
|
|
this.fill = null;
|
|
markup.push(
|
|
'<rect ',
|
|
'x="', (-1 * this.width / 2), '" y="', (-1 * this.height / 2),
|
|
'" width="', this.width, '" height="', this.height,
|
|
'" style="', this.getSvgStyles(),
|
|
'"/>'
|
|
);
|
|
this.fill = origFill;
|
|
}
|
|
|
|
markup.push('</g>');
|
|
|
|
return markup.join('');
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* Returns source of an image
|
|
* @return {String} Source of an image
|
|
*/
|
|
getSrc: function() {
|
|
return this.getElement().src || this.getElement()._src;
|
|
},
|
|
|
|
/**
|
|
* Returns string representation of an instance
|
|
* @return {String} String representation of an instance
|
|
*/
|
|
toString: function() {
|
|
return '#<fabric.Image: { src: "' + this.getSrc() + '" }>';
|
|
},
|
|
|
|
/**
|
|
* Returns a clone of an instance
|
|
* @param {Function} callback Callback is invoked with a clone as a first argument
|
|
* @param {Array} propertiesToInclude
|
|
*/
|
|
clone: function(callback, propertiesToInclude) {
|
|
this.constructor.fromObject(this.toObject(propertiesToInclude), callback);
|
|
},
|
|
|
|
/**
|
|
* Applies filters assigned to this image (from "filters" array)
|
|
* @mthod applyFilters
|
|
* @param {Function} callback Callback is invoked when all filters have been applied and new image is generated
|
|
* @return {fabric.Image} thisArg
|
|
* @chainable
|
|
*/
|
|
applyFilters: function(callback) {
|
|
|
|
if (this.filters.length === 0) {
|
|
this.setElement(this._originalImage);
|
|
callback && callback();
|
|
return;
|
|
}
|
|
|
|
var imgEl = this._originalImage,
|
|
canvasEl = fabric.util.createCanvasElement(),
|
|
replacement = fabric.util.createImage(),
|
|
_this = this;
|
|
|
|
canvasEl.width = imgEl.width;
|
|
canvasEl.height = imgEl.height;
|
|
|
|
canvasEl.getContext('2d').drawImage(imgEl, 0, 0, imgEl.width, imgEl.height);
|
|
|
|
this.filters.forEach(function(filter) {
|
|
filter && filter.applyTo(canvasEl);
|
|
});
|
|
|
|
/** @ignore */
|
|
|
|
replacement.width = imgEl.width;
|
|
replacement.height = imgEl.height;
|
|
|
|
if (fabric.isLikelyNode) {
|
|
// cut off data:image/png;base64, part in the beginning
|
|
var base64str = canvasEl.toDataURL('image/png').substring(22);
|
|
replacement.src = new Buffer(base64str, 'base64');
|
|
|
|
// onload doesn't fire in some node versions, so we invoke callback manually
|
|
_this._element = replacement;
|
|
callback && callback();
|
|
}
|
|
else {
|
|
replacement.onload = function() {
|
|
_this._element = replacement;
|
|
callback && callback();
|
|
replacement.onload = canvasEl = imgEl = null;
|
|
};
|
|
replacement.src = canvasEl.toDataURL('image/png');
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param ctx
|
|
*/
|
|
_render: function(ctx) {
|
|
ctx.drawImage(
|
|
this._element,
|
|
-this.width / 2,
|
|
-this.height / 2,
|
|
this.width,
|
|
this.height
|
|
);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_resetWidthHeight: function() {
|
|
var element = this.getElement();
|
|
|
|
this.set('width', element.width);
|
|
this.set('height', element.height);
|
|
},
|
|
|
|
/**
|
|
* The Image class's initialization method. This method is automatically
|
|
* called by the constructor.
|
|
* @private
|
|
* @param {HTMLImageElement|String} el The element representing the image
|
|
*/
|
|
_initElement: function(element) {
|
|
this.setElement(fabric.util.getById(element));
|
|
fabric.util.addClass(this.getElement(), fabric.Image.CSS_CANVAS);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
_initConfig: function(options) {
|
|
options || (options = { });
|
|
this.setOptions(options);
|
|
this._setWidthHeight(options);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} object Object with filters property
|
|
*/
|
|
_initFilters: function(object) {
|
|
if (object.filters && object.filters.length) {
|
|
this.filters = object.filters.map(function(filterObj) {
|
|
return filterObj && fabric.Image.filters[filterObj.type].fromObject(filterObj);
|
|
});
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} [options] Object with width/height properties
|
|
*/
|
|
_setWidthHeight: function(options) {
|
|
this.width = 'width' in options
|
|
? options.width
|
|
: (this.getElement().width || 0);
|
|
|
|
this.height = 'height' in options
|
|
? options.height
|
|
: (this.getElement().height || 0);
|
|
},
|
|
|
|
/**
|
|
* Returns complexity of an instance
|
|
* @return {Number} complexity
|
|
*/
|
|
complexity: function() {
|
|
return 1;
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Default CSS class name for canvas
|
|
* @static
|
|
* @type String
|
|
*/
|
|
fabric.Image.CSS_CANVAS = "canvas-img";
|
|
|
|
/**
|
|
* Alias for getSrc
|
|
* @static
|
|
*/
|
|
fabric.Image.prototype.getSvgSrc = fabric.Image.prototype.getSrc;
|
|
|
|
/**
|
|
* Creates an instance of fabric.Image from its object representation
|
|
* @static
|
|
* @param {Object} object
|
|
* @param {Function} [callback] Callback to invoke when an image instance is created
|
|
*/
|
|
fabric.Image.fromObject = function(object, callback) {
|
|
var img = fabric.document.createElement('img'),
|
|
src = object.src;
|
|
|
|
if (object.width) {
|
|
img.width = object.width;
|
|
}
|
|
|
|
if (object.height) {
|
|
img.height = object.height;
|
|
}
|
|
|
|
/** @ignore */
|
|
img.onload = function() {
|
|
fabric.Image.prototype._initFilters.call(object, object);
|
|
|
|
var instance = new fabric.Image(img, object);
|
|
callback && callback(instance);
|
|
img = img.onload = img.onerror = null;
|
|
};
|
|
|
|
/** @ignore */
|
|
img.onerror = function() {
|
|
fabric.log('Error loading ' + img.src);
|
|
callback && callback(null, true);
|
|
img = img.onload = img.onerror = null;
|
|
};
|
|
|
|
img.src = src;
|
|
};
|
|
|
|
/**
|
|
* Creates an instance of fabric.Image from an URL string
|
|
* @static
|
|
* @param {String} url URL to create an image from
|
|
* @param {Function} [callback] Callback to invoke when image is created (newly created image is passed as a first argument)
|
|
* @param {Object} [imgOptions] Options object
|
|
*/
|
|
fabric.Image.fromURL = function(url, callback, imgOptions) {
|
|
fabric.util.loadImage(url, function(img) {
|
|
callback(new fabric.Image(img, imgOptions));
|
|
});
|
|
};
|
|
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by {@link fabric.Image.fromElement})
|
|
* @static
|
|
* @see http://www.w3.org/TR/SVG/struct.html#ImageElement
|
|
*/
|
|
fabric.Image.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('x y width height xlink:href'.split(' '));
|
|
|
|
/**
|
|
* Returns {@link fabric.Image} instance from an SVG element
|
|
* @static
|
|
* @param {SVGElement} element Element to parse
|
|
* @param {Function} callback Callback to execute when fabric.Image object is created
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Image}
|
|
*/
|
|
fabric.Image.fromElement = function(element, callback, options) {
|
|
var parsedAttributes = fabric.parseAttributes(element, fabric.Image.ATTRIBUTE_NAMES);
|
|
|
|
fabric.Image.fromURL(parsedAttributes['xlink:href'], callback,
|
|
extend((options ? fabric.util.object.clone(options) : { }), parsedAttributes));
|
|
};
|
|
|
|
/**
|
|
* Indicates that instances of this type are async
|
|
* @static
|
|
* @type Boolean
|
|
*/
|
|
fabric.Image.async = true;
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ {
|
|
|
|
/**
|
|
* @private
|
|
* @return {Number} angle value
|
|
*/
|
|
_getAngleValueForStraighten: function() {
|
|
var angle = this.getAngle() % 360;
|
|
if (angle > 0) {
|
|
return Math.round((angle-1)/90) * 90;
|
|
}
|
|
return Math.round(angle/90) * 90;
|
|
},
|
|
|
|
/**
|
|
* Straightens an object (rotating it from current angle to one of 0, 90, 180, 270, etc. depending on which is closer)
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
straighten: function() {
|
|
this.setAngle(this._getAngleValueForStraighten());
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Same as {@link fabric.Object.prototype.straghten} but with animation
|
|
* @param {Object} callbacks
|
|
* - onComplete: invoked on completion
|
|
* - onChange: invoked on every step of animation
|
|
*
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
fxStraighten: function(callbacks) {
|
|
callbacks = callbacks || { };
|
|
|
|
var empty = function() { },
|
|
onComplete = callbacks.onComplete || empty,
|
|
onChange = callbacks.onChange || empty,
|
|
_this = this;
|
|
|
|
fabric.util.animate({
|
|
startValue: this.get('angle'),
|
|
endValue: this._getAngleValueForStraighten(),
|
|
duration: this.FX_DURATION,
|
|
onChange: function(value) {
|
|
_this.setAngle(value);
|
|
onChange();
|
|
},
|
|
onComplete: function() {
|
|
_this.setCoords();
|
|
onComplete();
|
|
},
|
|
onStart: function() {
|
|
_this.set('active', false);
|
|
}
|
|
});
|
|
|
|
return this;
|
|
}
|
|
});
|
|
|
|
fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ {
|
|
|
|
/**
|
|
* Straightens object, then rerenders canvas
|
|
* @param {fabric.Object} object Object to straighten
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
straightenObject: function (object) {
|
|
object.straighten();
|
|
this.renderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Same as {@link fabric.Canvas.prototype.straightenObject}, but animated
|
|
* @param {fabric.Object} object Object to straighten
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
fxStraightenObject: function (object) {
|
|
object.fxStraighten({
|
|
onChange: this.renderAll.bind(this)
|
|
});
|
|
return this;
|
|
}
|
|
});
|
|
|
|
/**
|
|
* @namespace fabric.Image.filters
|
|
* @memberOf fabric.Image
|
|
*/
|
|
fabric.Image.filters = { };
|
|
|
|
/**
|
|
* Grayscale image filter class
|
|
* @class fabric.Image.filters.Grayscale
|
|
* @memberOf fabric.Image.filters
|
|
*/
|
|
fabric.Image.filters.Grayscale = fabric.util.createClass( /** @lends fabric.Image.filters.Grayscale.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
*/
|
|
type: "Grayscale",
|
|
|
|
/**
|
|
* Applies filter to canvas element
|
|
* @memberOf fabric.Image.filters.Grayscale.prototype
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
*/
|
|
applyTo: function(canvasEl) {
|
|
var context = canvasEl.getContext('2d'),
|
|
imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height),
|
|
data = imageData.data,
|
|
len = imageData.width * imageData.height * 4,
|
|
index = 0,
|
|
average;
|
|
while (index < len) {
|
|
average = (data[index] + data[index + 1] + data[index + 2]) / 3;
|
|
data[index] = average;
|
|
data[index + 1] = average;
|
|
data[index + 2] = average;
|
|
index += 4;
|
|
}
|
|
context.putImageData(imageData, 0, 0);
|
|
},
|
|
|
|
/**
|
|
* Returns json representation of filter
|
|
* @return {Object} JSON representation of filter
|
|
*/
|
|
toJSON: function() {
|
|
return { type: this.type };
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @return {fabric.Image.filters.Grayscale}
|
|
*/
|
|
fabric.Image.filters.Grayscale.fromObject = function() {
|
|
return new fabric.Image.filters.Grayscale();
|
|
};
|
|
|
|
/**
|
|
* Remove white filter class
|
|
* @class fabric.Image.filters.RemoveWhite
|
|
* @memberOf fabric.Image.filters
|
|
*/
|
|
fabric.Image.filters.RemoveWhite = fabric.util.createClass( /** @lends fabric.Image.filters.RemoveWhite.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
*/
|
|
type: "RemoveWhite",
|
|
|
|
/**
|
|
* Constructor
|
|
* @memberOf fabric.Image.filters.RemoveWhite.prototype
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
initialize: function(options) {
|
|
options || (options = { });
|
|
this.threshold = options.threshold || 30;
|
|
this.distance = options.distance || 20;
|
|
},
|
|
|
|
/**
|
|
* Applies filter to canvas element
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
*/
|
|
applyTo: function(canvasEl) {
|
|
var context = canvasEl.getContext('2d'),
|
|
imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height),
|
|
data = imageData.data,
|
|
threshold = this.threshold,
|
|
distance = this.distance,
|
|
limit = 255 - threshold,
|
|
abs = Math.abs,
|
|
r, g, b;
|
|
|
|
for (var i = 0, len = data.length; i < len; i += 4) {
|
|
|
|
r = data[i];
|
|
g = data[i+1];
|
|
b = data[i+2];
|
|
|
|
if (r > limit &&
|
|
g > limit &&
|
|
b > limit &&
|
|
abs(r-g) < distance &&
|
|
abs(r-b) < distance &&
|
|
abs(g-b) < distance) {
|
|
|
|
data[i+3] = 1;
|
|
}
|
|
}
|
|
|
|
context.putImageData(imageData, 0, 0);
|
|
},
|
|
|
|
/**
|
|
* Returns json representation of filter
|
|
* @return {Object} JSON representation of filter
|
|
*/
|
|
toJSON: function() {
|
|
return {
|
|
type: this.type,
|
|
threshold: this.threshold,
|
|
distance: this.distance
|
|
};
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @return {fabric.Image.filters.RemoveWhite}
|
|
*/
|
|
fabric.Image.filters.RemoveWhite.fromObject = function(object) {
|
|
return new fabric.Image.filters.RemoveWhite(object);
|
|
};
|
|
|
|
/**
|
|
* Invert filter class
|
|
* @class fabric.Image.filters.Invert
|
|
* @memberOf fabric.Image.filters
|
|
*/
|
|
fabric.Image.filters.Invert = fabric.util.createClass( /** @lends fabric.Image.filters.Invert.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
*/
|
|
type: "Invert",
|
|
|
|
/**
|
|
* Applies filter to canvas element
|
|
* @memberOf fabric.Image.filters.Invert.prototype
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
*/
|
|
applyTo: function(canvasEl) {
|
|
var context = canvasEl.getContext('2d'),
|
|
imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height),
|
|
data = imageData.data,
|
|
iLen = data.length, i;
|
|
|
|
for (i = 0; i < iLen; i+=4) {
|
|
data[i] = 255 - data[i];
|
|
data[i + 1] = 255 - data[i + 1];
|
|
data[i + 2] = 255 - data[i + 2];
|
|
}
|
|
|
|
context.putImageData(imageData, 0, 0);
|
|
},
|
|
|
|
/**
|
|
* Returns json representation of filter
|
|
* @return {String} json representation of filter
|
|
*/
|
|
toJSON: function() {
|
|
return { type: this.type };
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @return {fabric.Image.filters.Invert}
|
|
*/
|
|
fabric.Image.filters.Invert.fromObject = function() {
|
|
return new fabric.Image.filters.Invert();
|
|
};
|
|
|
|
/**
|
|
* Sepia filter class
|
|
* @class fabric.Image.filters.Sepia
|
|
* @memberOf fabric.Image.filters
|
|
*/
|
|
fabric.Image.filters.Sepia = fabric.util.createClass( /** @lends fabric.Image.filters.Sepia.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
*/
|
|
type: "Sepia",
|
|
|
|
/**
|
|
* Applies filter to canvas element
|
|
* @memberOf fabric.Image.filters.Sepia.prototype
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
*/
|
|
applyTo: function(canvasEl) {
|
|
var context = canvasEl.getContext('2d'),
|
|
imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height),
|
|
data = imageData.data,
|
|
iLen = data.length, i, avg;
|
|
|
|
for (i = 0; i < iLen; i+=4) {
|
|
avg = 0.3 * data[i] + 0.59 * data[i + 1] + 0.11 * data[i + 2];
|
|
data[i] = avg + 100;
|
|
data[i + 1] = avg + 50;
|
|
data[i + 2] = avg + 255;
|
|
}
|
|
|
|
context.putImageData(imageData, 0, 0);
|
|
},
|
|
|
|
/**
|
|
* Returns json representation of filter
|
|
* @return {String} json representation of filter
|
|
*/
|
|
toJSON: function() {
|
|
return { type: this.type };
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @return {fabric.Image.filters.Sepia}
|
|
*/
|
|
fabric.Image.filters.Sepia.fromObject = function() {
|
|
return new fabric.Image.filters.Sepia();
|
|
};
|
|
|
|
/**
|
|
* Sepia2 filter class
|
|
* @class fabric.Image.filters.Sepia2
|
|
* @memberOf fabric.Image.filters
|
|
*/
|
|
fabric.Image.filters.Sepia2 = fabric.util.createClass( /** @lends fabric.Image.filters.Sepia2.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
*/
|
|
type: "Sepia2",
|
|
|
|
/**
|
|
* Applies filter to canvas element
|
|
* @memberOf fabric.Image.filters.Sepia.prototype
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
*/
|
|
applyTo: function(canvasEl) {
|
|
var context = canvasEl.getContext('2d'),
|
|
imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height),
|
|
data = imageData.data,
|
|
iLen = data.length, i, r, g, b;
|
|
|
|
for (i = 0; i < iLen; i+=4) {
|
|
|
|
r = data[i];
|
|
g = data[i + 1];
|
|
b = data[i + 2];
|
|
|
|
data[i] = (r * 0.393 + g * 0.769 + b * 0.189 ) / 1.351;
|
|
data[i + 1] = (r * 0.349 + g * 0.686 + b * 0.168 ) / 1.203;
|
|
data[i + 2] = (r * 0.272 + g * 0.534 + b * 0.131 ) / 2.140;
|
|
}
|
|
|
|
context.putImageData(imageData, 0, 0);
|
|
},
|
|
|
|
/**
|
|
* Returns json representation of filter
|
|
* @return {String} json representation of filter
|
|
*/
|
|
toJSON: function() {
|
|
return { type: this.type };
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @return {fabric.Image.filters.Sepia2}
|
|
*/
|
|
fabric.Image.filters.Sepia2.fromObject = function() {
|
|
return new fabric.Image.filters.Sepia2();
|
|
};
|
|
|
|
/**
|
|
* Brightness filter class
|
|
* @class fabric.Image.filters.Brightness
|
|
* @memberOf fabric.Image.filters
|
|
*/
|
|
fabric.Image.filters.Brightness = fabric.util.createClass( /** @lends fabric.Image.filters.Brightness.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
*/
|
|
type: "Brightness",
|
|
|
|
/**
|
|
* Constructor
|
|
* @memberOf fabric.Image.filters.Brightness.prototype
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
initialize: function(options) {
|
|
options || (options = { });
|
|
this.brightness = options.brightness || 100;
|
|
},
|
|
|
|
/**
|
|
* Applies filter to canvas element
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
*/
|
|
applyTo: function(canvasEl) {
|
|
var context = canvasEl.getContext('2d'),
|
|
imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height),
|
|
data = imageData.data,
|
|
brightness = this.brightness;
|
|
|
|
for (var i = 0, len = data.length; i < len; i += 4) {
|
|
data[i] += brightness;
|
|
data[i + 1] += brightness;
|
|
data[i + 2] += brightness;
|
|
}
|
|
|
|
context.putImageData(imageData, 0, 0);
|
|
},
|
|
|
|
/**
|
|
* Returns json representation of filter
|
|
* @return {String} json representation of filter
|
|
*/
|
|
toJSON: function() {
|
|
return {
|
|
type: this.type,
|
|
brightness: this.brightness
|
|
};
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @return {fabric.Image.filters.Brightness}
|
|
*/
|
|
fabric.Image.filters.Brightness.fromObject = function(object) {
|
|
return new fabric.Image.filters.Brightness(object);
|
|
};
|
|
|
|
/**
|
|
* Noise filter class
|
|
* @class fabric.Image.filters.Noise
|
|
* @memberOf fabric.Image.filters
|
|
*/
|
|
fabric.Image.filters.Noise = fabric.util.createClass( /** @lends fabric.Image.filters.Noise.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
*/
|
|
type: "Noise",
|
|
|
|
/**
|
|
* Constructor
|
|
* @memberOf fabric.Image.filters.Noise.prototype
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
initialize: function(options) {
|
|
options || (options = { });
|
|
this.noise = options.noise || 100;
|
|
},
|
|
|
|
/**
|
|
* Applies filter to canvas element
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
*/
|
|
applyTo: function(canvasEl) {
|
|
var context = canvasEl.getContext('2d'),
|
|
imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height),
|
|
data = imageData.data,
|
|
noise = this.noise, rand;
|
|
|
|
for (var i = 0, len = data.length; i < len; i += 4) {
|
|
|
|
rand = (0.5 - Math.random()) * noise;
|
|
|
|
data[i] += rand;
|
|
data[i + 1] += rand;
|
|
data[i + 2] += rand;
|
|
}
|
|
|
|
context.putImageData(imageData, 0, 0);
|
|
},
|
|
|
|
/**
|
|
* Returns json representation of filter
|
|
* @return {String} json representation of filter
|
|
*/
|
|
toJSON: function() {
|
|
return {
|
|
type: this.type,
|
|
noise: this.noise
|
|
};
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @return {fabric.Image.filters.Noise}
|
|
*/
|
|
fabric.Image.filters.Noise.fromObject = function(object) {
|
|
return new fabric.Image.filters.Noise(object);
|
|
};
|
|
|
|
/**
|
|
* GradientTransparency filter class
|
|
* @class fabric.Image.filters.GradientTransparency
|
|
* @memberOf fabric.Image.filters
|
|
*/
|
|
fabric.Image.filters.GradientTransparency = fabric.util.createClass( /** @lends fabric.Image.filters.GradientTransparency.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
*/
|
|
type: "GradientTransparency",
|
|
|
|
/**
|
|
* Constructor
|
|
* @memberOf fabric.Image.filters.GradientTransparency
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
initialize: function(options) {
|
|
options || (options = { });
|
|
this.threshold = options.threshold || 100;
|
|
},
|
|
|
|
/**
|
|
* Applies filter to canvas element
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
*/
|
|
applyTo: function(canvasEl) {
|
|
var context = canvasEl.getContext('2d'),
|
|
imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height),
|
|
data = imageData.data,
|
|
threshold = this.threshold,
|
|
total = data.length;
|
|
|
|
for (var i = 0, len = data.length; i < len; i += 4) {
|
|
data[i + 3] = threshold + 255 * (total - i) / total;
|
|
}
|
|
|
|
context.putImageData(imageData, 0, 0);
|
|
},
|
|
|
|
/**
|
|
* Returns json representation of filter
|
|
* @return {String} json representation of filter
|
|
*/
|
|
toJSON: function() {
|
|
return {
|
|
type: this.type,
|
|
threshold: this.threshold
|
|
};
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @return {fabric.Image.filters.GradientTransparency}
|
|
*/
|
|
fabric.Image.filters.GradientTransparency.fromObject = function(object) {
|
|
return new fabric.Image.filters.GradientTransparency(object);
|
|
};
|
|
|
|
/**
|
|
* Tint filter class
|
|
* @class fabric.Image.filters.Tint
|
|
* @memberOf fabric.Image.filters
|
|
*/
|
|
fabric.Image.filters.Tint = fabric.util.createClass( /** @lends fabric.Image.filters.Tint.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
*/
|
|
type: "Tint",
|
|
|
|
/**
|
|
* Constructor
|
|
* @memberOf fabric.Image.filters.Tint.prototype
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
initialize: function(options) {
|
|
options || (options = { });
|
|
this.color = options.color || 0;
|
|
},
|
|
|
|
/**
|
|
* Applies filter to canvas element
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
*/
|
|
applyTo: function(canvasEl) {
|
|
|
|
var context = canvasEl.getContext('2d'),
|
|
imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height),
|
|
data = imageData.data,
|
|
iLen = data.length, i, a;
|
|
|
|
var rgb = parseInt(this.color, 10).toString(16);
|
|
|
|
var cr = parseInt('0x' + rgb.substr(0, 2), 16);
|
|
var cg = parseInt('0x' + rgb.substr(2, 2), 16);
|
|
var cb = parseInt('0x' + rgb.substr(4, 2), 16);
|
|
|
|
for (i = 0; i < iLen; i+=4) {
|
|
|
|
a = data[i+3];
|
|
|
|
if (a > 0){
|
|
data[i] = cr;
|
|
data[i+1] = cg;
|
|
data[i+2] = cb;
|
|
}
|
|
}
|
|
|
|
context.putImageData(imageData, 0, 0);
|
|
},
|
|
|
|
/**
|
|
* Returns json representation of filter
|
|
* @return {String} json representation of filter
|
|
*/
|
|
toJSON: function() {
|
|
return {
|
|
type: this.type,
|
|
color: this.color
|
|
};
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @return {fabric.Image.filters.Tint}
|
|
*/
|
|
fabric.Image.filters.Tint.fromObject = function(object) {
|
|
return new fabric.Image.filters.Tint(object);
|
|
};
|
|
|
|
/**
|
|
* Adapted from <a href="http://www.html5rocks.com/en/tutorials/canvas/imagefilters/">html5rocks article</a>
|
|
* @class fabric.Image.filters.Convolute
|
|
* @memberOf fabric.Image.filters
|
|
*/
|
|
fabric.Image.filters.Convolute = fabric.util.createClass(/** @lends fabric.Image.filters.Convolute.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
*/
|
|
type: 'Convolute',
|
|
|
|
/**
|
|
* Constructor
|
|
* @memberOf fabric.Image.filters.Convolute.prototype
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
initialize: function(options) {
|
|
options || (options = { });
|
|
|
|
this.opaque = options.opaque;
|
|
this.matrix = options.matrix || [ 0, 0, 0,
|
|
0, 1, 0,
|
|
0, 0, 0 ];
|
|
|
|
var canvasEl = fabric.util.createCanvasElement();
|
|
this.tmpCtx = canvasEl.getContext('2d');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_createImageData: function(w, h) {
|
|
return this.tmpCtx.createImageData(w, h);
|
|
},
|
|
|
|
/**
|
|
* Applies filter to canvas element
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
*/
|
|
applyTo: function(canvasEl) {
|
|
|
|
var weights = this.matrix;
|
|
var context = canvasEl.getContext('2d');
|
|
var pixels = context.getImageData(0, 0, canvasEl.width, canvasEl.height);
|
|
|
|
var side = Math.round(Math.sqrt(weights.length));
|
|
var halfSide = Math.floor(side/2);
|
|
var src = pixels.data;
|
|
var sw = pixels.width;
|
|
var sh = pixels.height;
|
|
|
|
// pad output by the convolution matrix
|
|
var w = sw;
|
|
var h = sh;
|
|
var output = this._createImageData(w, h);
|
|
|
|
var dst = output.data;
|
|
|
|
// go through the destination image pixels
|
|
var alphaFac = this.opaque ? 1 : 0;
|
|
for (var y=0; y<h; y++) {
|
|
for (var x=0; x<w; x++) {
|
|
var sy = y;
|
|
var sx = x;
|
|
var dstOff = (y*w+x)*4;
|
|
// calculate the weighed sum of the source image pixels that
|
|
// fall under the convolution matrix
|
|
var r=0, g=0, b=0, a=0;
|
|
for (var cy=0; cy<side; cy++) {
|
|
for (var cx=0; cx<side; cx++) {
|
|
var scy = sy + cy - halfSide;
|
|
var scx = sx + cx - halfSide;
|
|
if (scy >= 0 && scy < sh && scx >= 0 && scx < sw) {
|
|
var srcOff = (scy*sw+scx)*4;
|
|
var wt = weights[cy*side+cx];
|
|
r += src[srcOff] * wt;
|
|
g += src[srcOff+1] * wt;
|
|
b += src[srcOff+2] * wt;
|
|
a += src[srcOff+3] * wt;
|
|
}
|
|
}
|
|
}
|
|
dst[dstOff] = r;
|
|
dst[dstOff+1] = g;
|
|
dst[dstOff+2] = b;
|
|
dst[dstOff+3] = a + alphaFac*(255-a);
|
|
}
|
|
}
|
|
|
|
context.putImageData(output, 0, 0);
|
|
},
|
|
|
|
/**
|
|
* Returns json representation of filter
|
|
* @return {String} json representation of filter
|
|
*/
|
|
toJSON: function() {
|
|
return {
|
|
type: this.type,
|
|
matrix: this.matrix
|
|
};
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @return {fabric.Image.filters.Convolute}
|
|
*/
|
|
fabric.Image.filters.Convolute.fromObject = function(object) {
|
|
return new fabric.Image.filters.Convolute(object);
|
|
};
|
|
|
|
/**
|
|
* Pixelate filter class
|
|
* @class fabric.Image.filters.Pixelate
|
|
* @memberOf fabric.Image.filters
|
|
*/
|
|
fabric.Image.filters.Pixelate = fabric.util.createClass(/** @lends fabric.Image.filters.Pixelate.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
*/
|
|
type: 'Pixelate',
|
|
|
|
/**
|
|
* Constructor
|
|
* @memberOf fabric.Image.filters.Pixelate.prototype
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
initialize: function(options) {
|
|
options || (options = { });
|
|
this.blocksize = options.blocksize || 4;
|
|
},
|
|
|
|
/**
|
|
* Applies filter to canvas element
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
*/
|
|
applyTo: function(canvasEl) {
|
|
|
|
var context = canvasEl.getContext('2d'),
|
|
imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height),
|
|
data = imageData.data,
|
|
iLen = imageData.height,
|
|
jLen = imageData.width,
|
|
index, i, j, r, g, b, a;
|
|
|
|
for (i = 0; i < iLen; i += this.blocksize) {
|
|
for (j = 0; j < jLen; j += this.blocksize) {
|
|
|
|
index = (i * 4) * jLen + (j * 4);
|
|
|
|
r = data[index];
|
|
g = data[index+1];
|
|
b = data[index+2];
|
|
a = data[index+3];
|
|
|
|
/*
|
|
blocksize: 4
|
|
|
|
[1,x,x,x,1]
|
|
[x,x,x,x,1]
|
|
[x,x,x,x,1]
|
|
[x,x,x,x,1]
|
|
[1,1,1,1,1]
|
|
*/
|
|
|
|
for (var _i = i, _ilen = i + this.blocksize; _i < _ilen; _i++) {
|
|
for (var _j = j, _jlen = j + this.blocksize; _j < _jlen; _j++) {
|
|
index = (_i * 4) * jLen + (_j * 4);
|
|
data[index] = r;
|
|
data[index + 1] = g;
|
|
data[index + 2] = b;
|
|
data[index + 3] = a;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
context.putImageData(imageData, 0, 0);
|
|
},
|
|
|
|
/**
|
|
* Returns json representation of filter
|
|
* @return {String} json representation of filter
|
|
*/
|
|
toJSON: function() {
|
|
return {
|
|
type: this.type,
|
|
blocksize: this.blocksize
|
|
};
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @return {fabric.Image.filters.Pixelate}
|
|
*/
|
|
fabric.Image.filters.Pixelate.fromObject = function(object) {
|
|
return new fabric.Image.filters.Pixelate(object);
|
|
};
|
|
|
|
(function(global) {
|
|
|
|
"use strict";
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
extend = fabric.util.object.extend,
|
|
clone = fabric.util.object.clone,
|
|
toFixed = fabric.util.toFixed,
|
|
supportsLineDash = fabric.StaticCanvas.supports('setLineDash');
|
|
|
|
if (fabric.Text) {
|
|
fabric.warn('fabric.Text is already defined');
|
|
return;
|
|
}
|
|
|
|
var dimensionAffectingProps = {
|
|
fontSize: true,
|
|
fontWeight: true,
|
|
fontFamily: true,
|
|
textDecoration: true,
|
|
fontStyle: true,
|
|
lineHeight: true,
|
|
stroke: true,
|
|
strokeWidth: true,
|
|
text: true
|
|
};
|
|
|
|
var stateProperties = fabric.Object.prototype.stateProperties.concat();
|
|
stateProperties.push(
|
|
'fontFamily',
|
|
'fontWeight',
|
|
'fontSize',
|
|
'path',
|
|
'text',
|
|
'textDecoration',
|
|
'textShadow',
|
|
'textAlign',
|
|
'fontStyle',
|
|
'lineHeight',
|
|
'stroke',
|
|
'strokeWidth',
|
|
'backgroundColor',
|
|
'textBackgroundColor',
|
|
'useNative'
|
|
);
|
|
|
|
/**
|
|
* Text class
|
|
* @class fabric.Text
|
|
* @extends fabric.Object
|
|
* @return {fabric.Text} thisArg
|
|
*/
|
|
fabric.Text = fabric.util.createClass(fabric.Object, /** @lends fabric.Text.prototype */ {
|
|
|
|
/**
|
|
* Font size (in pixels)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
fontSize: 40,
|
|
|
|
/**
|
|
* Font weight (e.g. bold, normal, 400, 600, 800)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
fontWeight: 'normal',
|
|
|
|
/**
|
|
* Font family
|
|
* @type String
|
|
* @default
|
|
*/
|
|
fontFamily: 'Times New Roman',
|
|
|
|
/**
|
|
* Text decoration (e.g. underline, overline)
|
|
* @type String
|
|
* @default
|
|
*/
|
|
textDecoration: '',
|
|
|
|
/**
|
|
* Text shadow
|
|
* @type String | null
|
|
* @default
|
|
*/
|
|
textShadow: '',
|
|
|
|
/**
|
|
* Text alignment. Possible values: "left", "center", or "right".
|
|
* @type String
|
|
* @default
|
|
*/
|
|
textAlign: 'left',
|
|
|
|
/**
|
|
* Font style (e.g. italic)
|
|
* @type String
|
|
* @default
|
|
*/
|
|
fontStyle: '',
|
|
|
|
/**
|
|
* Line height
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
lineHeight: 1.3,
|
|
|
|
/**
|
|
* Stroke style. When specified, text is rendered with stroke
|
|
* @type String
|
|
* @default
|
|
*/
|
|
stroke: '',
|
|
|
|
/**
|
|
* Stroke width
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
strokeWidth: 1,
|
|
|
|
/**
|
|
* Background color of an entire text box
|
|
* @type String
|
|
* @default
|
|
*/
|
|
backgroundColor: '',
|
|
|
|
/**
|
|
* Background color of text lines
|
|
* @type String
|
|
* @default
|
|
*/
|
|
textBackgroundColor: '',
|
|
|
|
/**
|
|
* URL of a font file, when using Cufon
|
|
* @type String | null
|
|
* @default
|
|
*/
|
|
path: null,
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'text',
|
|
|
|
/**
|
|
* Indicates whether canvas native text methods should be used to render text (otherwise, Cufon is used)
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
useNative: true,
|
|
|
|
/**
|
|
* List of properties to consider when checking if state of an object is changed ({@link fabric.Object#hasStateChanged})
|
|
* as well as for history (undo/redo) purposes
|
|
* @type Array
|
|
*/
|
|
stateProperties: stateProperties,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {String} text
|
|
* @param {Object} [options]
|
|
* @return {fabric.Text} thisArg
|
|
*/
|
|
initialize: function(text, options) {
|
|
options = options || { };
|
|
|
|
this.text = text;
|
|
this.__skipDimension = true;
|
|
this.setOptions(options);
|
|
this.__skipDimension = false;
|
|
this._initDimensions();
|
|
this.setCoords();
|
|
},
|
|
|
|
/**
|
|
* Renders text object on offscreen canvas, so that it would get dimensions
|
|
* @private
|
|
*/
|
|
_initDimensions: function() {
|
|
if (this.__skipDimension) return;
|
|
var canvasEl = fabric.util.createCanvasElement();
|
|
this._render(canvasEl.getContext('2d'));
|
|
},
|
|
|
|
/**
|
|
* Returns string representation of an instance
|
|
* @return {String} String representation of text object
|
|
*/
|
|
toString: function() {
|
|
return '#<fabric.Text (' + this.complexity() +
|
|
'): { "text": "' + this.text + '", "fontFamily": "' + this.fontFamily + '" }>';
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_render: function(ctx) {
|
|
|
|
var isInPathGroup = this.group && this.group.type !== 'group';
|
|
if (isInPathGroup && !this.transformMatrix) {
|
|
ctx.translate(-this.group.width/2 + this.left, -this.group.height / 2 + this.top);
|
|
}
|
|
else if (isInPathGroup && this.transformMatrix) {
|
|
ctx.translate(-this.group.width/2, -this.group.height/2);
|
|
}
|
|
|
|
if (typeof Cufon === 'undefined' || this.useNative === true) {
|
|
this._renderViaNative(ctx);
|
|
}
|
|
else {
|
|
this._renderViaCufon(ctx);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_renderViaCufon: function(ctx) {
|
|
var o = Cufon.textOptions || (Cufon.textOptions = { });
|
|
|
|
// export options to be used by cufon.js
|
|
o.left = this.left;
|
|
o.top = this.top;
|
|
o.context = ctx;
|
|
o.color = this.fill;
|
|
|
|
var el = this._initDummyElementForCufon();
|
|
|
|
// set "cursor" to top/left corner
|
|
this.transform(ctx);
|
|
|
|
// draw text
|
|
Cufon.replaceElement(el, {
|
|
engine: 'canvas',
|
|
separate: 'none',
|
|
fontFamily: this.fontFamily,
|
|
fontWeight: this.fontWeight,
|
|
textDecoration: this.textDecoration,
|
|
textShadow: this.textShadow,
|
|
textAlign: this.textAlign,
|
|
fontStyle: this.fontStyle,
|
|
lineHeight: this.lineHeight,
|
|
stroke: this.stroke,
|
|
strokeWidth: this.strokeWidth,
|
|
backgroundColor: this.backgroundColor,
|
|
textBackgroundColor: this.textBackgroundColor
|
|
});
|
|
|
|
// update width, height
|
|
this.width = o.width;
|
|
this.height = o.height;
|
|
|
|
this._totalLineHeight = o.totalLineHeight;
|
|
this._fontAscent = o.fontAscent;
|
|
this._boundaries = o.boundaries;
|
|
this._shadowOffsets = o.shadowOffsets;
|
|
this._shadows = o.shadows || [ ];
|
|
|
|
el = null;
|
|
|
|
// need to set coords _after_ the width/height was retreived from Cufon
|
|
this.setCoords();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderViaNative: function(ctx) {
|
|
|
|
this.transform(ctx, fabric.isLikelyNode);
|
|
|
|
this._setTextStyles(ctx);
|
|
|
|
var textLines = this.text.split(/\r?\n/);
|
|
|
|
this.width = this._getTextWidth(ctx, textLines);
|
|
this.height = this._getTextHeight(ctx, textLines);
|
|
|
|
this._renderTextBackground(ctx, textLines);
|
|
|
|
if (this.textAlign !== 'left' && this.textAlign !== 'justify') {
|
|
ctx.save();
|
|
ctx.translate(this.textAlign === 'center' ? (this.width / 2) : this.width, 0);
|
|
}
|
|
|
|
ctx.save();
|
|
this._setTextShadow(ctx);
|
|
this.clipTo && fabric.util.clipContext(this, ctx);
|
|
this._renderTextFill(ctx, textLines);
|
|
this._renderTextStroke(ctx, textLines);
|
|
this.clipTo && ctx.restore();
|
|
this.textShadow && ctx.restore();
|
|
ctx.restore();
|
|
|
|
if (this.textAlign !== 'left' && this.textAlign !== 'justify') {
|
|
ctx.restore();
|
|
}
|
|
|
|
this._renderTextDecoration(ctx, textLines);
|
|
this._setBoundaries(ctx, textLines);
|
|
this._totalLineHeight = 0;
|
|
|
|
this.setCoords();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_setBoundaries: function(ctx, textLines) {
|
|
this._boundaries = [ ];
|
|
|
|
for (var i = 0, len = textLines.length; i < len; i++) {
|
|
|
|
var lineWidth = this._getLineWidth(ctx, textLines[i]);
|
|
var lineLeftOffset = this._getLineLeftOffset(lineWidth);
|
|
|
|
this._boundaries.push({
|
|
height: this.fontSize * this.lineHeight,
|
|
width: lineWidth,
|
|
left: lineLeftOffset
|
|
});
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_setTextStyles: function(ctx) {
|
|
if (this.fill) {
|
|
ctx.fillStyle = this.fill.toLive
|
|
? this.fill.toLive(ctx)
|
|
: this.fill;
|
|
}
|
|
if (this.stroke) {
|
|
ctx.lineWidth = this.strokeWidth;
|
|
ctx.lineCap = this.strokeLineCap;
|
|
ctx.lineJoin = this.strokeLineJoin;
|
|
ctx.miterLimit = this.strokeMiterLimit;
|
|
ctx.strokeStyle = this.stroke.toLive
|
|
? this.stroke.toLive(ctx)
|
|
: this.stroke;
|
|
}
|
|
ctx.textBaseline = 'alphabetic';
|
|
ctx.textAlign = this.textAlign;
|
|
ctx.font = this._getFontDeclaration();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_getTextHeight: function(ctx, textLines) {
|
|
return this.fontSize * textLines.length * this.lineHeight;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_getTextWidth: function(ctx, textLines) {
|
|
var maxWidth = ctx.measureText(textLines[0]).width;
|
|
|
|
for (var i = 1, len = textLines.length; i < len; i++) {
|
|
var currentLineWidth = ctx.measureText(textLines[i]).width;
|
|
if (currentLineWidth > maxWidth) {
|
|
maxWidth = currentLineWidth;
|
|
}
|
|
}
|
|
return maxWidth;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_setTextShadow: function(ctx) {
|
|
if (this.textShadow) {
|
|
|
|
// "rgba(0,0,0,0.2) 2px 2px 10px"
|
|
// "rgb(0, 100, 0) 0 0 5px"
|
|
// "red 2px 2px 1px"
|
|
// "#f55 123 345 567"
|
|
var reOffsetsAndBlur = /\s+(-?\d+)(?:px)?\s+(-?\d+)(?:px)?\s+(\d+)(?:px)?\s*/;
|
|
|
|
var shadowDeclaration = this.textShadow;
|
|
var offsetsAndBlur = reOffsetsAndBlur.exec(this.textShadow);
|
|
var shadowColor = shadowDeclaration.replace(reOffsetsAndBlur, '');
|
|
|
|
ctx.save();
|
|
ctx.shadowColor = shadowColor;
|
|
ctx.shadowOffsetX = parseInt(offsetsAndBlur[1], 10);
|
|
ctx.shadowOffsetY = parseInt(offsetsAndBlur[2], 10);
|
|
ctx.shadowBlur = parseInt(offsetsAndBlur[3], 10);
|
|
|
|
this._shadows = [{
|
|
blur: ctx.shadowBlur,
|
|
color: ctx.shadowColor,
|
|
offX: ctx.shadowOffsetX,
|
|
offY: ctx.shadowOffsetY
|
|
}];
|
|
|
|
this._shadowOffsets = [[
|
|
parseInt(ctx.shadowOffsetX, 10), parseInt(ctx.shadowOffsetY, 10)
|
|
]];
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param method
|
|
* @param ctx
|
|
* @param line
|
|
* @param left
|
|
* param top
|
|
*/
|
|
_drawTextLine: function(method, ctx, line, left, top) {
|
|
|
|
// short-circuit
|
|
if (this.textAlign !== 'justify') {
|
|
ctx[method](line, left, top);
|
|
return;
|
|
}
|
|
|
|
var lineWidth = ctx.measureText(line).width;
|
|
var totalWidth = this.width;
|
|
|
|
if (totalWidth > lineWidth) {
|
|
// stretch the line
|
|
|
|
var words = line.split(/\s+/);
|
|
var wordsWidth = ctx.measureText(line.replace(/\s+/g, '')).width;
|
|
var widthDiff = totalWidth - wordsWidth;
|
|
var numSpaces = words.length - 1;
|
|
var spaceWidth = widthDiff / numSpaces;
|
|
|
|
var leftOffset = 0;
|
|
for (var i = 0, len = words.length; i < len; i++) {
|
|
ctx[method](words[i], left + leftOffset, top);
|
|
leftOffset += ctx.measureText(words[i]).width + spaceWidth;
|
|
}
|
|
}
|
|
else {
|
|
ctx[method](line, left, top);
|
|
}
|
|
},
|
|
|
|
_getLeftOffset: function() {
|
|
if (fabric.isLikelyNode && (this.originX === 'left' || this.originX === 'center')) {
|
|
return 0;
|
|
}
|
|
return -this.width / 2;
|
|
},
|
|
|
|
_getTopOffset: function() {
|
|
if (fabric.isLikelyNode && (this.originY === 'top' || this.originY === 'center')) {
|
|
return 0;
|
|
}
|
|
return -this.height / 2;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_renderTextFill: function(ctx, textLines) {
|
|
if (this.fill) {
|
|
this._boundaries = [ ];
|
|
for (var i = 0, len = textLines.length; i < len; i++) {
|
|
this._drawTextLine(
|
|
'fillText',
|
|
ctx,
|
|
textLines[i],
|
|
this._getLeftOffset(),
|
|
this._getTopOffset() + (i * this.fontSize * this.lineHeight) + this.fontSize
|
|
);
|
|
}
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_renderTextStroke: function(ctx, textLines) {
|
|
if (this.stroke) {
|
|
if (this.strokeDashArray) {
|
|
// Spec requires the concatenation of two copies the dash list when the number of elements is odd
|
|
if (1 & this.strokeDashArray.length) {
|
|
this.strokeDashArray.push.apply(this.strokeDashArray, this.strokeDashArray);
|
|
}
|
|
supportsLineDash && ctx.setLineDash(this.strokeDashArray);
|
|
}
|
|
|
|
ctx.beginPath();
|
|
for (var i = 0, len = textLines.length; i < len; i++) {
|
|
this._drawTextLine(
|
|
'strokeText',
|
|
ctx,
|
|
textLines[i],
|
|
this._getLeftOffset(),
|
|
this._getTopOffset() + (i * this.fontSize * this.lineHeight) + this.fontSize
|
|
);
|
|
}
|
|
ctx.closePath();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_renderTextBackground: function(ctx, textLines) {
|
|
this._renderTextBoxBackground(ctx);
|
|
this._renderTextLinesBackground(ctx, textLines);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_renderTextBoxBackground: function(ctx) {
|
|
if (this.backgroundColor) {
|
|
ctx.save();
|
|
ctx.fillStyle = this.backgroundColor;
|
|
|
|
ctx.fillRect(
|
|
this._getLeftOffset(),
|
|
this._getTopOffset(),
|
|
this.width,
|
|
this.height
|
|
);
|
|
|
|
ctx.restore();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_renderTextLinesBackground: function(ctx, textLines) {
|
|
if (this.textBackgroundColor) {
|
|
ctx.save();
|
|
ctx.fillStyle = this.textBackgroundColor;
|
|
|
|
for (var i = 0, len = textLines.length; i < len; i++) {
|
|
|
|
if (textLines[i] !== '') {
|
|
|
|
var lineWidth = this._getLineWidth(ctx, textLines[i]);
|
|
var lineLeftOffset = this._getLineLeftOffset(lineWidth);
|
|
|
|
ctx.fillRect(
|
|
this._getLeftOffset() + lineLeftOffset,
|
|
this._getTopOffset() + (i * this.fontSize * this.lineHeight),
|
|
lineWidth,
|
|
this.fontSize * this.lineHeight
|
|
);
|
|
}
|
|
}
|
|
ctx.restore();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_getLineLeftOffset: function(lineWidth) {
|
|
if (this.textAlign === 'center') {
|
|
return (this.width - lineWidth) / 2;
|
|
}
|
|
if (this.textAlign === 'right') {
|
|
return this.width - lineWidth;
|
|
}
|
|
return 0;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param ctx
|
|
* @param line
|
|
*/
|
|
_getLineWidth: function(ctx, line) {
|
|
return this.textAlign === 'justify'
|
|
? this.width
|
|
: ctx.measureText(line).width;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_renderTextDecoration: function(ctx, textLines) {
|
|
|
|
var halfOfVerticalBox = this.originY === 'top' ? 0 : this._getTextHeight(ctx, textLines) / 2;
|
|
var _this = this;
|
|
|
|
/** @ignore */
|
|
function renderLinesAtOffset(offset) {
|
|
for (var i = 0, len = textLines.length; i < len; i++) {
|
|
|
|
var lineWidth = _this._getLineWidth(ctx, textLines[i]);
|
|
var lineLeftOffset = _this._getLineLeftOffset(lineWidth);
|
|
|
|
ctx.fillRect(
|
|
_this._getLeftOffset() + lineLeftOffset,
|
|
(offset + (i * _this.fontSize * _this.lineHeight)) - halfOfVerticalBox,
|
|
lineWidth,
|
|
1);
|
|
}
|
|
}
|
|
|
|
if (this.textDecoration.indexOf('underline') > -1) {
|
|
renderLinesAtOffset(this.fontSize);
|
|
}
|
|
if (this.textDecoration.indexOf('line-through') > -1) {
|
|
renderLinesAtOffset(this.fontSize / 2);
|
|
}
|
|
if (this.textDecoration.indexOf('overline') > -1) {
|
|
renderLinesAtOffset(0);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_getFontDeclaration: function() {
|
|
return [
|
|
// node-canvas needs "weight style", while browsers need "style weight"
|
|
(fabric.isLikelyNode ? this.fontWeight : this.fontStyle),
|
|
(fabric.isLikelyNode ? this.fontStyle : this.fontWeight),
|
|
this.fontSize + 'px',
|
|
(fabric.isLikelyNode ? ('"' + this.fontFamily + '"') : this.fontFamily)
|
|
].join(' ');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_initDummyElementForCufon: function() {
|
|
var el = fabric.document.createElement('pre'),
|
|
container = fabric.document.createElement('div');
|
|
|
|
// Cufon doesn't play nice with textDecoration=underline if element doesn't have a parent
|
|
container.appendChild(el);
|
|
|
|
if (typeof G_vmlCanvasManager === 'undefined') {
|
|
el.innerHTML = this.text;
|
|
}
|
|
else {
|
|
// IE 7 & 8 drop newlines and white space on text nodes
|
|
// see: http://web.student.tuwien.ac.at/~e0226430/innerHtmlQuirk.html
|
|
// see: http://www.w3schools.com/dom/dom_mozilla_vs_ie.asp
|
|
el.innerText = this.text.replace(/\r?\n/gi, '\r');
|
|
}
|
|
|
|
el.style.fontSize = this.fontSize + 'px';
|
|
el.style.letterSpacing = 'normal';
|
|
|
|
return el;
|
|
},
|
|
|
|
/**
|
|
* Renders text instance on a specified context
|
|
* @param ctx {CanvasRenderingContext2D} context to render on
|
|
* @param {Boolean} [noTransform] When true, context is not transformed
|
|
*/
|
|
render: function(ctx, noTransform) {
|
|
// do not render if object is not visible
|
|
if (!this.visible) return;
|
|
|
|
ctx.save();
|
|
this._render(ctx);
|
|
if (!noTransform && this.active) {
|
|
this.drawBorders(ctx);
|
|
this.drawControls(ctx);
|
|
}
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} propertiesToInclude
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return extend(this.callSuper('toObject', propertiesToInclude), {
|
|
text: this.text,
|
|
fontSize: this.fontSize,
|
|
fontWeight: this.fontWeight,
|
|
fontFamily: this.fontFamily,
|
|
fontStyle: this.fontStyle,
|
|
lineHeight: this.lineHeight,
|
|
textDecoration: this.textDecoration,
|
|
textShadow: this.textShadow,
|
|
textAlign: this.textAlign,
|
|
path: this.path,
|
|
stroke: this.stroke,
|
|
strokeWidth: this.strokeWidth,
|
|
backgroundColor: this.backgroundColor,
|
|
textBackgroundColor: this.textBackgroundColor,
|
|
useNative: this.useNative
|
|
});
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns SVG representation of an instance
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toSVG: function() {
|
|
|
|
var textLines = this.text.split(/\r?\n/),
|
|
lineTopOffset = this.useNative
|
|
? this.fontSize * this.lineHeight
|
|
: (-this._fontAscent - ((this._fontAscent / 5) * this.lineHeight)),
|
|
|
|
textLeftOffset = -(this.width/2),
|
|
textTopOffset = this.useNative
|
|
? this.fontSize - 1
|
|
: (this.height/2) - (textLines.length * this.fontSize) - this._totalLineHeight,
|
|
|
|
textAndBg = this._getSVGTextAndBg(lineTopOffset, textLeftOffset, textLines),
|
|
shadowSpans = this._getSVGShadows(lineTopOffset, textLines);
|
|
|
|
// move top offset by an ascent
|
|
textTopOffset += (this._fontAscent ? ((this._fontAscent / 5) * this.lineHeight) : 0);
|
|
|
|
return [
|
|
'<g transform="', this.getSvgTransform(), '">',
|
|
textAndBg.textBgRects.join(''),
|
|
'<text ',
|
|
(this.fontFamily ? 'font-family="\'' + this.fontFamily + '\'" ': ''),
|
|
(this.fontSize ? 'font-size="' + this.fontSize + '" ': ''),
|
|
(this.fontStyle ? 'font-style="' + this.fontStyle + '" ': ''),
|
|
(this.fontWeight ? 'font-weight="' + this.fontWeight + '" ': ''),
|
|
(this.textDecoration ? 'text-decoration="' + this.textDecoration + '" ': ''),
|
|
'style="', this.getSvgStyles(), '" ',
|
|
/* svg starts from left/bottom corner so we normalize height */
|
|
'transform="translate(', toFixed(textLeftOffset, 2), ' ', toFixed(textTopOffset, 2), ')">',
|
|
shadowSpans.join(''),
|
|
textAndBg.textSpans.join(''),
|
|
'</text>',
|
|
'</g>'
|
|
].join('');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_getSVGShadows: function(lineTopOffset, textLines) {
|
|
var shadowSpans = [], j, i, jlen, ilen, lineTopOffsetMultiplier = 1;
|
|
|
|
if (!this._shadows || !this._boundaries) {
|
|
return shadowSpans;
|
|
}
|
|
|
|
for (j = 0, jlen = this._shadows.length; j < jlen; j++) {
|
|
for (i = 0, ilen = textLines.length; i < ilen; i++) {
|
|
if (textLines[i] !== '') {
|
|
var lineLeftOffset = (this._boundaries && this._boundaries[i]) ? this._boundaries[i].left : 0;
|
|
shadowSpans.push(
|
|
'<tspan x="',
|
|
toFixed((lineLeftOffset + lineTopOffsetMultiplier) + this._shadowOffsets[j][0], 2),
|
|
((i === 0 || this.useNative) ? '" y' : '" dy'), '="',
|
|
toFixed(this.useNative
|
|
? ((lineTopOffset * i) - this.height / 2 + this._shadowOffsets[j][1])
|
|
: (lineTopOffset + (i === 0 ? this._shadowOffsets[j][1] : 0)), 2),
|
|
'" ',
|
|
this._getFillAttributes(this._shadows[j].color), '>',
|
|
fabric.util.string.escapeXml(textLines[i]),
|
|
'</tspan>');
|
|
lineTopOffsetMultiplier = 1;
|
|
} else {
|
|
// in some environments (e.g. IE 7 & 8) empty tspans are completely ignored, using a lineTopOffsetMultiplier
|
|
// prevents empty tspans
|
|
lineTopOffsetMultiplier++;
|
|
}
|
|
}
|
|
}
|
|
return shadowSpans;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_getSVGTextAndBg: function(lineTopOffset, textLeftOffset, textLines) {
|
|
var textSpans = [ ], textBgRects = [ ], i, lineLeftOffset, len, lineTopOffsetMultiplier = 1;
|
|
|
|
// bounding-box background
|
|
if (this.backgroundColor && this._boundaries) {
|
|
textBgRects.push(
|
|
'<rect ',
|
|
this._getFillAttributes(this.backgroundColor),
|
|
' x="',
|
|
toFixed(-this.width / 2, 2),
|
|
'" y="',
|
|
toFixed(-this.height / 2, 2),
|
|
'" width="',
|
|
toFixed(this.width, 2),
|
|
'" height="',
|
|
toFixed(this.height, 2),
|
|
'"></rect>');
|
|
}
|
|
|
|
// text and text-background
|
|
for (i = 0, len = textLines.length; i < len; i++) {
|
|
if (textLines[i] !== '') {
|
|
lineLeftOffset = (this._boundaries && this._boundaries[i]) ? toFixed(this._boundaries[i].left, 2) : 0;
|
|
textSpans.push(
|
|
'<tspan x="',
|
|
lineLeftOffset, '" ',
|
|
(i === 0 || this.useNative ? 'y' : 'dy'), '="',
|
|
toFixed(this.useNative ? ((lineTopOffset * i) - this.height / 2) : (lineTopOffset * lineTopOffsetMultiplier), 2) , '" ',
|
|
// doing this on <tspan> elements since setting opacity on containing <text> one doesn't work in Illustrator
|
|
this._getFillAttributes(this.fill), '>',
|
|
fabric.util.string.escapeXml(textLines[i]),
|
|
'</tspan>'
|
|
);
|
|
lineTopOffsetMultiplier = 1;
|
|
}
|
|
else {
|
|
// in some environments (e.g. IE 7 & 8) empty tspans are completely ignored, using a lineTopOffsetMultiplier
|
|
// prevents empty tspans
|
|
lineTopOffsetMultiplier++;
|
|
}
|
|
|
|
if (!this.textBackgroundColor || !this._boundaries) continue;
|
|
|
|
textBgRects.push(
|
|
'<rect ',
|
|
this._getFillAttributes(this.textBackgroundColor),
|
|
' x="',
|
|
toFixed(textLeftOffset + this._boundaries[i].left, 2),
|
|
'" y="',
|
|
/* an offset that seems to straighten things out */
|
|
toFixed((lineTopOffset * i) - this.height / 2, 2),
|
|
'" width="',
|
|
toFixed(this._boundaries[i].width, 2),
|
|
'" height="',
|
|
toFixed(this._boundaries[i].height, 2),
|
|
'"></rect>');
|
|
}
|
|
return {
|
|
textSpans: textSpans,
|
|
textBgRects: textBgRects
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Adobe Illustrator (at least CS5) is unable to render rgba()-based fill values
|
|
* we work around it by "moving" alpha channel into opacity attribute and setting fill's alpha to 1
|
|
*
|
|
* @private
|
|
*/
|
|
_getFillAttributes: function(value) {
|
|
var fillColor = (value && typeof value === 'string') ? new fabric.Color(value) : '';
|
|
if (!fillColor || !fillColor.getSource() || fillColor.getAlpha() === 1) {
|
|
return 'fill="' + value + '"';
|
|
}
|
|
return 'opacity="' + fillColor.getAlpha() + '" fill="' + fillColor.setAlpha(1).toRgb() + '"';
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* Sets "color" of an instance (alias of `set('fill', …)`)
|
|
* @param {String} value
|
|
* @return {fabric.Text} thisArg
|
|
* @chainable
|
|
*/
|
|
setColor: function(value) {
|
|
this.set('fill', value);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns actual text value of an instance
|
|
* @return {String}
|
|
*/
|
|
getText: function() {
|
|
return this.text;
|
|
},
|
|
|
|
/**
|
|
* Sets specified property to a specified value
|
|
* @param {String} name
|
|
* @param {Any} value
|
|
* @return {fabric.Text} thisArg
|
|
* @chainable
|
|
*/
|
|
_set: function(name, value) {
|
|
if (name === 'fontFamily' && this.path) {
|
|
this.path = this.path.replace(/(.*?)([^\/]*)(\.font\.js)/, '$1' + value + '$3');
|
|
}
|
|
this.callSuper('_set', name, value);
|
|
|
|
if (name in dimensionAffectingProps) {
|
|
this._initDimensions();
|
|
this.setCoords();
|
|
}
|
|
}
|
|
});
|
|
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by {@link fabric.Text.fromElement})
|
|
* @static
|
|
*/
|
|
fabric.Text.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(
|
|
'x y font-family font-style font-weight font-size text-decoration'.split(' '));
|
|
|
|
/**
|
|
* Returns fabric.Text instance from an object representation
|
|
* @static
|
|
* @param {Object} object to create an instance from
|
|
* @return {fabric.Text} an instance
|
|
*/
|
|
fabric.Text.fromObject = function(object) {
|
|
return new fabric.Text(object.text, clone(object));
|
|
};
|
|
|
|
/**
|
|
* Returns fabric.Text instance from an SVG element (<b>not yet implemented</b>)
|
|
* @static
|
|
* @param element
|
|
* @param options
|
|
* @return {fabric.Text} an instance
|
|
*/
|
|
fabric.Text.fromElement = function(element, options) {
|
|
|
|
if (!element) {
|
|
return null;
|
|
}
|
|
|
|
var parsedAttributes = fabric.parseAttributes(element, fabric.Text.ATTRIBUTE_NAMES);
|
|
options = fabric.util.object.extend((options ? fabric.util.object.clone(options) : { }), parsedAttributes);
|
|
|
|
var text = new fabric.Text(element.textContent, options);
|
|
|
|
/*
|
|
Adjust positioning:
|
|
x/y attributes in SVG correspond to the bottom-left corner of text bounding box
|
|
top/left properties in Fabric correspond to center point of text bounding box
|
|
*/
|
|
|
|
text.set({
|
|
left: text.getLeft() + text.getWidth() / 2,
|
|
top: text.getTop() - text.getHeight() / 2
|
|
});
|
|
|
|
return text;
|
|
};
|
|
|
|
fabric.util.createAccessors(fabric.Text);
|
|
|
|
})(typeof exports !== 'undefined' ? exports : this);
|
|
|
|
(function() {
|
|
|
|
if (typeof document !== 'undefined' && typeof window !== 'undefined') {
|
|
return;
|
|
}
|
|
|
|
var DOMParser = new require('xmldom').DOMParser,
|
|
URL = require('url'),
|
|
HTTP = require('http'),
|
|
HTTPS = require('https'),
|
|
|
|
Canvas = require('canvas'),
|
|
Image = require('canvas').Image;
|
|
|
|
/** @private */
|
|
function request(url, encoding, callback) {
|
|
var oURL = URL.parse(url);
|
|
|
|
// detect if http or https is used
|
|
if ( !oURL.port ) {
|
|
oURL.port = ( oURL.protocol.indexOf('https:') === 0 ) ? 443 : 80;
|
|
}
|
|
|
|
// assign request handler based on protocol
|
|
var reqHandler = ( oURL.port === 443 ) ? HTTPS : HTTP;
|
|
|
|
var req = reqHandler.request({
|
|
hostname: oURL.hostname,
|
|
port: oURL.port,
|
|
path: oURL.path,
|
|
method: 'GET'
|
|
}, function(response){
|
|
var body = "";
|
|
if (encoding) {
|
|
response.setEncoding(encoding);
|
|
}
|
|
response.on('end', function () {
|
|
callback(body);
|
|
});
|
|
response.on('data', function (chunk) {
|
|
if (response.statusCode === 200) {
|
|
body += chunk;
|
|
}
|
|
});
|
|
});
|
|
|
|
req.on('error', function(err) {
|
|
if (err.errno === process.ECONNREFUSED) {
|
|
fabric.log('ECONNREFUSED: connection refused to ' + oURL.hostname + ':' + oURL.port);
|
|
}
|
|
else {
|
|
fabric.log(err.message);
|
|
}
|
|
});
|
|
|
|
req.end();
|
|
}
|
|
|
|
/** @private */
|
|
function request_fs(url, callback){
|
|
var fs = require('fs'),
|
|
stream = fs.createReadStream(url),
|
|
body = '';
|
|
stream.on('data', function(chunk){
|
|
body += chunk;
|
|
});
|
|
stream.on('end', function(){
|
|
callback(body);
|
|
});
|
|
}
|
|
|
|
fabric.util.loadImage = function(url, callback, context) {
|
|
var createImageAndCallBack = function(data){
|
|
img.src = new Buffer(data, 'binary');
|
|
// preserving original url, which seems to be lost in node-canvas
|
|
img._src = url;
|
|
callback && callback.call(context, img);
|
|
};
|
|
var img = new Image();
|
|
if (url && url.indexOf('data') === 0) {
|
|
img.src = img._src = url;
|
|
callback && callback.call(context, img);
|
|
}
|
|
else if (url && url.indexOf('http') !== 0) {
|
|
request_fs(url, createImageAndCallBack);
|
|
}
|
|
else if (url) {
|
|
request(url, 'binary', createImageAndCallBack);
|
|
}
|
|
};
|
|
|
|
fabric.loadSVGFromURL = function(url, callback) {
|
|
url = url.replace(/^\n\s*/, '').replace(/\?.*$/, '').trim();
|
|
if (url.indexOf('http') !== 0) {
|
|
request_fs(url, function(body) {
|
|
fabric.loadSVGFromString(body, callback);
|
|
});
|
|
}
|
|
else {
|
|
request(url, '', function(body) {
|
|
fabric.loadSVGFromString(body, callback);
|
|
});
|
|
}
|
|
};
|
|
|
|
fabric.loadSVGFromString = function(string, callback) {
|
|
var doc = new DOMParser().parseFromString(string);
|
|
fabric.parseSVGDocument(doc.documentElement, function(results, options) {
|
|
callback(results, options);
|
|
});
|
|
};
|
|
|
|
fabric.util.getScript = function(url, callback) {
|
|
request(url, '', function(body) {
|
|
eval(body);
|
|
callback && callback();
|
|
});
|
|
};
|
|
|
|
fabric.Image.fromObject = function(object, callback) {
|
|
fabric.util.loadImage(object.src, function(img) {
|
|
var oImg = new fabric.Image(img);
|
|
|
|
oImg._initConfig(object);
|
|
oImg._initFilters(object);
|
|
callback(oImg);
|
|
});
|
|
};
|
|
|
|
/**
|
|
* Only available when running fabric on node.js
|
|
* @param width Canvas width
|
|
* @param height Canvas height
|
|
* @return {Object} wrapped canvas instance
|
|
*/
|
|
fabric.createCanvasForNode = function(width, height) {
|
|
|
|
var canvasEl = fabric.document.createElement('canvas'),
|
|
nodeCanvas = new Canvas(width || 600, height || 600);
|
|
|
|
// jsdom doesn't create style on canvas element, so here be temp. workaround
|
|
canvasEl.style = { };
|
|
|
|
canvasEl.width = nodeCanvas.width;
|
|
canvasEl.height = nodeCanvas.height;
|
|
|
|
var FabricCanvas = fabric.Canvas || fabric.StaticCanvas;
|
|
var fabricCanvas = new FabricCanvas(canvasEl);
|
|
fabricCanvas.contextContainer = nodeCanvas.getContext('2d');
|
|
fabricCanvas.nodeCanvas = nodeCanvas;
|
|
fabricCanvas.Font = Canvas.Font;
|
|
|
|
return fabricCanvas;
|
|
};
|
|
|
|
/** @ignore */
|
|
fabric.StaticCanvas.prototype.createPNGStream = function() {
|
|
return this.nodeCanvas.createPNGStream();
|
|
};
|
|
|
|
fabric.StaticCanvas.prototype.createJPEGStream = function(opts) {
|
|
return this.nodeCanvas.createJPEGStream(opts);
|
|
};
|
|
|
|
var origSetWidth = fabric.StaticCanvas.prototype.setWidth;
|
|
fabric.StaticCanvas.prototype.setWidth = function(width) {
|
|
origSetWidth.call(this, width);
|
|
this.nodeCanvas.width = width;
|
|
return this;
|
|
};
|
|
if (fabric.Canvas) {
|
|
fabric.Canvas.prototype.setWidth = fabric.StaticCanvas.prototype.setWidth;
|
|
}
|
|
|
|
var origSetHeight = fabric.StaticCanvas.prototype.setHeight;
|
|
fabric.StaticCanvas.prototype.setHeight = function(height) {
|
|
origSetHeight.call(this, height);
|
|
this.nodeCanvas.height = height;
|
|
return this;
|
|
};
|
|
if (fabric.Canvas) {
|
|
fabric.Canvas.prototype.setHeight = fabric.StaticCanvas.prototype.setHeight;
|
|
}
|
|
|
|
})();
|
|
|